hanumanind/wp-includes/js/dist/block-editor.js

/******/ (function() { // webpackBootstrap
/******/ 	var __webpack_modules__ = ({

/***/ 6411:
/***/ (function(module, exports) {

var __WEBPACK_AMD_DEFINE_FACTORY__, __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_RESULT__;/*!
	autosize 4.0.4
	license: MIT
	http://www.jacklmoore.com/autosize
*/
(function (global, factory) {
	if (true) {
		!(__WEBPACK_AMD_DEFINE_ARRAY__ = [module, exports], __WEBPACK_AMD_DEFINE_FACTORY__ = (factory),
		__WEBPACK_AMD_DEFINE_RESULT__ = (typeof __WEBPACK_AMD_DEFINE_FACTORY__ === 'function' ?
		(__WEBPACK_AMD_DEFINE_FACTORY__.apply(exports, __WEBPACK_AMD_DEFINE_ARRAY__)) : __WEBPACK_AMD_DEFINE_FACTORY__),
		__WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__));
	} else { var mod; }
})(this, function (module, exports) {
	'use strict';

	var map = typeof Map === "function" ? new Map() : function () {
		var keys = [];
		var values = [];

		return {
			has: function has(key) {
				return keys.indexOf(key) > -1;
			},
			get: function get(key) {
				return values[keys.indexOf(key)];
			},
			set: function set(key, value) {
				if (keys.indexOf(key) === -1) {
					keys.push(key);
					values.push(value);
				}
			},
			delete: function _delete(key) {
				var index = keys.indexOf(key);
				if (index > -1) {
					keys.splice(index, 1);
					values.splice(index, 1);
				}
			}
		};
	}();

	var createEvent = function createEvent(name) {
		return new Event(name, { bubbles: true });
	};
	try {
		new Event('test');
	} catch (e) {
		// IE does not support `new Event()`
		createEvent = function createEvent(name) {
			var evt = document.createEvent('Event');
			evt.initEvent(name, true, false);
			return evt;
		};
	}

	function assign(ta) {
		if (!ta || !ta.nodeName || ta.nodeName !== 'TEXTAREA' || map.has(ta)) return;

		var heightOffset = null;
		var clientWidth = null;
		var cachedHeight = null;

		function init() {
			var style = window.getComputedStyle(ta, null);

			if (style.resize === 'vertical') {
				ta.style.resize = 'none';
			} else if (style.resize === 'both') {
				ta.style.resize = 'horizontal';
			}

			if (style.boxSizing === 'content-box') {
				heightOffset = -(parseFloat(style.paddingTop) + parseFloat(style.paddingBottom));
			} else {
				heightOffset = parseFloat(style.borderTopWidth) + parseFloat(style.borderBottomWidth);
			}
			// Fix when a textarea is not on document body and heightOffset is Not a Number
			if (isNaN(heightOffset)) {
				heightOffset = 0;
			}

			update();
		}

		function changeOverflow(value) {
			{
				// Chrome/Safari-specific fix:
				// When the textarea y-overflow is hidden, Chrome/Safari do not reflow the text to account for the space
				// made available by removing the scrollbar. The following forces the necessary text reflow.
				var width = ta.style.width;
				ta.style.width = '0px';
				// Force reflow:
				/* jshint ignore:start */
				ta.offsetWidth;
				/* jshint ignore:end */
				ta.style.width = width;
			}

			ta.style.overflowY = value;
		}

		function getParentOverflows(el) {
			var arr = [];

			while (el && el.parentNode && el.parentNode instanceof Element) {
				if (el.parentNode.scrollTop) {
					arr.push({
						node: el.parentNode,
						scrollTop: el.parentNode.scrollTop
					});
				}
				el = el.parentNode;
			}

			return arr;
		}

		function resize() {
			if (ta.scrollHeight === 0) {
				// If the scrollHeight is 0, then the element probably has display:none or is detached from the DOM.
				return;
			}

			var overflows = getParentOverflows(ta);
			var docTop = document.documentElement && document.documentElement.scrollTop; // Needed for Mobile IE (ticket #240)

			ta.style.height = '';
			ta.style.height = ta.scrollHeight + heightOffset + 'px';

			// used to check if an update is actually necessary on window.resize
			clientWidth = ta.clientWidth;

			// prevents scroll-position jumping
			overflows.forEach(function (el) {
				el.node.scrollTop = el.scrollTop;
			});

			if (docTop) {
				document.documentElement.scrollTop = docTop;
			}
		}

		function update() {
			resize();

			var styleHeight = Math.round(parseFloat(ta.style.height));
			var computed = window.getComputedStyle(ta, null);

			// Using offsetHeight as a replacement for computed.height in IE, because IE does not account use of border-box
			var actualHeight = computed.boxSizing === 'content-box' ? Math.round(parseFloat(computed.height)) : ta.offsetHeight;

			// The actual height not matching the style height (set via the resize method) indicates that 
			// the max-height has been exceeded, in which case the overflow should be allowed.
			if (actualHeight < styleHeight) {
				if (computed.overflowY === 'hidden') {
					changeOverflow('scroll');
					resize();
					actualHeight = computed.boxSizing === 'content-box' ? Math.round(parseFloat(window.getComputedStyle(ta, null).height)) : ta.offsetHeight;
				}
			} else {
				// Normally keep overflow set to hidden, to avoid flash of scrollbar as the textarea expands.
				if (computed.overflowY !== 'hidden') {
					changeOverflow('hidden');
					resize();
					actualHeight = computed.boxSizing === 'content-box' ? Math.round(parseFloat(window.getComputedStyle(ta, null).height)) : ta.offsetHeight;
				}
			}

			if (cachedHeight !== actualHeight) {
				cachedHeight = actualHeight;
				var evt = createEvent('autosize:resized');
				try {
					ta.dispatchEvent(evt);
				} catch (err) {
					// Firefox will throw an error on dispatchEvent for a detached element
					// https://bugzilla.mozilla.org/show_bug.cgi?id=889376
				}
			}
		}

		var pageResize = function pageResize() {
			if (ta.clientWidth !== clientWidth) {
				update();
			}
		};

		var destroy = function (style) {
			window.removeEventListener('resize', pageResize, false);
			ta.removeEventListener('input', update, false);
			ta.removeEventListener('keyup', update, false);
			ta.removeEventListener('autosize:destroy', destroy, false);
			ta.removeEventListener('autosize:update', update, false);

			Object.keys(style).forEach(function (key) {
				ta.style[key] = style[key];
			});

			map.delete(ta);
		}.bind(ta, {
			height: ta.style.height,
			resize: ta.style.resize,
			overflowY: ta.style.overflowY,
			overflowX: ta.style.overflowX,
			wordWrap: ta.style.wordWrap
		});

		ta.addEventListener('autosize:destroy', destroy, false);

		// IE9 does not fire onpropertychange or oninput for deletions,
		// so binding to onkeyup to catch most of those events.
		// There is no way that I know of to detect something like 'cut' in IE9.
		if ('onpropertychange' in ta && 'oninput' in ta) {
			ta.addEventListener('keyup', update, false);
		}

		window.addEventListener('resize', pageResize, false);
		ta.addEventListener('input', update, false);
		ta.addEventListener('autosize:update', update, false);
		ta.style.overflowX = 'hidden';
		ta.style.wordWrap = 'break-word';

		map.set(ta, {
			destroy: destroy,
			update: update
		});

		init();
	}

	function destroy(ta) {
		var methods = map.get(ta);
		if (methods) {
			methods.destroy();
		}
	}

	function update(ta) {
		var methods = map.get(ta);
		if (methods) {
			methods.update();
		}
	}

	var autosize = null;

	// Do nothing in Node.js environment and IE8 (or lower)
	if (typeof window === 'undefined' || typeof window.getComputedStyle !== 'function') {
		autosize = function autosize(el) {
			return el;
		};
		autosize.destroy = function (el) {
			return el;
		};
		autosize.update = function (el) {
			return el;
		};
	} else {
		autosize = function autosize(el, options) {
			if (el) {
				Array.prototype.forEach.call(el.length ? el : [el], function (x) {
					return assign(x, options);
				});
			}
			return el;
		};
		autosize.destroy = function (el) {
			if (el) {
				Array.prototype.forEach.call(el.length ? el : [el], destroy);
			}
			return el;
		};
		autosize.update = function (el) {
			if (el) {
				Array.prototype.forEach.call(el.length ? el : [el], update);
			}
			return el;
		};
	}

	exports.default = autosize;
	module.exports = exports['default'];
});

/***/ }),

/***/ 4403:
/***/ (function(module, exports) {

var __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_RESULT__;/*!
  Copyright (c) 2018 Jed Watson.
  Licensed under the MIT License (MIT), see
  http://jedwatson.github.io/classnames
*/
/* global define */

(function () {
	'use strict';

	var hasOwn = {}.hasOwnProperty;

	function classNames() {
		var classes = [];

		for (var i = 0; i < arguments.length; i++) {
			var arg = arguments[i];
			if (!arg) continue;

			var argType = typeof arg;

			if (argType === 'string' || argType === 'number') {
				classes.push(arg);
			} else if (Array.isArray(arg)) {
				if (arg.length) {
					var inner = classNames.apply(null, arg);
					if (inner) {
						classes.push(inner);
					}
				}
			} else if (argType === 'object') {
				if (arg.toString === Object.prototype.toString) {
					for (var key in arg) {
						if (hasOwn.call(arg, key) && arg[key]) {
							classes.push(key);
						}
					}
				} else {
					classes.push(arg.toString());
				}
			}
		}

		return classes.join(' ');
	}

	if ( true && module.exports) {
		classNames.default = classNames;
		module.exports = classNames;
	} else if (true) {
		// register as 'classnames', consistent with npm package name
		!(__WEBPACK_AMD_DEFINE_ARRAY__ = [], __WEBPACK_AMD_DEFINE_RESULT__ = (function () {
			return classNames;
		}).apply(exports, __WEBPACK_AMD_DEFINE_ARRAY__),
		__WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__));
	} else {}
}());


/***/ }),

/***/ 4827:
/***/ (function(module) {

// This code has been refactored for 140 bytes
// You can see the original here: https://github.com/twolfson/computedStyle/blob/04cd1da2e30fa45844f95f5cb1ac898e9b9ef050/lib/computedStyle.js
var computedStyle = function (el, prop, getComputedStyle) {
  getComputedStyle = window.getComputedStyle;

  // In one fell swoop
  return (
    // If we have getComputedStyle
    getComputedStyle ?
      // Query it
      // TODO: From CSS-Query notes, we might need (node, null) for FF
      getComputedStyle(el) :

    // Otherwise, we are in IE and use currentStyle
      el.currentStyle
  )[
    // Switch to camelCase for CSSOM
    // DEV: Grabbed from jQuery
    // https://github.com/jquery/jquery/blob/1.9-stable/src/css.js#L191-L194
    // https://github.com/jquery/jquery/blob/1.9-stable/src/core.js#L593-L597
    prop.replace(/-(\w)/gi, function (word, letter) {
      return letter.toUpperCase();
    })
  ];
};

module.exports = computedStyle;


/***/ }),

/***/ 1198:
/***/ (function(__unused_webpack_module, exports) {

"use strict";
/*istanbul ignore start*/


Object.defineProperty(exports, "__esModule", ({
  value: true
}));
exports["default"] = Diff;

/*istanbul ignore end*/
function Diff() {}

Diff.prototype = {
  /*istanbul ignore start*/

  /*istanbul ignore end*/
  diff: function diff(oldString, newString) {
    /*istanbul ignore start*/
    var
    /*istanbul ignore end*/
    options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
    var callback = options.callback;

    if (typeof options === 'function') {
      callback = options;
      options = {};
    }

    this.options = options;
    var self = this;

    function done(value) {
      if (callback) {
        setTimeout(function () {
          callback(undefined, value);
        }, 0);
        return true;
      } else {
        return value;
      }
    } // Allow subclasses to massage the input prior to running


    oldString = this.castInput(oldString);
    newString = this.castInput(newString);
    oldString = this.removeEmpty(this.tokenize(oldString));
    newString = this.removeEmpty(this.tokenize(newString));
    var newLen = newString.length,
        oldLen = oldString.length;
    var editLength = 1;
    var maxEditLength = newLen + oldLen;
    var bestPath = [{
      newPos: -1,
      components: []
    }]; // Seed editLength = 0, i.e. the content starts with the same values

    var oldPos = this.extractCommon(bestPath[0], newString, oldString, 0);

    if (bestPath[0].newPos + 1 >= newLen && oldPos + 1 >= oldLen) {
      // Identity per the equality and tokenizer
      return done([{
        value: this.join(newString),
        count: newString.length
      }]);
    } // Main worker method. checks all permutations of a given edit length for acceptance.


    function execEditLength() {
      for (var diagonalPath = -1 * editLength; diagonalPath <= editLength; diagonalPath += 2) {
        var basePath =
        /*istanbul ignore start*/
        void 0
        /*istanbul ignore end*/
        ;

        var addPath = bestPath[diagonalPath - 1],
            removePath = bestPath[diagonalPath + 1],
            _oldPos = (removePath ? removePath.newPos : 0) - diagonalPath;

        if (addPath) {
          // No one else is going to attempt to use this value, clear it
          bestPath[diagonalPath - 1] = undefined;
        }

        var canAdd = addPath && addPath.newPos + 1 < newLen,
            canRemove = removePath && 0 <= _oldPos && _oldPos < oldLen;

        if (!canAdd && !canRemove) {
          // If this path is a terminal then prune
          bestPath[diagonalPath] = undefined;
          continue;
        } // Select the diagonal that we want to branch from. We select the prior
        // path whose position in the new string is the farthest from the origin
        // and does not pass the bounds of the diff graph


        if (!canAdd || canRemove && addPath.newPos < removePath.newPos) {
          basePath = clonePath(removePath);
          self.pushComponent(basePath.components, undefined, true);
        } else {
          basePath = addPath; // No need to clone, we've pulled it from the list

          basePath.newPos++;
          self.pushComponent(basePath.components, true, undefined);
        }

        _oldPos = self.extractCommon(basePath, newString, oldString, diagonalPath); // If we have hit the end of both strings, then we are done

        if (basePath.newPos + 1 >= newLen && _oldPos + 1 >= oldLen) {
          return done(buildValues(self, basePath.components, newString, oldString, self.useLongestToken));
        } else {
          // Otherwise track this path as a potential candidate and continue.
          bestPath[diagonalPath] = basePath;
        }
      }

      editLength++;
    } // Performs the length of edit iteration. Is a bit fugly as this has to support the
    // sync and async mode which is never fun. Loops over execEditLength until a value
    // is produced.


    if (callback) {
      (function exec() {
        setTimeout(function () {
          // This should not happen, but we want to be safe.

          /* istanbul ignore next */
          if (editLength > maxEditLength) {
            return callback();
          }

          if (!execEditLength()) {
            exec();
          }
        }, 0);
      })();
    } else {
      while (editLength <= maxEditLength) {
        var ret = execEditLength();

        if (ret) {
          return ret;
        }
      }
    }
  },

  /*istanbul ignore start*/

  /*istanbul ignore end*/
  pushComponent: function pushComponent(components, added, removed) {
    var last = components[components.length - 1];

    if (last && last.added === added && last.removed === removed) {
      // We need to clone here as the component clone operation is just
      // as shallow array clone
      components[components.length - 1] = {
        count: last.count + 1,
        added: added,
        removed: removed
      };
    } else {
      components.push({
        count: 1,
        added: added,
        removed: removed
      });
    }
  },

  /*istanbul ignore start*/

  /*istanbul ignore end*/
  extractCommon: function extractCommon(basePath, newString, oldString, diagonalPath) {
    var newLen = newString.length,
        oldLen = oldString.length,
        newPos = basePath.newPos,
        oldPos = newPos - diagonalPath,
        commonCount = 0;

    while (newPos + 1 < newLen && oldPos + 1 < oldLen && this.equals(newString[newPos + 1], oldString[oldPos + 1])) {
      newPos++;
      oldPos++;
      commonCount++;
    }

    if (commonCount) {
      basePath.components.push({
        count: commonCount
      });
    }

    basePath.newPos = newPos;
    return oldPos;
  },

  /*istanbul ignore start*/

  /*istanbul ignore end*/
  equals: function equals(left, right) {
    if (this.options.comparator) {
      return this.options.comparator(left, right);
    } else {
      return left === right || this.options.ignoreCase && left.toLowerCase() === right.toLowerCase();
    }
  },

  /*istanbul ignore start*/

  /*istanbul ignore end*/
  removeEmpty: function removeEmpty(array) {
    var ret = [];

    for (var i = 0; i < array.length; i++) {
      if (array[i]) {
        ret.push(array[i]);
      }
    }

    return ret;
  },

  /*istanbul ignore start*/

  /*istanbul ignore end*/
  castInput: function castInput(value) {
    return value;
  },

  /*istanbul ignore start*/

  /*istanbul ignore end*/
  tokenize: function tokenize(value) {
    return value.split('');
  },

  /*istanbul ignore start*/

  /*istanbul ignore end*/
  join: function join(chars) {
    return chars.join('');
  }
};

function buildValues(diff, components, newString, oldString, useLongestToken) {
  var componentPos = 0,
      componentLen = components.length,
      newPos = 0,
      oldPos = 0;

  for (; componentPos < componentLen; componentPos++) {
    var component = components[componentPos];

    if (!component.removed) {
      if (!component.added && useLongestToken) {
        var value = newString.slice(newPos, newPos + component.count);
        value = value.map(function (value, i) {
          var oldValue = oldString[oldPos + i];
          return oldValue.length > value.length ? oldValue : value;
        });
        component.value = diff.join(value);
      } else {
        component.value = diff.join(newString.slice(newPos, newPos + component.count));
      }

      newPos += component.count; // Common case

      if (!component.added) {
        oldPos += component.count;
      }
    } else {
      component.value = diff.join(oldString.slice(oldPos, oldPos + component.count));
      oldPos += component.count; // Reverse add and remove so removes are output first to match common convention
      // The diffing algorithm is tied to add then remove output and this is the simplest
      // route to get the desired output with minimal overhead.

      if (componentPos && components[componentPos - 1].added) {
        var tmp = components[componentPos - 1];
        components[componentPos - 1] = components[componentPos];
        components[componentPos] = tmp;
      }
    }
  } // Special case handle for when one terminal is ignored (i.e. whitespace).
  // For this case we merge the terminal into the prior string and drop the change.
  // This is only available for string mode.


  var lastComponent = components[componentLen - 1];

  if (componentLen > 1 && typeof lastComponent.value === 'string' && (lastComponent.added || lastComponent.removed) && diff.equals('', lastComponent.value)) {
    components[componentLen - 2].value += lastComponent.value;
    components.pop();
  }

  return components;
}

function clonePath(path) {
  return {
    newPos: path.newPos,
    components: path.components.slice(0)
  };
}


/***/ }),

/***/ 1973:
/***/ (function(__unused_webpack_module, exports, __webpack_require__) {

"use strict";
var __webpack_unused_export__;
/*istanbul ignore start*/


__webpack_unused_export__ = ({
  value: true
});
exports.Kx = diffChars;
__webpack_unused_export__ = void 0;

/*istanbul ignore end*/
var
/*istanbul ignore start*/
_base = _interopRequireDefault(__webpack_require__(1198))
/*istanbul ignore end*/
;

/*istanbul ignore start*/ function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }

/*istanbul ignore end*/
var characterDiff = new
/*istanbul ignore start*/
_base
/*istanbul ignore end*/
.
/*istanbul ignore start*/
default
/*istanbul ignore end*/
();

/*istanbul ignore start*/
__webpack_unused_export__ = characterDiff;

/*istanbul ignore end*/
function diffChars(oldStr, newStr, options) {
  return characterDiff.diff(oldStr, newStr, options);
}


/***/ }),

/***/ 1345:
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {

"use strict";


var util = __webpack_require__(5022);

function scrollIntoView(elem, container, config) {
  config = config || {};
  // document 归一化到 window
  if (container.nodeType === 9) {
    container = util.getWindow(container);
  }

  var allowHorizontalScroll = config.allowHorizontalScroll;
  var onlyScrollIfNeeded = config.onlyScrollIfNeeded;
  var alignWithTop = config.alignWithTop;
  var alignWithLeft = config.alignWithLeft;
  var offsetTop = config.offsetTop || 0;
  var offsetLeft = config.offsetLeft || 0;
  var offsetBottom = config.offsetBottom || 0;
  var offsetRight = config.offsetRight || 0;

  allowHorizontalScroll = allowHorizontalScroll === undefined ? true : allowHorizontalScroll;

  var isWin = util.isWindow(container);
  var elemOffset = util.offset(elem);
  var eh = util.outerHeight(elem);
  var ew = util.outerWidth(elem);
  var containerOffset = undefined;
  var ch = undefined;
  var cw = undefined;
  var containerScroll = undefined;
  var diffTop = undefined;
  var diffBottom = undefined;
  var win = undefined;
  var winScroll = undefined;
  var ww = undefined;
  var wh = undefined;

  if (isWin) {
    win = container;
    wh = util.height(win);
    ww = util.width(win);
    winScroll = {
      left: util.scrollLeft(win),
      top: util.scrollTop(win)
    };
    // elem 相对 container 可视视窗的距离
    diffTop = {
      left: elemOffset.left - winScroll.left - offsetLeft,
      top: elemOffset.top - winScroll.top - offsetTop
    };
    diffBottom = {
      left: elemOffset.left + ew - (winScroll.left + ww) + offsetRight,
      top: elemOffset.top + eh - (winScroll.top + wh) + offsetBottom
    };
    containerScroll = winScroll;
  } else {
    containerOffset = util.offset(container);
    ch = container.clientHeight;
    cw = container.clientWidth;
    containerScroll = {
      left: container.scrollLeft,
      top: container.scrollTop
    };
    // elem 相对 container 可视视窗的距离
    // 注意边框, offset 是边框到根节点
    diffTop = {
      left: elemOffset.left - (containerOffset.left + (parseFloat(util.css(container, 'borderLeftWidth')) || 0)) - offsetLeft,
      top: elemOffset.top - (containerOffset.top + (parseFloat(util.css(container, 'borderTopWidth')) || 0)) - offsetTop
    };
    diffBottom = {
      left: elemOffset.left + ew - (containerOffset.left + cw + (parseFloat(util.css(container, 'borderRightWidth')) || 0)) + offsetRight,
      top: elemOffset.top + eh - (containerOffset.top + ch + (parseFloat(util.css(container, 'borderBottomWidth')) || 0)) + offsetBottom
    };
  }

  if (diffTop.top < 0 || diffBottom.top > 0) {
    // 强制向上
    if (alignWithTop === true) {
      util.scrollTop(container, containerScroll.top + diffTop.top);
    } else if (alignWithTop === false) {
      util.scrollTop(container, containerScroll.top + diffBottom.top);
    } else {
      // 自动调整
      if (diffTop.top < 0) {
        util.scrollTop(container, containerScroll.top + diffTop.top);
      } else {
        util.scrollTop(container, containerScroll.top + diffBottom.top);
      }
    }
  } else {
    if (!onlyScrollIfNeeded) {
      alignWithTop = alignWithTop === undefined ? true : !!alignWithTop;
      if (alignWithTop) {
        util.scrollTop(container, containerScroll.top + diffTop.top);
      } else {
        util.scrollTop(container, containerScroll.top + diffBottom.top);
      }
    }
  }

  if (allowHorizontalScroll) {
    if (diffTop.left < 0 || diffBottom.left > 0) {
      // 强制向上
      if (alignWithLeft === true) {
        util.scrollLeft(container, containerScroll.left + diffTop.left);
      } else if (alignWithLeft === false) {
        util.scrollLeft(container, containerScroll.left + diffBottom.left);
      } else {
        // 自动调整
        if (diffTop.left < 0) {
          util.scrollLeft(container, containerScroll.left + diffTop.left);
        } else {
          util.scrollLeft(container, containerScroll.left + diffBottom.left);
        }
      }
    } else {
      if (!onlyScrollIfNeeded) {
        alignWithLeft = alignWithLeft === undefined ? true : !!alignWithLeft;
        if (alignWithLeft) {
          util.scrollLeft(container, containerScroll.left + diffTop.left);
        } else {
          util.scrollLeft(container, containerScroll.left + diffBottom.left);
        }
      }
    }
  }
}

module.exports = scrollIntoView;

/***/ }),

/***/ 5425:
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {

"use strict";


module.exports = __webpack_require__(1345);

/***/ }),

/***/ 5022:
/***/ (function(module) {

"use strict";


var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; };

var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol ? "symbol" : typeof obj; };

var RE_NUM = /[\-+]?(?:\d*\.|)\d+(?:[eE][\-+]?\d+|)/.source;

function getClientPosition(elem) {
  var box = undefined;
  var x = undefined;
  var y = undefined;
  var doc = elem.ownerDocument;
  var body = doc.body;
  var docElem = doc && doc.documentElement;
  // 根据 GBS 最新数据，A-Grade Browsers 都已支持 getBoundingClientRect 方法，不用再考虑传统的实现方式
  box = elem.getBoundingClientRect();

  // 注：jQuery 还考虑减去 docElem.clientLeft/clientTop
  // 但测试发现，这样反而会导致当 html 和 body 有边距/边框样式时，获取的值不正确
  // 此外，ie6 会忽略 html 的 margin 值，幸运地是没有谁会去设置 html 的 margin

  x = box.left;
  y = box.top;

  // In IE, most of the time, 2 extra pixels are added to the top and left
  // due to the implicit 2-pixel inset border.  In IE6/7 quirks mode and
  // IE6 standards mode, this border can be overridden by setting the
  // document element's border to zero -- thus, we cannot rely on the
  // offset always being 2 pixels.

  // In quirks mode, the offset can be determined by querying the body's
  // clientLeft/clientTop, but in standards mode, it is found by querying
  // the document element's clientLeft/clientTop.  Since we already called
  // getClientBoundingRect we have already forced a reflow, so it is not
  // too expensive just to query them all.

  // ie 下应该减去窗口的边框吧，毕竟默认 absolute 都是相对窗口定位的
  // 窗口边框标准是设 documentElement ,quirks 时设置 body
  // 最好禁止在 body 和 html 上边框 ，但 ie < 9 html 默认有 2px ，减去
  // 但是非 ie 不可能设置窗口边框，body html 也不是窗口 ,ie 可以通过 html,body 设置
  // 标准 ie 下 docElem.clientTop 就是 border-top
  // ie7 html 即窗口边框改变不了。永远为 2
  // 但标准 firefox/chrome/ie9 下 docElem.clientTop 是窗口边框，即使设了 border-top 也为 0

  x -= docElem.clientLeft || body.clientLeft || 0;
  y -= docElem.clientTop || body.clientTop || 0;

  return {
    left: x,
    top: y
  };
}

function getScroll(w, top) {
  var ret = w['page' + (top ? 'Y' : 'X') + 'Offset'];
  var method = 'scroll' + (top ? 'Top' : 'Left');
  if (typeof ret !== 'number') {
    var d = w.document;
    // ie6,7,8 standard mode
    ret = d.documentElement[method];
    if (typeof ret !== 'number') {
      // quirks mode
      ret = d.body[method];
    }
  }
  return ret;
}

function getScrollLeft(w) {
  return getScroll(w);
}

function getScrollTop(w) {
  return getScroll(w, true);
}

function getOffset(el) {
  var pos = getClientPosition(el);
  var doc = el.ownerDocument;
  var w = doc.defaultView || doc.parentWindow;
  pos.left += getScrollLeft(w);
  pos.top += getScrollTop(w);
  return pos;
}
function _getComputedStyle(elem, name, computedStyle_) {
  var val = '';
  var d = elem.ownerDocument;
  var computedStyle = computedStyle_ || d.defaultView.getComputedStyle(elem, null);

  // https://github.com/kissyteam/kissy/issues/61
  if (computedStyle) {
    val = computedStyle.getPropertyValue(name) || computedStyle[name];
  }

  return val;
}

var _RE_NUM_NO_PX = new RegExp('^(' + RE_NUM + ')(?!px)[a-z%]+$', 'i');
var RE_POS = /^(top|right|bottom|left)$/;
var CURRENT_STYLE = 'currentStyle';
var RUNTIME_STYLE = 'runtimeStyle';
var LEFT = 'left';
var PX = 'px';

function _getComputedStyleIE(elem, name) {
  // currentStyle maybe null
  // http://msdn.microsoft.com/en-us/library/ms535231.aspx
  var ret = elem[CURRENT_STYLE] && elem[CURRENT_STYLE][name];

  // 当 width/height 设置为百分比时，通过 pixelLeft 方式转换的 width/height 值
  // 一开始就处理了! CUSTOM_STYLE.height,CUSTOM_STYLE.width ,cssHook 解决@2011-08-19
  // 在 ie 下不对，需要直接用 offset 方式
  // borderWidth 等值也有问题，但考虑到 borderWidth 设为百分比的概率很小，这里就不考虑了

  // From the awesome hack by Dean Edwards
  // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
  // If we're not dealing with a regular pixel number
  // but a number that has a weird ending, we need to convert it to pixels
  // exclude left right for relativity
  if (_RE_NUM_NO_PX.test(ret) && !RE_POS.test(name)) {
    // Remember the original values
    var style = elem.style;
    var left = style[LEFT];
    var rsLeft = elem[RUNTIME_STYLE][LEFT];

    // prevent flashing of content
    elem[RUNTIME_STYLE][LEFT] = elem[CURRENT_STYLE][LEFT];

    // Put in the new values to get a computed value out
    style[LEFT] = name === 'fontSize' ? '1em' : ret || 0;
    ret = style.pixelLeft + PX;

    // Revert the changed values
    style[LEFT] = left;

    elem[RUNTIME_STYLE][LEFT] = rsLeft;
  }
  return ret === '' ? 'auto' : ret;
}

var getComputedStyleX = undefined;
if (typeof window !== 'undefined') {
  getComputedStyleX = window.getComputedStyle ? _getComputedStyle : _getComputedStyleIE;
}

function each(arr, fn) {
  for (var i = 0; i < arr.length; i++) {
    fn(arr[i]);
  }
}

function isBorderBoxFn(elem) {
  return getComputedStyleX(elem, 'boxSizing') === 'border-box';
}

var BOX_MODELS = ['margin', 'border', 'padding'];
var CONTENT_INDEX = -1;
var PADDING_INDEX = 2;
var BORDER_INDEX = 1;
var MARGIN_INDEX = 0;

function swap(elem, options, callback) {
  var old = {};
  var style = elem.style;
  var name = undefined;

  // Remember the old values, and insert the new ones
  for (name in options) {
    if (options.hasOwnProperty(name)) {
      old[name] = style[name];
      style[name] = options[name];
    }
  }

  callback.call(elem);

  // Revert the old values
  for (name in options) {
    if (options.hasOwnProperty(name)) {
      style[name] = old[name];
    }
  }
}

function getPBMWidth(elem, props, which) {
  var value = 0;
  var prop = undefined;
  var j = undefined;
  var i = undefined;
  for (j = 0; j < props.length; j++) {
    prop = props[j];
    if (prop) {
      for (i = 0; i < which.length; i++) {
        var cssProp = undefined;
        if (prop === 'border') {
          cssProp = prop + which[i] + 'Width';
        } else {
          cssProp = prop + which[i];
        }
        value += parseFloat(getComputedStyleX(elem, cssProp)) || 0;
      }
    }
  }
  return value;
}

/**
 * A crude way of determining if an object is a window
 * @member util
 */
function isWindow(obj) {
  // must use == for ie8
  /* eslint eqeqeq:0 */
  return obj != null && obj == obj.window;
}

var domUtils = {};

each(['Width', 'Height'], function (name) {
  domUtils['doc' + name] = function (refWin) {
    var d = refWin.document;
    return Math.max(
    // firefox chrome documentElement.scrollHeight< body.scrollHeight
    // ie standard mode : documentElement.scrollHeight> body.scrollHeight
    d.documentElement['scroll' + name],
    // quirks : documentElement.scrollHeight 最大等于可视窗口多一点？
    d.body['scroll' + name], domUtils['viewport' + name](d));
  };

  domUtils['viewport' + name] = function (win) {
    // pc browser includes scrollbar in window.innerWidth
    var prop = 'client' + name;
    var doc = win.document;
    var body = doc.body;
    var documentElement = doc.documentElement;
    var documentElementProp = documentElement[prop];
    // 标准模式取 documentElement
    // backcompat 取 body
    return doc.compatMode === 'CSS1Compat' && documentElementProp || body && body[prop] || documentElementProp;
  };
});

/*
 得到元素的大小信息
 @param elem
 @param name
 @param {String} [extra]  'padding' : (css width) + padding
 'border' : (css width) + padding + border
 'margin' : (css width) + padding + border + margin
 */
function getWH(elem, name, extra) {
  if (isWindow(elem)) {
    return name === 'width' ? domUtils.viewportWidth(elem) : domUtils.viewportHeight(elem);
  } else if (elem.nodeType === 9) {
    return name === 'width' ? domUtils.docWidth(elem) : domUtils.docHeight(elem);
  }
  var which = name === 'width' ? ['Left', 'Right'] : ['Top', 'Bottom'];
  var borderBoxValue = name === 'width' ? elem.offsetWidth : elem.offsetHeight;
  var computedStyle = getComputedStyleX(elem);
  var isBorderBox = isBorderBoxFn(elem, computedStyle);
  var cssBoxValue = 0;
  if (borderBoxValue == null || borderBoxValue <= 0) {
    borderBoxValue = undefined;
    // Fall back to computed then un computed css if necessary
    cssBoxValue = getComputedStyleX(elem, name);
    if (cssBoxValue == null || Number(cssBoxValue) < 0) {
      cssBoxValue = elem.style[name] || 0;
    }
    // Normalize '', auto, and prepare for extra
    cssBoxValue = parseFloat(cssBoxValue) || 0;
  }
  if (extra === undefined) {
    extra = isBorderBox ? BORDER_INDEX : CONTENT_INDEX;
  }
  var borderBoxValueOrIsBorderBox = borderBoxValue !== undefined || isBorderBox;
  var val = borderBoxValue || cssBoxValue;
  if (extra === CONTENT_INDEX) {
    if (borderBoxValueOrIsBorderBox) {
      return val - getPBMWidth(elem, ['border', 'padding'], which, computedStyle);
    }
    return cssBoxValue;
  }
  if (borderBoxValueOrIsBorderBox) {
    var padding = extra === PADDING_INDEX ? -getPBMWidth(elem, ['border'], which, computedStyle) : getPBMWidth(elem, ['margin'], which, computedStyle);
    return val + (extra === BORDER_INDEX ? 0 : padding);
  }
  return cssBoxValue + getPBMWidth(elem, BOX_MODELS.slice(extra), which, computedStyle);
}

var cssShow = {
  position: 'absolute',
  visibility: 'hidden',
  display: 'block'
};

// fix #119 : https://github.com/kissyteam/kissy/issues/119
function getWHIgnoreDisplay(elem) {
  var val = undefined;
  var args = arguments;
  // in case elem is window
  // elem.offsetWidth === undefined
  if (elem.offsetWidth !== 0) {
    val = getWH.apply(undefined, args);
  } else {
    swap(elem, cssShow, function () {
      val = getWH.apply(undefined, args);
    });
  }
  return val;
}

function css(el, name, v) {
  var value = v;
  if ((typeof name === 'undefined' ? 'undefined' : _typeof(name)) === 'object') {
    for (var i in name) {
      if (name.hasOwnProperty(i)) {
        css(el, i, name[i]);
      }
    }
    return undefined;
  }
  if (typeof value !== 'undefined') {
    if (typeof value === 'number') {
      value += 'px';
    }
    el.style[name] = value;
    return undefined;
  }
  return getComputedStyleX(el, name);
}

each(['width', 'height'], function (name) {
  var first = name.charAt(0).toUpperCase() + name.slice(1);
  domUtils['outer' + first] = function (el, includeMargin) {
    return el && getWHIgnoreDisplay(el, name, includeMargin ? MARGIN_INDEX : BORDER_INDEX);
  };
  var which = name === 'width' ? ['Left', 'Right'] : ['Top', 'Bottom'];

  domUtils[name] = function (elem, val) {
    if (val !== undefined) {
      if (elem) {
        var computedStyle = getComputedStyleX(elem);
        var isBorderBox = isBorderBoxFn(elem);
        if (isBorderBox) {
          val += getPBMWidth(elem, ['padding', 'border'], which, computedStyle);
        }
        return css(elem, name, val);
      }
      return undefined;
    }
    return elem && getWHIgnoreDisplay(elem, name, CONTENT_INDEX);
  };
});

// 设置 elem 相对 elem.ownerDocument 的坐标
function setOffset(elem, offset) {
  // set position first, in-case top/left are set even on static elem
  if (css(elem, 'position') === 'static') {
    elem.style.position = 'relative';
  }

  var old = getOffset(elem);
  var ret = {};
  var current = undefined;
  var key = undefined;

  for (key in offset) {
    if (offset.hasOwnProperty(key)) {
      current = parseFloat(css(elem, key)) || 0;
      ret[key] = current + offset[key] - old[key];
    }
  }
  css(elem, ret);
}

module.exports = _extends({
  getWindow: function getWindow(node) {
    var doc = node.ownerDocument || node;
    return doc.defaultView || doc.parentWindow;
  },
  offset: function offset(el, value) {
    if (typeof value !== 'undefined') {
      setOffset(el, value);
    } else {
      return getOffset(el);
    }
  },

  isWindow: isWindow,
  each: each,
  css: css,
  clone: function clone(obj) {
    var ret = {};
    for (var i in obj) {
      if (obj.hasOwnProperty(i)) {
        ret[i] = obj[i];
      }
    }
    var overflow = obj.overflow;
    if (overflow) {
      for (var i in obj) {
        if (obj.hasOwnProperty(i)) {
          ret.overflow[i] = obj.overflow[i];
        }
      }
    }
    return ret;
  },
  scrollLeft: function scrollLeft(w, v) {
    if (isWindow(w)) {
      if (v === undefined) {
        return getScrollLeft(w);
      }
      window.scrollTo(v, getScrollTop(w));
    } else {
      if (v === undefined) {
        return w.scrollLeft;
      }
      w.scrollLeft = v;
    }
  },
  scrollTop: function scrollTop(w, v) {
    if (isWindow(w)) {
      if (v === undefined) {
        return getScrollTop(w);
      }
      window.scrollTo(getScrollLeft(w), v);
    } else {
      if (v === undefined) {
        return w.scrollTop;
      }
      w.scrollTop = v;
    }
  },

  viewportWidth: 0,
  viewportHeight: 0
}, domUtils);

/***/ }),

/***/ 8575:
/***/ (function(module) {

if (typeof Object.create === 'function') {
  // implementation from standard node.js 'util' module
  module.exports = function inherits(ctor, superCtor) {
    if (superCtor) {
      ctor.super_ = superCtor
      ctor.prototype = Object.create(superCtor.prototype, {
        constructor: {
          value: ctor,
          enumerable: false,
          writable: true,
          configurable: true
        }
      })
    }
  };
} else {
  // old school shim for old browsers
  module.exports = function inherits(ctor, superCtor) {
    if (superCtor) {
      ctor.super_ = superCtor
      var TempCtor = function () {}
      TempCtor.prototype = superCtor.prototype
      ctor.prototype = new TempCtor()
      ctor.prototype.constructor = ctor
    }
  }
}


/***/ }),

/***/ 9894:
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {

// Load in dependencies
var computedStyle = __webpack_require__(4827);

/**
 * Calculate the `line-height` of a given node
 * @param {HTMLElement} node Element to calculate line height of. Must be in the DOM.
 * @returns {Number} `line-height` of the element in pixels
 */
function lineHeight(node) {
  // Grab the line-height via style
  var lnHeightStr = computedStyle(node, 'line-height');
  var lnHeight = parseFloat(lnHeightStr, 10);

  // If the lineHeight did not contain a unit (i.e. it was numeric), convert it to ems (e.g. '2.3' === '2.3em')
  if (lnHeightStr === lnHeight + '') {
    // Save the old lineHeight style and update the em unit to the element
    var _lnHeightStyle = node.style.lineHeight;
    node.style.lineHeight = lnHeightStr + 'em';

    // Calculate the em based height
    lnHeightStr = computedStyle(node, 'line-height');
    lnHeight = parseFloat(lnHeightStr, 10);

    // Revert the lineHeight style
    if (_lnHeightStyle) {
      node.style.lineHeight = _lnHeightStyle;
    } else {
      delete node.style.lineHeight;
    }
  }

  // If the lineHeight is in `pt`, convert it to pixels (4px for 3pt)
  // DEV: `em` units are converted to `pt` in IE6
  // Conversion ratio from https://developer.mozilla.org/en-US/docs/Web/CSS/length
  if (lnHeightStr.indexOf('pt') !== -1) {
    lnHeight *= 4;
    lnHeight /= 3;
  // Otherwise, if the lineHeight is in `mm`, convert it to pixels (96px for 25.4mm)
  } else if (lnHeightStr.indexOf('mm') !== -1) {
    lnHeight *= 96;
    lnHeight /= 25.4;
  // Otherwise, if the lineHeight is in `cm`, convert it to pixels (96px for 2.54cm)
  } else if (lnHeightStr.indexOf('cm') !== -1) {
    lnHeight *= 96;
    lnHeight /= 2.54;
  // Otherwise, if the lineHeight is in `in`, convert it to pixels (96px for 1in)
  } else if (lnHeightStr.indexOf('in') !== -1) {
    lnHeight *= 96;
  // Otherwise, if the lineHeight is in `pc`, convert it to pixels (12pt for 1pc)
  } else if (lnHeightStr.indexOf('pc') !== -1) {
    lnHeight *= 16;
  }

  // Continue our computation
  lnHeight = Math.round(lnHeight);

  // If the line-height is "normal", calculate by font-size
  if (lnHeightStr === 'normal') {
    // Create a temporary node
    var nodeName = node.nodeName;
    var _node = document.createElement(nodeName);
    _node.innerHTML = '&nbsp;';

    // If we have a text area, reset it to only 1 row
    // https://github.com/twolfson/line-height/issues/4
    if (nodeName.toUpperCase() === 'TEXTAREA') {
      _node.setAttribute('rows', '1');
    }

    // Set the font-size of the element
    var fontSizeStr = computedStyle(node, 'font-size');
    _node.style.fontSize = fontSizeStr;

    // Remove default padding/border which can affect offset height
    // https://github.com/twolfson/line-height/issues/4
    // https://developer.mozilla.org/en-US/docs/Web/API/HTMLElement/offsetHeight
    _node.style.padding = '0px';
    _node.style.border = '0px';

    // Append it to the body
    var body = document.body;
    body.appendChild(_node);

    // Assume the line height of the element is the height
    var height = _node.offsetHeight;
    lnHeight = height;

    // Remove our child from the DOM
    body.removeChild(_node);
  }

  // Return the calculated height
  return lnHeight;
}

// Export lineHeight
module.exports = lineHeight;


/***/ }),

/***/ 7970:
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {

module.exports = __webpack_require__(195);


/***/ }),

/***/ 3110:
/***/ (function(module) {

"use strict";
/**
 * Copyright (c) 2015, Facebook, Inc.
 * All rights reserved.
 *
 * This source code is licensed under the BSD-style license found in the
 * LICENSE file in the root directory of this source tree. An additional grant
 * of patent rights can be found in the PATENTS file in the same directory.
 *
 * @providesModule ExecutionEnvironment
 */

/*jslint evil: true */



var canUseDOM = !!(
  typeof window !== 'undefined' &&
  window.document &&
  window.document.createElement
);

/**
 * Simple, lightweight module assisting with the detection and context of
 * Worker. Helps avoid circular dependencies and allows code to reason about
 * whether or not they are in a Worker, even if they never include the main
 * `ReactWorker` dependency.
 */
var ExecutionEnvironment = {

  canUseDOM: canUseDOM,

  canUseWorkers: typeof Worker !== 'undefined',

  canUseEventListeners:
    canUseDOM && !!(window.addEventListener || window.attachEvent),

  canUseViewport: canUseDOM && !!window.screen,

  isInWorker: !canUseDOM // For now, this is true - might change in the future.

};

module.exports = ExecutionEnvironment;


/***/ }),

/***/ 3812:
/***/ (function(module) {

/**
 * Copyright 2004-present Facebook. All Rights Reserved.
 *
 * @providesModule UserAgent_DEPRECATED
 */

/**
 *  Provides entirely client-side User Agent and OS detection. You should prefer
 *  the non-deprecated UserAgent module when possible, which exposes our
 *  authoritative server-side PHP-based detection to the client.
 *
 *  Usage is straightforward:
 *
 *    if (UserAgent_DEPRECATED.ie()) {
 *      //  IE
 *    }
 *
 *  You can also do version checks:
 *
 *    if (UserAgent_DEPRECATED.ie() >= 7) {
 *      //  IE7 or better
 *    }
 *
 *  The browser functions will return NaN if the browser does not match, so
 *  you can also do version compares the other way:
 *
 *    if (UserAgent_DEPRECATED.ie() < 7) {
 *      //  IE6 or worse
 *    }
 *
 *  Note that the version is a float and may include a minor version number,
 *  so you should always use range operators to perform comparisons, not
 *  strict equality.
 *
 *  **Note:** You should **strongly** prefer capability detection to browser
 *  version detection where it's reasonable:
 *
 *    http://www.quirksmode.org/js/support.html
 *
 *  Further, we have a large number of mature wrapper functions and classes
 *  which abstract away many browser irregularities. Check the documentation,
 *  grep for things, or ask on javascript@lists.facebook.com before writing yet
 *  another copy of "event || window.event".
 *
 */

var _populated = false;

// Browsers
var _ie, _firefox, _opera, _webkit, _chrome;

// Actual IE browser for compatibility mode
var _ie_real_version;

// Platforms
var _osx, _windows, _linux, _android;

// Architectures
var _win64;

// Devices
var _iphone, _ipad, _native;

var _mobile;

function _populate() {
  if (_populated) {
    return;
  }

  _populated = true;

  // To work around buggy JS libraries that can't handle multi-digit
  // version numbers, Opera 10's user agent string claims it's Opera
  // 9, then later includes a Version/X.Y field:
  //
  // Opera/9.80 (foo) Presto/2.2.15 Version/10.10
  var uas = navigator.userAgent;
  var agent = /(?:MSIE.(\d+\.\d+))|(?:(?:Firefox|GranParadiso|Iceweasel).(\d+\.\d+))|(?:Opera(?:.+Version.|.)(\d+\.\d+))|(?:AppleWebKit.(\d+(?:\.\d+)?))|(?:Trident\/\d+\.\d+.*rv:(\d+\.\d+))/.exec(uas);
  var os    = /(Mac OS X)|(Windows)|(Linux)/.exec(uas);

  _iphone = /\b(iPhone|iP[ao]d)/.exec(uas);
  _ipad = /\b(iP[ao]d)/.exec(uas);
  _android = /Android/i.exec(uas);
  _native = /FBAN\/\w+;/i.exec(uas);
  _mobile = /Mobile/i.exec(uas);

  // Note that the IE team blog would have you believe you should be checking
  // for 'Win64; x64'.  But MSDN then reveals that you can actually be coming
  // from either x64 or ia64;  so ultimately, you should just check for Win64
  // as in indicator of whether you're in 64-bit IE.  32-bit IE on 64-bit
  // Windows will send 'WOW64' instead.
  _win64 = !!(/Win64/.exec(uas));

  if (agent) {
    _ie = agent[1] ? parseFloat(agent[1]) : (
          agent[5] ? parseFloat(agent[5]) : NaN);
    // IE compatibility mode
    if (_ie && document && document.documentMode) {
      _ie = document.documentMode;
    }
    // grab the "true" ie version from the trident token if available
    var trident = /(?:Trident\/(\d+.\d+))/.exec(uas);
    _ie_real_version = trident ? parseFloat(trident[1]) + 4 : _ie;

    _firefox = agent[2] ? parseFloat(agent[2]) : NaN;
    _opera   = agent[3] ? parseFloat(agent[3]) : NaN;
    _webkit  = agent[4] ? parseFloat(agent[4]) : NaN;
    if (_webkit) {
      // We do not add the regexp to the above test, because it will always
      // match 'safari' only since 'AppleWebKit' appears before 'Chrome' in
      // the userAgent string.
      agent = /(?:Chrome\/(\d+\.\d+))/.exec(uas);
      _chrome = agent && agent[1] ? parseFloat(agent[1]) : NaN;
    } else {
      _chrome = NaN;
    }
  } else {
    _ie = _firefox = _opera = _chrome = _webkit = NaN;
  }

  if (os) {
    if (os[1]) {
      // Detect OS X version.  If no version number matches, set _osx to true.
      // Version examples:  10, 10_6_1, 10.7
      // Parses version number as a float, taking only first two sets of
      // digits.  If only one set of digits is found, returns just the major
      // version number.
      var ver = /(?:Mac OS X (\d+(?:[._]\d+)?))/.exec(uas);

      _osx = ver ? parseFloat(ver[1].replace('_', '.')) : true;
    } else {
      _osx = false;
    }
    _windows = !!os[2];
    _linux   = !!os[3];
  } else {
    _osx = _windows = _linux = false;
  }
}

var UserAgent_DEPRECATED = {

  /**
   *  Check if the UA is Internet Explorer.
   *
   *
   *  @return float|NaN Version number (if match) or NaN.
   */
  ie: function() {
    return _populate() || _ie;
  },

  /**
   * Check if we're in Internet Explorer compatibility mode.
   *
   * @return bool true if in compatibility mode, false if
   * not compatibility mode or not ie
   */
  ieCompatibilityMode: function() {
    return _populate() || (_ie_real_version > _ie);
  },


  /**
   * Whether the browser is 64-bit IE.  Really, this is kind of weak sauce;  we
   * only need this because Skype can't handle 64-bit IE yet.  We need to remove
   * this when we don't need it -- tracked by #601957.
   */
  ie64: function() {
    return UserAgent_DEPRECATED.ie() && _win64;
  },

  /**
   *  Check if the UA is Firefox.
   *
   *
   *  @return float|NaN Version number (if match) or NaN.
   */
  firefox: function() {
    return _populate() || _firefox;
  },


  /**
   *  Check if the UA is Opera.
   *
   *
   *  @return float|NaN Version number (if match) or NaN.
   */
  opera: function() {
    return _populate() || _opera;
  },


  /**
   *  Check if the UA is WebKit.
   *
   *
   *  @return float|NaN Version number (if match) or NaN.
   */
  webkit: function() {
    return _populate() || _webkit;
  },

  /**
   *  For Push
   *  WILL BE REMOVED VERY SOON. Use UserAgent_DEPRECATED.webkit
   */
  safari: function() {
    return UserAgent_DEPRECATED.webkit();
  },

  /**
   *  Check if the UA is a Chrome browser.
   *
   *
   *  @return float|NaN Version number (if match) or NaN.
   */
  chrome : function() {
    return _populate() || _chrome;
  },


  /**
   *  Check if the user is running Windows.
   *
   *  @return bool `true' if the user's OS is Windows.
   */
  windows: function() {
    return _populate() || _windows;
  },


  /**
   *  Check if the user is running Mac OS X.
   *
   *  @return float|bool   Returns a float if a version number is detected,
   *                       otherwise true/false.
   */
  osx: function() {
    return _populate() || _osx;
  },

  /**
   * Check if the user is running Linux.
   *
   * @return bool `true' if the user's OS is some flavor of Linux.
   */
  linux: function() {
    return _populate() || _linux;
  },

  /**
   * Check if the user is running on an iPhone or iPod platform.
   *
   * @return bool `true' if the user is running some flavor of the
   *    iPhone OS.
   */
  iphone: function() {
    return _populate() || _iphone;
  },

  mobile: function() {
    return _populate() || (_iphone || _ipad || _android || _mobile);
  },

  nativeApp: function() {
    // webviews inside of the native apps
    return _populate() || _native;
  },

  android: function() {
    return _populate() || _android;
  },

  ipad: function() {
    return _populate() || _ipad;
  }
};

module.exports = UserAgent_DEPRECATED;


/***/ }),

/***/ 7939:
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {

"use strict";
/**
 * Copyright 2013-2015, Facebook, Inc.
 * All rights reserved.
 *
 * This source code is licensed under the BSD-style license found in the
 * LICENSE file in the root directory of this source tree. An additional grant
 * of patent rights can be found in the PATENTS file in the same directory.
 *
 * @providesModule isEventSupported
 */



var ExecutionEnvironment = __webpack_require__(3110);

var useHasFeature;
if (ExecutionEnvironment.canUseDOM) {
  useHasFeature =
    document.implementation &&
    document.implementation.hasFeature &&
    // always returns true in newer browsers as per the standard.
    // @see http://dom.spec.whatwg.org/#dom-domimplementation-hasfeature
    document.implementation.hasFeature('', '') !== true;
}

/**
 * Checks if an event is supported in the current execution environment.
 *
 * NOTE: This will not work correctly for non-generic events such as `change`,
 * `reset`, `load`, `error`, and `select`.
 *
 * Borrows from Modernizr.
 *
 * @param {string} eventNameSuffix Event name, e.g. "click".
 * @param {?boolean} capture Check if the capture phase is supported.
 * @return {boolean} True if the event is supported.
 * @internal
 * @license Modernizr 3.0.0pre (Custom Build) | MIT
 */
function isEventSupported(eventNameSuffix, capture) {
  if (!ExecutionEnvironment.canUseDOM ||
      capture && !('addEventListener' in document)) {
    return false;
  }

  var eventName = 'on' + eventNameSuffix;
  var isSupported = eventName in document;

  if (!isSupported) {
    var element = document.createElement('div');
    element.setAttribute(eventName, 'return;');
    isSupported = typeof element[eventName] === 'function';
  }

  if (!isSupported && useHasFeature && eventNameSuffix === 'wheel') {
    // This is the only way to test support for the `wheel` event in IE9+.
    isSupported = document.implementation.hasFeature('Events.wheel', '3.0');
  }

  return isSupported;
}

module.exports = isEventSupported;


/***/ }),

/***/ 195:
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {

"use strict";
/**
 * Copyright (c) 2015, Facebook, Inc.
 * All rights reserved.
 *
 * This source code is licensed under the BSD-style license found in the
 * LICENSE file in the root directory of this source tree. An additional grant
 * of patent rights can be found in the PATENTS file in the same directory.
 *
 * @providesModule normalizeWheel
 * @typechecks
 */



var UserAgent_DEPRECATED = __webpack_require__(3812);

var isEventSupported = __webpack_require__(7939);


// Reasonable defaults
var PIXEL_STEP  = 10;
var LINE_HEIGHT = 40;
var PAGE_HEIGHT = 800;

/**
 * Mouse wheel (and 2-finger trackpad) support on the web sucks.  It is
 * complicated, thus this doc is long and (hopefully) detailed enough to answer
 * your questions.
 *
 * If you need to react to the mouse wheel in a predictable way, this code is
 * like your bestest friend. * hugs *
 *
 * As of today, there are 4 DOM event types you can listen to:
 *
 *   'wheel'                -- Chrome(31+), FF(17+), IE(9+)
 *   'mousewheel'           -- Chrome, IE(6+), Opera, Safari
 *   'MozMousePixelScroll'  -- FF(3.5 only!) (2010-2013) -- don't bother!
 *   'DOMMouseScroll'       -- FF(0.9.7+) since 2003
 *
 * So what to do?  The is the best:
 *
 *   normalizeWheel.getEventType();
 *
 * In your event callback, use this code to get sane interpretation of the
 * deltas.  This code will return an object with properties:
 *
 *   spinX   -- normalized spin speed (use for zoom) - x plane
 *   spinY   -- " - y plane
 *   pixelX  -- normalized distance (to pixels) - x plane
 *   pixelY  -- " - y plane
 *
 * Wheel values are provided by the browser assuming you are using the wheel to
 * scroll a web page by a number of lines or pixels (or pages).  Values can vary
 * significantly on different platforms and browsers, forgetting that you can
 * scroll at different speeds.  Some devices (like trackpads) emit more events
 * at smaller increments with fine granularity, and some emit massive jumps with
 * linear speed or acceleration.
 *
 * This code does its best to normalize the deltas for you:
 *
 *   - spin is trying to normalize how far the wheel was spun (or trackpad
 *     dragged).  This is super useful for zoom support where you want to
 *     throw away the chunky scroll steps on the PC and make those equal to
 *     the slow and smooth tiny steps on the Mac. Key data: This code tries to
 *     resolve a single slow step on a wheel to 1.
 *
 *   - pixel is normalizing the desired scroll delta in pixel units.  You'll
 *     get the crazy differences between browsers, but at least it'll be in
 *     pixels!
 *
 *   - positive value indicates scrolling DOWN/RIGHT, negative UP/LEFT.  This
 *     should translate to positive value zooming IN, negative zooming OUT.
 *     This matches the newer 'wheel' event.
 *
 * Why are there spinX, spinY (or pixels)?
 *
 *   - spinX is a 2-finger side drag on the trackpad, and a shift + wheel turn
 *     with a mouse.  It results in side-scrolling in the browser by default.
 *
 *   - spinY is what you expect -- it's the classic axis of a mouse wheel.
 *
 *   - I dropped spinZ/pixelZ.  It is supported by the DOM 3 'wheel' event and
 *     probably is by browsers in conjunction with fancy 3D controllers .. but
 *     you know.
 *
 * Implementation info:
 *
 * Examples of 'wheel' event if you scroll slowly (down) by one step with an
 * average mouse:
 *
 *   OS X + Chrome  (mouse)     -    4   pixel delta  (wheelDelta -120)
 *   OS X + Safari  (mouse)     -  N/A   pixel delta  (wheelDelta  -12)
 *   OS X + Firefox (mouse)     -    0.1 line  delta  (wheelDelta  N/A)
 *   Win8 + Chrome  (mouse)     -  100   pixel delta  (wheelDelta -120)
 *   Win8 + Firefox (mouse)     -    3   line  delta  (wheelDelta -120)
 *
 * On the trackpad:
 *
 *   OS X + Chrome  (trackpad)  -    2   pixel delta  (wheelDelta   -6)
 *   OS X + Firefox (trackpad)  -    1   pixel delta  (wheelDelta  N/A)
 *
 * On other/older browsers.. it's more complicated as there can be multiple and
 * also missing delta values.
 *
 * The 'wheel' event is more standard:
 *
 * http://www.w3.org/TR/DOM-Level-3-Events/#events-wheelevents
 *
 * The basics is that it includes a unit, deltaMode (pixels, lines, pages), and
 * deltaX, deltaY and deltaZ.  Some browsers provide other values to maintain
 * backward compatibility with older events.  Those other values help us
 * better normalize spin speed.  Example of what the browsers provide:
 *
 *                          | event.wheelDelta | event.detail
 *        ------------------+------------------+--------------
 *          Safari v5/OS X  |       -120       |       0
 *          Safari v5/Win7  |       -120       |       0
 *         Chrome v17/OS X  |       -120       |       0
 *         Chrome v17/Win7  |       -120       |       0
 *                IE9/Win7  |       -120       |   undefined
 *         Firefox v4/OS X  |     undefined    |       1
 *         Firefox v4/Win7  |     undefined    |       3
 *
 */
function normalizeWheel(/*object*/ event) /*object*/ {
  var sX = 0, sY = 0,       // spinX, spinY
      pX = 0, pY = 0;       // pixelX, pixelY

  // Legacy
  if ('detail'      in event) { sY = event.detail; }
  if ('wheelDelta'  in event) { sY = -event.wheelDelta / 120; }
  if ('wheelDeltaY' in event) { sY = -event.wheelDeltaY / 120; }
  if ('wheelDeltaX' in event) { sX = -event.wheelDeltaX / 120; }

  // side scrolling on FF with DOMMouseScroll
  if ( 'axis' in event && event.axis === event.HORIZONTAL_AXIS ) {
    sX = sY;
    sY = 0;
  }

  pX = sX * PIXEL_STEP;
  pY = sY * PIXEL_STEP;

  if ('deltaY' in event) { pY = event.deltaY; }
  if ('deltaX' in event) { pX = event.deltaX; }

  if ((pX || pY) && event.deltaMode) {
    if (event.deltaMode == 1) {          // delta in LINE units
      pX *= LINE_HEIGHT;
      pY *= LINE_HEIGHT;
    } else {                             // delta in PAGE units
      pX *= PAGE_HEIGHT;
      pY *= PAGE_HEIGHT;
    }
  }

  // Fall-back if spin cannot be determined
  if (pX && !sX) { sX = (pX < 1) ? -1 : 1; }
  if (pY && !sY) { sY = (pY < 1) ? -1 : 1; }

  return { spinX  : sX,
           spinY  : sY,
           pixelX : pX,
           pixelY : pY };
}


/**
 * The best combination if you prefer spinX + spinY normalization.  It favors
 * the older DOMMouseScroll for Firefox, as FF does not include wheelDelta with
 * 'wheel' event, making spin speed determination impossible.
 */
normalizeWheel.getEventType = function() /*string*/ {
  return (UserAgent_DEPRECATED.firefox())
           ? 'DOMMouseScroll'
           : (isEventSupported('wheel'))
               ? 'wheel'
               : 'mousewheel';
};

module.exports = normalizeWheel;


/***/ }),

/***/ 5372:
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {

"use strict";
/**
 * Copyright (c) 2013-present, Facebook, Inc.
 *
 * This source code is licensed under the MIT license found in the
 * LICENSE file in the root directory of this source tree.
 */



var ReactPropTypesSecret = __webpack_require__(9567);

function emptyFunction() {}
function emptyFunctionWithReset() {}
emptyFunctionWithReset.resetWarningCache = emptyFunction;

module.exports = function() {
  function shim(props, propName, componentName, location, propFullName, secret) {
    if (secret === ReactPropTypesSecret) {
      // It is still safe when called from React.
      return;
    }
    var err = new Error(
      'Calling PropTypes validators directly is not supported by the `prop-types` package. ' +
      'Use PropTypes.checkPropTypes() to call them. ' +
      'Read more at http://fb.me/use-check-prop-types'
    );
    err.name = 'Invariant Violation';
    throw err;
  };
  shim.isRequired = shim;
  function getShim() {
    return shim;
  };
  // Important!
  // Keep this list in sync with production version in `./factoryWithTypeCheckers.js`.
  var ReactPropTypes = {
    array: shim,
    bigint: shim,
    bool: shim,
    func: shim,
    number: shim,
    object: shim,
    string: shim,
    symbol: shim,

    any: shim,
    arrayOf: getShim,
    element: shim,
    elementType: shim,
    instanceOf: getShim,
    node: shim,
    objectOf: getShim,
    oneOf: getShim,
    oneOfType: getShim,
    shape: getShim,
    exact: getShim,

    checkPropTypes: emptyFunctionWithReset,
    resetWarningCache: emptyFunction
  };

  ReactPropTypes.PropTypes = ReactPropTypes;

  return ReactPropTypes;
};


/***/ }),

/***/ 2652:
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {

/**
 * Copyright (c) 2013-present, Facebook, Inc.
 *
 * This source code is licensed under the MIT license found in the
 * LICENSE file in the root directory of this source tree.
 */

if (false) { var throwOnDirectAccess, ReactIs; } else {
  // By explicitly using `prop-types` you are opting into new production behavior.
  // http://fb.me/prop-types-in-prod
  module.exports = __webpack_require__(5372)();
}


/***/ }),

/***/ 9567:
/***/ (function(module) {

"use strict";
/**
 * Copyright (c) 2013-present, Facebook, Inc.
 *
 * This source code is licensed under the MIT license found in the
 * LICENSE file in the root directory of this source tree.
 */



var ReactPropTypesSecret = 'SECRET_DO_NOT_PASS_THIS_OR_YOU_WILL_BE_FIRED';

module.exports = ReactPropTypesSecret;


/***/ }),

/***/ 5438:
/***/ (function(__unused_webpack_module, exports, __webpack_require__) {

"use strict";

var __extends = (this && this.__extends) || (function () {
    var extendStatics = Object.setPrototypeOf ||
        ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||
        function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };
    return function (d, b) {
        extendStatics(d, b);
        function __() { this.constructor = d; }
        d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());
    };
})();
var __assign = (this && this.__assign) || Object.assign || function(t) {
    for (var s, i = 1, n = arguments.length; i < n; i++) {
        s = arguments[i];
        for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p))
            t[p] = s[p];
    }
    return t;
};
var __rest = (this && this.__rest) || function (s, e) {
    var t = {};
    for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)
        t[p] = s[p];
    if (s != null && typeof Object.getOwnPropertySymbols === "function")
        for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) if (e.indexOf(p[i]) < 0)
            t[p[i]] = s[p[i]];
    return t;
};
exports.__esModule = true;
var React = __webpack_require__(9196);
var PropTypes = __webpack_require__(2652);
var autosize = __webpack_require__(6411);
var _getLineHeight = __webpack_require__(9894);
var getLineHeight = _getLineHeight;
var RESIZED = "autosize:resized";
/**
 * A light replacement for built-in textarea component
 * which automaticaly adjusts its height to match the content
 */
var TextareaAutosizeClass = /** @class */ (function (_super) {
    __extends(TextareaAutosizeClass, _super);
    function TextareaAutosizeClass() {
        var _this = _super !== null && _super.apply(this, arguments) || this;
        _this.state = {
            lineHeight: null
        };
        _this.textarea = null;
        _this.onResize = function (e) {
            if (_this.props.onResize) {
                _this.props.onResize(e);
            }
        };
        _this.updateLineHeight = function () {
            if (_this.textarea) {
                _this.setState({
                    lineHeight: getLineHeight(_this.textarea)
                });
            }
        };
        _this.onChange = function (e) {
            var onChange = _this.props.onChange;
            _this.currentValue = e.currentTarget.value;
            onChange && onChange(e);
        };
        return _this;
    }
    TextareaAutosizeClass.prototype.componentDidMount = function () {
        var _this = this;
        var _a = this.props, maxRows = _a.maxRows, async = _a.async;
        if (typeof maxRows === "number") {
            this.updateLineHeight();
        }
        if (typeof maxRows === "number" || async) {
            /*
              the defer is needed to:
                - force "autosize" to activate the scrollbar when this.props.maxRows is passed
                - support StyledComponents (see #71)
            */
            setTimeout(function () { return _this.textarea && autosize(_this.textarea); });
        }
        else {
            this.textarea && autosize(this.textarea);
        }
        if (this.textarea) {
            this.textarea.addEventListener(RESIZED, this.onResize);
        }
    };
    TextareaAutosizeClass.prototype.componentWillUnmount = function () {
        if (this.textarea) {
            this.textarea.removeEventListener(RESIZED, this.onResize);
            autosize.destroy(this.textarea);
        }
    };
    TextareaAutosizeClass.prototype.render = function () {
        var _this = this;
        var _a = this, _b = _a.props, onResize = _b.onResize, maxRows = _b.maxRows, onChange = _b.onChange, style = _b.style, innerRef = _b.innerRef, children = _b.children, props = __rest(_b, ["onResize", "maxRows", "onChange", "style", "innerRef", "children"]), lineHeight = _a.state.lineHeight;
        var maxHeight = maxRows && lineHeight ? lineHeight * maxRows : null;
        return (React.createElement("textarea", __assign({}, props, { onChange: this.onChange, style: maxHeight ? __assign({}, style, { maxHeight: maxHeight }) : style, ref: function (element) {
                _this.textarea = element;
                if (typeof _this.props.innerRef === 'function') {
                    _this.props.innerRef(element);
                }
                else if (_this.props.innerRef) {
                    _this.props.innerRef.current = element;
                }
            } }), children));
    };
    TextareaAutosizeClass.prototype.componentDidUpdate = function () {
        this.textarea && autosize.update(this.textarea);
    };
    TextareaAutosizeClass.defaultProps = {
        rows: 1,
        async: false
    };
    TextareaAutosizeClass.propTypes = {
        rows: PropTypes.number,
        maxRows: PropTypes.number,
        onResize: PropTypes.func,
        innerRef: PropTypes.any,
        async: PropTypes.bool
    };
    return TextareaAutosizeClass;
}(React.Component));
exports.TextareaAutosize = React.forwardRef(function (props, ref) {
    return React.createElement(TextareaAutosizeClass, __assign({}, props, { innerRef: ref }));
});


/***/ }),

/***/ 773:
/***/ (function(__unused_webpack_module, exports, __webpack_require__) {

"use strict";
var __webpack_unused_export__;

__webpack_unused_export__ = true;
var TextareaAutosize_1 = __webpack_require__(5438);
exports.Z = TextareaAutosize_1.TextareaAutosize;


/***/ }),

/***/ 3124:
/***/ (function(module) {

var traverse = module.exports = function (obj) {
    return new Traverse(obj);
};

function Traverse (obj) {
    this.value = obj;
}

Traverse.prototype.get = function (ps) {
    var node = this.value;
    for (var i = 0; i < ps.length; i ++) {
        var key = ps[i];
        if (!node || !hasOwnProperty.call(node, key)) {
            node = undefined;
            break;
        }
        node = node[key];
    }
    return node;
};

Traverse.prototype.has = function (ps) {
    var node = this.value;
    for (var i = 0; i < ps.length; i ++) {
        var key = ps[i];
        if (!node || !hasOwnProperty.call(node, key)) {
            return false;
        }
        node = node[key];
    }
    return true;
};

Traverse.prototype.set = function (ps, value) {
    var node = this.value;
    for (var i = 0; i < ps.length - 1; i ++) {
        var key = ps[i];
        if (!hasOwnProperty.call(node, key)) node[key] = {};
        node = node[key];
    }
    node[ps[i]] = value;
    return value;
};

Traverse.prototype.map = function (cb) {
    return walk(this.value, cb, true);
};

Traverse.prototype.forEach = function (cb) {
    this.value = walk(this.value, cb, false);
    return this.value;
};

Traverse.prototype.reduce = function (cb, init) {
    var skip = arguments.length === 1;
    var acc = skip ? this.value : init;
    this.forEach(function (x) {
        if (!this.isRoot || !skip) {
            acc = cb.call(this, acc, x);
        }
    });
    return acc;
};

Traverse.prototype.paths = function () {
    var acc = [];
    this.forEach(function (x) {
        acc.push(this.path); 
    });
    return acc;
};

Traverse.prototype.nodes = function () {
    var acc = [];
    this.forEach(function (x) {
        acc.push(this.node);
    });
    return acc;
};

Traverse.prototype.clone = function () {
    var parents = [], nodes = [];
    
    return (function clone (src) {
        for (var i = 0; i < parents.length; i++) {
            if (parents[i] === src) {
                return nodes[i];
            }
        }
        
        if (typeof src === 'object' && src !== null) {
            var dst = copy(src);
            
            parents.push(src);
            nodes.push(dst);
            
            forEach(objectKeys(src), function (key) {
                dst[key] = clone(src[key]);
            });
            
            parents.pop();
            nodes.pop();
            return dst;
        }
        else {
            return src;
        }
    })(this.value);
};

function walk (root, cb, immutable) {
    var path = [];
    var parents = [];
    var alive = true;
    
    return (function walker (node_) {
        var node = immutable ? copy(node_) : node_;
        var modifiers = {};
        
        var keepGoing = true;
        
        var state = {
            node : node,
            node_ : node_,
            path : [].concat(path),
            parent : parents[parents.length - 1],
            parents : parents,
            key : path.slice(-1)[0],
            isRoot : path.length === 0,
            level : path.length,
            circular : null,
            update : function (x, stopHere) {
                if (!state.isRoot) {
                    state.parent.node[state.key] = x;
                }
                state.node = x;
                if (stopHere) keepGoing = false;
            },
            'delete' : function (stopHere) {
                delete state.parent.node[state.key];
                if (stopHere) keepGoing = false;
            },
            remove : function (stopHere) {
                if (isArray(state.parent.node)) {
                    state.parent.node.splice(state.key, 1);
                }
                else {
                    delete state.parent.node[state.key];
                }
                if (stopHere) keepGoing = false;
            },
            keys : null,
            before : function (f) { modifiers.before = f },
            after : function (f) { modifiers.after = f },
            pre : function (f) { modifiers.pre = f },
            post : function (f) { modifiers.post = f },
            stop : function () { alive = false },
            block : function () { keepGoing = false }
        };
        
        if (!alive) return state;
        
        function updateState() {
            if (typeof state.node === 'object' && state.node !== null) {
                if (!state.keys || state.node_ !== state.node) {
                    state.keys = objectKeys(state.node)
                }
                
                state.isLeaf = state.keys.length == 0;
                
                for (var i = 0; i < parents.length; i++) {
                    if (parents[i].node_ === node_) {
                        state.circular = parents[i];
                        break;
                    }
                }
            }
            else {
                state.isLeaf = true;
                state.keys = null;
            }
            
            state.notLeaf = !state.isLeaf;
            state.notRoot = !state.isRoot;
        }
        
        updateState();
        
        // use return values to update if defined
        var ret = cb.call(state, state.node);
        if (ret !== undefined && state.update) state.update(ret);
        
        if (modifiers.before) modifiers.before.call(state, state.node);
        
        if (!keepGoing) return state;
        
        if (typeof state.node == 'object'
        && state.node !== null && !state.circular) {
            parents.push(state);
            
            updateState();
            
            forEach(state.keys, function (key, i) {
                path.push(key);
                
                if (modifiers.pre) modifiers.pre.call(state, state.node[key], key);
                
                var child = walker(state.node[key]);
                if (immutable && hasOwnProperty.call(state.node, key)) {
                    state.node[key] = child.node;
                }
                
                child.isLast = i == state.keys.length - 1;
                child.isFirst = i == 0;
                
                if (modifiers.post) modifiers.post.call(state, child);
                
                path.pop();
            });
            parents.pop();
        }
        
        if (modifiers.after) modifiers.after.call(state, state.node);
        
        return state;
    })(root).node;
}

function copy (src) {
    if (typeof src === 'object' && src !== null) {
        var dst;
        
        if (isArray(src)) {
            dst = [];
        }
        else if (isDate(src)) {
            dst = new Date(src.getTime ? src.getTime() : src);
        }
        else if (isRegExp(src)) {
            dst = new RegExp(src);
        }
        else if (isError(src)) {
            dst = { message: src.message };
        }
        else if (isBoolean(src)) {
            dst = new Boolean(src);
        }
        else if (isNumber(src)) {
            dst = new Number(src);
        }
        else if (isString(src)) {
            dst = new String(src);
        }
        else if (Object.create && Object.getPrototypeOf) {
            dst = Object.create(Object.getPrototypeOf(src));
        }
        else if (src.constructor === Object) {
            dst = {};
        }
        else {
            var proto =
                (src.constructor && src.constructor.prototype)
                || src.__proto__
                || {}
            ;
            var T = function () {};
            T.prototype = proto;
            dst = new T;
        }
        
        forEach(objectKeys(src), function (key) {
            dst[key] = src[key];
        });
        return dst;
    }
    else return src;
}

var objectKeys = Object.keys || function keys (obj) {
    var res = [];
    for (var key in obj) res.push(key)
    return res;
};

function toS (obj) { return Object.prototype.toString.call(obj) }
function isDate (obj) { return toS(obj) === '[object Date]' }
function isRegExp (obj) { return toS(obj) === '[object RegExp]' }
function isError (obj) { return toS(obj) === '[object Error]' }
function isBoolean (obj) { return toS(obj) === '[object Boolean]' }
function isNumber (obj) { return toS(obj) === '[object Number]' }
function isString (obj) { return toS(obj) === '[object String]' }

var isArray = Array.isArray || function isArray (xs) {
    return Object.prototype.toString.call(xs) === '[object Array]';
};

var forEach = function (xs, fn) {
    if (xs.forEach) return xs.forEach(fn)
    else for (var i = 0; i < xs.length; i++) {
        fn(xs[i], i, xs);
    }
};

forEach(objectKeys(Traverse.prototype), function (key) {
    traverse[key] = function (obj) {
        var args = [].slice.call(arguments, 1);
        var t = new Traverse(obj);
        return t[key].apply(t, args);
    };
});

var hasOwnProperty = Object.hasOwnProperty || function (obj, key) {
    return key in obj;
};


/***/ }),

/***/ 9196:
/***/ (function(module) {

"use strict";
module.exports = window["React"];

/***/ })

/******/ 	});
/************************************************************************/
/******/ 	// The module cache
/******/ 	var __webpack_module_cache__ = {};
/******/ 	
/******/ 	// The require function
/******/ 	function __webpack_require__(moduleId) {
/******/ 		// Check if module is in cache
/******/ 		var cachedModule = __webpack_module_cache__[moduleId];
/******/ 		if (cachedModule !== undefined) {
/******/ 			return cachedModule.exports;
/******/ 		}
/******/ 		// Create a new module (and put it into the cache)
/******/ 		var module = __webpack_module_cache__[moduleId] = {
/******/ 			// no module.id needed
/******/ 			// no module.loaded needed
/******/ 			exports: {}
/******/ 		};
/******/ 	
/******/ 		// Execute the module function
/******/ 		__webpack_modules__[moduleId].call(module.exports, module, module.exports, __webpack_require__);
/******/ 	
/******/ 		// Return the exports of the module
/******/ 		return module.exports;
/******/ 	}
/******/ 	
/************************************************************************/
/******/ 	/* webpack/runtime/compat get default export */
/******/ 	!function() {
/******/ 		// getDefaultExport function for compatibility with non-harmony modules
/******/ 		__webpack_require__.n = function(module) {
/******/ 			var getter = module && module.__esModule ?
/******/ 				function() { return module['default']; } :
/******/ 				function() { return module; };
/******/ 			__webpack_require__.d(getter, { a: getter });
/******/ 			return getter;
/******/ 		};
/******/ 	}();
/******/ 	
/******/ 	/* webpack/runtime/define property getters */
/******/ 	!function() {
/******/ 		// define getter functions for harmony exports
/******/ 		__webpack_require__.d = function(exports, definition) {
/******/ 			for(var key in definition) {
/******/ 				if(__webpack_require__.o(definition, key) && !__webpack_require__.o(exports, key)) {
/******/ 					Object.defineProperty(exports, key, { enumerable: true, get: definition[key] });
/******/ 				}
/******/ 			}
/******/ 		};
/******/ 	}();
/******/ 	
/******/ 	/* webpack/runtime/hasOwnProperty shorthand */
/******/ 	!function() {
/******/ 		__webpack_require__.o = function(obj, prop) { return Object.prototype.hasOwnProperty.call(obj, prop); }
/******/ 	}();
/******/ 	
/******/ 	/* webpack/runtime/make namespace object */
/******/ 	!function() {
/******/ 		// define __esModule on exports
/******/ 		__webpack_require__.r = function(exports) {
/******/ 			if(typeof Symbol !== 'undefined' && Symbol.toStringTag) {
/******/ 				Object.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });
/******/ 			}
/******/ 			Object.defineProperty(exports, '__esModule', { value: true });
/******/ 		};
/******/ 	}();
/******/ 	
/************************************************************************/
var __webpack_exports__ = {};
// This entry need to be wrapped in an IIFE because it need to be in strict mode.
!function() {
"use strict";
// ESM COMPAT FLAG
__webpack_require__.r(__webpack_exports__);

// EXPORTS
__webpack_require__.d(__webpack_exports__, {
  "AlignmentControl": function() { return /* reexport */ AlignmentControl; },
  "AlignmentToolbar": function() { return /* reexport */ AlignmentToolbar; },
  "Autocomplete": function() { return /* reexport */ autocomplete; },
  "BlockAlignmentControl": function() { return /* reexport */ BlockAlignmentControl; },
  "BlockAlignmentToolbar": function() { return /* reexport */ BlockAlignmentToolbar; },
  "BlockBreadcrumb": function() { return /* reexport */ block_breadcrumb; },
  "BlockColorsStyleSelector": function() { return /* reexport */ color_style_selector; },
  "BlockContextProvider": function() { return /* reexport */ BlockContextProvider; },
  "BlockControls": function() { return /* reexport */ block_controls; },
  "BlockEdit": function() { return /* reexport */ BlockEdit; },
  "BlockEditorKeyboardShortcuts": function() { return /* reexport */ keyboard_shortcuts; },
  "BlockEditorProvider": function() { return /* reexport */ provider; },
  "BlockFormatControls": function() { return /* reexport */ BlockFormatControls; },
  "BlockIcon": function() { return /* reexport */ block_icon; },
  "BlockInspector": function() { return /* reexport */ block_inspector; },
  "BlockList": function() { return /* reexport */ BlockList; },
  "BlockMover": function() { return /* reexport */ block_mover; },
  "BlockNavigationDropdown": function() { return /* reexport */ dropdown; },
  "BlockPreview": function() { return /* reexport */ block_preview; },
  "BlockSelectionClearer": function() { return /* reexport */ BlockSelectionClearer; },
  "BlockSettingsMenu": function() { return /* reexport */ block_settings_menu; },
  "BlockSettingsMenuControls": function() { return /* reexport */ block_settings_menu_controls; },
  "BlockStyles": function() { return /* reexport */ block_styles; },
  "BlockTitle": function() { return /* reexport */ BlockTitle; },
  "BlockToolbar": function() { return /* reexport */ block_toolbar; },
  "BlockTools": function() { return /* reexport */ BlockTools; },
  "BlockVerticalAlignmentControl": function() { return /* reexport */ BlockVerticalAlignmentControl; },
  "BlockVerticalAlignmentToolbar": function() { return /* reexport */ BlockVerticalAlignmentToolbar; },
  "ButtonBlockAppender": function() { return /* reexport */ button_block_appender; },
  "ButtonBlockerAppender": function() { return /* reexport */ ButtonBlockerAppender; },
  "ColorPalette": function() { return /* reexport */ color_palette; },
  "ColorPaletteControl": function() { return /* reexport */ ColorPaletteControl; },
  "ContrastChecker": function() { return /* reexport */ contrast_checker; },
  "CopyHandler": function() { return /* reexport */ copy_handler; },
  "DefaultBlockAppender": function() { return /* reexport */ default_block_appender; },
  "FontSizePicker": function() { return /* reexport */ font_size_picker; },
  "InnerBlocks": function() { return /* reexport */ inner_blocks; },
  "Inserter": function() { return /* reexport */ inserter; },
  "InspectorAdvancedControls": function() { return /* reexport */ InspectorAdvancedControls; },
  "InspectorControls": function() { return /* reexport */ inspector_controls; },
  "JustifyContentControl": function() { return /* reexport */ JustifyContentControl; },
  "JustifyToolbar": function() { return /* reexport */ JustifyToolbar; },
  "LineHeightControl": function() { return /* reexport */ line_height_control; },
  "MediaPlaceholder": function() { return /* reexport */ media_placeholder; },
  "MediaReplaceFlow": function() { return /* reexport */ media_replace_flow; },
  "MediaUpload": function() { return /* reexport */ media_upload; },
  "MediaUploadCheck": function() { return /* reexport */ media_upload_check; },
  "MultiSelectScrollIntoView": function() { return /* reexport */ MultiSelectScrollIntoView; },
  "NavigableToolbar": function() { return /* reexport */ navigable_toolbar; },
  "ObserveTyping": function() { return /* reexport */ observe_typing; },
  "PanelColorSettings": function() { return /* reexport */ panel_color_settings; },
  "PlainText": function() { return /* reexport */ plain_text; },
  "RichText": function() { return /* reexport */ rich_text; },
  "RichTextShortcut": function() { return /* reexport */ RichTextShortcut; },
  "RichTextToolbarButton": function() { return /* reexport */ RichTextToolbarButton; },
  "SETTINGS_DEFAULTS": function() { return /* reexport */ SETTINGS_DEFAULTS; },
  "SkipToSelectedBlock": function() { return /* reexport */ skip_to_selected_block; },
  "ToolSelector": function() { return /* reexport */ tool_selector; },
  "Typewriter": function() { return /* reexport */ typewriter; },
  "URLInput": function() { return /* reexport */ url_input; },
  "URLInputButton": function() { return /* reexport */ url_input_button; },
  "URLPopover": function() { return /* reexport */ url_popover; },
  "Warning": function() { return /* reexport */ warning; },
  "WritingFlow": function() { return /* reexport */ writing_flow; },
  "__experimentalBlockAlignmentMatrixControl": function() { return /* reexport */ block_alignment_matrix_control; },
  "__experimentalBlockContentOverlay": function() { return /* reexport */ BlockContentOverlay; },
  "__experimentalBlockFullHeightAligmentControl": function() { return /* reexport */ block_full_height_alignment_control; },
  "__experimentalBlockPatternSetup": function() { return /* reexport */ block_pattern_setup; },
  "__experimentalBlockPatternsList": function() { return /* reexport */ block_patterns_list; },
  "__experimentalBlockVariationPicker": function() { return /* reexport */ block_variation_picker; },
  "__experimentalBlockVariationTransforms": function() { return /* reexport */ block_variation_transforms; },
  "__experimentalBorderRadiusControl": function() { return /* reexport */ BorderRadiusControl; },
  "__experimentalBorderStyleControl": function() { return /* reexport */ BorderStyleControl; },
  "__experimentalColorGradientControl": function() { return /* reexport */ control; },
  "__experimentalColorGradientSettingsDropdown": function() { return /* reexport */ ColorGradientSettingsDropdown; },
  "__experimentalDateFormatPicker": function() { return /* reexport */ DateFormatPicker; },
  "__experimentalDuotoneControl": function() { return /* reexport */ duotone_control; },
  "__experimentalFontAppearanceControl": function() { return /* reexport */ FontAppearanceControl; },
  "__experimentalFontFamilyControl": function() { return /* reexport */ FontFamilyControl; },
  "__experimentalGetBorderClassesAndStyles": function() { return /* reexport */ getBorderClassesAndStyles; },
  "__experimentalGetColorClassesAndStyles": function() { return /* reexport */ getColorClassesAndStyles; },
  "__experimentalGetGradientClass": function() { return /* reexport */ __experimentalGetGradientClass; },
  "__experimentalGetGradientObjectByGradientValue": function() { return /* reexport */ __experimentalGetGradientObjectByGradientValue; },
  "__experimentalGetMatchingVariation": function() { return /* reexport */ __experimentalGetMatchingVariation; },
  "__experimentalGetSpacingClassesAndStyles": function() { return /* reexport */ getSpacingClassesAndStyles; },
  "__experimentalImageEditingProvider": function() { return /* reexport */ ImageEditingProvider; },
  "__experimentalImageEditor": function() { return /* reexport */ ImageEditor; },
  "__experimentalImageSizeControl": function() { return /* reexport */ ImageSizeControl; },
  "__experimentalImageURLInputUI": function() { return /* reexport */ ImageURLInputUI; },
  "__experimentalLayoutStyle": function() { return /* reexport */ LayoutStyle; },
  "__experimentalLetterSpacingControl": function() { return /* reexport */ LetterSpacingControl; },
  "__experimentalLibrary": function() { return /* reexport */ library; },
  "__experimentalLinkControl": function() { return /* reexport */ link_control; },
  "__experimentalLinkControlSearchInput": function() { return /* reexport */ search_input; },
  "__experimentalLinkControlSearchItem": function() { return /* reexport */ search_item; },
  "__experimentalLinkControlSearchResults": function() { return /* reexport */ LinkControlSearchResults; },
  "__experimentalListView": function() { return /* reexport */ components_list_view; },
  "__experimentalPanelColorGradientSettings": function() { return /* reexport */ panel_color_gradient_settings; },
  "__experimentalPreviewOptions": function() { return /* reexport */ PreviewOptions; },
  "__experimentalResponsiveBlockControl": function() { return /* reexport */ responsive_block_control; },
  "__experimentalTextDecorationControl": function() { return /* reexport */ TextDecorationControl; },
  "__experimentalTextTransformControl": function() { return /* reexport */ TextTransformControl; },
  "__experimentalToolsPanelColorDropdown": function() { return /* reexport */ ToolsPanelColorDropdown; },
  "__experimentalUnitControl": function() { return /* reexport */ UnitControl; },
  "__experimentalUseBlockPreview": function() { return /* reexport */ useBlockPreview; },
  "__experimentalUseBorderProps": function() { return /* reexport */ useBorderProps; },
  "__experimentalUseColorProps": function() { return /* reexport */ useColorProps; },
  "__experimentalUseCustomSides": function() { return /* reexport */ useCustomSides; },
  "__experimentalUseGradient": function() { return /* reexport */ __experimentalUseGradient; },
  "__experimentalUseNoRecursiveRenders": function() { return /* reexport */ useNoRecursiveRenders; },
  "__experimentalUseResizeCanvas": function() { return /* reexport */ useResizeCanvas; },
  "__unstableBlockNameContext": function() { return /* reexport */ block_name_context; },
  "__unstableBlockSettingsMenuFirstItem": function() { return /* reexport */ block_settings_menu_first_item; },
  "__unstableBlockToolbarLastItem": function() { return /* reexport */ block_toolbar_last_item; },
  "__unstableEditorStyles": function() { return /* reexport */ EditorStyles; },
  "__unstableIframe": function() { return /* reexport */ iframe; },
  "__unstableInserterMenuExtension": function() { return /* reexport */ inserter_menu_extension; },
  "__unstablePresetDuotoneFilter": function() { return /* reexport */ PresetDuotoneFilter; },
  "__unstableRichTextInputEvent": function() { return /* reexport */ __unstableRichTextInputEvent; },
  "__unstableUseBlockSelectionClearer": function() { return /* reexport */ useBlockSelectionClearer; },
  "__unstableUseClipboardHandler": function() { return /* reexport */ useClipboardHandler; },
  "__unstableUseMouseMoveTypingReset": function() { return /* reexport */ useMouseMoveTypingReset; },
  "__unstableUseTypewriter": function() { return /* reexport */ useTypewriter; },
  "__unstableUseTypingObserver": function() { return /* reexport */ useTypingObserver; },
  "createCustomColorsHOC": function() { return /* reexport */ createCustomColorsHOC; },
  "getColorClassName": function() { return /* reexport */ getColorClassName; },
  "getColorObjectByAttributeValues": function() { return /* reexport */ getColorObjectByAttributeValues; },
  "getColorObjectByColorValue": function() { return /* reexport */ getColorObjectByColorValue; },
  "getFontSize": function() { return /* reexport */ getFontSize; },
  "getFontSizeClass": function() { return /* reexport */ getFontSizeClass; },
  "getFontSizeObjectByValue": function() { return /* reexport */ getFontSizeObjectByValue; },
  "getGradientSlugByValue": function() { return /* reexport */ getGradientSlugByValue; },
  "getGradientValueBySlug": function() { return /* reexport */ getGradientValueBySlug; },
  "getPxFromCssUnit": function() { return /* reexport */ parse_css_unit_to_px; },
  "store": function() { return /* reexport */ store; },
  "storeConfig": function() { return /* reexport */ storeConfig; },
  "transformStyles": function() { return /* reexport */ transform_styles; },
  "useBlockDisplayInformation": function() { return /* reexport */ useBlockDisplayInformation; },
  "useBlockEditContext": function() { return /* reexport */ useBlockEditContext; },
  "useBlockProps": function() { return /* reexport */ useBlockProps; },
  "useCachedTruthy": function() { return /* reexport */ useCachedTruthy; },
  "useInnerBlocksProps": function() { return /* reexport */ useInnerBlocksProps; },
  "useSetting": function() { return /* reexport */ useSetting; },
  "withColorContext": function() { return /* reexport */ with_color_context; },
  "withColors": function() { return /* reexport */ withColors; },
  "withFontSizes": function() { return /* reexport */ with_font_sizes; }
});

// NAMESPACE OBJECT: ./node_modules/@wordpress/block-editor/build-module/store/selectors.js
var selectors_namespaceObject = {};
__webpack_require__.r(selectors_namespaceObject);
__webpack_require__.d(selectors_namespaceObject, {
  "__experimentalGetActiveBlockIdByBlockNames": function() { return __experimentalGetActiveBlockIdByBlockNames; },
  "__experimentalGetAllowedBlocks": function() { return __experimentalGetAllowedBlocks; },
  "__experimentalGetAllowedPatterns": function() { return __experimentalGetAllowedPatterns; },
  "__experimentalGetBlockListSettingsForBlocks": function() { return __experimentalGetBlockListSettingsForBlocks; },
  "__experimentalGetDirectInsertBlock": function() { return __experimentalGetDirectInsertBlock; },
  "__experimentalGetGlobalBlocksByName": function() { return __experimentalGetGlobalBlocksByName; },
  "__experimentalGetLastBlockAttributeChanges": function() { return __experimentalGetLastBlockAttributeChanges; },
  "__experimentalGetParsedPattern": function() { return __experimentalGetParsedPattern; },
  "__experimentalGetPatternTransformItems": function() { return __experimentalGetPatternTransformItems; },
  "__experimentalGetPatternsByBlockTypes": function() { return __experimentalGetPatternsByBlockTypes; },
  "__experimentalGetReusableBlockTitle": function() { return __experimentalGetReusableBlockTitle; },
  "__unstableGetBlockWithoutInnerBlocks": function() { return __unstableGetBlockWithoutInnerBlocks; },
  "__unstableGetClientIdWithClientIdsTree": function() { return __unstableGetClientIdWithClientIdsTree; },
  "__unstableGetClientIdsTree": function() { return __unstableGetClientIdsTree; },
  "__unstableGetSelectedBlocksWithPartialSelection": function() { return __unstableGetSelectedBlocksWithPartialSelection; },
  "__unstableIsFullySelected": function() { return __unstableIsFullySelected; },
  "__unstableIsLastBlockChangeIgnored": function() { return __unstableIsLastBlockChangeIgnored; },
  "__unstableIsSelectionCollapsed": function() { return __unstableIsSelectionCollapsed; },
  "__unstableIsSelectionMergeable": function() { return __unstableIsSelectionMergeable; },
  "areInnerBlocksControlled": function() { return areInnerBlocksControlled; },
  "canInsertBlockType": function() { return canInsertBlockType; },
  "canInsertBlocks": function() { return canInsertBlocks; },
  "canLockBlockType": function() { return canLockBlockType; },
  "canMoveBlock": function() { return canMoveBlock; },
  "canMoveBlocks": function() { return canMoveBlocks; },
  "canRemoveBlock": function() { return canRemoveBlock; },
  "canRemoveBlocks": function() { return canRemoveBlocks; },
  "didAutomaticChange": function() { return didAutomaticChange; },
  "getAdjacentBlockClientId": function() { return getAdjacentBlockClientId; },
  "getBlock": function() { return getBlock; },
  "getBlockAttributes": function() { return getBlockAttributes; },
  "getBlockCount": function() { return getBlockCount; },
  "getBlockHierarchyRootClientId": function() { return getBlockHierarchyRootClientId; },
  "getBlockIndex": function() { return getBlockIndex; },
  "getBlockInsertionPoint": function() { return getBlockInsertionPoint; },
  "getBlockListSettings": function() { return getBlockListSettings; },
  "getBlockMode": function() { return getBlockMode; },
  "getBlockName": function() { return getBlockName; },
  "getBlockOrder": function() { return getBlockOrder; },
  "getBlockParents": function() { return getBlockParents; },
  "getBlockParentsByBlockName": function() { return getBlockParentsByBlockName; },
  "getBlockRootClientId": function() { return getBlockRootClientId; },
  "getBlockSelectionEnd": function() { return getBlockSelectionEnd; },
  "getBlockSelectionStart": function() { return getBlockSelectionStart; },
  "getBlockTransformItems": function() { return getBlockTransformItems; },
  "getBlocks": function() { return getBlocks; },
  "getBlocksByClientId": function() { return getBlocksByClientId; },
  "getClientIdsOfDescendants": function() { return getClientIdsOfDescendants; },
  "getClientIdsWithDescendants": function() { return getClientIdsWithDescendants; },
  "getDraggedBlockClientIds": function() { return getDraggedBlockClientIds; },
  "getFirstMultiSelectedBlockClientId": function() { return getFirstMultiSelectedBlockClientId; },
  "getGlobalBlockCount": function() { return getGlobalBlockCount; },
  "getInserterItems": function() { return getInserterItems; },
  "getLastMultiSelectedBlockClientId": function() { return getLastMultiSelectedBlockClientId; },
  "getLowestCommonAncestorWithSelectedBlock": function() { return getLowestCommonAncestorWithSelectedBlock; },
  "getMultiSelectedBlockClientIds": function() { return getMultiSelectedBlockClientIds; },
  "getMultiSelectedBlocks": function() { return getMultiSelectedBlocks; },
  "getMultiSelectedBlocksEndClientId": function() { return getMultiSelectedBlocksEndClientId; },
  "getMultiSelectedBlocksStartClientId": function() { return getMultiSelectedBlocksStartClientId; },
  "getNextBlockClientId": function() { return getNextBlockClientId; },
  "getPreviousBlockClientId": function() { return getPreviousBlockClientId; },
  "getSelectedBlock": function() { return getSelectedBlock; },
  "getSelectedBlockClientId": function() { return getSelectedBlockClientId; },
  "getSelectedBlockClientIds": function() { return getSelectedBlockClientIds; },
  "getSelectedBlockCount": function() { return getSelectedBlockCount; },
  "getSelectedBlocksInitialCaretPosition": function() { return getSelectedBlocksInitialCaretPosition; },
  "getSelectionEnd": function() { return getSelectionEnd; },
  "getSelectionStart": function() { return getSelectionStart; },
  "getSettings": function() { return getSettings; },
  "getTemplate": function() { return getTemplate; },
  "getTemplateLock": function() { return getTemplateLock; },
  "hasBlockMovingClientId": function() { return selectors_hasBlockMovingClientId; },
  "hasInserterItems": function() { return hasInserterItems; },
  "hasMultiSelection": function() { return hasMultiSelection; },
  "hasSelectedBlock": function() { return hasSelectedBlock; },
  "hasSelectedInnerBlock": function() { return hasSelectedInnerBlock; },
  "isAncestorBeingDragged": function() { return isAncestorBeingDragged; },
  "isAncestorMultiSelected": function() { return isAncestorMultiSelected; },
  "isBlockBeingDragged": function() { return isBlockBeingDragged; },
  "isBlockHighlighted": function() { return isBlockHighlighted; },
  "isBlockInsertionPointVisible": function() { return isBlockInsertionPointVisible; },
  "isBlockMultiSelected": function() { return isBlockMultiSelected; },
  "isBlockSelected": function() { return isBlockSelected; },
  "isBlockValid": function() { return isBlockValid; },
  "isBlockWithinSelection": function() { return isBlockWithinSelection; },
  "isCaretWithinFormattedText": function() { return selectors_isCaretWithinFormattedText; },
  "isDraggingBlocks": function() { return isDraggingBlocks; },
  "isFirstMultiSelectedBlock": function() { return isFirstMultiSelectedBlock; },
  "isLastBlockChangePersistent": function() { return isLastBlockChangePersistent; },
  "isMultiSelecting": function() { return selectors_isMultiSelecting; },
  "isNavigationMode": function() { return selectors_isNavigationMode; },
  "isSelectionEnabled": function() { return selectors_isSelectionEnabled; },
  "isTyping": function() { return selectors_isTyping; },
  "isValidTemplate": function() { return isValidTemplate; },
  "wasBlockJustInserted": function() { return wasBlockJustInserted; }
});

// NAMESPACE OBJECT: ./node_modules/@wordpress/block-editor/build-module/store/actions.js
var actions_namespaceObject = {};
__webpack_require__.r(actions_namespaceObject);
__webpack_require__.d(actions_namespaceObject, {
  "__unstableDeleteSelection": function() { return __unstableDeleteSelection; },
  "__unstableExpandSelection": function() { return __unstableExpandSelection; },
  "__unstableMarkAutomaticChange": function() { return __unstableMarkAutomaticChange; },
  "__unstableMarkLastChangeAsPersistent": function() { return __unstableMarkLastChangeAsPersistent; },
  "__unstableMarkNextChangeAsNotPersistent": function() { return __unstableMarkNextChangeAsNotPersistent; },
  "__unstableSaveReusableBlock": function() { return __unstableSaveReusableBlock; },
  "__unstableSplitSelection": function() { return __unstableSplitSelection; },
  "clearSelectedBlock": function() { return clearSelectedBlock; },
  "duplicateBlocks": function() { return duplicateBlocks; },
  "enterFormattedText": function() { return enterFormattedText; },
  "exitFormattedText": function() { return exitFormattedText; },
  "flashBlock": function() { return flashBlock; },
  "hideInsertionPoint": function() { return hideInsertionPoint; },
  "insertAfterBlock": function() { return insertAfterBlock; },
  "insertBeforeBlock": function() { return insertBeforeBlock; },
  "insertBlock": function() { return insertBlock; },
  "insertBlocks": function() { return insertBlocks; },
  "insertDefaultBlock": function() { return insertDefaultBlock; },
  "mergeBlocks": function() { return mergeBlocks; },
  "moveBlockToPosition": function() { return moveBlockToPosition; },
  "moveBlocksDown": function() { return moveBlocksDown; },
  "moveBlocksToPosition": function() { return moveBlocksToPosition; },
  "moveBlocksUp": function() { return moveBlocksUp; },
  "multiSelect": function() { return multiSelect; },
  "receiveBlocks": function() { return receiveBlocks; },
  "removeBlock": function() { return removeBlock; },
  "removeBlocks": function() { return removeBlocks; },
  "replaceBlock": function() { return replaceBlock; },
  "replaceBlocks": function() { return replaceBlocks; },
  "replaceInnerBlocks": function() { return replaceInnerBlocks; },
  "resetBlocks": function() { return resetBlocks; },
  "resetSelection": function() { return resetSelection; },
  "selectBlock": function() { return selectBlock; },
  "selectNextBlock": function() { return selectNextBlock; },
  "selectPreviousBlock": function() { return selectPreviousBlock; },
  "selectionChange": function() { return selectionChange; },
  "setBlockMovingClientId": function() { return setBlockMovingClientId; },
  "setHasControlledInnerBlocks": function() { return setHasControlledInnerBlocks; },
  "setNavigationMode": function() { return setNavigationMode; },
  "setTemplateValidity": function() { return setTemplateValidity; },
  "showInsertionPoint": function() { return showInsertionPoint; },
  "startDraggingBlocks": function() { return startDraggingBlocks; },
  "startMultiSelect": function() { return startMultiSelect; },
  "startTyping": function() { return startTyping; },
  "stopDraggingBlocks": function() { return stopDraggingBlocks; },
  "stopMultiSelect": function() { return stopMultiSelect; },
  "stopTyping": function() { return stopTyping; },
  "synchronizeTemplate": function() { return synchronizeTemplate; },
  "toggleBlockHighlight": function() { return toggleBlockHighlight; },
  "toggleBlockMode": function() { return toggleBlockMode; },
  "toggleSelection": function() { return toggleSelection; },
  "updateBlock": function() { return updateBlock; },
  "updateBlockAttributes": function() { return updateBlockAttributes; },
  "updateBlockListSettings": function() { return updateBlockListSettings; },
  "updateSettings": function() { return updateSettings; },
  "validateBlocksToTemplate": function() { return validateBlocksToTemplate; }
});

;// CONCATENATED MODULE: external ["wp","blocks"]
var external_wp_blocks_namespaceObject = window["wp"]["blocks"];
;// CONCATENATED MODULE: external ["wp","hooks"]
var external_wp_hooks_namespaceObject = window["wp"]["hooks"];
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/compat.js
/**
 * WordPress dependencies
 */



function migrateLightBlockWrapper(settings) {
  const {
    apiVersion = 1
  } = settings;

  if (apiVersion < 2 && (0,external_wp_blocks_namespaceObject.hasBlockSupport)(settings, 'lightBlockWrapper', false)) {
    settings.apiVersion = 2;
  }

  return settings;
}

(0,external_wp_hooks_namespaceObject.addFilter)('blocks.registerBlockType', 'core/compat/migrateLightBlockWrapper', migrateLightBlockWrapper);

;// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/extends.js
function _extends() {
  _extends = Object.assign ? Object.assign.bind() : function (target) {
    for (var i = 1; i < arguments.length; i++) {
      var source = arguments[i];

      for (var key in source) {
        if (Object.prototype.hasOwnProperty.call(source, key)) {
          target[key] = source[key];
        }
      }
    }

    return target;
  };
  return _extends.apply(this, arguments);
}
;// CONCATENATED MODULE: external ["wp","element"]
var external_wp_element_namespaceObject = window["wp"]["element"];
// EXTERNAL MODULE: ./node_modules/classnames/index.js
var classnames = __webpack_require__(4403);
var classnames_default = /*#__PURE__*/__webpack_require__.n(classnames);
;// CONCATENATED MODULE: external "lodash"
var external_lodash_namespaceObject = window["lodash"];
;// CONCATENATED MODULE: external ["wp","compose"]
var external_wp_compose_namespaceObject = window["wp"]["compose"];
;// CONCATENATED MODULE: external ["wp","components"]
var external_wp_components_namespaceObject = window["wp"]["components"];
;// CONCATENATED MODULE: external ["wp","data"]
var external_wp_data_namespaceObject = window["wp"]["data"];
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-controls/groups.js
/**
 * WordPress dependencies
 */

const BlockControlsDefault = (0,external_wp_components_namespaceObject.createSlotFill)('BlockControls');
const BlockControlsBlock = (0,external_wp_components_namespaceObject.createSlotFill)('BlockControlsBlock');
const BlockControlsInline = (0,external_wp_components_namespaceObject.createSlotFill)('BlockFormatControls');
const BlockControlsOther = (0,external_wp_components_namespaceObject.createSlotFill)('BlockControlsOther');
const BlockControlsParent = (0,external_wp_components_namespaceObject.createSlotFill)('BlockControlsParent');
const groups = {
  default: BlockControlsDefault,
  block: BlockControlsBlock,
  inline: BlockControlsInline,
  other: BlockControlsOther,
  parent: BlockControlsParent
};
/* harmony default export */ var block_controls_groups = (groups);

;// CONCATENATED MODULE: external ["wp","i18n"]
var external_wp_i18n_namespaceObject = window["wp"]["i18n"];
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/store/defaults.js
/**
 * WordPress dependencies
 */

const PREFERENCES_DEFAULTS = {
  insertUsage: {}
};
/**
 * The default editor settings
 *
 * @typedef {Object} SETTINGS_DEFAULT
 * @property {boolean}       alignWide                              Enable/Disable Wide/Full Alignments
 * @property {boolean}       supportsLayout                         Enable/disable layouts support in container blocks.
 * @property {boolean}       imageEditing                           Image Editing settings set to false to disable.
 * @property {Array}         imageSizes                             Available image sizes
 * @property {number}        maxWidth                               Max width to constraint resizing
 * @property {boolean|Array} allowedBlockTypes                      Allowed block types
 * @property {boolean}       hasFixedToolbar                        Whether or not the editor toolbar is fixed
 * @property {boolean}       focusMode                              Whether the focus mode is enabled or not
 * @property {Array}         styles                                 Editor Styles
 * @property {boolean}       keepCaretInsideBlock                   Whether caret should move between blocks in edit mode
 * @property {string}        bodyPlaceholder                        Empty post placeholder
 * @property {string}        titlePlaceholder                       Empty title placeholder
 * @property {boolean}       canLockBlocks                          Whether the user can manage Block Lock state
 * @property {boolean}       codeEditingEnabled                     Whether or not the user can switch to the code editor
 * @property {boolean}       generateAnchors                        Enable/Disable auto anchor generation for Heading blocks
 * @property {boolean}       __experimentalCanUserUseUnfilteredHTML Whether the user should be able to use unfiltered HTML or the HTML should be filtered e.g., to remove elements considered insecure like iframes.
 * @property {boolean}       __experimentalBlockDirectory           Whether the user has enabled the Block Directory
 * @property {Array}         __experimentalBlockPatterns            Array of objects representing the block patterns
 * @property {Array}         __experimentalBlockPatternCategories   Array of objects representing the block pattern categories
 * @property {boolean}       __unstableGalleryWithImageBlocks       Whether the user has enabled the refactored gallery block which uses InnerBlocks
 */

const SETTINGS_DEFAULTS = {
  alignWide: false,
  supportsLayout: true,
  // colors setting is not used anymore now defaults are passed from theme.json on the server and core has its own defaults.
  // The setting is only kept for backward compatibility purposes.
  colors: [{
    name: (0,external_wp_i18n_namespaceObject.__)('Black'),
    slug: 'black',
    color: '#000000'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Cyan bluish gray'),
    slug: 'cyan-bluish-gray',
    color: '#abb8c3'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('White'),
    slug: 'white',
    color: '#ffffff'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Pale pink'),
    slug: 'pale-pink',
    color: '#f78da7'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Vivid red'),
    slug: 'vivid-red',
    color: '#cf2e2e'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Luminous vivid orange'),
    slug: 'luminous-vivid-orange',
    color: '#ff6900'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Luminous vivid amber'),
    slug: 'luminous-vivid-amber',
    color: '#fcb900'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Light green cyan'),
    slug: 'light-green-cyan',
    color: '#7bdcb5'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Vivid green cyan'),
    slug: 'vivid-green-cyan',
    color: '#00d084'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Pale cyan blue'),
    slug: 'pale-cyan-blue',
    color: '#8ed1fc'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Vivid cyan blue'),
    slug: 'vivid-cyan-blue',
    color: '#0693e3'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Vivid purple'),
    slug: 'vivid-purple',
    color: '#9b51e0'
  }],
  // fontSizes setting is not used anymore now defaults are passed from theme.json on the server and core has its own defaults.
  // The setting is only kept for backward compatibility purposes.
  fontSizes: [{
    name: (0,external_wp_i18n_namespaceObject._x)('Small', 'font size name'),
    size: 13,
    slug: 'small'
  }, {
    name: (0,external_wp_i18n_namespaceObject._x)('Normal', 'font size name'),
    size: 16,
    slug: 'normal'
  }, {
    name: (0,external_wp_i18n_namespaceObject._x)('Medium', 'font size name'),
    size: 20,
    slug: 'medium'
  }, {
    name: (0,external_wp_i18n_namespaceObject._x)('Large', 'font size name'),
    size: 36,
    slug: 'large'
  }, {
    name: (0,external_wp_i18n_namespaceObject._x)('Huge', 'font size name'),
    size: 42,
    slug: 'huge'
  }],
  // Image default size slug.
  imageDefaultSize: 'large',
  imageSizes: [{
    slug: 'thumbnail',
    name: (0,external_wp_i18n_namespaceObject.__)('Thumbnail')
  }, {
    slug: 'medium',
    name: (0,external_wp_i18n_namespaceObject.__)('Medium')
  }, {
    slug: 'large',
    name: (0,external_wp_i18n_namespaceObject.__)('Large')
  }, {
    slug: 'full',
    name: (0,external_wp_i18n_namespaceObject.__)('Full Size')
  }],
  // Allow plugin to disable Image Editor if need be.
  imageEditing: true,
  // This is current max width of the block inner area
  // It's used to constraint image resizing and this value could be overridden later by themes
  maxWidth: 580,
  // Allowed block types for the editor, defaulting to true (all supported).
  allowedBlockTypes: true,
  // Maximum upload size in bytes allowed for the site.
  maxUploadFileSize: 0,
  // List of allowed mime types and file extensions.
  allowedMimeTypes: null,
  // Allows to disable block locking interface.
  canLockBlocks: true,
  __experimentalCanUserUseUnfilteredHTML: false,
  __experimentalBlockDirectory: false,
  __mobileEnablePageTemplates: false,
  __experimentalBlockPatterns: [],
  __experimentalBlockPatternCategories: [],
  __experimentalSpotlightEntityBlocks: [],
  __unstableGalleryWithImageBlocks: false,
  generateAnchors: false,
  // gradients setting is not used anymore now defaults are passed from theme.json on the server and core has its own defaults.
  // The setting is only kept for backward compatibility purposes.
  gradients: [{
    name: (0,external_wp_i18n_namespaceObject.__)('Vivid cyan blue to vivid purple'),
    gradient: 'linear-gradient(135deg,rgba(6,147,227,1) 0%,rgb(155,81,224) 100%)',
    slug: 'vivid-cyan-blue-to-vivid-purple'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Light green cyan to vivid green cyan'),
    gradient: 'linear-gradient(135deg,rgb(122,220,180) 0%,rgb(0,208,130) 100%)',
    slug: 'light-green-cyan-to-vivid-green-cyan'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Luminous vivid amber to luminous vivid orange'),
    gradient: 'linear-gradient(135deg,rgba(252,185,0,1) 0%,rgba(255,105,0,1) 100%)',
    slug: 'luminous-vivid-amber-to-luminous-vivid-orange'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Luminous vivid orange to vivid red'),
    gradient: 'linear-gradient(135deg,rgba(255,105,0,1) 0%,rgb(207,46,46) 100%)',
    slug: 'luminous-vivid-orange-to-vivid-red'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Very light gray to cyan bluish gray'),
    gradient: 'linear-gradient(135deg,rgb(238,238,238) 0%,rgb(169,184,195) 100%)',
    slug: 'very-light-gray-to-cyan-bluish-gray'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Cool to warm spectrum'),
    gradient: 'linear-gradient(135deg,rgb(74,234,220) 0%,rgb(151,120,209) 20%,rgb(207,42,186) 40%,rgb(238,44,130) 60%,rgb(251,105,98) 80%,rgb(254,248,76) 100%)',
    slug: 'cool-to-warm-spectrum'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Blush light purple'),
    gradient: 'linear-gradient(135deg,rgb(255,206,236) 0%,rgb(152,150,240) 100%)',
    slug: 'blush-light-purple'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Blush bordeaux'),
    gradient: 'linear-gradient(135deg,rgb(254,205,165) 0%,rgb(254,45,45) 50%,rgb(107,0,62) 100%)',
    slug: 'blush-bordeaux'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Luminous dusk'),
    gradient: 'linear-gradient(135deg,rgb(255,203,112) 0%,rgb(199,81,192) 50%,rgb(65,88,208) 100%)',
    slug: 'luminous-dusk'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Pale ocean'),
    gradient: 'linear-gradient(135deg,rgb(255,245,203) 0%,rgb(182,227,212) 50%,rgb(51,167,181) 100%)',
    slug: 'pale-ocean'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Electric grass'),
    gradient: 'linear-gradient(135deg,rgb(202,248,128) 0%,rgb(113,206,126) 100%)',
    slug: 'electric-grass'
  }, {
    name: (0,external_wp_i18n_namespaceObject.__)('Midnight'),
    gradient: 'linear-gradient(135deg,rgb(2,3,129) 0%,rgb(40,116,252) 100%)',
    slug: 'midnight'
  }],
  __unstableResolvedAssets: {
    styles: [],
    scripts: []
  }
};

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/store/array.js
/**
 * External dependencies
 */

/**
 * Insert one or multiple elements into a given position of an array.
 *
 * @param {Array}  array    Source array.
 * @param {*}      elements Elements to insert.
 * @param {number} index    Insert Position.
 *
 * @return {Array} Result.
 */

function insertAt(array, elements, index) {
  return [...array.slice(0, index), ...(0,external_lodash_namespaceObject.castArray)(elements), ...array.slice(index)];
}
/**
 * Moves an element in an array.
 *
 * @param {Array}  array Source array.
 * @param {number} from  Source index.
 * @param {number} to    Destination index.
 * @param {number} count Number of elements to move.
 *
 * @return {Array} Result.
 */

function moveTo(array, from, to) {
  let count = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : 1;
  const withoutMovedElements = [...array];
  withoutMovedElements.splice(from, count);
  return insertAt(withoutMovedElements, array.slice(from, from + count), to);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/store/reducer.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */



/**
 * Given an array of blocks, returns an object where each key is a nesting
 * context, the value of which is an array of block client IDs existing within
 * that nesting context.
 *
 * @param {Array}   blocks       Blocks to map.
 * @param {?string} rootClientId Assumed root client ID.
 *
 * @return {Object} Block order map object.
 */

function mapBlockOrder(blocks) {
  let rootClientId = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : '';
  const result = {
    [rootClientId]: []
  };
  blocks.forEach(block => {
    const {
      clientId,
      innerBlocks
    } = block;
    result[rootClientId].push(clientId);
    Object.assign(result, mapBlockOrder(innerBlocks, clientId));
  });
  return result;
}
/**
 * Given an array of blocks, returns an object where each key contains
 * the clientId of the block and the value is the parent of the block.
 *
 * @param {Array}   blocks       Blocks to map.
 * @param {?string} rootClientId Assumed root client ID.
 *
 * @return {Object} Block order map object.
 */


function mapBlockParents(blocks) {
  let rootClientId = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : '';
  return blocks.reduce((result, block) => Object.assign(result, {
    [block.clientId]: rootClientId
  }, mapBlockParents(block.innerBlocks, block.clientId)), {});
}
/**
 * Helper method to iterate through all blocks, recursing into inner blocks,
 * applying a transformation function to each one.
 * Returns a flattened object with the transformed blocks.
 *
 * @param {Array}    blocks    Blocks to flatten.
 * @param {Function} transform Transforming function to be applied to each block.
 *
 * @return {Object} Flattened object.
 */


function flattenBlocks(blocks) {
  let transform = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : external_lodash_namespaceObject.identity;
  const result = {};
  const stack = [...blocks];

  while (stack.length) {
    const {
      innerBlocks,
      ...block
    } = stack.shift();
    stack.push(...innerBlocks);
    result[block.clientId] = transform(block);
  }

  return result;
}
/**
 * Given an array of blocks, returns an object containing all blocks, without
 * attributes, recursing into inner blocks. Keys correspond to the block client
 * ID, the value of which is the attributes object.
 *
 * @param {Array} blocks Blocks to flatten.
 *
 * @return {Object} Flattened block attributes object.
 */


function getFlattenedBlocksWithoutAttributes(blocks) {
  return flattenBlocks(blocks, block => (0,external_lodash_namespaceObject.omit)(block, 'attributes'));
}
/**
 * Given an array of blocks, returns an object containing all block attributes,
 * recursing into inner blocks. Keys correspond to the block client ID, the
 * value of which is the attributes object.
 *
 * @param {Array} blocks Blocks to flatten.
 *
 * @return {Object} Flattened block attributes object.
 */


function getFlattenedBlockAttributes(blocks) {
  return flattenBlocks(blocks, block => block.attributes);
}
/**
 * Returns an object against which it is safe to perform mutating operations,
 * given the original object and its current working copy.
 *
 * @param {Object} original Original object.
 * @param {Object} working  Working object.
 *
 * @return {Object} Mutation-safe object.
 */


function getMutateSafeObject(original, working) {
  if (original === working) {
    return { ...original
    };
  }

  return working;
}
/**
 * Returns true if the two object arguments have the same keys, or false
 * otherwise.
 *
 * @param {Object} a First object.
 * @param {Object} b Second object.
 *
 * @return {boolean} Whether the two objects have the same keys.
 */


function hasSameKeys(a, b) {
  return (0,external_lodash_namespaceObject.isEqual)((0,external_lodash_namespaceObject.keys)(a), (0,external_lodash_namespaceObject.keys)(b));
}
/**
 * Returns true if, given the currently dispatching action and the previously
 * dispatched action, the two actions are updating the same block attribute, or
 * false otherwise.
 *
 * @param {Object} action     Currently dispatching action.
 * @param {Object} lastAction Previously dispatched action.
 *
 * @return {boolean} Whether actions are updating the same block attribute.
 */

function isUpdatingSameBlockAttribute(action, lastAction) {
  return action.type === 'UPDATE_BLOCK_ATTRIBUTES' && lastAction !== undefined && lastAction.type === 'UPDATE_BLOCK_ATTRIBUTES' && (0,external_lodash_namespaceObject.isEqual)(action.clientIds, lastAction.clientIds) && hasSameKeys(action.attributes, lastAction.attributes);
}

function buildBlockTree(state, blocks) {
  const result = {};
  const stack = [...blocks];
  const flattenedBlocks = [...blocks];

  while (stack.length) {
    const block = stack.shift();
    stack.push(...block.innerBlocks);
    flattenedBlocks.push(...block.innerBlocks);
  } // Create objects before mutating them, that way it's always defined.


  for (const block of flattenedBlocks) {
    result[block.clientId] = {};
  }

  for (const block of flattenedBlocks) {
    result[block.clientId] = Object.assign(result[block.clientId], { ...state.byClientId[block.clientId],
      attributes: state.attributes[block.clientId],
      innerBlocks: block.innerBlocks.map(subBlock => result[subBlock.clientId])
    });
  }

  return result;
}

function updateParentInnerBlocksInTree(state, tree, updatedClientIds) {
  let updateChildrenOfUpdatedClientIds = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : false;
  const uncontrolledParents = new Set([]);
  const controlledParents = new Set();

  for (const clientId of updatedClientIds) {
    let current = updateChildrenOfUpdatedClientIds ? clientId : state.parents[clientId];

    do {
      if (state.controlledInnerBlocks[current]) {
        // Should stop on controlled blocks.
        // If we reach a controlled parent, break out of the loop.
        controlledParents.add(current);
        break;
      } else {
        // Else continue traversing up through parents.
        uncontrolledParents.add(current);
        current = state.parents[current];
      }
    } while (current !== undefined);
  } // To make sure the order of assignments doesn't matter,
  // we first create empty objects and mutates the inner blocks later.


  for (const clientId of uncontrolledParents) {
    tree[clientId] = { ...tree[clientId]
    };
  }

  for (const clientId of uncontrolledParents) {
    tree[clientId].innerBlocks = (state.order[clientId] || []).map(subClientId => tree[subClientId]);
  } // Controlled parent blocks, need a dedicated key for their inner blocks
  // to be used when doing getBlocks( controlledBlockClientId ).


  for (const clientId of controlledParents) {
    tree['controlled||' + clientId] = {
      innerBlocks: (state.order[clientId] || []).map(subClientId => tree[subClientId])
    };
  }

  return tree;
}
/**
 * Higher-order reducer intended to compute full block objects key for each block in the post.
 * This is a denormalization to optimize the performance of the getBlock selectors and avoid
 * recomputing the block objects and avoid heavy memoization.
 *
 * @param {Function} reducer Original reducer function.
 *
 * @return {Function} Enhanced reducer function.
 */


const withBlockTree = reducer => function () {
  let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  let action = arguments.length > 1 ? arguments[1] : undefined;
  const newState = reducer(state, action);

  if (newState === state) {
    return state;
  }

  newState.tree = state.tree ? state.tree : {};

  switch (action.type) {
    case 'RECEIVE_BLOCKS':
    case 'INSERT_BLOCKS':
      {
        const subTree = buildBlockTree(newState, action.blocks);
        newState.tree = updateParentInnerBlocksInTree(newState, { ...newState.tree,
          ...subTree
        }, action.rootClientId ? [action.rootClientId] : [''], true);
        break;
      }

    case 'UPDATE_BLOCK':
      newState.tree = updateParentInnerBlocksInTree(newState, { ...newState.tree,
        [action.clientId]: { ...newState.tree[action.clientId],
          ...newState.byClientId[action.clientId],
          attributes: newState.attributes[action.clientId]
        }
      }, [action.clientId], false);
      break;

    case 'UPDATE_BLOCK_ATTRIBUTES':
      {
        const newSubTree = action.clientIds.reduce((result, clientId) => {
          result[clientId] = { ...newState.tree[clientId],
            attributes: newState.attributes[clientId]
          };
          return result;
        }, {});
        newState.tree = updateParentInnerBlocksInTree(newState, { ...newState.tree,
          ...newSubTree
        }, action.clientIds, false);
        break;
      }

    case 'REPLACE_BLOCKS_AUGMENTED_WITH_CHILDREN':
      {
        const subTree = buildBlockTree(newState, action.blocks);
        newState.tree = updateParentInnerBlocksInTree(newState, { ...(0,external_lodash_namespaceObject.omit)(newState.tree, action.replacedClientIds.concat( // Controlled inner blocks are only removed
          // if the block doesn't move to another position
          // otherwise their content will be lost.
          action.replacedClientIds.filter(clientId => !subTree[clientId]).map(clientId => 'controlled||' + clientId))),
          ...subTree
        }, action.blocks.map(b => b.clientId), false); // If there are no replaced blocks, it means we're removing blocks so we need to update their parent.

        const parentsOfRemovedBlocks = [];

        for (const clientId of action.clientIds) {
          if (state.parents[clientId] !== undefined && (state.parents[clientId] === '' || newState.byClientId[state.parents[clientId]])) {
            parentsOfRemovedBlocks.push(state.parents[clientId]);
          }
        }

        newState.tree = updateParentInnerBlocksInTree(newState, newState.tree, parentsOfRemovedBlocks, true);
        break;
      }

    case 'REMOVE_BLOCKS_AUGMENTED_WITH_CHILDREN':
      const parentsOfRemovedBlocks = [];

      for (const clientId of action.clientIds) {
        if (state.parents[clientId] !== undefined && (state.parents[clientId] === '' || newState.byClientId[state.parents[clientId]])) {
          parentsOfRemovedBlocks.push(state.parents[clientId]);
        }
      }

      newState.tree = updateParentInnerBlocksInTree(newState, (0,external_lodash_namespaceObject.omit)(newState.tree, action.removedClientIds.concat(action.removedClientIds.map(clientId => 'controlled||' + clientId))), parentsOfRemovedBlocks, true);
      break;

    case 'MOVE_BLOCKS_TO_POSITION':
      {
        const updatedBlockUids = [];

        if (action.fromRootClientId) {
          updatedBlockUids.push(action.fromRootClientId);
        }

        if (action.toRootClientId) {
          updatedBlockUids.push(action.toRootClientId);
        }

        if (!action.fromRootClientId || !action.fromRootClientId) {
          updatedBlockUids.push('');
        }

        newState.tree = updateParentInnerBlocksInTree(newState, newState.tree, updatedBlockUids, true);
        break;
      }

    case 'MOVE_BLOCKS_UP':
    case 'MOVE_BLOCKS_DOWN':
      {
        const updatedBlockUids = [action.rootClientId ? action.rootClientId : ''];
        newState.tree = updateParentInnerBlocksInTree(newState, newState.tree, updatedBlockUids, true);
        break;
      }

    case 'SAVE_REUSABLE_BLOCK_SUCCESS':
      {
        const updatedBlockUids = (0,external_lodash_namespaceObject.keys)((0,external_lodash_namespaceObject.omitBy)(newState.attributes, (attributes, clientId) => {
          return newState.byClientId[clientId].name !== 'core/block' || attributes.ref !== action.updatedId;
        }));
        newState.tree = updateParentInnerBlocksInTree(newState, { ...newState.tree,
          ...updatedBlockUids.reduce((result, clientId) => {
            result[clientId] = { ...newState.byClientId[clientId],
              attributes: newState.attributes[clientId],
              innerBlocks: newState.tree[clientId].innerBlocks
            };
            return result;
          }, {})
        }, updatedBlockUids, false);
      }
  }

  return newState;
};
/**
 * Higher-order reducer intended to augment the blocks reducer, assigning an
 * `isPersistentChange` property value corresponding to whether a change in
 * state can be considered as persistent. All changes are considered persistent
 * except when updating the same block attribute as in the previous action.
 *
 * @param {Function} reducer Original reducer function.
 *
 * @return {Function} Enhanced reducer function.
 */


function withPersistentBlockChange(reducer) {
  let lastAction;
  let markNextChangeAsNotPersistent = false;
  return (state, action) => {
    let nextState = reducer(state, action);
    const isExplicitPersistentChange = action.type === 'MARK_LAST_CHANGE_AS_PERSISTENT' || markNextChangeAsNotPersistent; // Defer to previous state value (or default) unless changing or
    // explicitly marking as persistent.

    if (state === nextState && !isExplicitPersistentChange) {
      var _state$isPersistentCh;

      markNextChangeAsNotPersistent = action.type === 'MARK_NEXT_CHANGE_AS_NOT_PERSISTENT';
      const nextIsPersistentChange = (_state$isPersistentCh = state === null || state === void 0 ? void 0 : state.isPersistentChange) !== null && _state$isPersistentCh !== void 0 ? _state$isPersistentCh : true;

      if (state.isPersistentChange === nextIsPersistentChange) {
        return state;
      }

      return { ...nextState,
        isPersistentChange: nextIsPersistentChange
      };
    }

    nextState = { ...nextState,
      isPersistentChange: isExplicitPersistentChange ? !markNextChangeAsNotPersistent : !isUpdatingSameBlockAttribute(action, lastAction)
    }; // In comparing against the previous action, consider only those which
    // would have qualified as one which would have been ignored or not
    // have resulted in a changed state.

    lastAction = action;
    markNextChangeAsNotPersistent = action.type === 'MARK_NEXT_CHANGE_AS_NOT_PERSISTENT';
    return nextState;
  };
}
/**
 * Higher-order reducer intended to augment the blocks reducer, assigning an
 * `isIgnoredChange` property value corresponding to whether a change in state
 * can be considered as ignored. A change is considered ignored when the result
 * of an action not incurred by direct user interaction.
 *
 * @param {Function} reducer Original reducer function.
 *
 * @return {Function} Enhanced reducer function.
 */


function withIgnoredBlockChange(reducer) {
  /**
   * Set of action types for which a blocks state change should be ignored.
   *
   * @type {Set}
   */
  const IGNORED_ACTION_TYPES = new Set(['RECEIVE_BLOCKS']);
  return (state, action) => {
    const nextState = reducer(state, action);

    if (nextState !== state) {
      nextState.isIgnoredChange = IGNORED_ACTION_TYPES.has(action.type);
    }

    return nextState;
  };
}
/**
 * Higher-order reducer targeting the combined blocks reducer, augmenting
 * block client IDs in remove action to include cascade of inner blocks.
 *
 * @param {Function} reducer Original reducer function.
 *
 * @return {Function} Enhanced reducer function.
 */


const withInnerBlocksRemoveCascade = reducer => (state, action) => {
  // Gets all children which need to be removed.
  const getAllChildren = clientIds => {
    let result = clientIds;

    for (let i = 0; i < result.length; i++) {
      if (!state.order[result[i]] || action.keepControlledInnerBlocks && action.keepControlledInnerBlocks[result[i]]) {
        continue;
      }

      if (result === clientIds) {
        result = [...result];
      }

      result.push(...state.order[result[i]]);
    }

    return result;
  };

  if (state) {
    switch (action.type) {
      case 'REMOVE_BLOCKS':
        action = { ...action,
          type: 'REMOVE_BLOCKS_AUGMENTED_WITH_CHILDREN',
          removedClientIds: getAllChildren(action.clientIds)
        };
        break;

      case 'REPLACE_BLOCKS':
        action = { ...action,
          type: 'REPLACE_BLOCKS_AUGMENTED_WITH_CHILDREN',
          replacedClientIds: getAllChildren(action.clientIds)
        };
        break;
    }
  }

  return reducer(state, action);
};
/**
 * Higher-order reducer which targets the combined blocks reducer and handles
 * the `RESET_BLOCKS` action. When dispatched, this action will replace all
 * blocks that exist in the post, leaving blocks that exist only in state (e.g.
 * reusable blocks and blocks controlled by inner blocks controllers) alone.
 *
 * @param {Function} reducer Original reducer function.
 *
 * @return {Function} Enhanced reducer function.
 */


const withBlockReset = reducer => (state, action) => {
  if (action.type === 'RESET_BLOCKS') {
    const newState = { ...state,
      byClientId: getFlattenedBlocksWithoutAttributes(action.blocks),
      attributes: getFlattenedBlockAttributes(action.blocks),
      order: mapBlockOrder(action.blocks),
      parents: mapBlockParents(action.blocks),
      controlledInnerBlocks: {}
    };
    const subTree = buildBlockTree(newState, action.blocks);
    newState.tree = { ...subTree,
      // Root.
      '': {
        innerBlocks: action.blocks.map(subBlock => subTree[subBlock.clientId])
      }
    };
    return newState;
  }

  return reducer(state, action);
};
/**
 * Higher-order reducer which targets the combined blocks reducer and handles
 * the `REPLACE_INNER_BLOCKS` action. When dispatched, this action the state
 * should become equivalent to the execution of a `REMOVE_BLOCKS` action
 * containing all the child's of the root block followed by the execution of
 * `INSERT_BLOCKS` with the new blocks.
 *
 * @param {Function} reducer Original reducer function.
 *
 * @return {Function} Enhanced reducer function.
 */


const withReplaceInnerBlocks = reducer => (state, action) => {
  if (action.type !== 'REPLACE_INNER_BLOCKS') {
    return reducer(state, action);
  } // Finds every nested inner block controller. We must check the action blocks
  // and not just the block parent state because some inner block controllers
  // should be deleted if specified, whereas others should not be deleted. If
  // a controlled should not be deleted, then we need to avoid deleting its
  // inner blocks from the block state because its inner blocks will not be
  // attached to the block in the action.


  const nestedControllers = {};

  if (Object.keys(state.controlledInnerBlocks).length) {
    const stack = [...action.blocks];

    while (stack.length) {
      const {
        innerBlocks,
        ...block
      } = stack.shift();
      stack.push(...innerBlocks);

      if (!!state.controlledInnerBlocks[block.clientId]) {
        nestedControllers[block.clientId] = true;
      }
    }
  } // The `keepControlledInnerBlocks` prop will keep the inner blocks of the
  // marked block in the block state so that they can be reattached to the
  // marked block when we re-insert everything a few lines below.


  let stateAfterBlocksRemoval = state;

  if (state.order[action.rootClientId]) {
    stateAfterBlocksRemoval = reducer(stateAfterBlocksRemoval, {
      type: 'REMOVE_BLOCKS',
      keepControlledInnerBlocks: nestedControllers,
      clientIds: state.order[action.rootClientId]
    });
  }

  let stateAfterInsert = stateAfterBlocksRemoval;

  if (action.blocks.length) {
    stateAfterInsert = reducer(stateAfterInsert, { ...action,
      type: 'INSERT_BLOCKS',
      index: 0
    }); // We need to re-attach the block order of the controlled inner blocks.
    // Otherwise, an inner block controller's blocks will be deleted entirely
    // from its entity..

    stateAfterInsert.order = { ...stateAfterInsert.order,
      ...(0,external_lodash_namespaceObject.reduce)(nestedControllers, (result, value, key) => {
        if (state.order[key]) {
          result[key] = state.order[key];
        }

        return result;
      }, {})
    };
  }

  return stateAfterInsert;
};
/**
 * Higher-order reducer which targets the combined blocks reducer and handles
 * the `SAVE_REUSABLE_BLOCK_SUCCESS` action. This action can't be handled by
 * regular reducers and needs a higher-order reducer since it needs access to
 * both `byClientId` and `attributes` simultaneously.
 *
 * @param {Function} reducer Original reducer function.
 *
 * @return {Function} Enhanced reducer function.
 */


const withSaveReusableBlock = reducer => (state, action) => {
  if (state && action.type === 'SAVE_REUSABLE_BLOCK_SUCCESS') {
    const {
      id,
      updatedId
    } = action; // If a temporary reusable block is saved, we swap the temporary id with the final one.

    if (id === updatedId) {
      return state;
    }

    state = { ...state
    };
    state.attributes = (0,external_lodash_namespaceObject.mapValues)(state.attributes, (attributes, clientId) => {
      const {
        name
      } = state.byClientId[clientId];

      if (name === 'core/block' && attributes.ref === id) {
        return { ...attributes,
          ref: updatedId
        };
      }

      return attributes;
    });
  }

  return reducer(state, action);
};
/**
 * Higher-order reducer which removes blocks from state when switching parent block controlled state.
 *
 * @param {Function} reducer Original reducer function.
 *
 * @return {Function} Enhanced reducer function.
 */


const withResetControlledBlocks = reducer => (state, action) => {
  if (action.type === 'SET_HAS_CONTROLLED_INNER_BLOCKS') {
    // when switching a block from controlled to uncontrolled or inverse,
    // we need to remove its content first.
    const tempState = reducer(state, {
      type: 'REPLACE_INNER_BLOCKS',
      rootClientId: action.clientId,
      blocks: []
    });
    return reducer(tempState, action);
  }

  return reducer(state, action);
};
/**
 * Reducer returning the blocks state.
 *
 * @param {Object} state  Current state.
 * @param {Object} action Dispatched action.
 *
 * @return {Object} Updated state.
 */


const blocks = (0,external_lodash_namespaceObject.flow)(external_wp_data_namespaceObject.combineReducers, withSaveReusableBlock, // Needs to be before withBlockCache.
withBlockTree, // Needs to be before withInnerBlocksRemoveCascade.
withInnerBlocksRemoveCascade, withReplaceInnerBlocks, // Needs to be after withInnerBlocksRemoveCascade.
withBlockReset, withPersistentBlockChange, withIgnoredBlockChange, withResetControlledBlocks)({
  byClientId() {
    let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
    let action = arguments.length > 1 ? arguments[1] : undefined;

    switch (action.type) {
      case 'RECEIVE_BLOCKS':
      case 'INSERT_BLOCKS':
        return { ...state,
          ...getFlattenedBlocksWithoutAttributes(action.blocks)
        };

      case 'UPDATE_BLOCK':
        // Ignore updates if block isn't known.
        if (!state[action.clientId]) {
          return state;
        } // Do nothing if only attributes change.


        const changes = (0,external_lodash_namespaceObject.omit)(action.updates, 'attributes');

        if ((0,external_lodash_namespaceObject.isEmpty)(changes)) {
          return state;
        }

        return { ...state,
          [action.clientId]: { ...state[action.clientId],
            ...changes
          }
        };

      case 'REPLACE_BLOCKS_AUGMENTED_WITH_CHILDREN':
        if (!action.blocks) {
          return state;
        }

        return { ...(0,external_lodash_namespaceObject.omit)(state, action.replacedClientIds),
          ...getFlattenedBlocksWithoutAttributes(action.blocks)
        };

      case 'REMOVE_BLOCKS_AUGMENTED_WITH_CHILDREN':
        return (0,external_lodash_namespaceObject.omit)(state, action.removedClientIds);
    }

    return state;
  },

  attributes() {
    let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
    let action = arguments.length > 1 ? arguments[1] : undefined;

    switch (action.type) {
      case 'RECEIVE_BLOCKS':
      case 'INSERT_BLOCKS':
        return { ...state,
          ...getFlattenedBlockAttributes(action.blocks)
        };

      case 'UPDATE_BLOCK':
        // Ignore updates if block isn't known or there are no attribute changes.
        if (!state[action.clientId] || !action.updates.attributes) {
          return state;
        }

        return { ...state,
          [action.clientId]: { ...state[action.clientId],
            ...action.updates.attributes
          }
        };

      case 'UPDATE_BLOCK_ATTRIBUTES':
        {
          // Avoid a state change if none of the block IDs are known.
          if (action.clientIds.every(id => !state[id])) {
            return state;
          }

          const next = action.clientIds.reduce((accumulator, id) => ({ ...accumulator,
            [id]: (0,external_lodash_namespaceObject.reduce)(action.uniqueByBlock ? action.attributes[id] : action.attributes, (result, value, key) => {
              // Consider as updates only changed values.
              if (value !== result[key]) {
                result = getMutateSafeObject(state[id], result);
                result[key] = value;
              }

              return result;
            }, state[id])
          }), {});

          if (action.clientIds.every(id => next[id] === state[id])) {
            return state;
          }

          return { ...state,
            ...next
          };
        }

      case 'REPLACE_BLOCKS_AUGMENTED_WITH_CHILDREN':
        if (!action.blocks) {
          return state;
        }

        return { ...(0,external_lodash_namespaceObject.omit)(state, action.replacedClientIds),
          ...getFlattenedBlockAttributes(action.blocks)
        };

      case 'REMOVE_BLOCKS_AUGMENTED_WITH_CHILDREN':
        return (0,external_lodash_namespaceObject.omit)(state, action.removedClientIds);
    }

    return state;
  },

  order() {
    let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
    let action = arguments.length > 1 ? arguments[1] : undefined;

    switch (action.type) {
      case 'RECEIVE_BLOCKS':
        {
          const blockOrder = mapBlockOrder(action.blocks);
          return { ...state,
            ...(0,external_lodash_namespaceObject.omit)(blockOrder, ''),
            '': ((state === null || state === void 0 ? void 0 : state['']) || []).concat(blockOrder[''])
          };
        }

      case 'INSERT_BLOCKS':
        {
          const {
            rootClientId = ''
          } = action;
          const subState = state[rootClientId] || [];
          const mappedBlocks = mapBlockOrder(action.blocks, rootClientId);
          const {
            index = subState.length
          } = action;
          return { ...state,
            ...mappedBlocks,
            [rootClientId]: insertAt(subState, mappedBlocks[rootClientId], index)
          };
        }

      case 'MOVE_BLOCKS_TO_POSITION':
        {
          const {
            fromRootClientId = '',
            toRootClientId = '',
            clientIds
          } = action;
          const {
            index = state[toRootClientId].length
          } = action; // Moving inside the same parent block.

          if (fromRootClientId === toRootClientId) {
            const subState = state[toRootClientId];
            const fromIndex = subState.indexOf(clientIds[0]);
            return { ...state,
              [toRootClientId]: moveTo(state[toRootClientId], fromIndex, index, clientIds.length)
            };
          } // Moving from a parent block to another.


          return { ...state,
            [fromRootClientId]: (0,external_lodash_namespaceObject.without)(state[fromRootClientId], ...clientIds),
            [toRootClientId]: insertAt(state[toRootClientId], clientIds, index)
          };
        }

      case 'MOVE_BLOCKS_UP':
        {
          const {
            clientIds,
            rootClientId = ''
          } = action;
          const firstClientId = (0,external_lodash_namespaceObject.first)(clientIds);
          const subState = state[rootClientId];

          if (!subState.length || firstClientId === (0,external_lodash_namespaceObject.first)(subState)) {
            return state;
          }

          const firstIndex = subState.indexOf(firstClientId);
          return { ...state,
            [rootClientId]: moveTo(subState, firstIndex, firstIndex - 1, clientIds.length)
          };
        }

      case 'MOVE_BLOCKS_DOWN':
        {
          const {
            clientIds,
            rootClientId = ''
          } = action;
          const firstClientId = (0,external_lodash_namespaceObject.first)(clientIds);
          const lastClientId = (0,external_lodash_namespaceObject.last)(clientIds);
          const subState = state[rootClientId];

          if (!subState.length || lastClientId === (0,external_lodash_namespaceObject.last)(subState)) {
            return state;
          }

          const firstIndex = subState.indexOf(firstClientId);
          return { ...state,
            [rootClientId]: moveTo(subState, firstIndex, firstIndex + 1, clientIds.length)
          };
        }

      case 'REPLACE_BLOCKS_AUGMENTED_WITH_CHILDREN':
        {
          const {
            clientIds
          } = action;

          if (!action.blocks) {
            return state;
          }

          const mappedBlocks = mapBlockOrder(action.blocks);
          return (0,external_lodash_namespaceObject.flow)([nextState => (0,external_lodash_namespaceObject.omit)(nextState, action.replacedClientIds), nextState => ({ ...nextState,
            ...(0,external_lodash_namespaceObject.omit)(mappedBlocks, '')
          }), nextState => (0,external_lodash_namespaceObject.mapValues)(nextState, subState => (0,external_lodash_namespaceObject.reduce)(subState, (result, clientId) => {
            if (clientId === clientIds[0]) {
              return [...result, ...mappedBlocks['']];
            }

            if (clientIds.indexOf(clientId) === -1) {
              result.push(clientId);
            }

            return result;
          }, []))])(state);
        }

      case 'REMOVE_BLOCKS_AUGMENTED_WITH_CHILDREN':
        return (0,external_lodash_namespaceObject.flow)([// Remove inner block ordering for removed blocks.
        nextState => (0,external_lodash_namespaceObject.omit)(nextState, action.removedClientIds), // Remove deleted blocks from other blocks' orderings.
        nextState => (0,external_lodash_namespaceObject.mapValues)(nextState, subState => (0,external_lodash_namespaceObject.without)(subState, ...action.removedClientIds))])(state);
    }

    return state;
  },

  // While technically redundant data as the inverse of `order`, it serves as
  // an optimization for the selectors which derive the ancestry of a block.
  parents() {
    let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
    let action = arguments.length > 1 ? arguments[1] : undefined;

    switch (action.type) {
      case 'RECEIVE_BLOCKS':
        return { ...state,
          ...mapBlockParents(action.blocks)
        };

      case 'INSERT_BLOCKS':
        return { ...state,
          ...mapBlockParents(action.blocks, action.rootClientId || '')
        };

      case 'MOVE_BLOCKS_TO_POSITION':
        {
          return { ...state,
            ...action.clientIds.reduce((accumulator, id) => {
              accumulator[id] = action.toRootClientId || '';
              return accumulator;
            }, {})
          };
        }

      case 'REPLACE_BLOCKS_AUGMENTED_WITH_CHILDREN':
        return { ...(0,external_lodash_namespaceObject.omit)(state, action.replacedClientIds),
          ...mapBlockParents(action.blocks, state[action.clientIds[0]])
        };

      case 'REMOVE_BLOCKS_AUGMENTED_WITH_CHILDREN':
        return (0,external_lodash_namespaceObject.omit)(state, action.removedClientIds);
    }

    return state;
  },

  controlledInnerBlocks() {
    let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
    let {
      type,
      clientId,
      hasControlledInnerBlocks
    } = arguments.length > 1 ? arguments[1] : undefined;

    if (type === 'SET_HAS_CONTROLLED_INNER_BLOCKS') {
      return { ...state,
        [clientId]: hasControlledInnerBlocks
      };
    }

    return state;
  }

});
/**
 * Reducer returning typing state.
 *
 * @param {boolean} state  Current state.
 * @param {Object}  action Dispatched action.
 *
 * @return {boolean} Updated state.
 */

function isTyping() {
  let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;
  let action = arguments.length > 1 ? arguments[1] : undefined;

  switch (action.type) {
    case 'START_TYPING':
      return true;

    case 'STOP_TYPING':
      return false;
  }

  return state;
}
/**
 * Reducer returning dragged block client id.
 *
 * @param {string[]} state  Current state.
 * @param {Object}   action Dispatched action.
 *
 * @return {string[]} Updated state.
 */

function draggedBlocks() {
  let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : [];
  let action = arguments.length > 1 ? arguments[1] : undefined;

  switch (action.type) {
    case 'START_DRAGGING_BLOCKS':
      return action.clientIds;

    case 'STOP_DRAGGING_BLOCKS':
      return [];
  }

  return state;
}
/**
 * Reducer returning whether the caret is within formatted text.
 *
 * @param {boolean} state  Current state.
 * @param {Object}  action Dispatched action.
 *
 * @return {boolean} Updated state.
 */

function isCaretWithinFormattedText() {
  let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;
  let action = arguments.length > 1 ? arguments[1] : undefined;

  switch (action.type) {
    case 'ENTER_FORMATTED_TEXT':
      return true;

    case 'EXIT_FORMATTED_TEXT':
      return false;
  }

  return state;
}
/**
 * Internal helper reducer for selectionStart and selectionEnd. Can hold a block
 * selection, represented by an object with property clientId.
 *
 * @param {Object} state  Current state.
 * @param {Object} action Dispatched action.
 *
 * @return {Object} Updated state.
 */

function selectionHelper() {
  let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  let action = arguments.length > 1 ? arguments[1] : undefined;

  switch (action.type) {
    case 'CLEAR_SELECTED_BLOCK':
      {
        if (state.clientId) {
          return {};
        }

        return state;
      }

    case 'SELECT_BLOCK':
      if (action.clientId === state.clientId) {
        return state;
      }

      return {
        clientId: action.clientId
      };

    case 'REPLACE_INNER_BLOCKS':
    case 'INSERT_BLOCKS':
      {
        if (!action.updateSelection || !action.blocks.length) {
          return state;
        }

        return {
          clientId: action.blocks[0].clientId
        };
      }

    case 'REMOVE_BLOCKS':
      if (!action.clientIds || !action.clientIds.length || action.clientIds.indexOf(state.clientId) === -1) {
        return state;
      }

      return {};

    case 'REPLACE_BLOCKS':
      {
        if (action.clientIds.indexOf(state.clientId) === -1) {
          return state;
        }

        const blockToSelect = action.blocks[action.indexToSelect] || action.blocks[action.blocks.length - 1];

        if (!blockToSelect) {
          return {};
        }

        if (blockToSelect.clientId === state.clientId) {
          return state;
        }

        return {
          clientId: blockToSelect.clientId
        };
      }
  }

  return state;
}
/**
 * Reducer returning the selection state.
 *
 * @param {boolean} state  Current state.
 * @param {Object}  action Dispatched action.
 *
 * @return {boolean} Updated state.
 */


function selection() {
  var _state$selectionStart, _state$selectionEnd, _state$selectionStart2, _state$selectionEnd2;

  let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  let action = arguments.length > 1 ? arguments[1] : undefined;

  switch (action.type) {
    case 'SELECTION_CHANGE':
      if (action.clientId) {
        return {
          selectionStart: {
            clientId: action.clientId,
            attributeKey: action.attributeKey,
            offset: action.startOffset
          },
          selectionEnd: {
            clientId: action.clientId,
            attributeKey: action.attributeKey,
            offset: action.endOffset
          }
        };
      }

      return {
        selectionStart: action.start || state.selectionStart,
        selectionEnd: action.end || state.selectionEnd
      };

    case 'RESET_SELECTION':
      const {
        selectionStart,
        selectionEnd
      } = action;
      return {
        selectionStart,
        selectionEnd
      };

    case 'MULTI_SELECT':
      const {
        start,
        end
      } = action;

      if (start === ((_state$selectionStart = state.selectionStart) === null || _state$selectionStart === void 0 ? void 0 : _state$selectionStart.clientId) && end === ((_state$selectionEnd = state.selectionEnd) === null || _state$selectionEnd === void 0 ? void 0 : _state$selectionEnd.clientId)) {
        return state;
      }

      return {
        selectionStart: {
          clientId: start
        },
        selectionEnd: {
          clientId: end
        }
      };

    case 'RESET_BLOCKS':
      const startClientId = state === null || state === void 0 ? void 0 : (_state$selectionStart2 = state.selectionStart) === null || _state$selectionStart2 === void 0 ? void 0 : _state$selectionStart2.clientId;
      const endClientId = state === null || state === void 0 ? void 0 : (_state$selectionEnd2 = state.selectionEnd) === null || _state$selectionEnd2 === void 0 ? void 0 : _state$selectionEnd2.clientId; // Do nothing if there's no selected block.

      if (!startClientId && !endClientId) {
        return state;
      } // If the start of the selection won't exist after reset, remove selection.


      if (!action.blocks.some(block => block.clientId === startClientId)) {
        return {
          selectionStart: {},
          selectionEnd: {}
        };
      } // If the end of the selection won't exist after reset, collapse selection.


      if (!action.blocks.some(block => block.clientId === endClientId)) {
        return { ...state,
          selectionEnd: state.selectionStart
        };
      }

  }

  return {
    selectionStart: selectionHelper(state.selectionStart, action),
    selectionEnd: selectionHelper(state.selectionEnd, action)
  };
}
/**
 * Reducer returning whether the user is multi-selecting.
 *
 * @param {boolean} state  Current state.
 * @param {Object}  action Dispatched action.
 *
 * @return {boolean} Updated state.
 */

function isMultiSelecting() {
  let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;
  let action = arguments.length > 1 ? arguments[1] : undefined;

  switch (action.type) {
    case 'START_MULTI_SELECT':
      return true;

    case 'STOP_MULTI_SELECT':
      return false;
  }

  return state;
}
/**
 * Reducer returning whether selection is enabled.
 *
 * @param {boolean} state  Current state.
 * @param {Object}  action Dispatched action.
 *
 * @return {boolean} Updated state.
 */

function isSelectionEnabled() {
  let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : true;
  let action = arguments.length > 1 ? arguments[1] : undefined;

  switch (action.type) {
    case 'TOGGLE_SELECTION':
      return action.isSelectionEnabled;
  }

  return state;
}
/**
 * Reducer returning the initial block selection.
 *
 * Currently this in only used to restore the selection after block deletion and
 * pasting new content.This reducer should eventually be removed in favour of setting
 * selection directly.
 *
 * @param {boolean} state  Current state.
 * @param {Object}  action Dispatched action.
 *
 * @return {number|null} Initial position: 0, -1 or null.
 */

function initialPosition() {
  let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : null;
  let action = arguments.length > 1 ? arguments[1] : undefined;

  if (action.type === 'REPLACE_BLOCKS' && action.initialPosition !== undefined) {
    return action.initialPosition;
  } else if (['MULTI_SELECT', 'SELECT_BLOCK', 'RESET_SELECTION', 'INSERT_BLOCKS', 'REPLACE_INNER_BLOCKS'].includes(action.type)) {
    return action.initialPosition;
  }

  return state;
}
function blocksMode() {
  let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  let action = arguments.length > 1 ? arguments[1] : undefined;

  if (action.type === 'TOGGLE_BLOCK_MODE') {
    const {
      clientId
    } = action;
    return { ...state,
      [clientId]: state[clientId] && state[clientId] === 'html' ? 'visual' : 'html'
    };
  }

  return state;
}
/**
 * Reducer returning the block insertion point visibility, either null if there
 * is not an explicit insertion point assigned, or an object of its `index` and
 * `rootClientId`.
 *
 * @param {Object} state  Current state.
 * @param {Object} action Dispatched action.
 *
 * @return {Object} Updated state.
 */

function insertionPoint() {
  let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : null;
  let action = arguments.length > 1 ? arguments[1] : undefined;

  switch (action.type) {
    case 'SHOW_INSERTION_POINT':
      const {
        rootClientId,
        index,
        __unstableWithInserter
      } = action;
      return {
        rootClientId,
        index,
        __unstableWithInserter
      };

    case 'HIDE_INSERTION_POINT':
      return null;
  }

  return state;
}
/**
 * Reducer returning whether the post blocks match the defined template or not.
 *
 * @param {Object} state  Current state.
 * @param {Object} action Dispatched action.
 *
 * @return {boolean} Updated state.
 */

function template() {
  let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {
    isValid: true
  };
  let action = arguments.length > 1 ? arguments[1] : undefined;

  switch (action.type) {
    case 'SET_TEMPLATE_VALIDITY':
      return { ...state,
        isValid: action.isValid
      };
  }

  return state;
}
/**
 * Reducer returning the editor setting.
 *
 * @param {Object} state  Current state.
 * @param {Object} action Dispatched action.
 *
 * @return {Object} Updated state.
 */

function settings() {
  let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : SETTINGS_DEFAULTS;
  let action = arguments.length > 1 ? arguments[1] : undefined;

  switch (action.type) {
    case 'UPDATE_SETTINGS':
      return { ...state,
        ...action.settings
      };
  }

  return state;
}
/**
 * Reducer returning the user preferences.
 *
 * @param {Object} state  Current state.
 * @param {Object} action Dispatched action.
 *
 * @return {string} Updated state.
 */

function preferences() {
  let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : PREFERENCES_DEFAULTS;
  let action = arguments.length > 1 ? arguments[1] : undefined;

  switch (action.type) {
    case 'INSERT_BLOCKS':
    case 'REPLACE_BLOCKS':
      return action.blocks.reduce((prevState, block) => {
        const {
          attributes,
          name: blockName
        } = block;
        const match = (0,external_wp_data_namespaceObject.select)(external_wp_blocks_namespaceObject.store).getActiveBlockVariation(blockName, attributes); // If a block variation match is found change the name to be the same with the
        // one that is used for block variations in the Inserter (`getItemFromVariation`).

        let id = match !== null && match !== void 0 && match.name ? `${blockName}/${match.name}` : blockName;
        const insert = {
          name: id
        };

        if (blockName === 'core/block') {
          insert.ref = attributes.ref;
          id += '/' + attributes.ref;
        }

        return { ...prevState,
          insertUsage: { ...prevState.insertUsage,
            [id]: {
              time: action.time,
              count: prevState.insertUsage[id] ? prevState.insertUsage[id].count + 1 : 1,
              insert
            }
          }
        };
      }, state);
  }

  return state;
}
/**
 * Reducer returning an object where each key is a block client ID, its value
 * representing the settings for its nested blocks.
 *
 * @param {Object} state  Current state.
 * @param {Object} action Dispatched action.
 *
 * @return {Object} Updated state.
 */

const blockListSettings = function () {
  let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  let action = arguments.length > 1 ? arguments[1] : undefined;

  switch (action.type) {
    // Even if the replaced blocks have the same client ID, our logic
    // should correct the state.
    case 'REPLACE_BLOCKS':
    case 'REMOVE_BLOCKS':
      {
        return (0,external_lodash_namespaceObject.omit)(state, action.clientIds);
      }

    case 'UPDATE_BLOCK_LIST_SETTINGS':
      {
        const {
          clientId
        } = action;

        if (!action.settings) {
          if (state.hasOwnProperty(clientId)) {
            return (0,external_lodash_namespaceObject.omit)(state, clientId);
          }

          return state;
        }

        if ((0,external_lodash_namespaceObject.isEqual)(state[clientId], action.settings)) {
          return state;
        }

        return { ...state,
          [clientId]: action.settings
        };
      }
  }

  return state;
};
/**
 * Reducer returning whether the navigation mode is enabled or not.
 *
 * @param {string} state  Current state.
 * @param {Object} action Dispatched action.
 *
 * @return {string} Updated state.
 */

function isNavigationMode() {
  let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;
  let action = arguments.length > 1 ? arguments[1] : undefined;

  // Let inserting block always trigger Edit mode.
  if (action.type === 'INSERT_BLOCKS') {
    return false;
  }

  if (action.type === 'SET_NAVIGATION_MODE') {
    return action.isNavigationMode;
  }

  return state;
}
/**
 * Reducer returning whether the block moving mode is enabled or not.
 *
 * @param {string|null} state  Current state.
 * @param {Object}      action Dispatched action.
 *
 * @return {string|null} Updated state.
 */

function hasBlockMovingClientId() {
  let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : null;
  let action = arguments.length > 1 ? arguments[1] : undefined;

  // Let inserting block always trigger Edit mode.
  if (action.type === 'SET_BLOCK_MOVING_MODE') {
    return action.hasBlockMovingClientId;
  }

  if (action.type === 'SET_NAVIGATION_MODE') {
    return null;
  }

  return state;
}
/**
 * Reducer return an updated state representing the most recent block attribute
 * update. The state is structured as an object where the keys represent the
 * client IDs of blocks, the values a subset of attributes from the most recent
 * block update. The state is always reset to null if the last action is
 * anything other than an attributes update.
 *
 * @param {Object<string,Object>} state  Current state.
 * @param {Object}                action Action object.
 *
 * @return {[string,Object]} Updated state.
 */

function lastBlockAttributesChange(state, action) {
  switch (action.type) {
    case 'UPDATE_BLOCK':
      if (!action.updates.attributes) {
        break;
      }

      return {
        [action.clientId]: action.updates.attributes
      };

    case 'UPDATE_BLOCK_ATTRIBUTES':
      return action.clientIds.reduce((accumulator, id) => ({ ...accumulator,
        [id]: action.uniqueByBlock ? action.attributes[id] : action.attributes
      }), {});
  }

  return null;
}
/**
 * Reducer returning automatic change state.
 *
 * @param {boolean} state  Current state.
 * @param {Object}  action Dispatched action.
 *
 * @return {string} Updated state.
 */

function automaticChangeStatus(state, action) {
  switch (action.type) {
    case 'MARK_AUTOMATIC_CHANGE':
      return 'pending';

    case 'MARK_AUTOMATIC_CHANGE_FINAL':
      if (state === 'pending') {
        return 'final';
      }

      return;

    case 'SELECTION_CHANGE':
      // As long as the state is not final, ignore any selection changes.
      if (state !== 'final') {
        return state;
      }

      return;
    // Undoing an automatic change should still be possible after mouse
    // move.

    case 'START_TYPING':
    case 'STOP_TYPING':
      return state;
  } // Reset the state by default (for any action not handled).

}
/**
 * Reducer returning current highlighted block.
 *
 * @param {boolean} state  Current highlighted block.
 * @param {Object}  action Dispatched action.
 *
 * @return {string} Updated state.
 */

function highlightedBlock(state, action) {
  switch (action.type) {
    case 'TOGGLE_BLOCK_HIGHLIGHT':
      const {
        clientId,
        isHighlighted
      } = action;

      if (isHighlighted) {
        return clientId;
      } else if (state === clientId) {
        return null;
      }

      return state;

    case 'SELECT_BLOCK':
      if (action.clientId !== state) {
        return null;
      }

  }

  return state;
}
/**
 * Reducer returning the block insertion event list state.
 *
 * @param {Object} state  Current state.
 * @param {Object} action Dispatched action.
 *
 * @return {Object} Updated state.
 */

function lastBlockInserted() {
  var _action$meta;

  let state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  let action = arguments.length > 1 ? arguments[1] : undefined;

  switch (action.type) {
    case 'INSERT_BLOCKS':
      if (!action.blocks.length) {
        return state;
      }

      const clientId = action.blocks[0].clientId;
      const source = (_action$meta = action.meta) === null || _action$meta === void 0 ? void 0 : _action$meta.source;
      return {
        clientId,
        source
      };

    case 'RESET_BLOCKS':
      return {};
  }

  return state;
}
/* harmony default export */ var reducer = ((0,external_wp_data_namespaceObject.combineReducers)({
  blocks,
  isTyping,
  draggedBlocks,
  isCaretWithinFormattedText,
  selection,
  isMultiSelecting,
  isSelectionEnabled,
  initialPosition,
  blocksMode,
  blockListSettings,
  insertionPoint,
  template,
  settings,
  preferences,
  lastBlockAttributesChange,
  isNavigationMode,
  hasBlockMovingClientId,
  automaticChangeStatus,
  highlightedBlock,
  lastBlockInserted
}));

;// CONCATENATED MODULE: ./node_modules/rememo/es/rememo.js


var LEAF_KEY, hasWeakMap;

/**
 * Arbitrary value used as key for referencing cache object in WeakMap tree.
 *
 * @type {Object}
 */
LEAF_KEY = {};

/**
 * Whether environment supports WeakMap.
 *
 * @type {boolean}
 */
hasWeakMap = typeof WeakMap !== 'undefined';

/**
 * Returns the first argument as the sole entry in an array.
 *
 * @param {*} value Value to return.
 *
 * @return {Array} Value returned as entry in array.
 */
function arrayOf( value ) {
	return [ value ];
}

/**
 * Returns true if the value passed is object-like, or false otherwise. A value
 * is object-like if it can support property assignment, e.g. object or array.
 *
 * @param {*} value Value to test.
 *
 * @return {boolean} Whether value is object-like.
 */
function isObjectLike( value ) {
	return !! value && 'object' === typeof value;
}

/**
 * Creates and returns a new cache object.
 *
 * @return {Object} Cache object.
 */
function createCache() {
	var cache = {
		clear: function() {
			cache.head = null;
		},
	};

	return cache;
}

/**
 * Returns true if entries within the two arrays are strictly equal by
 * reference from a starting index.
 *
 * @param {Array}  a         First array.
 * @param {Array}  b         Second array.
 * @param {number} fromIndex Index from which to start comparison.
 *
 * @return {boolean} Whether arrays are shallowly equal.
 */
function isShallowEqual( a, b, fromIndex ) {
	var i;

	if ( a.length !== b.length ) {
		return false;
	}

	for ( i = fromIndex; i < a.length; i++ ) {
		if ( a[ i ] !== b[ i ] ) {
			return false;
		}
	}

	return true;
}

/**
 * Returns a memoized selector function. The getDependants function argument is
 * called before the memoized selector and is expected to return an immutable
 * reference or array of references on which the selector depends for computing
 * its own return value. The memoize cache is preserved only as long as those
 * dependant references remain the same. If getDependants returns a different
 * reference(s), the cache is cleared and the selector value regenerated.
 *
 * @param {Function} selector      Selector function.
 * @param {Function} getDependants Dependant getter returning an immutable
 *                                 reference or array of reference used in
 *                                 cache bust consideration.
 *
 * @return {Function} Memoized selector.
 */
/* harmony default export */ function rememo(selector, getDependants ) {
	var rootCache, getCache;

	// Use object source as dependant if getter not provided
	if ( ! getDependants ) {
		getDependants = arrayOf;
	}

	/**
	 * Returns the root cache. If WeakMap is supported, this is assigned to the
	 * root WeakMap cache set, otherwise it is a shared instance of the default
	 * cache object.
	 *
	 * @return {(WeakMap|Object)} Root cache object.
	 */
	function getRootCache() {
		return rootCache;
	}

	/**
	 * Returns the cache for a given dependants array. When possible, a WeakMap
	 * will be used to create a unique cache for each set of dependants. This
	 * is feasible due to the nature of WeakMap in allowing garbage collection
	 * to occur on entries where the key object is no longer referenced. Since
	 * WeakMap requires the key to be an object, this is only possible when the
	 * dependant is object-like. The root cache is created as a hierarchy where
	 * each top-level key is the first entry in a dependants set, the value a
	 * WeakMap where each key is the next dependant, and so on. This continues
	 * so long as the dependants are object-like. If no dependants are object-
	 * like, then the cache is shared across all invocations.
	 *
	 * @see isObjectLike
	 *
	 * @param {Array} dependants Selector dependants.
	 *
	 * @return {Object} Cache object.
	 */
	function getWeakMapCache( dependants ) {
		var caches = rootCache,
			isUniqueByDependants = true,
			i, dependant, map, cache;

		for ( i = 0; i < dependants.length; i++ ) {
			dependant = dependants[ i ];

			// Can only compose WeakMap from object-like key.
			if ( ! isObjectLike( dependant ) ) {
				isUniqueByDependants = false;
				break;
			}

			// Does current segment of cache already have a WeakMap?
			if ( caches.has( dependant ) ) {
				// Traverse into nested WeakMap.
				caches = caches.get( dependant );
			} else {
				// Create, set, and traverse into a new one.
				map = new WeakMap();
				caches.set( dependant, map );
				caches = map;
			}
		}

		// We use an arbitrary (but consistent) object as key for the last item
		// in the WeakMap to serve as our running cache.
		if ( ! caches.has( LEAF_KEY ) ) {
			cache = createCache();
			cache.isUniqueByDependants = isUniqueByDependants;
			caches.set( LEAF_KEY, cache );
		}

		return caches.get( LEAF_KEY );
	}

	// Assign cache handler by availability of WeakMap
	getCache = hasWeakMap ? getWeakMapCache : getRootCache;

	/**
	 * Resets root memoization cache.
	 */
	function clear() {
		rootCache = hasWeakMap ? new WeakMap() : createCache();
	}

	// eslint-disable-next-line jsdoc/check-param-names
	/**
	 * The augmented selector call, considering first whether dependants have
	 * changed before passing it to underlying memoize function.
	 *
	 * @param {Object} source    Source object for derivation.
	 * @param {...*}   extraArgs Additional arguments to pass to selector.
	 *
	 * @return {*} Selector result.
	 */
	function callSelector( /* source, ...extraArgs */ ) {
		var len = arguments.length,
			cache, node, i, args, dependants;

		// Create copy of arguments (avoid leaking deoptimization).
		args = new Array( len );
		for ( i = 0; i < len; i++ ) {
			args[ i ] = arguments[ i ];
		}

		dependants = getDependants.apply( null, args );
		cache = getCache( dependants );

		// If not guaranteed uniqueness by dependants (primitive type or lack
		// of WeakMap support), shallow compare against last dependants and, if
		// references have changed, destroy cache to recalculate result.
		if ( ! cache.isUniqueByDependants ) {
			if ( cache.lastDependants && ! isShallowEqual( dependants, cache.lastDependants, 0 ) ) {
				cache.clear();
			}

			cache.lastDependants = dependants;
		}

		node = cache.head;
		while ( node ) {
			// Check whether node arguments match arguments
			if ( ! isShallowEqual( node.args, args, 1 ) ) {
				node = node.next;
				continue;
			}

			// At this point we can assume we've found a match

			// Surface matched node to head if not already
			if ( node !== cache.head ) {
				// Adjust siblings to point to each other.
				node.prev.next = node.next;
				if ( node.next ) {
					node.next.prev = node.prev;
				}

				node.next = cache.head;
				node.prev = null;
				cache.head.prev = node;
				cache.head = node;
			}

			// Return immediately
			return node.val;
		}

		// No cached value found. Continue to insertion phase:

		node = {
			// Generate the result from original function
			val: selector.apply( null, args ),
		};

		// Avoid including the source object in the cache.
		args[ 0 ] = null;
		node.args = args;

		// Don't need to check whether node is already head, since it would
		// have been returned above already if it was

		// Shift existing head down list
		if ( cache.head ) {
			cache.head.prev = node;
			node.next = cache.head;
		}

		cache.head = node;

		return node.val;
	}

	callSelector.getDependants = getDependants;
	callSelector.clear = clear;
	clear();

	return callSelector;
}

;// CONCATENATED MODULE: external ["wp","primitives"]
var external_wp_primitives_namespaceObject = window["wp"]["primitives"];
;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/symbol.js


/**
 * WordPress dependencies
 */

const symbol = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M21.3 10.8l-5.6-5.6c-.7-.7-1.8-.7-2.5 0l-5.6 5.6c-.7.7-.7 1.8 0 2.5l5.6 5.6c.3.3.8.5 1.2.5s.9-.2 1.2-.5l5.6-5.6c.8-.7.8-1.9.1-2.5zm-1 1.4l-5.6 5.6c-.1.1-.3.1-.4 0l-5.6-5.6c-.1-.1-.1-.3 0-.4l5.6-5.6s.1-.1.2-.1.1 0 .2.1l5.6 5.6c.1.1.1.3 0 .4zm-16.6-.4L10 5.5l-1-1-6.3 6.3c-.7.7-.7 1.8 0 2.5L9 19.5l1.1-1.1-6.3-6.3c-.2 0-.2-.2-.1-.3z"
}));
/* harmony default export */ var library_symbol = (symbol);

;// CONCATENATED MODULE: external ["wp","richText"]
var external_wp_richText_namespaceObject = window["wp"]["richText"];
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/store/utils.js
/**
 * Helper function that maps attribute definition properties to the
 * ones used by RichText utils like `create, toHTMLString, etc..`.
 *
 * @param {Object} attributeDefinition A block's attribute definition object.
 * @return {Object} The mapped object.
 */
function mapRichTextSettings(attributeDefinition) {
  const {
    multiline: multilineTag,
    __unstableMultilineWrapperTags: multilineWrapperTags,
    __unstablePreserveWhiteSpace: preserveWhiteSpace
  } = attributeDefinition;
  return {
    multilineTag,
    multilineWrapperTags,
    preserveWhiteSpace
  };
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/store/selectors.js
/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */







/**
 * Internal dependencies
 */


/**
 * A block selection object.
 *
 * @typedef {Object} WPBlockSelection
 *
 * @property {string} clientId     A block client ID.
 * @property {string} attributeKey A block attribute key.
 * @property {number} offset       An attribute value offset, based on the rich
 *                                 text value. See `wp.richText.create`.
 */
// Module constants.

const MILLISECONDS_PER_HOUR = 3600 * 1000;
const MILLISECONDS_PER_DAY = 24 * 3600 * 1000;
const MILLISECONDS_PER_WEEK = 7 * 24 * 3600 * 1000;
/**
 * Shared reference to an empty array for cases where it is important to avoid
 * returning a new array reference on every invocation, as in a connected or
 * other pure component which performs `shouldComponentUpdate` check on props.
 * This should be used as a last resort, since the normalized data should be
 * maintained by the reducer result in state.
 *
 * @type {Array}
 */

const EMPTY_ARRAY = [];
/**
 * Returns a block's name given its client ID, or null if no block exists with
 * the client ID.
 *
 * @param {Object} state    Editor state.
 * @param {string} clientId Block client ID.
 *
 * @return {string} Block name.
 */

function getBlockName(state, clientId) {
  const block = state.blocks.byClientId[clientId];
  const socialLinkName = 'core/social-link';

  if (external_wp_element_namespaceObject.Platform.OS !== 'web' && (block === null || block === void 0 ? void 0 : block.name) === socialLinkName) {
    const attributes = state.blocks.attributes[clientId];
    const {
      service
    } = attributes;
    return service ? `${socialLinkName}-${service}` : socialLinkName;
  }

  return block ? block.name : null;
}
/**
 * Returns whether a block is valid or not.
 *
 * @param {Object} state    Editor state.
 * @param {string} clientId Block client ID.
 *
 * @return {boolean} Is Valid.
 */

function isBlockValid(state, clientId) {
  const block = state.blocks.byClientId[clientId];
  return !!block && block.isValid;
}
/**
 * Returns a block's attributes given its client ID, or null if no block exists with
 * the client ID.
 *
 * @param {Object} state    Editor state.
 * @param {string} clientId Block client ID.
 *
 * @return {Object?} Block attributes.
 */

function getBlockAttributes(state, clientId) {
  const block = state.blocks.byClientId[clientId];

  if (!block) {
    return null;
  }

  return state.blocks.attributes[clientId];
}
/**
 * Returns a block given its client ID. This is a parsed copy of the block,
 * containing its `blockName`, `clientId`, and current `attributes` state. This
 * is not the block's registration settings, which must be retrieved from the
 * blocks module registration store.
 *
 * getBlock recurses through its inner blocks until all its children blocks have
 * been retrieved. Note that getBlock will not return the child inner blocks of
 * an inner block controller. This is because an inner block controller syncs
 * itself with its own entity, and should therefore not be included with the
 * blocks of a different entity. For example, say you call `getBlocks( TP )` to
 * get the blocks of a template part. If another template part is a child of TP,
 * then the nested template part's child blocks will not be returned. This way,
 * the template block itself is considered part of the parent, but the children
 * are not.
 *
 * @param {Object} state    Editor state.
 * @param {string} clientId Block client ID.
 *
 * @return {Object} Parsed block object.
 */

function getBlock(state, clientId) {
  const block = state.blocks.byClientId[clientId];

  if (!block) {
    return null;
  }

  return state.blocks.tree[clientId];
}
const __unstableGetBlockWithoutInnerBlocks = rememo((state, clientId) => {
  const block = state.blocks.byClientId[clientId];

  if (!block) {
    return null;
  }

  return { ...block,
    attributes: getBlockAttributes(state, clientId)
  };
}, (state, clientId) => [state.blocks.byClientId[clientId], state.blocks.attributes[clientId]]);
/**
 * Returns all block objects for the current post being edited as an array in
 * the order they appear in the post. Note that this will exclude child blocks
 * of nested inner block controllers.
 *
 * @param {Object}  state        Editor state.
 * @param {?string} rootClientId Optional root client ID of block list.
 *
 * @return {Object[]} Post blocks.
 */

function getBlocks(state, rootClientId) {
  var _state$blocks$tree$tr;

  const treeKey = !rootClientId || !areInnerBlocksControlled(state, rootClientId) ? rootClientId || '' : 'controlled||' + rootClientId;
  return ((_state$blocks$tree$tr = state.blocks.tree[treeKey]) === null || _state$blocks$tree$tr === void 0 ? void 0 : _state$blocks$tree$tr.innerBlocks) || EMPTY_ARRAY;
}
/**
 * Returns a stripped down block object containing only its client ID,
 * and its inner blocks' client IDs.
 *
 * @param {Object} state    Editor state.
 * @param {string} clientId Client ID of the block to get.
 *
 * @return {Object} Client IDs of the post blocks.
 */

const __unstableGetClientIdWithClientIdsTree = rememo((state, clientId) => ({
  clientId,
  innerBlocks: __unstableGetClientIdsTree(state, clientId)
}), state => [state.blocks.order]);
/**
 * Returns the block tree represented in the block-editor store from the
 * given root, consisting of stripped down block objects containing only
 * their client IDs, and their inner blocks' client IDs.
 *
 * @param {Object}  state        Editor state.
 * @param {?string} rootClientId Optional root client ID of block list.
 *
 * @return {Object[]} Client IDs of the post blocks.
 */

const __unstableGetClientIdsTree = rememo(function (state) {
  let rootClientId = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : '';
  return (0,external_lodash_namespaceObject.map)(getBlockOrder(state, rootClientId), clientId => __unstableGetClientIdWithClientIdsTree(state, clientId));
}, state => [state.blocks.order]);
/**
 * Returns an array containing the clientIds of all descendants of the blocks
 * given. Returned ids are ordered first by the order of the ids given, then
 * by the order that they appear in the editor.
 *
 * @param {Object} state     Global application state.
 * @param {Array}  clientIds Array of blocks to inspect.
 *
 * @return {Array} ids of descendants.
 */

const getClientIdsOfDescendants = rememo((state, clientIds) => {
  const collectedIds = [];

  for (const givenId of clientIds) {
    for (const descendantId of getBlockOrder(state, givenId)) {
      collectedIds.push(descendantId, ...getClientIdsOfDescendants(state, [descendantId]));
    }
  }

  return collectedIds;
}, state => [state.blocks.order]);
/**
 * Returns an array containing the clientIds of the top-level blocks and
 * their descendants of any depth (for nested blocks). Ids are returned
 * in the same order that they appear in the editor.
 *
 * @param {Object} state Global application state.
 *
 * @return {Array} ids of top-level and descendant blocks.
 */

const getClientIdsWithDescendants = rememo(state => {
  const collectedIds = [];

  for (const topLevelId of getBlockOrder(state)) {
    collectedIds.push(topLevelId, ...getClientIdsOfDescendants(state, [topLevelId]));
  }

  return collectedIds;
}, state => [state.blocks.order]);
/**
 * Returns the total number of blocks, or the total number of blocks with a specific name in a post.
 * The number returned includes nested blocks.
 *
 * @param {Object}  state     Global application state.
 * @param {?string} blockName Optional block name, if specified only blocks of that type will be counted.
 *
 * @return {number} Number of blocks in the post, or number of blocks with name equal to blockName.
 */

const getGlobalBlockCount = rememo((state, blockName) => {
  const clientIds = getClientIdsWithDescendants(state);

  if (!blockName) {
    return clientIds.length;
  }

  return (0,external_lodash_namespaceObject.reduce)(clientIds, (accumulator, clientId) => {
    const block = state.blocks.byClientId[clientId];
    return block.name === blockName ? accumulator + 1 : accumulator;
  }, 0);
}, state => [state.blocks.order, state.blocks.byClientId]);
/**
 * Returns all global blocks that match a blockName. Results include nested blocks.
 *
 * @param {Object}  state     Global application state.
 * @param {?string} blockName Optional block name, if not specified, returns an empty array.
 *
 * @return {Array} Array of clientIds of blocks with name equal to blockName.
 */

const __experimentalGetGlobalBlocksByName = rememo((state, blockName) => {
  if (!blockName) {
    return EMPTY_ARRAY;
  }

  const clientIds = getClientIdsWithDescendants(state);
  const foundBlocks = clientIds.filter(clientId => {
    const block = state.blocks.byClientId[clientId];
    return block.name === blockName;
  });
  return foundBlocks.length > 0 ? foundBlocks : EMPTY_ARRAY;
}, state => [state.blocks.order, state.blocks.byClientId]);
/**
 * Given an array of block client IDs, returns the corresponding array of block
 * objects.
 *
 * @param {Object}   state     Editor state.
 * @param {string[]} clientIds Client IDs for which blocks are to be returned.
 *
 * @return {WPBlock[]} Block objects.
 */

const getBlocksByClientId = rememo((state, clientIds) => (0,external_lodash_namespaceObject.map)((0,external_lodash_namespaceObject.castArray)(clientIds), clientId => getBlock(state, clientId)), (state, clientIds) => (0,external_lodash_namespaceObject.map)((0,external_lodash_namespaceObject.castArray)(clientIds), clientId => state.blocks.tree[clientId]));
/**
 * Returns the number of blocks currently present in the post.
 *
 * @param {Object}  state        Editor state.
 * @param {?string} rootClientId Optional root client ID of block list.
 *
 * @return {number} Number of blocks in the post.
 */

function getBlockCount(state, rootClientId) {
  return getBlockOrder(state, rootClientId).length;
}
/**
 * Returns the current selection start block client ID, attribute key and text
 * offset.
 *
 * @param {Object} state Block editor state.
 *
 * @return {WPBlockSelection} Selection start information.
 */

function getSelectionStart(state) {
  return state.selection.selectionStart;
}
/**
 * Returns the current selection end block client ID, attribute key and text
 * offset.
 *
 * @param {Object} state Block editor state.
 *
 * @return {WPBlockSelection} Selection end information.
 */

function getSelectionEnd(state) {
  return state.selection.selectionEnd;
}
/**
 * Returns the current block selection start. This value may be null, and it
 * may represent either a singular block selection or multi-selection start.
 * A selection is singular if its start and end match.
 *
 * @param {Object} state Global application state.
 *
 * @return {?string} Client ID of block selection start.
 */

function getBlockSelectionStart(state) {
  return state.selection.selectionStart.clientId;
}
/**
 * Returns the current block selection end. This value may be null, and it
 * may represent either a singular block selection or multi-selection end.
 * A selection is singular if its start and end match.
 *
 * @param {Object} state Global application state.
 *
 * @return {?string} Client ID of block selection end.
 */

function getBlockSelectionEnd(state) {
  return state.selection.selectionEnd.clientId;
}
/**
 * Returns the number of blocks currently selected in the post.
 *
 * @param {Object} state Global application state.
 *
 * @return {number} Number of blocks selected in the post.
 */

function getSelectedBlockCount(state) {
  const multiSelectedBlockCount = getMultiSelectedBlockClientIds(state).length;

  if (multiSelectedBlockCount) {
    return multiSelectedBlockCount;
  }

  return state.selection.selectionStart.clientId ? 1 : 0;
}
/**
 * Returns true if there is a single selected block, or false otherwise.
 *
 * @param {Object} state Editor state.
 *
 * @return {boolean} Whether a single block is selected.
 */

function hasSelectedBlock(state) {
  const {
    selectionStart,
    selectionEnd
  } = state.selection;
  return !!selectionStart.clientId && selectionStart.clientId === selectionEnd.clientId;
}
/**
 * Returns the currently selected block client ID, or null if there is no
 * selected block.
 *
 * @param {Object} state Editor state.
 *
 * @return {?string} Selected block client ID.
 */

function getSelectedBlockClientId(state) {
  const {
    selectionStart,
    selectionEnd
  } = state.selection;
  const {
    clientId
  } = selectionStart;

  if (!clientId || clientId !== selectionEnd.clientId) {
    return null;
  }

  return clientId;
}
/**
 * Returns the currently selected block, or null if there is no selected block.
 *
 * @param {Object} state Global application state.
 *
 * @return {?Object} Selected block.
 */

function getSelectedBlock(state) {
  const clientId = getSelectedBlockClientId(state);
  return clientId ? getBlock(state, clientId) : null;
}
/**
 * Given a block client ID, returns the root block from which the block is
 * nested, an empty string for top-level blocks, or null if the block does not
 * exist.
 *
 * @param {Object} state    Editor state.
 * @param {string} clientId Block from which to find root client ID.
 *
 * @return {?string} Root client ID, if exists
 */

function getBlockRootClientId(state, clientId) {
  return state.blocks.parents[clientId] !== undefined ? state.blocks.parents[clientId] : null;
}
/**
 * Given a block client ID, returns the list of all its parents from top to bottom.
 *
 * @param {Object}  state     Editor state.
 * @param {string}  clientId  Block from which to find root client ID.
 * @param {boolean} ascending Order results from bottom to top (true) or top to bottom (false).
 *
 * @return {Array} ClientIDs of the parent blocks.
 */

const getBlockParents = rememo(function (state, clientId) {
  let ascending = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false;
  const parents = [];
  let current = clientId;

  while (!!state.blocks.parents[current]) {
    current = state.blocks.parents[current];
    parents.push(current);
  }

  return ascending ? parents : parents.reverse();
}, state => [state.blocks.parents]);
/**
 * Given a block client ID and a block name, returns the list of all its parents
 * from top to bottom, filtered by the given name(s). For example, if passed
 * 'core/group' as the blockName, it will only return parents which are group
 * blocks. If passed `[ 'core/group', 'core/cover']`, as the blockName, it will
 * return parents which are group blocks and parents which are cover blocks.
 *
 * @param {Object}          state     Editor state.
 * @param {string}          clientId  Block from which to find root client ID.
 * @param {string|string[]} blockName Block name(s) to filter.
 * @param {boolean}         ascending Order results from bottom to top (true) or top to bottom (false).
 *
 * @return {Array} ClientIDs of the parent blocks.
 */

const getBlockParentsByBlockName = rememo(function (state, clientId, blockName) {
  let ascending = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : false;
  const parents = getBlockParents(state, clientId, ascending);
  return (0,external_lodash_namespaceObject.map)((0,external_lodash_namespaceObject.filter)((0,external_lodash_namespaceObject.map)(parents, id => ({
    id,
    name: getBlockName(state, id)
  })), _ref => {
    let {
      name
    } = _ref;

    if (Array.isArray(blockName)) {
      return blockName.includes(name);
    }

    return name === blockName;
  }), _ref2 => {
    let {
      id
    } = _ref2;
    return id;
  });
}, state => [state.blocks.parents]);
/**
 * Given a block client ID, returns the root of the hierarchy from which the block is nested, return the block itself for root level blocks.
 *
 * @param {Object} state    Editor state.
 * @param {string} clientId Block from which to find root client ID.
 *
 * @return {string} Root client ID
 */

function getBlockHierarchyRootClientId(state, clientId) {
  let current = clientId;
  let parent;

  do {
    parent = current;
    current = state.blocks.parents[current];
  } while (current);

  return parent;
}
/**
 * Given a block client ID, returns the lowest common ancestor with selected client ID.
 *
 * @param {Object} state    Editor state.
 * @param {string} clientId Block from which to find common ancestor client ID.
 *
 * @return {string} Common ancestor client ID or undefined
 */

function getLowestCommonAncestorWithSelectedBlock(state, clientId) {
  const selectedId = getSelectedBlockClientId(state);
  const clientParents = [...getBlockParents(state, clientId), clientId];
  const selectedParents = [...getBlockParents(state, selectedId), selectedId];
  let lowestCommonAncestor;
  const maxDepth = Math.min(clientParents.length, selectedParents.length);

  for (let index = 0; index < maxDepth; index++) {
    if (clientParents[index] === selectedParents[index]) {
      lowestCommonAncestor = clientParents[index];
    } else {
      break;
    }
  }

  return lowestCommonAncestor;
}
/**
 * Returns the client ID of the block adjacent one at the given reference
 * startClientId and modifier directionality. Defaults start startClientId to
 * the selected block, and direction as next block. Returns null if there is no
 * adjacent block.
 *
 * @param {Object}  state         Editor state.
 * @param {?string} startClientId Optional client ID of block from which to
 *                                search.
 * @param {?number} modifier      Directionality multiplier (1 next, -1
 *                                previous).
 *
 * @return {?string} Return the client ID of the block, or null if none exists.
 */

function getAdjacentBlockClientId(state, startClientId) {
  let modifier = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : 1;

  // Default to selected block.
  if (startClientId === undefined) {
    startClientId = getSelectedBlockClientId(state);
  } // Try multi-selection starting at extent based on modifier.


  if (startClientId === undefined) {
    if (modifier < 0) {
      startClientId = getFirstMultiSelectedBlockClientId(state);
    } else {
      startClientId = getLastMultiSelectedBlockClientId(state);
    }
  } // Validate working start client ID.


  if (!startClientId) {
    return null;
  } // Retrieve start block root client ID, being careful to allow the falsey
  // empty string top-level root by explicitly testing against null.


  const rootClientId = getBlockRootClientId(state, startClientId);

  if (rootClientId === null) {
    return null;
  }

  const {
    order
  } = state.blocks;
  const orderSet = order[rootClientId];
  const index = orderSet.indexOf(startClientId);
  const nextIndex = index + 1 * modifier; // Block was first in set and we're attempting to get previous.

  if (nextIndex < 0) {
    return null;
  } // Block was last in set and we're attempting to get next.


  if (nextIndex === orderSet.length) {
    return null;
  } // Assume incremented index is within the set.


  return orderSet[nextIndex];
}
/**
 * Returns the previous block's client ID from the given reference start ID.
 * Defaults start to the selected block. Returns null if there is no previous
 * block.
 *
 * @param {Object}  state         Editor state.
 * @param {?string} startClientId Optional client ID of block from which to
 *                                search.
 *
 * @return {?string} Adjacent block's client ID, or null if none exists.
 */

function getPreviousBlockClientId(state, startClientId) {
  return getAdjacentBlockClientId(state, startClientId, -1);
}
/**
 * Returns the next block's client ID from the given reference start ID.
 * Defaults start to the selected block. Returns null if there is no next
 * block.
 *
 * @param {Object}  state         Editor state.
 * @param {?string} startClientId Optional client ID of block from which to
 *                                search.
 *
 * @return {?string} Adjacent block's client ID, or null if none exists.
 */

function getNextBlockClientId(state, startClientId) {
  return getAdjacentBlockClientId(state, startClientId, 1);
}
/* eslint-disable jsdoc/valid-types */

/**
 * Returns the initial caret position for the selected block.
 * This position is to used to position the caret properly when the selected block changes.
 * If the current block is not a RichText, having initial position set to 0 means "focus block"
 *
 * @param {Object} state Global application state.
 *
 * @return {0|-1|null} Initial position.
 */

function getSelectedBlocksInitialCaretPosition(state) {
  /* eslint-enable jsdoc/valid-types */
  return state.initialPosition;
}
/**
 * Returns the current selection set of block client IDs (multiselection or single selection).
 *
 * @param {Object} state Editor state.
 *
 * @return {Array} Multi-selected block client IDs.
 */

const getSelectedBlockClientIds = rememo(state => {
  const {
    selectionStart,
    selectionEnd
  } = state.selection;

  if (selectionStart.clientId === undefined || selectionEnd.clientId === undefined) {
    return EMPTY_ARRAY;
  }

  if (selectionStart.clientId === selectionEnd.clientId) {
    return [selectionStart.clientId];
  } // Retrieve root client ID to aid in retrieving relevant nested block
  // order, being careful to allow the falsey empty string top-level root
  // by explicitly testing against null.


  const rootClientId = getBlockRootClientId(state, selectionStart.clientId);

  if (rootClientId === null) {
    return EMPTY_ARRAY;
  }

  const blockOrder = getBlockOrder(state, rootClientId);
  const startIndex = blockOrder.indexOf(selectionStart.clientId);
  const endIndex = blockOrder.indexOf(selectionEnd.clientId);

  if (startIndex > endIndex) {
    return blockOrder.slice(endIndex, startIndex + 1);
  }

  return blockOrder.slice(startIndex, endIndex + 1);
}, state => [state.blocks.order, state.selection.selectionStart.clientId, state.selection.selectionEnd.clientId]);
/**
 * Returns the current multi-selection set of block client IDs, or an empty
 * array if there is no multi-selection.
 *
 * @param {Object} state Editor state.
 *
 * @return {Array} Multi-selected block client IDs.
 */

function getMultiSelectedBlockClientIds(state) {
  const {
    selectionStart,
    selectionEnd
  } = state.selection;

  if (selectionStart.clientId === selectionEnd.clientId) {
    return EMPTY_ARRAY;
  }

  return getSelectedBlockClientIds(state);
}
/**
 * Returns the current multi-selection set of blocks, or an empty array if
 * there is no multi-selection.
 *
 * @param {Object} state Editor state.
 *
 * @return {Array} Multi-selected block objects.
 */

const getMultiSelectedBlocks = rememo(state => {
  const multiSelectedBlockClientIds = getMultiSelectedBlockClientIds(state);

  if (!multiSelectedBlockClientIds.length) {
    return EMPTY_ARRAY;
  }

  return multiSelectedBlockClientIds.map(clientId => getBlock(state, clientId));
}, state => [...getSelectedBlockClientIds.getDependants(state), state.blocks.byClientId, state.blocks.order, state.blocks.attributes]);
/**
 * Returns the client ID of the first block in the multi-selection set, or null
 * if there is no multi-selection.
 *
 * @param {Object} state Editor state.
 *
 * @return {?string} First block client ID in the multi-selection set.
 */

function getFirstMultiSelectedBlockClientId(state) {
  return (0,external_lodash_namespaceObject.first)(getMultiSelectedBlockClientIds(state)) || null;
}
/**
 * Returns the client ID of the last block in the multi-selection set, or null
 * if there is no multi-selection.
 *
 * @param {Object} state Editor state.
 *
 * @return {?string} Last block client ID in the multi-selection set.
 */

function getLastMultiSelectedBlockClientId(state) {
  return (0,external_lodash_namespaceObject.last)(getMultiSelectedBlockClientIds(state)) || null;
}
/**
 * Returns true if a multi-selection exists, and the block corresponding to the
 * specified client ID is the first block of the multi-selection set, or false
 * otherwise.
 *
 * @param {Object} state    Editor state.
 * @param {string} clientId Block client ID.
 *
 * @return {boolean} Whether block is first in multi-selection.
 */

function isFirstMultiSelectedBlock(state, clientId) {
  return getFirstMultiSelectedBlockClientId(state) === clientId;
}
/**
 * Returns true if the client ID occurs within the block multi-selection, or
 * false otherwise.
 *
 * @param {Object} state    Editor state.
 * @param {string} clientId Block client ID.
 *
 * @return {boolean} Whether block is in multi-selection set.
 */

function isBlockMultiSelected(state, clientId) {
  return getMultiSelectedBlockClientIds(state).indexOf(clientId) !== -1;
}
/**
 * Returns true if an ancestor of the block is multi-selected, or false
 * otherwise.
 *
 * @param {Object} state    Editor state.
 * @param {string} clientId Block client ID.
 *
 * @return {boolean} Whether an ancestor of the block is in multi-selection
 *                   set.
 */

const isAncestorMultiSelected = rememo((state, clientId) => {
  let ancestorClientId = clientId;
  let isMultiSelected = false;

  while (ancestorClientId && !isMultiSelected) {
    ancestorClientId = getBlockRootClientId(state, ancestorClientId);
    isMultiSelected = isBlockMultiSelected(state, ancestorClientId);
  }

  return isMultiSelected;
}, state => [state.blocks.order, state.selection.selectionStart.clientId, state.selection.selectionEnd.clientId]);
/**
 * Returns the client ID of the block which begins the multi-selection set, or
 * null if there is no multi-selection.
 *
 * This is not necessarily the first client ID in the selection.
 *
 * @see getFirstMultiSelectedBlockClientId
 *
 * @param {Object} state Editor state.
 *
 * @return {?string} Client ID of block beginning multi-selection.
 */

function getMultiSelectedBlocksStartClientId(state) {
  const {
    selectionStart,
    selectionEnd
  } = state.selection;

  if (selectionStart.clientId === selectionEnd.clientId) {
    return null;
  }

  return selectionStart.clientId || null;
}
/**
 * Returns the client ID of the block which ends the multi-selection set, or
 * null if there is no multi-selection.
 *
 * This is not necessarily the last client ID in the selection.
 *
 * @see getLastMultiSelectedBlockClientId
 *
 * @param {Object} state Editor state.
 *
 * @return {?string} Client ID of block ending multi-selection.
 */

function getMultiSelectedBlocksEndClientId(state) {
  const {
    selectionStart,
    selectionEnd
  } = state.selection;

  if (selectionStart.clientId === selectionEnd.clientId) {
    return null;
  }

  return selectionEnd.clientId || null;
}
/**
 * Returns true if the selection is not partial.
 *
 * @param {Object} state Editor state.
 *
 * @return {boolean} Whether the selection is mergeable.
 */

function __unstableIsFullySelected(state) {
  const selectionAnchor = getSelectionStart(state);
  const selectionFocus = getSelectionEnd(state);
  return !selectionAnchor.attributeKey && !selectionFocus.attributeKey && typeof selectionAnchor.offset === 'undefined' && typeof selectionFocus.offset === 'undefined';
}
/**
 * Returns true if the selection is collapsed.
 *
 * @param {Object} state Editor state.
 *
 * @return {boolean} Whether the selection is collapsed.
 */

function __unstableIsSelectionCollapsed(state) {
  const selectionAnchor = getSelectionStart(state);
  const selectionFocus = getSelectionEnd(state);
  return !!selectionAnchor && !!selectionFocus && selectionAnchor.clientId === selectionFocus.clientId && selectionAnchor.attributeKey === selectionFocus.attributeKey && selectionAnchor.offset === selectionFocus.offset;
}
/**
 * Check whether the selection is mergeable.
 *
 * @param {Object}  state     Editor state.
 * @param {boolean} isForward Whether to merge forwards.
 *
 * @return {boolean} Whether the selection is mergeable.
 */

function __unstableIsSelectionMergeable(state, isForward) {
  const selectionAnchor = getSelectionStart(state);
  const selectionFocus = getSelectionEnd(state); // It's not mergeable if the start and end are within the same block.

  if (selectionAnchor.clientId === selectionFocus.clientId) return false; // It's not mergeable if there's no rich text selection.

  if (!selectionAnchor.attributeKey || !selectionFocus.attributeKey || typeof selectionAnchor.offset === 'undefined' || typeof selectionFocus.offset === 'undefined') return false;
  const anchorRootClientId = getBlockRootClientId(state, selectionAnchor.clientId);
  const focusRootClientId = getBlockRootClientId(state, selectionFocus.clientId); // It's not mergeable if the selection doesn't start and end in the same
  // block list. Maybe in the future it should be allowed.

  if (anchorRootClientId !== focusRootClientId) {
    return false;
  }

  const blockOrder = getBlockOrder(state, anchorRootClientId);
  const anchorIndex = blockOrder.indexOf(selectionAnchor.clientId);
  const focusIndex = blockOrder.indexOf(selectionFocus.clientId); // Reassign selection start and end based on order.

  let selectionStart, selectionEnd;

  if (anchorIndex > focusIndex) {
    selectionStart = selectionFocus;
    selectionEnd = selectionAnchor;
  } else {
    selectionStart = selectionAnchor;
    selectionEnd = selectionFocus;
  }

  const targetBlockClientId = isForward ? selectionEnd.clientId : selectionStart.clientId;
  const blockToMergeClientId = isForward ? selectionStart.clientId : selectionEnd.clientId;
  const targetBlock = getBlock(state, targetBlockClientId);
  const targetBlockType = (0,external_wp_blocks_namespaceObject.getBlockType)(targetBlock.name);
  if (!targetBlockType.merge) return false;
  const blockToMerge = getBlock(state, blockToMergeClientId); // It's mergeable if the blocks are of the same type.

  if (blockToMerge.name === targetBlock.name) return true; // If the blocks are of a different type, try to transform the block being
  // merged into the same type of block.

  const blocksToMerge = (0,external_wp_blocks_namespaceObject.switchToBlockType)(blockToMerge, targetBlock.name);
  return blocksToMerge && blocksToMerge.length;
}
/**
 * Get partial selected blocks with their content updated
 * based on the selection.
 *
 * @param {Object} state Editor state.
 *
 * @return {Object[]} Updated partial selected blocks.
 */

const __unstableGetSelectedBlocksWithPartialSelection = state => {
  const selectionAnchor = getSelectionStart(state);
  const selectionFocus = getSelectionEnd(state);

  if (selectionAnchor.clientId === selectionFocus.clientId) {
    return EMPTY_ARRAY;
  } // Can't split if the selection is not set.


  if (!selectionAnchor.attributeKey || !selectionFocus.attributeKey || typeof selectionAnchor.offset === 'undefined' || typeof selectionFocus.offset === 'undefined') {
    return EMPTY_ARRAY;
  }

  const anchorRootClientId = getBlockRootClientId(state, selectionAnchor.clientId);
  const focusRootClientId = getBlockRootClientId(state, selectionFocus.clientId); // It's not splittable if the selection doesn't start and end in the same
  // block list. Maybe in the future it should be allowed.

  if (anchorRootClientId !== focusRootClientId) {
    return EMPTY_ARRAY;
  }

  const blockOrder = getBlockOrder(state, anchorRootClientId);
  const anchorIndex = blockOrder.indexOf(selectionAnchor.clientId);
  const focusIndex = blockOrder.indexOf(selectionFocus.clientId); // Reassign selection start and end based on order.

  const [selectionStart, selectionEnd] = anchorIndex > focusIndex ? [selectionFocus, selectionAnchor] : [selectionAnchor, selectionFocus];
  const blockA = getBlock(state, selectionStart.clientId);
  const blockAType = (0,external_wp_blocks_namespaceObject.getBlockType)(blockA.name);
  const blockB = getBlock(state, selectionEnd.clientId);
  const blockBType = (0,external_wp_blocks_namespaceObject.getBlockType)(blockB.name);
  const htmlA = blockA.attributes[selectionStart.attributeKey];
  const htmlB = blockB.attributes[selectionEnd.attributeKey];
  const attributeDefinitionA = blockAType.attributes[selectionStart.attributeKey];
  const attributeDefinitionB = blockBType.attributes[selectionEnd.attributeKey];
  let valueA = (0,external_wp_richText_namespaceObject.create)({
    html: htmlA,
    ...mapRichTextSettings(attributeDefinitionA)
  });
  let valueB = (0,external_wp_richText_namespaceObject.create)({
    html: htmlB,
    ...mapRichTextSettings(attributeDefinitionB)
  });
  valueA = (0,external_wp_richText_namespaceObject.remove)(valueA, 0, selectionStart.offset);
  valueB = (0,external_wp_richText_namespaceObject.remove)(valueB, selectionEnd.offset, valueB.text.length);
  return [{ ...blockA,
    attributes: { ...blockA.attributes,
      [selectionStart.attributeKey]: (0,external_wp_richText_namespaceObject.toHTMLString)({
        value: valueA,
        ...mapRichTextSettings(attributeDefinitionA)
      })
    }
  }, { ...blockB,
    attributes: { ...blockB.attributes,
      [selectionEnd.attributeKey]: (0,external_wp_richText_namespaceObject.toHTMLString)({
        value: valueB,
        ...mapRichTextSettings(attributeDefinitionB)
      })
    }
  }];
};
/**
 * Returns an array containing all block client IDs in the editor in the order
 * they appear. Optionally accepts a root client ID of the block list for which
 * the order should be returned, defaulting to the top-level block order.
 *
 * @param {Object}  state        Editor state.
 * @param {?string} rootClientId Optional root client ID of block list.
 *
 * @return {Array} Ordered client IDs of editor blocks.
 */

function getBlockOrder(state, rootClientId) {
  return state.blocks.order[rootClientId || ''] || EMPTY_ARRAY;
}
/**
 * Returns the index at which the block corresponding to the specified client
 * ID occurs within the block order, or `-1` if the block does not exist.
 *
 * @param {Object} state    Editor state.
 * @param {string} clientId Block client ID.
 *
 * @return {number} Index at which block exists in order.
 */

function getBlockIndex(state, clientId) {
  const rootClientId = getBlockRootClientId(state, clientId);
  return getBlockOrder(state, rootClientId).indexOf(clientId);
}
/**
 * Returns true if the block corresponding to the specified client ID is
 * currently selected and no multi-selection exists, or false otherwise.
 *
 * @param {Object} state    Editor state.
 * @param {string} clientId Block client ID.
 *
 * @return {boolean} Whether block is selected and multi-selection exists.
 */

function isBlockSelected(state, clientId) {
  const {
    selectionStart,
    selectionEnd
  } = state.selection;

  if (selectionStart.clientId !== selectionEnd.clientId) {
    return false;
  }

  return selectionStart.clientId === clientId;
}
/**
 * Returns true if one of the block's inner blocks is selected.
 *
 * @param {Object}  state    Editor state.
 * @param {string}  clientId Block client ID.
 * @param {boolean} deep     Perform a deep check.
 *
 * @return {boolean} Whether the block as an inner block selected
 */

function hasSelectedInnerBlock(state, clientId) {
  let deep = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false;
  return (0,external_lodash_namespaceObject.some)(getBlockOrder(state, clientId), innerClientId => isBlockSelected(state, innerClientId) || isBlockMultiSelected(state, innerClientId) || deep && hasSelectedInnerBlock(state, innerClientId, deep));
}
/**
 * Returns true if the block corresponding to the specified client ID is
 * currently selected but isn't the last of the selected blocks. Here "last"
 * refers to the block sequence in the document, _not_ the sequence of
 * multi-selection, which is why `state.selectionEnd` isn't used.
 *
 * @param {Object} state    Editor state.
 * @param {string} clientId Block client ID.
 *
 * @return {boolean} Whether block is selected and not the last in the
 *                   selection.
 */

function isBlockWithinSelection(state, clientId) {
  if (!clientId) {
    return false;
  }

  const clientIds = getMultiSelectedBlockClientIds(state);
  const index = clientIds.indexOf(clientId);
  return index > -1 && index < clientIds.length - 1;
}
/**
 * Returns true if a multi-selection has been made, or false otherwise.
 *
 * @param {Object} state Editor state.
 *
 * @return {boolean} Whether multi-selection has been made.
 */

function hasMultiSelection(state) {
  const {
    selectionStart,
    selectionEnd
  } = state.selection;
  return selectionStart.clientId !== selectionEnd.clientId;
}
/**
 * Whether in the process of multi-selecting or not. This flag is only true
 * while the multi-selection is being selected (by mouse move), and is false
 * once the multi-selection has been settled.
 *
 * @see hasMultiSelection
 *
 * @param {Object} state Global application state.
 *
 * @return {boolean} True if multi-selecting, false if not.
 */

function selectors_isMultiSelecting(state) {
  return state.isMultiSelecting;
}
/**
 * Selector that returns if multi-selection is enabled or not.
 *
 * @param {Object} state Global application state.
 *
 * @return {boolean} True if it should be possible to multi-select blocks, false if multi-selection is disabled.
 */

function selectors_isSelectionEnabled(state) {
  return state.isSelectionEnabled;
}
/**
 * Returns the block's editing mode, defaulting to "visual" if not explicitly
 * assigned.
 *
 * @param {Object} state    Editor state.
 * @param {string} clientId Block client ID.
 *
 * @return {Object} Block editing mode.
 */

function getBlockMode(state, clientId) {
  return state.blocksMode[clientId] || 'visual';
}
/**
 * Returns true if the user is typing, or false otherwise.
 *
 * @param {Object} state Global application state.
 *
 * @return {boolean} Whether user is typing.
 */

function selectors_isTyping(state) {
  return state.isTyping;
}
/**
 * Returns true if the user is dragging blocks, or false otherwise.
 *
 * @param {Object} state Global application state.
 *
 * @return {boolean} Whether user is dragging blocks.
 */

function isDraggingBlocks(state) {
  return !!state.draggedBlocks.length;
}
/**
 * Returns the client ids of any blocks being directly dragged.
 *
 * This does not include children of a parent being dragged.
 *
 * @param {Object} state Global application state.
 *
 * @return {string[]} Array of dragged block client ids.
 */

function getDraggedBlockClientIds(state) {
  return state.draggedBlocks;
}
/**
 * Returns whether the block is being dragged.
 *
 * Only returns true if the block is being directly dragged,
 * not if the block is a child of a parent being dragged.
 * See `isAncestorBeingDragged` for child blocks.
 *
 * @param {Object} state    Global application state.
 * @param {string} clientId Client id for block to check.
 *
 * @return {boolean} Whether the block is being dragged.
 */

function isBlockBeingDragged(state, clientId) {
  return state.draggedBlocks.includes(clientId);
}
/**
 * Returns whether a parent/ancestor of the block is being dragged.
 *
 * @param {Object} state    Global application state.
 * @param {string} clientId Client id for block to check.
 *
 * @return {boolean} Whether the block's ancestor is being dragged.
 */

function isAncestorBeingDragged(state, clientId) {
  // Return early if no blocks are being dragged rather than
  // the more expensive check for parents.
  if (!isDraggingBlocks(state)) {
    return false;
  }

  const parents = getBlockParents(state, clientId);
  return (0,external_lodash_namespaceObject.some)(parents, parentClientId => isBlockBeingDragged(state, parentClientId));
}
/**
 * Returns true if the caret is within formatted text, or false otherwise.
 *
 * @param {Object} state Global application state.
 *
 * @return {boolean} Whether the caret is within formatted text.
 */

function selectors_isCaretWithinFormattedText(state) {
  return state.isCaretWithinFormattedText;
}
/**
 * Returns the insertion point, the index at which the new inserted block would
 * be placed. Defaults to the last index.
 *
 * @param {Object} state Editor state.
 *
 * @return {Object} Insertion point object with `rootClientId`, `index`.
 */

function getBlockInsertionPoint(state) {
  let rootClientId, index;
  const {
    insertionPoint,
    selection: {
      selectionEnd
    }
  } = state;

  if (insertionPoint !== null) {
    return insertionPoint;
  }

  const {
    clientId
  } = selectionEnd;

  if (clientId) {
    rootClientId = getBlockRootClientId(state, clientId) || undefined;
    index = getBlockIndex(state, selectionEnd.clientId, rootClientId) + 1;
  } else {
    index = getBlockOrder(state).length;
  }

  return {
    rootClientId,
    index
  };
}
/**
 * Returns true if we should show the block insertion point.
 *
 * @param {Object} state Global application state.
 *
 * @return {?boolean} Whether the insertion point is visible or not.
 */

function isBlockInsertionPointVisible(state) {
  return state.insertionPoint !== null;
}
/**
 * Returns whether the blocks matches the template or not.
 *
 * @param {boolean} state
 * @return {?boolean} Whether the template is valid or not.
 */

function isValidTemplate(state) {
  return state.template.isValid;
}
/**
 * Returns the defined block template
 *
 * @param {boolean} state
 *
 * @return {?Array} Block Template.
 */

function getTemplate(state) {
  return state.settings.template;
}
/**
 * Returns the defined block template lock. Optionally accepts a root block
 * client ID as context, otherwise defaulting to the global context.
 *
 * @param {Object}  state        Editor state.
 * @param {?string} rootClientId Optional block root client ID.
 *
 * @return {?string} Block Template Lock
 */

function getTemplateLock(state, rootClientId) {
  if (!rootClientId) {
    return state.settings.templateLock;
  }

  const blockListSettings = getBlockListSettings(state, rootClientId);

  if (!blockListSettings) {
    return null;
  }

  return blockListSettings.templateLock;
}

const checkAllowList = function (list, item) {
  let defaultResult = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : null;

  if ((0,external_lodash_namespaceObject.isBoolean)(list)) {
    return list;
  }

  if ((0,external_lodash_namespaceObject.isArray)(list)) {
    // TODO: when there is a canonical way to detect that we are editing a post
    // the following check should be changed to something like:
    // if ( list.includes( 'core/post-content' ) && getEditorMode() === 'post-content' && item === null )
    if (list.includes('core/post-content') && item === null) {
      return true;
    }

    return list.includes(item);
  }

  return defaultResult;
};
/**
 * Determines if the given block type is allowed to be inserted into the block list.
 * This function is not exported and not memoized because using a memoized selector
 * inside another memoized selector is just a waste of time.
 *
 * @param {Object}        state        Editor state.
 * @param {string|Object} blockName    The block type object, e.g., the response
 *                                     from the block directory; or a string name of
 *                                     an installed block type, e.g.' core/paragraph'.
 * @param {?string}       rootClientId Optional root client ID of block list.
 *
 * @return {boolean} Whether the given block type is allowed to be inserted.
 */


const canInsertBlockTypeUnmemoized = function (state, blockName) {
  let rootClientId = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : null;
  let blockType;

  if (blockName && 'object' === typeof blockName) {
    blockType = blockName;
    blockName = blockType.name;
  } else {
    blockType = (0,external_wp_blocks_namespaceObject.getBlockType)(blockName);
  }

  if (!blockType) {
    return false;
  }

  const {
    allowedBlockTypes
  } = getSettings(state);
  const isBlockAllowedInEditor = checkAllowList(allowedBlockTypes, blockName, true);

  if (!isBlockAllowedInEditor) {
    return false;
  }

  const isLocked = !!getTemplateLock(state, rootClientId);

  if (isLocked) {
    return false;
  }

  const parentBlockListSettings = getBlockListSettings(state, rootClientId); // The parent block doesn't have settings indicating it doesn't support
  // inner blocks, return false.

  if (rootClientId && parentBlockListSettings === undefined) {
    return false;
  }

  const parentAllowedBlocks = parentBlockListSettings === null || parentBlockListSettings === void 0 ? void 0 : parentBlockListSettings.allowedBlocks;
  const hasParentAllowedBlock = checkAllowList(parentAllowedBlocks, blockName);
  const blockAllowedParentBlocks = blockType.parent;
  const parentName = getBlockName(state, rootClientId);
  const hasBlockAllowedParent = checkAllowList(blockAllowedParentBlocks, parentName);
  let hasBlockAllowedAncestor = true;
  const blockAllowedAncestorBlocks = blockType.ancestor;

  if (blockAllowedAncestorBlocks) {
    const ancestors = [rootClientId, ...getBlockParents(state, rootClientId)];
    hasBlockAllowedAncestor = (0,external_lodash_namespaceObject.some)(ancestors, ancestorClientId => checkAllowList(blockAllowedAncestorBlocks, getBlockName(state, ancestorClientId)));
  }

  const canInsert = hasBlockAllowedAncestor && (hasParentAllowedBlock === null && hasBlockAllowedParent === null || hasParentAllowedBlock === true || hasBlockAllowedParent === true);

  if (!canInsert) {
    return canInsert;
  }
  /**
   * This filter is an ad-hoc solution to prevent adding template parts inside post content.
   * Conceptually, having a filter inside a selector is bad pattern so this code will be
   * replaced by a declarative API that doesn't the following drawbacks:
   *
   * Filters are not reactive: Upon switching between "template mode" and non "template mode",
   * the filter and selector won't necessarily be executed again. For now, it doesn't matter much
   * because you can't switch between the two modes while the inserter stays open.
   *
   * Filters are global: Once they're defined, they will affect all editor instances and all registries.
   * An ideal API would only affect specific editor instances.
   */


  return (0,external_wp_hooks_namespaceObject.applyFilters)('blockEditor.__unstableCanInsertBlockType', canInsert, blockType, rootClientId, {
    // Pass bound selectors of the current registry. If we're in a nested
    // context, the data will differ from the one selected from the root
    // registry.
    getBlock: getBlock.bind(null, state),
    getBlockParentsByBlockName: getBlockParentsByBlockName.bind(null, state)
  });
};
/**
 * Determines if the given block type is allowed to be inserted into the block list.
 *
 * @param {Object}  state        Editor state.
 * @param {string}  blockName    The name of the block type, e.g.' core/paragraph'.
 * @param {?string} rootClientId Optional root client ID of block list.
 *
 * @return {boolean} Whether the given block type is allowed to be inserted.
 */


const canInsertBlockType = rememo(canInsertBlockTypeUnmemoized, (state, blockName, rootClientId) => [state.blockListSettings[rootClientId], state.blocks.byClientId[rootClientId], state.settings.allowedBlockTypes, state.settings.templateLock]);
/**
 * Determines if the given blocks are allowed to be inserted into the block
 * list.
 *
 * @param {Object}  state        Editor state.
 * @param {string}  clientIds    The block client IDs to be inserted.
 * @param {?string} rootClientId Optional root client ID of block list.
 *
 * @return {boolean} Whether the given blocks are allowed to be inserted.
 */

function canInsertBlocks(state, clientIds) {
  let rootClientId = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : null;
  return clientIds.every(id => canInsertBlockType(state, getBlockName(state, id), rootClientId));
}
/**
 * Determines if the given block is allowed to be deleted.
 *
 * @param {Object}  state        Editor state.
 * @param {string}  clientId     The block client Id.
 * @param {?string} rootClientId Optional root client ID of block list.
 *
 * @return {boolean} Whether the given block is allowed to be removed.
 */

function canRemoveBlock(state, clientId) {
  let rootClientId = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : null;
  const attributes = getBlockAttributes(state, clientId); // attributes can be null if the block is already deleted.

  if (attributes === null) {
    return true;
  }

  const {
    lock
  } = attributes;
  const parentIsLocked = !!getTemplateLock(state, rootClientId); // If we don't have a lock on the blockType level, we defer to the parent templateLock.

  if (lock === undefined || (lock === null || lock === void 0 ? void 0 : lock.remove) === undefined) {
    return !parentIsLocked;
  } // When remove is true, it means we cannot remove it.


  return !(lock !== null && lock !== void 0 && lock.remove);
}
/**
 * Determines if the given blocks are allowed to be removed.
 *
 * @param {Object}  state        Editor state.
 * @param {string}  clientIds    The block client IDs to be removed.
 * @param {?string} rootClientId Optional root client ID of block list.
 *
 * @return {boolean} Whether the given blocks are allowed to be removed.
 */

function canRemoveBlocks(state, clientIds) {
  let rootClientId = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : null;
  return clientIds.every(clientId => canRemoveBlock(state, clientId, rootClientId));
}
/**
 * Determines if the given block is allowed to be moved.
 *
 * @param {Object}  state        Editor state.
 * @param {string}  clientId     The block client Id.
 * @param {?string} rootClientId Optional root client ID of block list.
 *
 * @return {boolean} Whether the given block is allowed to be moved.
 */

function canMoveBlock(state, clientId) {
  let rootClientId = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : null;
  const attributes = getBlockAttributes(state, clientId);

  if (attributes === null) {
    return;
  }

  const {
    lock
  } = attributes;
  const parentIsLocked = getTemplateLock(state, rootClientId) === 'all'; // If we don't have a lock on the blockType level, we defer to the parent templateLock.

  if (lock === undefined || (lock === null || lock === void 0 ? void 0 : lock.move) === undefined) {
    return !parentIsLocked;
  } // When move is true, it means we cannot move it.


  return !(lock !== null && lock !== void 0 && lock.move);
}
/**
 * Determines if the given blocks are allowed to be moved.
 *
 * @param {Object}  state        Editor state.
 * @param {string}  clientIds    The block client IDs to be moved.
 * @param {?string} rootClientId Optional root client ID of block list.
 *
 * @return {boolean} Whether the given blocks are allowed to be moved.
 */

function canMoveBlocks(state, clientIds) {
  let rootClientId = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : null;
  return clientIds.every(clientId => canMoveBlock(state, clientId, rootClientId));
}
/**
 * Determines if the given block type can be locked/unlocked by a user.
 *
 * @param {Object}          state      Editor state.
 * @param {(string|Object)} nameOrType Block name or type object.
 *
 * @return {boolean} Whether a given block type can be locked/unlocked.
 */

function canLockBlockType(state, nameOrType) {
  var _state$settings;

  if (!(0,external_wp_blocks_namespaceObject.hasBlockSupport)(nameOrType, 'lock', true)) {
    return false;
  } // Use block editor settings as the default value.


  return !!((_state$settings = state.settings) !== null && _state$settings !== void 0 && _state$settings.canLockBlocks);
}
/**
 * Returns information about how recently and frequently a block has been inserted.
 *
 * @param {Object} state Global application state.
 * @param {string} id    A string which identifies the insert, e.g. 'core/block/12'
 *
 * @return {?{ time: number, count: number }} An object containing `time` which is when the last
 *                                            insert occurred as a UNIX epoch, and `count` which is
 *                                            the number of inserts that have occurred.
 */

function getInsertUsage(state, id) {
  var _state$preferences$in, _state$preferences$in2;

  return (_state$preferences$in = (_state$preferences$in2 = state.preferences.insertUsage) === null || _state$preferences$in2 === void 0 ? void 0 : _state$preferences$in2[id]) !== null && _state$preferences$in !== void 0 ? _state$preferences$in : null;
}
/**
 * Returns whether we can show a block type in the inserter
 *
 * @param {Object}  state        Global State
 * @param {Object}  blockType    BlockType
 * @param {?string} rootClientId Optional root client ID of block list.
 *
 * @return {boolean} Whether the given block type is allowed to be shown in the inserter.
 */


const canIncludeBlockTypeInInserter = (state, blockType, rootClientId) => {
  if (!(0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockType, 'inserter', true)) {
    return false;
  }

  return canInsertBlockTypeUnmemoized(state, blockType.name, rootClientId);
};
/**
 * Return a function to be used to tranform a block variation to an inserter item
 *
 * @param {Object} state Global State
 * @param {Object} item  Denormalized inserter item
 * @return {Function} Function to transform a block variation to inserter item
 */


const getItemFromVariation = (state, item) => variation => {
  const variationId = `${item.id}/${variation.name}`;
  const {
    time,
    count = 0
  } = getInsertUsage(state, variationId) || {};
  return { ...item,
    id: variationId,
    icon: variation.icon || item.icon,
    title: variation.title || item.title,
    description: variation.description || item.description,
    category: variation.category || item.category,
    // If `example` is explicitly undefined for the variation, the preview will not be shown.
    example: variation.hasOwnProperty('example') ? variation.example : item.example,
    initialAttributes: { ...item.initialAttributes,
      ...variation.attributes
    },
    innerBlocks: variation.innerBlocks,
    keywords: variation.keywords || item.keywords,
    frecency: calculateFrecency(time, count)
  };
};
/**
 * Returns the calculated frecency.
 *
 * 'frecency' is a heuristic (https://en.wikipedia.org/wiki/Frecency)
 * that combines block usage frequenty and recency.
 *
 * @param {number} time  When the last insert occurred as a UNIX epoch
 * @param {number} count The number of inserts that have occurred.
 *
 * @return {number} The calculated frecency.
 */


const calculateFrecency = (time, count) => {
  if (!time) {
    return count;
  } // The selector is cached, which means Date.now() is the last time that the
  // relevant state changed. This suits our needs.


  const duration = Date.now() - time;

  switch (true) {
    case duration < MILLISECONDS_PER_HOUR:
      return count * 4;

    case duration < MILLISECONDS_PER_DAY:
      return count * 2;

    case duration < MILLISECONDS_PER_WEEK:
      return count / 2;

    default:
      return count / 4;
  }
};
/**
 * Returns a function that accepts a block type and builds an item to be shown
 * in a specific context. It's used for building items for Inserter and available
 * block Transfroms list.
 *
 * @param {Object} state              Editor state.
 * @param {Object} options            Options object for handling the building of a block type.
 * @param {string} options.buildScope The scope for which the item is going to be used.
 * @return {Function} Function returns an item to be shown in a specific context (Inserter|Transforms list).
 */


const buildBlockTypeItem = (state, _ref3) => {
  let {
    buildScope = 'inserter'
  } = _ref3;
  return blockType => {
    const id = blockType.name;
    let isDisabled = false;

    if (!(0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockType.name, 'multiple', true)) {
      isDisabled = (0,external_lodash_namespaceObject.some)(getBlocksByClientId(state, getClientIdsWithDescendants(state)), {
        name: blockType.name
      });
    }

    const {
      time,
      count = 0
    } = getInsertUsage(state, id) || {};
    const blockItemBase = {
      id,
      name: blockType.name,
      title: blockType.title,
      icon: blockType.icon,
      isDisabled,
      frecency: calculateFrecency(time, count)
    };
    if (buildScope === 'transform') return blockItemBase;
    const inserterVariations = (0,external_wp_blocks_namespaceObject.getBlockVariations)(blockType.name, 'inserter');
    return { ...blockItemBase,
      initialAttributes: {},
      description: blockType.description,
      category: blockType.category,
      keywords: blockType.keywords,
      variations: inserterVariations,
      example: blockType.example,
      utility: 1 // Deprecated.

    };
  };
};
/**
 * Determines the items that appear in the inserter. Includes both static
 * items (e.g. a regular block type) and dynamic items (e.g. a reusable block).
 *
 * Each item object contains what's necessary to display a button in the
 * inserter and handle its selection.
 *
 * The 'frecency' property is a heuristic (https://en.wikipedia.org/wiki/Frecency)
 * that combines block usage frequenty and recency.
 *
 * Items are returned ordered descendingly by their 'utility' and 'frecency'.
 *
 * @param    {Object}   state             Editor state.
 * @param    {?string}  rootClientId      Optional root client ID of block list.
 *
 * @return {WPEditorInserterItem[]} Items that appear in inserter.
 *
 * @typedef {Object} WPEditorInserterItem
 * @property {string}   id                Unique identifier for the item.
 * @property {string}   name              The type of block to create.
 * @property {Object}   initialAttributes Attributes to pass to the newly created block.
 * @property {string}   title             Title of the item, as it appears in the inserter.
 * @property {string}   icon              Dashicon for the item, as it appears in the inserter.
 * @property {string}   category          Block category that the item is associated with.
 * @property {string[]} keywords          Keywords that can be searched to find this item.
 * @property {boolean}  isDisabled        Whether or not the user should be prevented from inserting
 *                                        this item.
 * @property {number}   frecency          Heuristic that combines frequency and recency.
 */


const getInserterItems = rememo(function (state) {
  let rootClientId = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : null;
  const buildBlockTypeInserterItem = buildBlockTypeItem(state, {
    buildScope: 'inserter'
  });
  /*
   * Matches block comment delimiters amid serialized content.
   *
   * @see `tokenizer` in `@wordpress/block-serialization-default-parser`
   * package
   *
   * blockParserTokenizer differs from the original tokenizer in the
   * following ways:
   *
   * - removed global flag (/g)
   * - prepended ^\s*
   *
   */

  const blockParserTokenizer = /^\s*<!--\s+(\/)?wp:([a-z][a-z0-9_-]*\/)?([a-z][a-z0-9_-]*)\s+({(?:(?=([^}]+|}+(?=})|(?!}\s+\/?-->)[^])*)\5|[^]*?)}\s+)?(\/)?-->/;

  const buildReusableBlockInserterItem = reusableBlock => {
    let icon = library_symbol;
    /*
     * Instead of always displaying a generic "symbol" icon for every
     * reusable block, try to use an icon that represents the first
     * outermost block contained in the reusable block. This requires
     * scanning the serialized form of the reusable block to find its
     * first block delimiter, then looking up the corresponding block
     * type, if available.
     */

    if (external_wp_element_namespaceObject.Platform.OS === 'web') {
      const content = typeof reusableBlock.content.raw === 'string' ? reusableBlock.content.raw : reusableBlock.content;
      const rawBlockMatch = content.match(blockParserTokenizer);

      if (rawBlockMatch) {
        const [,, namespace = 'core/', blockName] = rawBlockMatch;
        const referencedBlockType = (0,external_wp_blocks_namespaceObject.getBlockType)(namespace + blockName);

        if (referencedBlockType) {
          icon = referencedBlockType.icon;
        }
      }
    }

    const id = `core/block/${reusableBlock.id}`;
    const {
      time,
      count = 0
    } = getInsertUsage(state, id) || {};
    const frecency = calculateFrecency(time, count);
    return {
      id,
      name: 'core/block',
      initialAttributes: {
        ref: reusableBlock.id
      },
      title: reusableBlock.title.raw,
      icon,
      category: 'reusable',
      keywords: [],
      isDisabled: false,
      utility: 1,
      // Deprecated.
      frecency
    };
  };

  const blockTypeInserterItems = (0,external_wp_blocks_namespaceObject.getBlockTypes)().filter(blockType => canIncludeBlockTypeInInserter(state, blockType, rootClientId)).map(buildBlockTypeInserterItem);
  const reusableBlockInserterItems = canInsertBlockTypeUnmemoized(state, 'core/block', rootClientId) ? getReusableBlocks(state).map(buildReusableBlockInserterItem) : [];
  const items = blockTypeInserterItems.reduce((accumulator, item) => {
    const {
      variations = []
    } = item; // Exclude any block type item that is to be replaced by a default variation.

    if (!variations.some(_ref4 => {
      let {
        isDefault
      } = _ref4;
      return isDefault;
    })) {
      accumulator.push(item);
    }

    if (variations.length) {
      const variationMapper = getItemFromVariation(state, item);
      accumulator.push(...variations.map(variationMapper));
    }

    return accumulator;
  }, []); // Ensure core blocks are prioritized in the returned results,
  // because third party blocks can be registered earlier than
  // the core blocks (usually by using the `init` action),
  // thus affecting the display order.
  // We don't sort reusable blocks as they are handled differently.

  const groupByType = (blocks, block) => {
    const {
      core,
      noncore
    } = blocks;
    const type = block.name.startsWith('core/') ? core : noncore;
    type.push(block);
    return blocks;
  };

  const {
    core: coreItems,
    noncore: nonCoreItems
  } = items.reduce(groupByType, {
    core: [],
    noncore: []
  });
  const sortedBlockTypes = [...coreItems, ...nonCoreItems];
  return [...sortedBlockTypes, ...reusableBlockInserterItems];
}, (state, rootClientId) => [state.blockListSettings[rootClientId], state.blocks.byClientId, state.blocks.order, state.preferences.insertUsage, state.settings.allowedBlockTypes, state.settings.templateLock, getReusableBlocks(state), (0,external_wp_blocks_namespaceObject.getBlockTypes)()]);
/**
 * Determines the items that appear in the available block transforms list.
 *
 * Each item object contains what's necessary to display a menu item in the
 * transform list and handle its selection.
 *
 * The 'frecency' property is a heuristic (https://en.wikipedia.org/wiki/Frecency)
 * that combines block usage frequenty and recency.
 *
 * Items are returned ordered descendingly by their 'frecency'.
 *
 * @param    {Object}  state        Editor state.
 * @param    {?string} rootClientId Optional root client ID of block list.
 *
 * @return {WPEditorTransformItem[]} Items that appear in inserter.
 *
 * @typedef {Object} WPEditorTransformItem
 * @property {string}  id           Unique identifier for the item.
 * @property {string}  name         The type of block to create.
 * @property {string}  title        Title of the item, as it appears in the inserter.
 * @property {string}  icon         Dashicon for the item, as it appears in the inserter.
 * @property {boolean} isDisabled   Whether or not the user should be prevented from inserting
 *                                  this item.
 * @property {number}  frecency     Heuristic that combines frequency and recency.
 */

const getBlockTransformItems = rememo(function (state, blocks) {
  var _itemsByName$sourceBl;

  let rootClientId = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : null;
  const [sourceBlock] = blocks;
  const buildBlockTypeTransformItem = buildBlockTypeItem(state, {
    buildScope: 'transform'
  });
  const blockTypeTransformItems = (0,external_wp_blocks_namespaceObject.getBlockTypes)().filter(blockType => canIncludeBlockTypeInInserter(state, blockType, rootClientId)).map(buildBlockTypeTransformItem);
  const itemsByName = (0,external_lodash_namespaceObject.mapKeys)(blockTypeTransformItems, _ref5 => {
    let {
      name
    } = _ref5;
    return name;
  }); // Consider unwraping the highest priority.

  itemsByName['*'] = {
    frecency: +Infinity,
    id: '*',
    isDisabled: false,
    name: '*',
    title: (0,external_wp_i18n_namespaceObject.__)('Unwrap'),
    icon: (_itemsByName$sourceBl = itemsByName[sourceBlock.name]) === null || _itemsByName$sourceBl === void 0 ? void 0 : _itemsByName$sourceBl.icon
  };
  const possibleTransforms = (0,external_wp_blocks_namespaceObject.getPossibleBlockTransformations)(blocks).reduce((accumulator, block) => {
    if (block === '*') {
      accumulator.push(itemsByName['*']);
    } else if (itemsByName[block === null || block === void 0 ? void 0 : block.name]) {
      accumulator.push(itemsByName[block.name]);
    }

    return accumulator;
  }, []);
  return (0,external_lodash_namespaceObject.orderBy)(possibleTransforms, block => itemsByName[block.name].frecency, 'desc');
}, (state, rootClientId) => [state.blockListSettings[rootClientId], state.blocks.byClientId, state.preferences.insertUsage, state.settings.allowedBlockTypes, state.settings.templateLock, (0,external_wp_blocks_namespaceObject.getBlockTypes)()]);
/**
 * Determines whether there are items to show in the inserter.
 *
 * @param {Object}  state        Editor state.
 * @param {?string} rootClientId Optional root client ID of block list.
 *
 * @return {boolean} Items that appear in inserter.
 */

const hasInserterItems = rememo(function (state) {
  let rootClientId = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : null;
  const hasBlockType = (0,external_lodash_namespaceObject.some)((0,external_wp_blocks_namespaceObject.getBlockTypes)(), blockType => canIncludeBlockTypeInInserter(state, blockType, rootClientId));

  if (hasBlockType) {
    return true;
  }

  const hasReusableBlock = canInsertBlockTypeUnmemoized(state, 'core/block', rootClientId) && getReusableBlocks(state).length > 0;
  return hasReusableBlock;
}, (state, rootClientId) => [state.blockListSettings[rootClientId], state.blocks.byClientId, state.settings.allowedBlockTypes, state.settings.templateLock, getReusableBlocks(state), (0,external_wp_blocks_namespaceObject.getBlockTypes)()]);
/**
 * Returns the list of allowed inserter blocks for inner blocks children
 *
 * @param {Object}  state        Editor state.
 * @param {?string} rootClientId Optional root client ID of block list.
 *
 * @return {Array?} The list of allowed block types.
 */

const __experimentalGetAllowedBlocks = rememo(function (state) {
  let rootClientId = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : null;

  if (!rootClientId) {
    return;
  }

  return (0,external_lodash_namespaceObject.filter)((0,external_wp_blocks_namespaceObject.getBlockTypes)(), blockType => canIncludeBlockTypeInInserter(state, blockType, rootClientId));
}, (state, rootClientId) => [state.blockListSettings[rootClientId], state.blocks.byClientId, state.settings.allowedBlockTypes, state.settings.templateLock, (0,external_wp_blocks_namespaceObject.getBlockTypes)()]);
/**
 * Returns the block to be directly inserted by the block appender.
 *
 * @param    {Object}         state            Editor state.
 * @param    {?string}        rootClientId     Optional root client ID of block list.
 *
 * @return {?WPDirectInsertBlock}              The block type to be directly inserted.
 *
 * @typedef {Object} WPDirectInsertBlock
 * @property {string}         name             The type of block.
 * @property {?Object}        attributes       Attributes to pass to the newly created block.
 * @property {?Array<string>} attributesToCopy Attributes to be copied from adjecent blocks when inserted.
 */

const __experimentalGetDirectInsertBlock = rememo(function (state) {
  var _state$blockListSetti, _state$blockListSetti2;

  let rootClientId = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : null;

  if (!rootClientId) {
    return;
  }

  const defaultBlock = (_state$blockListSetti = state.blockListSettings[rootClientId]) === null || _state$blockListSetti === void 0 ? void 0 : _state$blockListSetti.__experimentalDefaultBlock;
  const directInsert = (_state$blockListSetti2 = state.blockListSettings[rootClientId]) === null || _state$blockListSetti2 === void 0 ? void 0 : _state$blockListSetti2.__experimentalDirectInsert;

  if (!defaultBlock || !directInsert) {
    return;
  }

  if (typeof directInsert === 'function') {
    return directInsert(getBlock(state, rootClientId)) ? defaultBlock : null;
  }

  return defaultBlock;
}, (state, rootClientId) => [state.blockListSettings[rootClientId], state.blocks.tree[rootClientId]]);

const checkAllowListRecursive = (blocks, allowedBlockTypes) => {
  if ((0,external_lodash_namespaceObject.isBoolean)(allowedBlockTypes)) {
    return allowedBlockTypes;
  }

  const blocksQueue = [...blocks];

  while (blocksQueue.length > 0) {
    var _block$innerBlocks;

    const block = blocksQueue.shift();
    const isAllowed = checkAllowList(allowedBlockTypes, block.name || block.blockName, true);

    if (!isAllowed) {
      return false;
    }

    (_block$innerBlocks = block.innerBlocks) === null || _block$innerBlocks === void 0 ? void 0 : _block$innerBlocks.forEach(innerBlock => {
      blocksQueue.push(innerBlock);
    });
  }

  return true;
};

const __experimentalGetParsedPattern = rememo((state, patternName) => {
  const patterns = state.settings.__experimentalBlockPatterns;
  const pattern = patterns.find(_ref6 => {
    let {
      name
    } = _ref6;
    return name === patternName;
  });

  if (!pattern) {
    return null;
  }

  return { ...pattern,
    blocks: (0,external_wp_blocks_namespaceObject.parse)(pattern.content, {
      __unstableSkipMigrationLogs: true
    })
  };
}, state => [state.settings.__experimentalBlockPatterns]);
const getAllAllowedPatterns = rememo(state => {
  const patterns = state.settings.__experimentalBlockPatterns;
  const {
    allowedBlockTypes
  } = getSettings(state);
  const parsedPatterns = patterns.filter(_ref7 => {
    let {
      inserter = true
    } = _ref7;
    return !!inserter;
  }).map(_ref8 => {
    let {
      name
    } = _ref8;
    return __experimentalGetParsedPattern(state, name);
  });
  const allowedPatterns = parsedPatterns.filter(_ref9 => {
    let {
      blocks
    } = _ref9;
    return checkAllowListRecursive(blocks, allowedBlockTypes);
  });
  return allowedPatterns;
}, state => [state.settings.__experimentalBlockPatterns, state.settings.allowedBlockTypes]);
/**
 * Returns the list of allowed patterns for inner blocks children.
 *
 * @param {Object}  state        Editor state.
 * @param {?string} rootClientId Optional target root client ID.
 *
 * @return {Array?} The list of allowed patterns.
 */

const __experimentalGetAllowedPatterns = rememo(function (state) {
  let rootClientId = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : null;
  const availableParsedPatterns = getAllAllowedPatterns(state);
  const patternsAllowed = (0,external_lodash_namespaceObject.filter)(availableParsedPatterns, _ref10 => {
    let {
      blocks
    } = _ref10;
    return blocks.every(_ref11 => {
      let {
        name
      } = _ref11;
      return canInsertBlockType(state, name, rootClientId);
    });
  });
  return patternsAllowed;
}, (state, rootClientId) => [state.settings.__experimentalBlockPatterns, state.settings.allowedBlockTypes, state.settings.templateLock, state.blockListSettings[rootClientId], state.blocks.byClientId[rootClientId]]);
/**
 * Returns the list of patterns based on their declared `blockTypes`
 * and a block's name.
 * Patterns can use `blockTypes` to integrate in work flows like
 * suggesting appropriate patterns in a Placeholder state(during insertion)
 * or blocks transformations.
 *
 * @param {Object}          state        Editor state.
 * @param {string|string[]} blockNames   Block's name or array of block names to find matching pattens.
 * @param {?string}         rootClientId Optional target root client ID.
 *
 * @return {Array} The list of matched block patterns based on declared `blockTypes` and block name.
 */

const __experimentalGetPatternsByBlockTypes = rememo(function (state, blockNames) {
  let rootClientId = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : null;
  if (!blockNames) return EMPTY_ARRAY;

  const patterns = __experimentalGetAllowedPatterns(state, rootClientId);

  const normalizedBlockNames = Array.isArray(blockNames) ? blockNames : [blockNames];
  return patterns.filter(pattern => {
    var _pattern$blockTypes, _pattern$blockTypes$s;

    return pattern === null || pattern === void 0 ? void 0 : (_pattern$blockTypes = pattern.blockTypes) === null || _pattern$blockTypes === void 0 ? void 0 : (_pattern$blockTypes$s = _pattern$blockTypes.some) === null || _pattern$blockTypes$s === void 0 ? void 0 : _pattern$blockTypes$s.call(_pattern$blockTypes, blockName => normalizedBlockNames.includes(blockName));
  });
}, (state, rootClientId) => [...__experimentalGetAllowedPatterns.getDependants(state, rootClientId)]);
/**
 * Determines the items that appear in the available pattern transforms list.
 *
 * For now we only handle blocks without InnerBlocks and take into account
 * the `__experimentalRole` property of blocks' attributes for the transformation.
 *
 * We return the first set of possible eligible block patterns,
 * by checking the `blockTypes` property. We still have to recurse through
 * block pattern's blocks and try to find matches from the selected blocks.
 * Now this happens in the consumer to avoid heavy operations in the selector.
 *
 * @param {Object}   state        Editor state.
 * @param {Object[]} blocks       The selected blocks.
 * @param {?string}  rootClientId Optional root client ID of block list.
 *
 * @return {WPBlockPattern[]} Items that are eligible for a pattern transformation.
 */

const __experimentalGetPatternTransformItems = rememo(function (state, blocks) {
  let rootClientId = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : null;
  if (!blocks) return EMPTY_ARRAY;
  /**
   * For now we only handle blocks without InnerBlocks and take into account
   * the `__experimentalRole` property of blocks' attributes for the transformation.
   * Note that the blocks have been retrieved through `getBlock`, which doesn't
   * return the inner blocks of an inner block controller, so we still need
   * to check for this case too.
   */

  if (blocks.some(_ref12 => {
    let {
      clientId,
      innerBlocks
    } = _ref12;
    return innerBlocks.length || areInnerBlocksControlled(state, clientId);
  })) {
    return EMPTY_ARRAY;
  } // Create a Set of the selected block names that is used in patterns filtering.


  const selectedBlockNames = Array.from(new Set(blocks.map(_ref13 => {
    let {
      name
    } = _ref13;
    return name;
  })));
  /**
   * Here we will return first set of possible eligible block patterns,
   * by checking the `blockTypes` property. We still have to recurse through
   * block pattern's blocks and try to find matches from the selected blocks.
   * Now this happens in the consumer to avoid heavy operations in the selector.
   */

  return __experimentalGetPatternsByBlockTypes(state, selectedBlockNames, rootClientId);
}, (state, rootClientId) => [...__experimentalGetPatternsByBlockTypes.getDependants(state, rootClientId)]);
/**
 * Returns the Block List settings of a block, if any exist.
 *
 * @param {Object}  state    Editor state.
 * @param {?string} clientId Block client ID.
 *
 * @return {?Object} Block settings of the block if set.
 */

function getBlockListSettings(state, clientId) {
  return state.blockListSettings[clientId];
}
/**
 * Returns the editor settings.
 *
 * @param {Object} state Editor state.
 *
 * @return {Object} The editor settings object.
 */

function getSettings(state) {
  return state.settings;
}
/**
 * Returns true if the most recent block change is be considered persistent, or
 * false otherwise. A persistent change is one committed by BlockEditorProvider
 * via its `onChange` callback, in addition to `onInput`.
 *
 * @param {Object} state Block editor state.
 *
 * @return {boolean} Whether the most recent block change was persistent.
 */

function isLastBlockChangePersistent(state) {
  return state.blocks.isPersistentChange;
}
/**
 * Returns the block list settings for an array of blocks, if any exist.
 *
 * @param {Object} state     Editor state.
 * @param {Array}  clientIds Block client IDs.
 *
 * @return {Object} An object where the keys are client ids and the values are
 *                  a block list setting object.
 */

const __experimentalGetBlockListSettingsForBlocks = rememo(function (state) {
  let clientIds = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : [];
  return clientIds.reduce((blockListSettingsForBlocks, clientId) => {
    if (!state.blockListSettings[clientId]) {
      return blockListSettingsForBlocks;
    }

    return { ...blockListSettingsForBlocks,
      [clientId]: state.blockListSettings[clientId]
    };
  }, {});
}, state => [state.blockListSettings]);
/**
 * Returns the title of a given reusable block
 *
 * @param {Object}        state Global application state.
 * @param {number|string} ref   The shared block's ID.
 *
 * @return {string} The reusable block saved title.
 */

const __experimentalGetReusableBlockTitle = rememo((state, ref) => {
  var _reusableBlock$title;

  const reusableBlock = (0,external_lodash_namespaceObject.find)(getReusableBlocks(state), block => block.id === ref);

  if (!reusableBlock) {
    return null;
  }

  return (_reusableBlock$title = reusableBlock.title) === null || _reusableBlock$title === void 0 ? void 0 : _reusableBlock$title.raw;
}, state => [getReusableBlocks(state)]);
/**
 * Returns true if the most recent block change is be considered ignored, or
 * false otherwise. An ignored change is one not to be committed by
 * BlockEditorProvider, neither via `onChange` nor `onInput`.
 *
 * @param {Object} state Block editor state.
 *
 * @return {boolean} Whether the most recent block change was ignored.
 */

function __unstableIsLastBlockChangeIgnored(state) {
  // TODO: Removal Plan: Changes incurred by RECEIVE_BLOCKS should not be
  // ignored if in-fact they result in a change in blocks state. The current
  // need to ignore changes not a result of user interaction should be
  // accounted for in the refactoring of reusable blocks as occurring within
  // their own separate block editor / state (#7119).
  return state.blocks.isIgnoredChange;
}
/**
 * Returns the block attributes changed as a result of the last dispatched
 * action.
 *
 * @param {Object} state Block editor state.
 *
 * @return {Object<string,Object>} Subsets of block attributes changed, keyed
 *                                 by block client ID.
 */

function __experimentalGetLastBlockAttributeChanges(state) {
  return state.lastBlockAttributesChange;
}
/**
 * Returns the available reusable blocks
 *
 * @param {Object} state Global application state.
 *
 * @return {Array} Reusable blocks
 */

function getReusableBlocks(state) {
  var _state$settings$__exp, _state$settings2;

  return (_state$settings$__exp = state === null || state === void 0 ? void 0 : (_state$settings2 = state.settings) === null || _state$settings2 === void 0 ? void 0 : _state$settings2.__experimentalReusableBlocks) !== null && _state$settings$__exp !== void 0 ? _state$settings$__exp : EMPTY_ARRAY;
}
/**
 * Returns whether the navigation mode is enabled.
 *
 * @param {Object} state Editor state.
 *
 * @return {boolean} Is navigation mode enabled.
 */


function selectors_isNavigationMode(state) {
  return state.isNavigationMode;
}
/**
 * Returns whether block moving mode is enabled.
 *
 * @param {Object} state Editor state.
 *
 * @return {string} Client Id of moving block.
 */

function selectors_hasBlockMovingClientId(state) {
  return state.hasBlockMovingClientId;
}
/**
 * Returns true if the last change was an automatic change, false otherwise.
 *
 * @param {Object} state Global application state.
 *
 * @return {boolean} Whether the last change was automatic.
 */

function didAutomaticChange(state) {
  return !!state.automaticChangeStatus;
}
/**
 * Returns true if the current highlighted block matches the block clientId.
 *
 * @param {Object} state    Global application state.
 * @param {string} clientId The block to check.
 *
 * @return {boolean} Whether the block is currently highlighted.
 */

function isBlockHighlighted(state, clientId) {
  return state.highlightedBlock === clientId;
}
/**
 * Checks if a given block has controlled inner blocks.
 *
 * @param {Object} state    Global application state.
 * @param {string} clientId The block to check.
 *
 * @return {boolean} True if the block has controlled inner blocks.
 */

function areInnerBlocksControlled(state, clientId) {
  return !!state.blocks.controlledInnerBlocks[clientId];
}
/**
 * Returns the clientId for the first 'active' block of a given array of block names.
 * A block is 'active' if it (or a child) is the selected block.
 * Returns the first match moving up the DOM from the selected block.
 *
 * @param {Object}   state            Global application state.
 * @param {string[]} validBlocksNames The names of block types to check for.
 *
 * @return {string} The matching block's clientId.
 */

const __experimentalGetActiveBlockIdByBlockNames = rememo((state, validBlockNames) => {
  if (!validBlockNames.length) {
    return null;
  } // Check if selected block is a valid entity area.


  const selectedBlockClientId = getSelectedBlockClientId(state);

  if (validBlockNames.includes(getBlockName(state, selectedBlockClientId))) {
    return selectedBlockClientId;
  } // Check if first selected block is a child of a valid entity area.


  const multiSelectedBlockClientIds = getMultiSelectedBlockClientIds(state);
  const entityAreaParents = getBlockParentsByBlockName(state, selectedBlockClientId || multiSelectedBlockClientIds[0], validBlockNames);

  if (entityAreaParents) {
    // Last parent closest/most interior.
    return (0,external_lodash_namespaceObject.last)(entityAreaParents);
  }

  return null;
}, (state, validBlockNames) => [state.selection.selectionStart.clientId, state.selection.selectionEnd.clientId, validBlockNames]);
/**
 * Tells if the block with the passed clientId was just inserted.
 *
 * @param {Object}  state    Global application state.
 * @param {Object}  clientId Client Id of the block.
 * @param {?string} source   Optional insertion source of the block.
 * @return {boolean} True if the block matches the last block inserted from the specified source.
 */

function wasBlockJustInserted(state, clientId, source) {
  const {
    lastBlockInserted
  } = state;
  return lastBlockInserted.clientId === clientId && lastBlockInserted.source === source;
}

;// CONCATENATED MODULE: external ["wp","a11y"]
var external_wp_a11y_namespaceObject = window["wp"]["a11y"];
;// CONCATENATED MODULE: external ["wp","deprecated"]
var external_wp_deprecated_namespaceObject = window["wp"]["deprecated"];
var external_wp_deprecated_default = /*#__PURE__*/__webpack_require__.n(external_wp_deprecated_namespaceObject);
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/store/actions.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */


/**
 * Action which will insert a default block insert action if there
 * are no other blocks at the root of the editor. This action should be used
 * in actions which may result in no blocks remaining in the editor (removal,
 * replacement, etc).
 */

const ensureDefaultBlock = () => _ref => {
  let {
    select,
    dispatch
  } = _ref;
  // To avoid a focus loss when removing the last block, assure there is
  // always a default block if the last of the blocks have been removed.
  const count = select.getBlockCount();

  if (count > 0) {
    return;
  } // If there's an custom appender, don't insert default block.
  // We have to remember to manually move the focus elsewhere to
  // prevent it from being lost though.


  const {
    __unstableHasCustomAppender
  } = select.getSettings();

  if (__unstableHasCustomAppender) {
    return;
  }

  dispatch.insertDefaultBlock();
};
/**
 * Action that resets blocks state to the specified array of blocks, taking precedence
 * over any other content reflected as an edit in state.
 *
 * @param {Array} blocks Array of blocks.
 */


const resetBlocks = blocks => _ref2 => {
  let {
    dispatch
  } = _ref2;
  dispatch({
    type: 'RESET_BLOCKS',
    blocks
  });
  dispatch(validateBlocksToTemplate(blocks));
};
/**
 * Block validity is a function of blocks state (at the point of a
 * reset) and the template setting. As a compromise to its placement
 * across distinct parts of state, it is implemented here as a side-
 * effect of the block reset action.
 *
 * @param {Array} blocks Array of blocks.
 */

const validateBlocksToTemplate = blocks => _ref3 => {
  let {
    select,
    dispatch
  } = _ref3;
  const template = select.getTemplate();
  const templateLock = select.getTemplateLock(); // Unlocked templates are considered always valid because they act
  // as default values only.

  const isBlocksValidToTemplate = !template || templateLock !== 'all' || (0,external_wp_blocks_namespaceObject.doBlocksMatchTemplate)(blocks, template); // Update if validity has changed.

  const isValidTemplate = select.isValidTemplate();

  if (isBlocksValidToTemplate !== isValidTemplate) {
    dispatch.setTemplateValidity(isBlocksValidToTemplate);
    return isBlocksValidToTemplate;
  }
};
/**
 * A block selection object.
 *
 * @typedef {Object} WPBlockSelection
 *
 * @property {string} clientId     A block client ID.
 * @property {string} attributeKey A block attribute key.
 * @property {number} offset       An attribute value offset, based on the rich
 *                                 text value. See `wp.richText.create`.
 */

/**
 * A selection object.
 *
 * @typedef {Object} WPSelection
 *
 * @property {WPBlockSelection} start The selection start.
 * @property {WPBlockSelection} end   The selection end.
 */

/* eslint-disable jsdoc/valid-types */

/**
 * Returns an action object used in signalling that selection state should be
 * reset to the specified selection.
 *
 * @param {WPBlockSelection} selectionStart  The selection start.
 * @param {WPBlockSelection} selectionEnd    The selection end.
 * @param {0|-1|null}        initialPosition Initial block position.
 *
 * @return {Object} Action object.
 */

function resetSelection(selectionStart, selectionEnd, initialPosition) {
  /* eslint-enable jsdoc/valid-types */
  return {
    type: 'RESET_SELECTION',
    selectionStart,
    selectionEnd,
    initialPosition
  };
}
/**
 * Returns an action object used in signalling that blocks have been received.
 * Unlike resetBlocks, these should be appended to the existing known set, not
 * replacing.
 *
 * @deprecated
 *
 * @param {Object[]} blocks Array of block objects.
 *
 * @return {Object} Action object.
 */

function receiveBlocks(blocks) {
  external_wp_deprecated_default()('wp.data.dispatch( "core/block-editor" ).receiveBlocks', {
    since: '5.9',
    alternative: 'resetBlocks or insertBlocks'
  });
  return {
    type: 'RECEIVE_BLOCKS',
    blocks
  };
}
/**
 * Action that updates attributes of multiple blocks with the specified client IDs.
 *
 * @param {string|string[]} clientIds     Block client IDs.
 * @param {Object}          attributes    Block attributes to be merged. Should be keyed by clientIds if
 *                                        uniqueByBlock is true.
 * @param {boolean}         uniqueByBlock true if each block in clientIds array has a unique set of attributes
 * @return {Object} Action object.
 */

function updateBlockAttributes(clientIds, attributes) {
  let uniqueByBlock = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false;
  return {
    type: 'UPDATE_BLOCK_ATTRIBUTES',
    clientIds: (0,external_lodash_namespaceObject.castArray)(clientIds),
    attributes,
    uniqueByBlock
  };
}
/**
 * Action that updates the block with the specified client ID.
 *
 * @param {string} clientId Block client ID.
 * @param {Object} updates  Block attributes to be merged.
 *
 * @return {Object} Action object.
 */

function updateBlock(clientId, updates) {
  return {
    type: 'UPDATE_BLOCK',
    clientId,
    updates
  };
}
/* eslint-disable jsdoc/valid-types */

/**
 * Returns an action object used in signalling that the block with the
 * specified client ID has been selected, optionally accepting a position
 * value reflecting its selection directionality. An initialPosition of -1
 * reflects a reverse selection.
 *
 * @param {string}    clientId        Block client ID.
 * @param {0|-1|null} initialPosition Optional initial position. Pass as -1 to
 *                                    reflect reverse selection.
 *
 * @return {Object} Action object.
 */

function selectBlock(clientId) {
  let initialPosition = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 0;

  /* eslint-enable jsdoc/valid-types */
  return {
    type: 'SELECT_BLOCK',
    initialPosition,
    clientId
  };
}
/**
 * Yields action objects used in signalling that the block preceding the given
 * clientId should be selected.
 *
 * @param {string} clientId Block client ID.
 */

const selectPreviousBlock = clientId => _ref4 => {
  let {
    select,
    dispatch
  } = _ref4;
  const previousBlockClientId = select.getPreviousBlockClientId(clientId);

  if (previousBlockClientId) {
    dispatch.selectBlock(previousBlockClientId, -1);
  }
};
/**
 * Yields action objects used in signalling that the block following the given
 * clientId should be selected.
 *
 * @param {string} clientId Block client ID.
 */

const selectNextBlock = clientId => _ref5 => {
  let {
    select,
    dispatch
  } = _ref5;
  const nextBlockClientId = select.getNextBlockClientId(clientId);

  if (nextBlockClientId) {
    dispatch.selectBlock(nextBlockClientId);
  }
};
/**
 * Action that starts block multi-selection.
 *
 * @return {Object} Action object.
 */

function startMultiSelect() {
  return {
    type: 'START_MULTI_SELECT'
  };
}
/**
 * Action that stops block multi-selection.
 *
 * @return {Object} Action object.
 */

function stopMultiSelect() {
  return {
    type: 'STOP_MULTI_SELECT'
  };
}
/**
 * Action that changes block multi-selection.
 *
 * @param {string}      start                         First block of the multi selection.
 * @param {string}      end                           Last block of the multiselection.
 * @param {number|null} __experimentalInitialPosition Optional initial position. Pass as null to skip focus within editor canvas.
 */

const multiSelect = function (start, end) {
  let __experimentalInitialPosition = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : 0;

  return _ref6 => {
    let {
      select,
      dispatch
    } = _ref6;
    const startBlockRootClientId = select.getBlockRootClientId(start);
    const endBlockRootClientId = select.getBlockRootClientId(end); // Only allow block multi-selections at the same level.

    if (startBlockRootClientId !== endBlockRootClientId) {
      return;
    }

    dispatch({
      type: 'MULTI_SELECT',
      start,
      end,
      initialPosition: __experimentalInitialPosition
    });
    const blockCount = select.getSelectedBlockCount();
    (0,external_wp_a11y_namespaceObject.speak)((0,external_wp_i18n_namespaceObject.sprintf)(
    /* translators: %s: number of selected blocks */
    (0,external_wp_i18n_namespaceObject._n)('%s block selected.', '%s blocks selected.', blockCount), blockCount), 'assertive');
  };
};
/**
 * Action that clears the block selection.
 *
 * @return {Object} Action object.
 */

function clearSelectedBlock() {
  return {
    type: 'CLEAR_SELECTED_BLOCK'
  };
}
/**
 * Action that enables or disables block selection.
 *
 * @param {boolean} [isSelectionEnabled=true] Whether block selection should
 *                                            be enabled.
 *
 * @return {Object} Action object.
 */

function toggleSelection() {
  let isSelectionEnabled = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : true;
  return {
    type: 'TOGGLE_SELECTION',
    isSelectionEnabled
  };
}

function getBlocksWithDefaultStylesApplied(blocks, blockEditorSettings) {
  var _blockEditorSettings$, _blockEditorSettings$2;

  const preferredStyleVariations = (_blockEditorSettings$ = blockEditorSettings === null || blockEditorSettings === void 0 ? void 0 : (_blockEditorSettings$2 = blockEditorSettings.__experimentalPreferredStyleVariations) === null || _blockEditorSettings$2 === void 0 ? void 0 : _blockEditorSettings$2.value) !== null && _blockEditorSettings$ !== void 0 ? _blockEditorSettings$ : {};
  return blocks.map(block => {
    var _block$attributes;

    const blockName = block.name;

    if (!(0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockName, 'defaultStylePicker', true)) {
      return block;
    }

    if (!preferredStyleVariations[blockName]) {
      return block;
    }

    const className = (_block$attributes = block.attributes) === null || _block$attributes === void 0 ? void 0 : _block$attributes.className;

    if (className !== null && className !== void 0 && className.includes('is-style-')) {
      return block;
    }

    const {
      attributes = {}
    } = block;
    const blockStyle = preferredStyleVariations[blockName];
    return { ...block,
      attributes: { ...attributes,
        className: `${className || ''} is-style-${blockStyle}`.trim()
      }
    };
  });
}
/* eslint-disable jsdoc/valid-types */

/**
 * Action that replaces given blocks with one or more replacement blocks.
 *
 * @param {(string|string[])} clientIds       Block client ID(s) to replace.
 * @param {(Object|Object[])} blocks          Replacement block(s).
 * @param {number}            indexToSelect   Index of replacement block to select.
 * @param {0|-1|null}         initialPosition Index of caret after in the selected block after the operation.
 * @param {?Object}           meta            Optional Meta values to be passed to the action object.
 *
 * @return {Object} Action object.
 */


const replaceBlocks = function (clientIds, blocks, indexToSelect) {
  let initialPosition = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : 0;
  let meta = arguments.length > 4 ? arguments[4] : undefined;
  return _ref7 => {
    let {
      select,
      dispatch
    } = _ref7;

    /* eslint-enable jsdoc/valid-types */
    clientIds = (0,external_lodash_namespaceObject.castArray)(clientIds);
    blocks = getBlocksWithDefaultStylesApplied((0,external_lodash_namespaceObject.castArray)(blocks), select.getSettings());
    const rootClientId = select.getBlockRootClientId((0,external_lodash_namespaceObject.first)(clientIds)); // Replace is valid if the new blocks can be inserted in the root block.

    for (let index = 0; index < blocks.length; index++) {
      const block = blocks[index];
      const canInsertBlock = select.canInsertBlockType(block.name, rootClientId);

      if (!canInsertBlock) {
        return;
      }
    }

    dispatch({
      type: 'REPLACE_BLOCKS',
      clientIds,
      blocks,
      time: Date.now(),
      indexToSelect,
      initialPosition,
      meta
    });
    dispatch(ensureDefaultBlock());
  };
};
/**
 * Action that replaces a single block with one or more replacement blocks.
 *
 * @param {(string|string[])} clientId Block client ID to replace.
 * @param {(Object|Object[])} block    Replacement block(s).
 *
 * @return {Object} Action object.
 */

function replaceBlock(clientId, block) {
  return replaceBlocks(clientId, block);
}
/**
 * Higher-order action creator which, given the action type to dispatch creates
 * an action creator for managing block movement.
 *
 * @param {string} type Action type to dispatch.
 *
 * @return {Function} Action creator.
 */

const createOnMove = type => (clientIds, rootClientId) => _ref8 => {
  let {
    select,
    dispatch
  } = _ref8;
  // If one of the blocks is locked or the parent is locked, we cannot move any block.
  const canMoveBlocks = select.canMoveBlocks(clientIds, rootClientId);

  if (!canMoveBlocks) {
    return;
  }

  dispatch({
    type,
    clientIds: (0,external_lodash_namespaceObject.castArray)(clientIds),
    rootClientId
  });
};

const moveBlocksDown = createOnMove('MOVE_BLOCKS_DOWN');
const moveBlocksUp = createOnMove('MOVE_BLOCKS_UP');
/**
 * Action that moves given blocks to a new position.
 *
 * @param {?string} clientIds        The client IDs of the blocks.
 * @param {?string} fromRootClientId Root client ID source.
 * @param {?string} toRootClientId   Root client ID destination.
 * @param {number}  index            The index to move the blocks to.
 */

const moveBlocksToPosition = function (clientIds) {
  let fromRootClientId = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : '';
  let toRootClientId = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : '';
  let index = arguments.length > 3 ? arguments[3] : undefined;
  return _ref9 => {
    let {
      select,
      dispatch
    } = _ref9;
    const canMoveBlocks = select.canMoveBlocks(clientIds, fromRootClientId); // If one of the blocks is locked or the parent is locked, we cannot move any block.

    if (!canMoveBlocks) {
      return;
    } // If moving inside the same root block the move is always possible.


    if (fromRootClientId !== toRootClientId) {
      const canRemoveBlocks = select.canRemoveBlocks(clientIds, fromRootClientId); // If we're moving to another block, it means we're deleting blocks from
      // the original block, so we need to check if removing is possible.

      if (!canRemoveBlocks) {
        return;
      }

      const canInsertBlocks = select.canInsertBlocks(clientIds, toRootClientId); // If moving to other parent block, the move is possible if we can insert a block of the same type inside the new parent block.

      if (!canInsertBlocks) {
        return;
      }
    }

    dispatch({
      type: 'MOVE_BLOCKS_TO_POSITION',
      fromRootClientId,
      toRootClientId,
      clientIds,
      index
    });
  };
};
/**
 * Action that moves given block to a new position.
 *
 * @param {?string} clientId         The client ID of the block.
 * @param {?string} fromRootClientId Root client ID source.
 * @param {?string} toRootClientId   Root client ID destination.
 * @param {number}  index            The index to move the block to.
 */

function moveBlockToPosition(clientId) {
  let fromRootClientId = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : '';
  let toRootClientId = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : '';
  let index = arguments.length > 3 ? arguments[3] : undefined;
  return moveBlocksToPosition([clientId], fromRootClientId, toRootClientId, index);
}
/**
 * Action that inserts a single block, optionally at a specific index respective a root block list.
 *
 * @param {Object}   block           Block object to insert.
 * @param {?number}  index           Index at which block should be inserted.
 * @param {?string}  rootClientId    Optional root client ID of block list on which to insert.
 * @param {?boolean} updateSelection If true block selection will be updated. If false, block selection will not change. Defaults to true.
 * @param {?Object}  meta            Optional Meta values to be passed to the action object.
 *
 * @return {Object} Action object.
 */

function insertBlock(block, index, rootClientId, updateSelection, meta) {
  return insertBlocks([block], index, rootClientId, updateSelection, 0, meta);
}
/* eslint-disable jsdoc/valid-types */

/**
 * Action that inserts an array of blocks, optionally at a specific index respective a root block list.
 *
 * @param {Object[]}  blocks          Block objects to insert.
 * @param {?number}   index           Index at which block should be inserted.
 * @param {?string}   rootClientId    Optional root client ID of block list on which to insert.
 * @param {?boolean}  updateSelection If true block selection will be updated.  If false, block selection will not change. Defaults to true.
 * @param {0|-1|null} initialPosition Initial focus position. Setting it to null prevent focusing the inserted block.
 * @param {?Object}   meta            Optional Meta values to be passed to the action object.
 * @return {Object} Action object.
 */

const insertBlocks = function (blocks, index, rootClientId) {
  let updateSelection = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : true;
  let initialPosition = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : 0;
  let meta = arguments.length > 5 ? arguments[5] : undefined;
  return _ref10 => {
    let {
      select,
      dispatch
    } = _ref10;

    /* eslint-enable jsdoc/valid-types */
    if ((0,external_lodash_namespaceObject.isObject)(initialPosition)) {
      meta = initialPosition;
      initialPosition = 0;
      external_wp_deprecated_default()("meta argument in wp.data.dispatch('core/block-editor')", {
        since: '5.8',
        hint: 'The meta argument is now the 6th argument of the function'
      });
    }

    blocks = getBlocksWithDefaultStylesApplied((0,external_lodash_namespaceObject.castArray)(blocks), select.getSettings());
    const allowedBlocks = [];

    for (const block of blocks) {
      const isValid = select.canInsertBlockType(block.name, rootClientId);

      if (isValid) {
        allowedBlocks.push(block);
      }
    }

    if (allowedBlocks.length) {
      dispatch({
        type: 'INSERT_BLOCKS',
        blocks: allowedBlocks,
        index,
        rootClientId,
        time: Date.now(),
        updateSelection,
        initialPosition: updateSelection ? initialPosition : null,
        meta
      });
    }
  };
};
/**
 * Action that shows the insertion point.
 *
 * @param {?string} rootClientId      Optional root client ID of block list on
 *                                    which to insert.
 * @param {?number} index             Index at which block should be inserted.
 * @param {Object}  __unstableOptions Whether or not to show an inserter button.
 *
 * @return {Object} Action object.
 */

function showInsertionPoint(rootClientId, index) {
  let __unstableOptions = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};

  const {
    __unstableWithInserter
  } = __unstableOptions;
  return {
    type: 'SHOW_INSERTION_POINT',
    rootClientId,
    index,
    __unstableWithInserter
  };
}
/**
 * Action that hides the insertion point.
 *
 * @return {Object} Action object.
 */

function hideInsertionPoint() {
  return {
    type: 'HIDE_INSERTION_POINT'
  };
}
/**
 * Action that resets the template validity.
 *
 * @param {boolean} isValid template validity flag.
 *
 * @return {Object} Action object.
 */

function setTemplateValidity(isValid) {
  return {
    type: 'SET_TEMPLATE_VALIDITY',
    isValid
  };
}
/**
 * Action that synchronizes the template with the list of blocks.
 *
 * @return {Object} Action object.
 */

const synchronizeTemplate = () => _ref11 => {
  let {
    select,
    dispatch
  } = _ref11;
  dispatch({
    type: 'SYNCHRONIZE_TEMPLATE'
  });
  const blocks = select.getBlocks();
  const template = select.getTemplate();
  const updatedBlockList = (0,external_wp_blocks_namespaceObject.synchronizeBlocksWithTemplate)(blocks, template);
  dispatch.resetBlocks(updatedBlockList);
};
/**
 * Delete the current selection.
 *
 * @param {boolean} isForward
 */

const __unstableDeleteSelection = isForward => _ref12 => {
  let {
    registry,
    select,
    dispatch
  } = _ref12;
  const selectionAnchor = select.getSelectionStart();
  const selectionFocus = select.getSelectionEnd();
  if (selectionAnchor.clientId === selectionFocus.clientId) return; // It's not mergeable if there's no rich text selection.

  if (!selectionAnchor.attributeKey || !selectionFocus.attributeKey || typeof selectionAnchor.offset === 'undefined' || typeof selectionFocus.offset === 'undefined') return false;
  const anchorRootClientId = select.getBlockRootClientId(selectionAnchor.clientId);
  const focusRootClientId = select.getBlockRootClientId(selectionFocus.clientId); // It's not mergeable if the selection doesn't start and end in the same
  // block list. Maybe in the future it should be allowed.

  if (anchorRootClientId !== focusRootClientId) {
    return;
  }

  const blockOrder = select.getBlockOrder(anchorRootClientId);
  const anchorIndex = blockOrder.indexOf(selectionAnchor.clientId);
  const focusIndex = blockOrder.indexOf(selectionFocus.clientId); // Reassign selection start and end based on order.

  let selectionStart, selectionEnd;

  if (anchorIndex > focusIndex) {
    selectionStart = selectionFocus;
    selectionEnd = selectionAnchor;
  } else {
    selectionStart = selectionAnchor;
    selectionEnd = selectionFocus;
  }

  const targetSelection = isForward ? selectionEnd : selectionStart;
  const targetBlock = select.getBlock(targetSelection.clientId);
  const targetBlockType = (0,external_wp_blocks_namespaceObject.getBlockType)(targetBlock.name);

  if (!targetBlockType.merge) {
    return;
  }

  const selectionA = selectionStart;
  const selectionB = selectionEnd;
  const blockA = select.getBlock(selectionA.clientId);
  const blockAType = (0,external_wp_blocks_namespaceObject.getBlockType)(blockA.name);
  const blockB = select.getBlock(selectionB.clientId);
  const blockBType = (0,external_wp_blocks_namespaceObject.getBlockType)(blockB.name);
  const htmlA = blockA.attributes[selectionA.attributeKey];
  const htmlB = blockB.attributes[selectionB.attributeKey];
  const attributeDefinitionA = blockAType.attributes[selectionA.attributeKey];
  const attributeDefinitionB = blockBType.attributes[selectionB.attributeKey];
  let valueA = (0,external_wp_richText_namespaceObject.create)({
    html: htmlA,
    ...mapRichTextSettings(attributeDefinitionA)
  });
  let valueB = (0,external_wp_richText_namespaceObject.create)({
    html: htmlB,
    ...mapRichTextSettings(attributeDefinitionB)
  }); // A robust way to retain selection position through various transforms
  // is to insert a special character at the position and then recover it.

  const START_OF_SELECTED_AREA = '\u0086';
  valueA = (0,external_wp_richText_namespaceObject.remove)(valueA, selectionA.offset, valueA.text.length);
  valueB = (0,external_wp_richText_namespaceObject.insert)(valueB, START_OF_SELECTED_AREA, 0, selectionB.offset); // Clone the blocks so we don't manipulate the original.

  const cloneA = (0,external_wp_blocks_namespaceObject.cloneBlock)(blockA, {
    [selectionA.attributeKey]: (0,external_wp_richText_namespaceObject.toHTMLString)({
      value: valueA,
      ...mapRichTextSettings(attributeDefinitionA)
    })
  });
  const cloneB = (0,external_wp_blocks_namespaceObject.cloneBlock)(blockB, {
    [selectionB.attributeKey]: (0,external_wp_richText_namespaceObject.toHTMLString)({
      value: valueB,
      ...mapRichTextSettings(attributeDefinitionB)
    })
  });
  const followingBlock = isForward ? cloneA : cloneB; // We can only merge blocks with similar types
  // thus, we transform the block to merge first

  const blocksWithTheSameType = blockA.name === blockB.name ? [followingBlock] : (0,external_wp_blocks_namespaceObject.switchToBlockType)(followingBlock, targetBlockType.name); // If the block types can not match, do nothing

  if (!blocksWithTheSameType || !blocksWithTheSameType.length) {
    return;
  }

  let updatedAttributes;

  if (isForward) {
    const blockToMerge = blocksWithTheSameType.pop();
    updatedAttributes = targetBlockType.merge(blockToMerge.attributes, cloneB.attributes);
  } else {
    const blockToMerge = blocksWithTheSameType.shift();
    updatedAttributes = targetBlockType.merge(cloneA.attributes, blockToMerge.attributes);
  }

  const newAttributeKey = (0,external_lodash_namespaceObject.findKey)(updatedAttributes, v => typeof v === 'string' && v.indexOf(START_OF_SELECTED_AREA) !== -1);
  const convertedHtml = updatedAttributes[newAttributeKey];
  const convertedValue = (0,external_wp_richText_namespaceObject.create)({
    html: convertedHtml,
    ...mapRichTextSettings(targetBlockType.attributes[newAttributeKey])
  });
  const newOffset = convertedValue.text.indexOf(START_OF_SELECTED_AREA);
  const newValue = (0,external_wp_richText_namespaceObject.remove)(convertedValue, newOffset, newOffset + 1);
  const newHtml = (0,external_wp_richText_namespaceObject.toHTMLString)({
    value: newValue,
    ...mapRichTextSettings(targetBlockType.attributes[newAttributeKey])
  });
  updatedAttributes[newAttributeKey] = newHtml;
  const selectedBlockClientIds = select.getSelectedBlockClientIds();
  const replacement = [...(isForward ? blocksWithTheSameType : []), { // Preserve the original client ID.
    ...targetBlock,
    attributes: { ...targetBlock.attributes,
      ...updatedAttributes
    }
  }, ...(isForward ? [] : blocksWithTheSameType)];
  registry.batch(() => {
    dispatch.selectionChange(targetBlock.clientId, newAttributeKey, newOffset, newOffset);
    dispatch.replaceBlocks(selectedBlockClientIds, replacement, 0, // If we don't pass the `indexToSelect` it will default to the last block.
    select.getSelectedBlocksInitialCaretPosition());
  });
};
/**
 * Split the current selection.
 */

const __unstableSplitSelection = () => _ref13 => {
  let {
    select,
    dispatch
  } = _ref13;
  const selectionAnchor = select.getSelectionStart();
  const selectionFocus = select.getSelectionEnd();
  if (selectionAnchor.clientId === selectionFocus.clientId) return; // Can't split if the selection is not set.

  if (!selectionAnchor.attributeKey || !selectionFocus.attributeKey || typeof selectionAnchor.offset === 'undefined' || typeof selectionFocus.offset === 'undefined') return;
  const anchorRootClientId = select.getBlockRootClientId(selectionAnchor.clientId);
  const focusRootClientId = select.getBlockRootClientId(selectionFocus.clientId); // It's not splittable if the selection doesn't start and end in the same
  // block list. Maybe in the future it should be allowed.

  if (anchorRootClientId !== focusRootClientId) {
    return;
  }

  const blockOrder = select.getBlockOrder(anchorRootClientId);
  const anchorIndex = blockOrder.indexOf(selectionAnchor.clientId);
  const focusIndex = blockOrder.indexOf(selectionFocus.clientId); // Reassign selection start and end based on order.

  let selectionStart, selectionEnd;

  if (anchorIndex > focusIndex) {
    selectionStart = selectionFocus;
    selectionEnd = selectionAnchor;
  } else {
    selectionStart = selectionAnchor;
    selectionEnd = selectionFocus;
  }

  const selectionA = selectionStart;
  const selectionB = selectionEnd;
  const blockA = select.getBlock(selectionA.clientId);
  const blockAType = (0,external_wp_blocks_namespaceObject.getBlockType)(blockA.name);
  const blockB = select.getBlock(selectionB.clientId);
  const blockBType = (0,external_wp_blocks_namespaceObject.getBlockType)(blockB.name);
  const htmlA = blockA.attributes[selectionA.attributeKey];
  const htmlB = blockB.attributes[selectionB.attributeKey];
  const attributeDefinitionA = blockAType.attributes[selectionA.attributeKey];
  const attributeDefinitionB = blockBType.attributes[selectionB.attributeKey];
  let valueA = (0,external_wp_richText_namespaceObject.create)({
    html: htmlA,
    ...mapRichTextSettings(attributeDefinitionA)
  });
  let valueB = (0,external_wp_richText_namespaceObject.create)({
    html: htmlB,
    ...mapRichTextSettings(attributeDefinitionB)
  });
  valueA = (0,external_wp_richText_namespaceObject.remove)(valueA, selectionA.offset, valueA.text.length);
  valueB = (0,external_wp_richText_namespaceObject.remove)(valueB, 0, selectionB.offset);
  dispatch.replaceBlocks(select.getSelectedBlockClientIds(), [{ // Preserve the original client ID.
    ...blockA,
    attributes: { ...blockA.attributes,
      [selectionA.attributeKey]: (0,external_wp_richText_namespaceObject.toHTMLString)({
        value: valueA,
        ...mapRichTextSettings(attributeDefinitionA)
      })
    }
  }, (0,external_wp_blocks_namespaceObject.createBlock)((0,external_wp_blocks_namespaceObject.getDefaultBlockName)()), { // Preserve the original client ID.
    ...blockB,
    attributes: { ...blockB.attributes,
      [selectionB.attributeKey]: (0,external_wp_richText_namespaceObject.toHTMLString)({
        value: valueB,
        ...mapRichTextSettings(attributeDefinitionB)
      })
    }
  }], 1, // If we don't pass the `indexToSelect` it will default to the last block.
  select.getSelectedBlocksInitialCaretPosition());
};
/**
 * Expand the selection to cover the entire blocks, removing partial selection.
 */

const __unstableExpandSelection = () => _ref14 => {
  let {
    select,
    dispatch
  } = _ref14;
  const selectionAnchor = select.getSelectionStart();
  const selectionFocus = select.getSelectionEnd();
  dispatch.selectionChange({
    start: {
      clientId: selectionAnchor.clientId
    },
    end: {
      clientId: selectionFocus.clientId
    }
  });
};
/**
 * Action that merges two blocks.
 *
 * @param {string} firstBlockClientId  Client ID of the first block to merge.
 * @param {string} secondBlockClientId Client ID of the second block to merge.
 */

const mergeBlocks = (firstBlockClientId, secondBlockClientId) => _ref15 => {
  let {
    select,
    dispatch
  } = _ref15;
  const blocks = [firstBlockClientId, secondBlockClientId];
  dispatch({
    type: 'MERGE_BLOCKS',
    blocks
  });
  const [clientIdA, clientIdB] = blocks;
  const blockA = select.getBlock(clientIdA);
  const blockAType = (0,external_wp_blocks_namespaceObject.getBlockType)(blockA.name); // Only focus the previous block if it's not mergeable.

  if (blockAType && !blockAType.merge) {
    dispatch.selectBlock(blockA.clientId);
    return;
  }

  const blockB = select.getBlock(clientIdB);
  const blockBType = (0,external_wp_blocks_namespaceObject.getBlockType)(blockB.name);
  const {
    clientId,
    attributeKey,
    offset
  } = select.getSelectionStart();
  const selectedBlockType = clientId === clientIdA ? blockAType : blockBType;
  const attributeDefinition = selectedBlockType.attributes[attributeKey];
  const canRestoreTextSelection = (clientId === clientIdA || clientId === clientIdB) && attributeKey !== undefined && offset !== undefined && // We cannot restore text selection if the RichText identifier
  // is not a defined block attribute key. This can be the case if the
  // fallback intance ID is used to store selection (and no RichText
  // identifier is set), or when the identifier is wrong.
  !!attributeDefinition;

  if (!attributeDefinition) {
    if (typeof attributeKey === 'number') {
      window.console.error(`RichText needs an identifier prop that is the block attribute key of the attribute it controls. Its type is expected to be a string, but was ${typeof attributeKey}`);
    } else {
      window.console.error('The RichText identifier prop does not match any attributes defined by the block.');
    }
  } // A robust way to retain selection position through various transforms
  // is to insert a special character at the position and then recover it.


  const START_OF_SELECTED_AREA = '\u0086'; // Clone the blocks so we don't insert the character in a "live" block.

  const cloneA = (0,external_wp_blocks_namespaceObject.cloneBlock)(blockA);
  const cloneB = (0,external_wp_blocks_namespaceObject.cloneBlock)(blockB);

  if (canRestoreTextSelection) {
    const selectedBlock = clientId === clientIdA ? cloneA : cloneB;
    const html = selectedBlock.attributes[attributeKey];
    const value = (0,external_wp_richText_namespaceObject.insert)((0,external_wp_richText_namespaceObject.create)({
      html,
      ...mapRichTextSettings(attributeDefinition)
    }), START_OF_SELECTED_AREA, offset, offset);
    selectedBlock.attributes[attributeKey] = (0,external_wp_richText_namespaceObject.toHTMLString)({
      value,
      ...mapRichTextSettings(attributeDefinition)
    });
  } // We can only merge blocks with similar types
  // thus, we transform the block to merge first.


  const blocksWithTheSameType = blockA.name === blockB.name ? [cloneB] : (0,external_wp_blocks_namespaceObject.switchToBlockType)(cloneB, blockA.name); // If the block types can not match, do nothing.

  if (!blocksWithTheSameType || !blocksWithTheSameType.length) {
    return;
  } // Calling the merge to update the attributes and remove the block to be merged.


  const updatedAttributes = blockAType.merge(cloneA.attributes, blocksWithTheSameType[0].attributes);

  if (canRestoreTextSelection) {
    const newAttributeKey = (0,external_lodash_namespaceObject.findKey)(updatedAttributes, v => typeof v === 'string' && v.indexOf(START_OF_SELECTED_AREA) !== -1);
    const convertedHtml = updatedAttributes[newAttributeKey];
    const convertedValue = (0,external_wp_richText_namespaceObject.create)({
      html: convertedHtml,
      ...mapRichTextSettings(blockAType.attributes[newAttributeKey])
    });
    const newOffset = convertedValue.text.indexOf(START_OF_SELECTED_AREA);
    const newValue = (0,external_wp_richText_namespaceObject.remove)(convertedValue, newOffset, newOffset + 1);
    const newHtml = (0,external_wp_richText_namespaceObject.toHTMLString)({
      value: newValue,
      ...mapRichTextSettings(blockAType.attributes[newAttributeKey])
    });
    updatedAttributes[newAttributeKey] = newHtml;
    dispatch.selectionChange(blockA.clientId, newAttributeKey, newOffset, newOffset);
  }

  dispatch.replaceBlocks([blockA.clientId, blockB.clientId], [{ ...blockA,
    attributes: { ...blockA.attributes,
      ...updatedAttributes
    }
  }, ...blocksWithTheSameType.slice(1)], 0 // If we don't pass the `indexToSelect` it will default to the last block.
  );
};
/**
 * Yields action objects used in signalling that the blocks corresponding to
 * the set of specified client IDs are to be removed.
 *
 * @param {string|string[]} clientIds      Client IDs of blocks to remove.
 * @param {boolean}         selectPrevious True if the previous block should be
 *                                         selected when a block is removed.
 */

const removeBlocks = function (clientIds) {
  let selectPrevious = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : true;
  return _ref16 => {
    let {
      select,
      dispatch
    } = _ref16;

    if (!clientIds || !clientIds.length) {
      return;
    }

    clientIds = (0,external_lodash_namespaceObject.castArray)(clientIds);
    const rootClientId = select.getBlockRootClientId(clientIds[0]);
    const canRemoveBlocks = select.canRemoveBlocks(clientIds, rootClientId);

    if (!canRemoveBlocks) {
      return;
    }

    if (selectPrevious) {
      dispatch.selectPreviousBlock(clientIds[0]);
    }

    dispatch({
      type: 'REMOVE_BLOCKS',
      clientIds
    }); // To avoid a focus loss when removing the last block, assure there is
    // always a default block if the last of the blocks have been removed.

    dispatch(ensureDefaultBlock());
  };
};
/**
 * Returns an action object used in signalling that the block with the
 * specified client ID is to be removed.
 *
 * @param {string}  clientId       Client ID of block to remove.
 * @param {boolean} selectPrevious True if the previous block should be
 *                                 selected when a block is removed.
 *
 * @return {Object} Action object.
 */

function removeBlock(clientId, selectPrevious) {
  return removeBlocks([clientId], selectPrevious);
}
/* eslint-disable jsdoc/valid-types */

/**
 * Returns an action object used in signalling that the inner blocks with the
 * specified client ID should be replaced.
 *
 * @param {string}    rootClientId    Client ID of the block whose InnerBlocks will re replaced.
 * @param {Object[]}  blocks          Block objects to insert as new InnerBlocks
 * @param {?boolean}  updateSelection If true block selection will be updated. If false, block selection will not change. Defaults to false.
 * @param {0|-1|null} initialPosition Initial block position.
 * @return {Object} Action object.
 */

function replaceInnerBlocks(rootClientId, blocks) {
  let updateSelection = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false;
  let initialPosition = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : 0;

  /* eslint-enable jsdoc/valid-types */
  return {
    type: 'REPLACE_INNER_BLOCKS',
    rootClientId,
    blocks,
    updateSelection,
    initialPosition: updateSelection ? initialPosition : null,
    time: Date.now()
  };
}
/**
 * Returns an action object used to toggle the block editing mode between
 * visual and HTML modes.
 *
 * @param {string} clientId Block client ID.
 *
 * @return {Object} Action object.
 */

function toggleBlockMode(clientId) {
  return {
    type: 'TOGGLE_BLOCK_MODE',
    clientId
  };
}
/**
 * Returns an action object used in signalling that the user has begun to type.
 *
 * @return {Object} Action object.
 */

function startTyping() {
  return {
    type: 'START_TYPING'
  };
}
/**
 * Returns an action object used in signalling that the user has stopped typing.
 *
 * @return {Object} Action object.
 */

function stopTyping() {
  return {
    type: 'STOP_TYPING'
  };
}
/**
 * Returns an action object used in signalling that the user has begun to drag blocks.
 *
 * @param {string[]} clientIds An array of client ids being dragged
 *
 * @return {Object} Action object.
 */

function startDraggingBlocks() {
  let clientIds = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : [];
  return {
    type: 'START_DRAGGING_BLOCKS',
    clientIds
  };
}
/**
 * Returns an action object used in signalling that the user has stopped dragging blocks.
 *
 * @return {Object} Action object.
 */

function stopDraggingBlocks() {
  return {
    type: 'STOP_DRAGGING_BLOCKS'
  };
}
/**
 * Returns an action object used in signalling that the caret has entered formatted text.
 *
 * @return {Object} Action object.
 */

function enterFormattedText() {
  return {
    type: 'ENTER_FORMATTED_TEXT'
  };
}
/**
 * Returns an action object used in signalling that the user caret has exited formatted text.
 *
 * @return {Object} Action object.
 */

function exitFormattedText() {
  return {
    type: 'EXIT_FORMATTED_TEXT'
  };
}
/**
 * Action that changes the position of the user caret.
 *
 * @param {string|WPSelection} clientId     The selected block client ID.
 * @param {string}             attributeKey The selected block attribute key.
 * @param {number}             startOffset  The start offset.
 * @param {number}             endOffset    The end offset.
 *
 * @return {Object} Action object.
 */

function selectionChange(clientId, attributeKey, startOffset, endOffset) {
  if (typeof clientId === 'string') {
    return {
      type: 'SELECTION_CHANGE',
      clientId,
      attributeKey,
      startOffset,
      endOffset
    };
  }

  return {
    type: 'SELECTION_CHANGE',
    ...clientId
  };
}
/**
 * Action that adds a new block of the default type to the block list.
 *
 * @param {?Object} attributes   Optional attributes of the block to assign.
 * @param {?string} rootClientId Optional root client ID of block list on which
 *                               to append.
 * @param {?number} index        Optional index where to insert the default block.
 */

const insertDefaultBlock = (attributes, rootClientId, index) => _ref17 => {
  let {
    dispatch
  } = _ref17;
  // Abort if there is no default block type (if it has been unregistered).
  const defaultBlockName = (0,external_wp_blocks_namespaceObject.getDefaultBlockName)();

  if (!defaultBlockName) {
    return;
  }

  const block = (0,external_wp_blocks_namespaceObject.createBlock)(defaultBlockName, attributes);
  return dispatch.insertBlock(block, index, rootClientId);
};
/**
 * Action that changes the nested settings of a given block.
 *
 * @param {string} clientId Client ID of the block whose nested setting are
 *                          being received.
 * @param {Object} settings Object with the new settings for the nested block.
 *
 * @return {Object} Action object
 */

function updateBlockListSettings(clientId, settings) {
  return {
    type: 'UPDATE_BLOCK_LIST_SETTINGS',
    clientId,
    settings
  };
}
/**
 * Action that updates the block editor settings.
 *
 * @param {Object} settings Updated settings
 *
 * @return {Object} Action object
 */

function updateSettings(settings) {
  return {
    type: 'UPDATE_SETTINGS',
    settings
  };
}
/**
 * Action that signals that a temporary reusable block has been saved
 * in order to switch its temporary id with the real id.
 *
 * @param {string} id        Reusable block's id.
 * @param {string} updatedId Updated block's id.
 *
 * @return {Object} Action object.
 */

function __unstableSaveReusableBlock(id, updatedId) {
  return {
    type: 'SAVE_REUSABLE_BLOCK_SUCCESS',
    id,
    updatedId
  };
}
/**
 * Action that marks the last block change explicitly as persistent.
 *
 * @return {Object} Action object.
 */

function __unstableMarkLastChangeAsPersistent() {
  return {
    type: 'MARK_LAST_CHANGE_AS_PERSISTENT'
  };
}
/**
 * Action that signals that the next block change should be marked explicitly as not persistent.
 *
 * @return {Object} Action object.
 */

function __unstableMarkNextChangeAsNotPersistent() {
  return {
    type: 'MARK_NEXT_CHANGE_AS_NOT_PERSISTENT'
  };
}
/**
 * Action that marks the last block change as an automatic change, meaning it was not
 * performed by the user, and can be undone using the `Escape` and `Backspace` keys.
 * This action must be called after the change was made, and any actions that are a
 * consequence of it, so it is recommended to be called at the next idle period to ensure all
 * selection changes have been recorded.
 */

const __unstableMarkAutomaticChange = () => _ref18 => {
  let {
    dispatch
  } = _ref18;
  dispatch({
    type: 'MARK_AUTOMATIC_CHANGE'
  });
  const {
    requestIdleCallback = cb => setTimeout(cb, 100)
  } = window;
  requestIdleCallback(() => {
    dispatch({
      type: 'MARK_AUTOMATIC_CHANGE_FINAL'
    });
  });
};
/**
 * Action that enables or disables the navigation mode.
 *
 * @param {string} isNavigationMode Enable/Disable navigation mode.
 */

const setNavigationMode = function () {
  let isNavigationMode = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : true;
  return _ref19 => {
    let {
      dispatch
    } = _ref19;
    dispatch({
      type: 'SET_NAVIGATION_MODE',
      isNavigationMode
    });

    if (isNavigationMode) {
      (0,external_wp_a11y_namespaceObject.speak)((0,external_wp_i18n_namespaceObject.__)('You are currently in navigation mode. Navigate blocks using the Tab key and Arrow keys. Use Left and Right Arrow keys to move between nesting levels. To exit navigation mode and edit the selected block, press Enter.'));
    } else {
      (0,external_wp_a11y_namespaceObject.speak)((0,external_wp_i18n_namespaceObject.__)('You are currently in edit mode. To return to the navigation mode, press Escape.'));
    }
  };
};
/**
 * Action that enables or disables the block moving mode.
 *
 * @param {string|null} hasBlockMovingClientId Enable/Disable block moving mode.
 */

const setBlockMovingClientId = function () {
  let hasBlockMovingClientId = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : null;
  return _ref20 => {
    let {
      dispatch
    } = _ref20;
    dispatch({
      type: 'SET_BLOCK_MOVING_MODE',
      hasBlockMovingClientId
    });

    if (hasBlockMovingClientId) {
      (0,external_wp_a11y_namespaceObject.speak)((0,external_wp_i18n_namespaceObject.__)('Use the Tab key and Arrow keys to choose new block location. Use Left and Right Arrow keys to move between nesting levels. Once location is selected press Enter or Space to move the block.'));
    }
  };
};
/**
 * Action that duplicates a list of blocks.
 *
 * @param {string[]} clientIds
 * @param {boolean}  updateSelection
 */

const duplicateBlocks = function (clientIds) {
  let updateSelection = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : true;
  return _ref21 => {
    let {
      select,
      dispatch
    } = _ref21;

    if (!clientIds || !clientIds.length) {
      return;
    } // Return early if blocks don't exist.


    const blocks = select.getBlocksByClientId(clientIds);

    if ((0,external_lodash_namespaceObject.some)(blocks, block => !block)) {
      return;
    } // Return early if blocks don't support multiple usage.


    const blockNames = blocks.map(block => block.name);

    if (blockNames.some(blockName => !(0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockName, 'multiple', true))) {
      return;
    }

    const rootClientId = select.getBlockRootClientId(clientIds[0]);
    const lastSelectedIndex = select.getBlockIndex((0,external_lodash_namespaceObject.last)((0,external_lodash_namespaceObject.castArray)(clientIds)));
    const clonedBlocks = blocks.map(block => (0,external_wp_blocks_namespaceObject.__experimentalCloneSanitizedBlock)(block));
    dispatch.insertBlocks(clonedBlocks, lastSelectedIndex + 1, rootClientId, updateSelection);

    if (clonedBlocks.length > 1 && updateSelection) {
      dispatch.multiSelect((0,external_lodash_namespaceObject.first)(clonedBlocks).clientId, (0,external_lodash_namespaceObject.last)(clonedBlocks).clientId);
    }

    return clonedBlocks.map(block => block.clientId);
  };
};
/**
 * Action that inserts an empty block before a given block.
 *
 * @param {string} clientId
 */

const insertBeforeBlock = clientId => _ref22 => {
  let {
    select,
    dispatch
  } = _ref22;

  if (!clientId) {
    return;
  }

  const rootClientId = select.getBlockRootClientId(clientId);
  const isLocked = select.getTemplateLock(rootClientId);

  if (isLocked) {
    return;
  }

  const firstSelectedIndex = select.getBlockIndex(clientId);
  return dispatch.insertDefaultBlock({}, rootClientId, firstSelectedIndex);
};
/**
 * Action that inserts an empty block after a given block.
 *
 * @param {string} clientId
 */

const insertAfterBlock = clientId => _ref23 => {
  let {
    select,
    dispatch
  } = _ref23;

  if (!clientId) {
    return;
  }

  const rootClientId = select.getBlockRootClientId(clientId);
  const isLocked = select.getTemplateLock(rootClientId);

  if (isLocked) {
    return;
  }

  const firstSelectedIndex = select.getBlockIndex(clientId);
  return dispatch.insertDefaultBlock({}, rootClientId, firstSelectedIndex + 1);
};
/**
 * Action that toggles the highlighted block state.
 *
 * @param {string}  clientId      The block's clientId.
 * @param {boolean} isHighlighted The highlight state.
 */

function toggleBlockHighlight(clientId, isHighlighted) {
  return {
    type: 'TOGGLE_BLOCK_HIGHLIGHT',
    clientId,
    isHighlighted
  };
}
/**
 * Action that "flashes" the block with a given `clientId` by rhythmically highlighting it.
 *
 * @param {string} clientId Target block client ID.
 */

const flashBlock = clientId => async _ref24 => {
  let {
    dispatch
  } = _ref24;
  dispatch(toggleBlockHighlight(clientId, true));
  await new Promise(resolve => setTimeout(resolve, 150));
  dispatch(toggleBlockHighlight(clientId, false));
};
/**
 * Action that sets whether a block has controlled inner blocks.
 *
 * @param {string}  clientId                 The block's clientId.
 * @param {boolean} hasControlledInnerBlocks True if the block's inner blocks are controlled.
 */

function setHasControlledInnerBlocks(clientId, hasControlledInnerBlocks) {
  return {
    type: 'SET_HAS_CONTROLLED_INNER_BLOCKS',
    hasControlledInnerBlocks,
    clientId
  };
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/store/constants.js
const STORE_NAME = 'core/block-editor';

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/store/index.js
/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */





/**
 * Block editor data store configuration.
 *
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/data/README.md#registerStore
 *
 * @type {Object}
 */

const storeConfig = {
  reducer: reducer,
  selectors: selectors_namespaceObject,
  actions: actions_namespaceObject
};
/**
 * Store definition for the block editor namespace.
 *
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/data/README.md#createReduxStore
 *
 * @type {Object}
 */

const store = (0,external_wp_data_namespaceObject.createReduxStore)(STORE_NAME, { ...storeConfig,
  persist: ['preferences']
}); // Ideally we'd use register instead of register stores.

(0,external_wp_data_namespaceObject.registerStore)(STORE_NAME, { ...storeConfig,
  persist: ['preferences']
});

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-edit/context.js
/**
 * WordPress dependencies
 */

const DEFAULT_BLOCK_EDIT_CONTEXT = {
  name: '',
  isSelected: false
};
const Context = (0,external_wp_element_namespaceObject.createContext)(DEFAULT_BLOCK_EDIT_CONTEXT);
const {
  Provider
} = Context;

/**
 * A hook that returns the block edit context.
 *
 * @return {Object} Block edit context
 */

function useBlockEditContext() {
  return (0,external_wp_element_namespaceObject.useContext)(Context);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/use-display-block-controls/index.js
/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */



function useDisplayBlockControls() {
  const {
    isSelected,
    clientId,
    name
  } = useBlockEditContext();
  return (0,external_wp_data_namespaceObject.useSelect)(select => {
    if (isSelected) {
      return true;
    }

    const {
      getBlockName,
      isFirstMultiSelectedBlock,
      getMultiSelectedBlockClientIds
    } = select(store);

    if (isFirstMultiSelectedBlock(clientId)) {
      return getMultiSelectedBlockClientIds().every(id => getBlockName(id) === name);
    }

    return false;
  }, [clientId, isSelected, name]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-controls/hook.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */





function useBlockControlsFill(group, shareWithChildBlocks) {
  const isDisplayed = useDisplayBlockControls();
  const {
    clientId
  } = useBlockEditContext();
  const isParentDisplayed = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getBlockName,
      hasSelectedInnerBlock
    } = select(store);
    const {
      hasBlockSupport
    } = select(external_wp_blocks_namespaceObject.store);
    return shareWithChildBlocks && hasBlockSupport(getBlockName(clientId), '__experimentalExposeControlsToChildren', false) && hasSelectedInnerBlock(clientId);
  }, [shareWithChildBlocks, clientId]);

  if (isDisplayed) {
    var _groups$group;

    return (_groups$group = block_controls_groups[group]) === null || _groups$group === void 0 ? void 0 : _groups$group.Fill;
  }

  if (isParentDisplayed) {
    return block_controls_groups.parent.Fill;
  }

  return null;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-controls/fill.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


function BlockControlsFill(_ref) {
  let {
    group = 'default',
    controls,
    children,
    __experimentalShareWithChildBlocks = false
  } = _ref;
  const Fill = useBlockControlsFill(group, __experimentalShareWithChildBlocks);

  if (!Fill) {
    return null;
  }

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalStyleProvider, {
    document: document
  }, (0,external_wp_element_namespaceObject.createElement)(Fill, null, fillProps => {
    // Children passed to BlockControlsFill will not have access to any
    // React Context whose Provider is part of the BlockControlsSlot tree.
    // So we re-create the Provider in this subtree.
    const value = !(0,external_lodash_namespaceObject.isEmpty)(fillProps) ? fillProps : null;
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToolbarContext.Provider, {
      value: value
    }, group === 'default' && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarGroup, {
      controls: controls
    }), children);
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-controls/slot.js



/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


function BlockControlsSlot(_ref) {
  let {
    group = 'default',
    ...props
  } = _ref;
  const accessibleToolbarState = (0,external_wp_element_namespaceObject.useContext)(external_wp_components_namespaceObject.__experimentalToolbarContext);
  const Slot = block_controls_groups[group].Slot;
  const slot = (0,external_wp_components_namespaceObject.__experimentalUseSlot)(Slot.__unstableName);
  const hasFills = Boolean(slot.fills && slot.fills.length);

  if (!hasFills) {
    return null;
  }

  if (group === 'default') {
    return (0,external_wp_element_namespaceObject.createElement)(Slot, _extends({}, props, {
      bubblesVirtually: true,
      fillProps: accessibleToolbarState
    }));
  }

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarGroup, null, (0,external_wp_element_namespaceObject.createElement)(Slot, _extends({}, props, {
    bubblesVirtually: true,
    fillProps: accessibleToolbarState
  })));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-controls/index.js



/**
 * Internal dependencies
 */


const BlockControls = BlockControlsFill;
BlockControls.Slot = BlockControlsSlot; // This is just here for backward compatibility.

const BlockFormatControls = props => {
  return (0,external_wp_element_namespaceObject.createElement)(BlockControlsFill, _extends({
    group: "inline"
  }, props));
};

BlockFormatControls.Slot = props => {
  return (0,external_wp_element_namespaceObject.createElement)(BlockControlsSlot, _extends({
    group: "inline"
  }, props));
};

/* harmony default export */ var block_controls = (BlockControls);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/align-none.js


/**
 * WordPress dependencies
 */

const alignNone = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M5 15h14V9H5v6zm0 4.8h14v-1.5H5v1.5zM5 4.2v1.5h14V4.2H5z"
}));
/* harmony default export */ var align_none = (alignNone);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/position-left.js


/**
 * WordPress dependencies
 */

const positionLeft = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M4 9v6h14V9H4zm8-4.8H4v1.5h8V4.2zM4 19.8h8v-1.5H4v1.5z"
}));
/* harmony default export */ var position_left = (positionLeft);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/position-center.js


/**
 * WordPress dependencies
 */

const positionCenter = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M7 9v6h10V9H7zM5 19.8h14v-1.5H5v1.5zM5 4.3v1.5h14V4.3H5z"
}));
/* harmony default export */ var position_center = (positionCenter);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/position-right.js


/**
 * WordPress dependencies
 */

const positionRight = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M6 15h14V9H6v6zm6-10.8v1.5h8V4.2h-8zm0 15.6h8v-1.5h-8v1.5z"
}));
/* harmony default export */ var position_right = (positionRight);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/stretch-wide.js


/**
 * WordPress dependencies
 */

const stretchWide = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M5 9v6h14V9H5zm11-4.8H8v1.5h8V4.2zM8 19.8h8v-1.5H8v1.5z"
}));
/* harmony default export */ var stretch_wide = (stretchWide);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/stretch-full-width.js


/**
 * WordPress dependencies
 */

const stretchFullWidth = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M5 4v11h14V4H5zm3 15.8h8v-1.5H8v1.5z"
}));
/* harmony default export */ var stretch_full_width = (stretchFullWidth);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/justify-left.js


/**
 * WordPress dependencies
 */

const justifyLeft = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M9 9v6h11V9H9zM4 20h1.5V4H4v16z"
}));
/* harmony default export */ var justify_left = (justifyLeft);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/justify-center.js


/**
 * WordPress dependencies
 */

const justifyCenter = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M20 9h-7.2V4h-1.6v5H4v6h7.2v5h1.6v-5H20z"
}));
/* harmony default export */ var justify_center = (justifyCenter);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/justify-right.js


/**
 * WordPress dependencies
 */

const justifyRight = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M4 15h11V9H4v6zM18.5 4v16H20V4h-1.5z"
}));
/* harmony default export */ var justify_right = (justifyRight);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/justify-space-between.js


/**
 * WordPress dependencies
 */

const justifySpaceBetween = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M9 15h6V9H9v6zm-5 5h1.5V4H4v16zM18.5 4v16H20V4h-1.5z"
}));
/* harmony default export */ var justify_space_between = (justifySpaceBetween);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/arrow-right.js


/**
 * WordPress dependencies
 */

const arrowRight = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M14.3 6.7l-1.1 1.1 4 4H4v1.5h13.3l-4.1 4.4 1.1 1.1 5.8-6.3z"
}));
/* harmony default export */ var arrow_right = (arrowRight);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/arrow-down.js


/**
 * WordPress dependencies
 */

const arrowDown = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M16.2 13.2l-4 4V4h-1.5v13.3l-4.5-4.1-1 1.1 6.2 5.8 5.8-5.8-1-1.1z"
}));
/* harmony default export */ var arrow_down = (arrowDown);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/layouts/utils.js
/**
 * Utility to generate the proper CSS selector for layout styles.
 *
 * @param {string|string[]} selectors - CSS selectors
 * @param {boolean}         append    - string to append.
 *
 * @return {string} - CSS selector.
 */
function appendSelectors(selectors) {
  let append = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : '';
  // Ideally we shouldn't need the `.editor-styles-wrapper` increased specificity here
  // The problem though is that we have a `.editor-styles-wrapper p { margin: reset; }` style
  // it's used to reset the default margin added by wp-admin to paragraphs
  // so we need this to be higher speficity otherwise, it won't be applied to paragraphs inside containers
  // When the post editor is fully iframed, this extra classname could be removed.
  return selectors.split(',').map(subselector => `.editor-styles-wrapper ${subselector} ${append}`).join(',');
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/provider/block-refs-provider.js


/**
 * WordPress dependencies
 */

const BlockRefs = (0,external_wp_element_namespaceObject.createContext)({
  refs: new Map(),
  callbacks: new Map()
});
function BlockRefsProvider(_ref) {
  let {
    children
  } = _ref;
  const value = (0,external_wp_element_namespaceObject.useMemo)(() => ({
    refs: new Map(),
    callbacks: new Map()
  }), []);
  return (0,external_wp_element_namespaceObject.createElement)(BlockRefs.Provider, {
    value: value
  }, children);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/use-block-props/use-block-refs.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


/** @typedef {import('@wordpress/element').RefCallback} RefCallback */

/** @typedef {import('@wordpress/element').RefObject} RefObject */

/**
 * Provides a ref to the BlockRefs context.
 *
 * @param {string} clientId The client ID of the element ref.
 *
 * @return {RefCallback} Ref callback.
 */

function useBlockRefProvider(clientId) {
  const {
    refs,
    callbacks
  } = (0,external_wp_element_namespaceObject.useContext)(BlockRefs);
  const ref = (0,external_wp_element_namespaceObject.useRef)();
  (0,external_wp_element_namespaceObject.useLayoutEffect)(() => {
    refs.set(ref, clientId);
    return () => {
      refs.delete(ref);
    };
  }, [clientId]);
  return (0,external_wp_compose_namespaceObject.useRefEffect)(element => {
    // Update the ref in the provider.
    ref.current = element; // Call any update functions.

    callbacks.forEach((id, setElement) => {
      if (clientId === id) {
        setElement(element);
      }
    });
  }, [clientId]);
}
/**
 * Gets a ref pointing to the current block element. Continues to return a
 * stable ref even if the block client ID changes.
 *
 * @param {string} clientId The client ID to get a ref for.
 *
 * @return {RefObject} A ref containing the element.
 */

function useBlockRef(clientId) {
  const {
    refs
  } = (0,external_wp_element_namespaceObject.useContext)(BlockRefs);
  const freshClientId = (0,external_wp_element_namespaceObject.useRef)();
  freshClientId.current = clientId; // Always return an object, even if no ref exists for a given client ID, so
  // that `current` works at a later point.

  return (0,external_wp_element_namespaceObject.useMemo)(() => ({
    get current() {
      let element = null; // Multiple refs may be created for a single block. Find the
      // first that has an element set.

      for (const [ref, id] of refs.entries()) {
        if (id === freshClientId.current && ref.current) {
          element = ref.current;
        }
      }

      return element;
    }

  }), []);
}
/**
 * Return the element for a given client ID. Updates whenever the element
 * changes, becomes available, or disappears.
 *
 * @param {string} clientId The client ID to an element for.
 *
 * @return {Element|null} The block's wrapper element.
 */


function useBlockElement(clientId) {
  const {
    callbacks
  } = (0,external_wp_element_namespaceObject.useContext)(BlockRefs);
  const ref = useBlockRef(clientId);
  const [element, setElement] = (0,external_wp_element_namespaceObject.useState)(null);
  (0,external_wp_element_namespaceObject.useLayoutEffect)(() => {
    if (!clientId) {
      return;
    }

    callbacks.set(setElement, clientId);
    return () => {
      callbacks.delete(setElement);
    };
  }, [clientId]);
  return ref.current || element;
}




;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/use-setting/index.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */



const blockedPaths = ['color', 'border', 'typography', 'spacing'];
const deprecatedFlags = {
  'color.palette': settings => settings.colors === undefined ? undefined : settings.colors,
  'color.gradients': settings => settings.gradients === undefined ? undefined : settings.gradients,
  'color.custom': settings => settings.disableCustomColors === undefined ? undefined : !settings.disableCustomColors,
  'color.customGradient': settings => settings.disableCustomGradients === undefined ? undefined : !settings.disableCustomGradients,
  'typography.fontSizes': settings => settings.fontSizes === undefined ? undefined : settings.fontSizes,
  'typography.customFontSize': settings => settings.disableCustomFontSizes === undefined ? undefined : !settings.disableCustomFontSizes,
  'typography.lineHeight': settings => settings.enableCustomLineHeight,
  'spacing.units': settings => {
    if (settings.enableCustomUnits === undefined) {
      return;
    }

    if (settings.enableCustomUnits === true) {
      return ['px', 'em', 'rem', 'vh', 'vw', '%'];
    }

    return settings.enableCustomUnits;
  },
  'spacing.padding': settings => settings.enableCustomSpacing
};
const prefixedFlags = {
  /*
   * These were only available in the plugin
   * and can be removed when the minimum WordPress version
   * for the plugin is 5.9.
   */
  'border.customColor': 'border.color',
  'border.customStyle': 'border.style',
  'border.customWidth': 'border.width',
  'typography.customFontStyle': 'typography.fontStyle',
  'typography.customFontWeight': 'typography.fontWeight',
  'typography.customLetterSpacing': 'typography.letterSpacing',
  'typography.customTextDecorations': 'typography.textDecoration',
  'typography.customTextTransforms': 'typography.textTransform',

  /*
   * These were part of WordPress 5.8 and we need to keep them.
   */
  'border.customRadius': 'border.radius',
  'spacing.customMargin': 'spacing.margin',
  'spacing.customPadding': 'spacing.padding',
  'typography.customLineHeight': 'typography.lineHeight'
};
/**
 * Remove `custom` prefixes for flags that did not land in 5.8.
 *
 * This provides continued support for `custom` prefixed properties. It will
 * be removed once third party devs have had sufficient time to update themes,
 * plugins, etc.
 *
 * @see https://github.com/WordPress/gutenberg/pull/34485
 *
 * @param {string} path Path to desired value in settings.
 * @return {string}     The value for defined setting.
 */

const removeCustomPrefixes = path => {
  return prefixedFlags[path] || path;
};
/**
 * Hook that retrieves the editor setting.
 * It works with nested objects using by finding the value at path.
 *
 * @param {string} path The path to the setting.
 * @return {any} Returns the value defined for the setting.
 * @example
 * ```js
 * const isEnabled = useSetting( 'typography.dropCap' );
 * ```
 */


function useSetting(path) {
  const {
    name: blockName
  } = useBlockEditContext();
  const setting = (0,external_wp_data_namespaceObject.useSelect)(select => {
    var _get;

    if (blockedPaths.includes(path)) {
      // eslint-disable-next-line no-console
      console.warn('Top level useSetting paths are disabled. Please use a subpath to query the information needed.');
      return undefined;
    }

    const settings = select(store).getSettings(); // 1 - Use __experimental features, if available.
    // We cascade to the all value if the block one is not available.

    const normalizedPath = removeCustomPrefixes(path);
    const defaultsPath = `__experimentalFeatures.${normalizedPath}`;
    const blockPath = `__experimentalFeatures.blocks.${blockName}.${normalizedPath}`;
    const experimentalFeaturesResult = (_get = (0,external_lodash_namespaceObject.get)(settings, blockPath)) !== null && _get !== void 0 ? _get : (0,external_lodash_namespaceObject.get)(settings, defaultsPath);

    if (experimentalFeaturesResult !== undefined) {
      if (external_wp_blocks_namespaceObject.__EXPERIMENTAL_PATHS_WITH_MERGE[normalizedPath]) {
        var _ref, _experimentalFeatures;

        return (_ref = (_experimentalFeatures = experimentalFeaturesResult.custom) !== null && _experimentalFeatures !== void 0 ? _experimentalFeatures : experimentalFeaturesResult.theme) !== null && _ref !== void 0 ? _ref : experimentalFeaturesResult.default;
      }

      return experimentalFeaturesResult;
    } // 2 - Use deprecated settings, otherwise.


    const deprecatedSettingsValue = deprecatedFlags[normalizedPath] ? deprecatedFlags[normalizedPath](settings) : undefined;

    if (deprecatedSettingsValue !== undefined) {
      return deprecatedSettingsValue;
    } // 3 - Fall back for typography.dropCap:
    // This is only necessary to support typography.dropCap.
    // when __experimentalFeatures are not present (core without plugin).
    // To remove when __experimentalFeatures are ported to core.


    return normalizedPath === 'typography.dropCap' ? true : undefined;
  }, [blockName, path]);
  return setting;
}

;// CONCATENATED MODULE: external ["wp","warning"]
var external_wp_warning_namespaceObject = window["wp"]["warning"];
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inspector-controls/groups.js
/**
 * WordPress dependencies
 */

const InspectorControlsDefault = (0,external_wp_components_namespaceObject.createSlotFill)('InspectorControls');
const InspectorControlsAdvanced = (0,external_wp_components_namespaceObject.createSlotFill)('InspectorAdvancedControls');
const InspectorControlsBorder = (0,external_wp_components_namespaceObject.createSlotFill)('InspectorControlsBorder');
const InspectorControlsColor = (0,external_wp_components_namespaceObject.createSlotFill)('InspectorControlsColor');
const InspectorControlsDimensions = (0,external_wp_components_namespaceObject.createSlotFill)('InspectorControlsDimensions');
const InspectorControlsTypography = (0,external_wp_components_namespaceObject.createSlotFill)('InspectorControlsTypography');
const groups_groups = {
  default: InspectorControlsDefault,
  advanced: InspectorControlsAdvanced,
  border: InspectorControlsBorder,
  color: InspectorControlsColor,
  dimensions: InspectorControlsDimensions,
  typography: InspectorControlsTypography
};
/* harmony default export */ var inspector_controls_groups = (groups_groups);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inspector-controls/fill.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */



function InspectorControlsFill(_ref) {
  var _groups$group;

  let {
    __experimentalGroup: group = 'default',
    children
  } = _ref;
  const isDisplayed = useDisplayBlockControls();
  const Fill = (_groups$group = inspector_controls_groups[group]) === null || _groups$group === void 0 ? void 0 : _groups$group.Fill;

  if (!Fill) {
    typeof process !== "undefined" && process.env && "production" !== "production" ? 0 : void 0;
    return null;
  }

  if (!isDisplayed) {
    return null;
  }

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalStyleProvider, {
    document: document
  }, (0,external_wp_element_namespaceObject.createElement)(Fill, null, fillProps => {
    // Children passed to InspectorControlsFill will not have
    // access to any React Context whose Provider is part of
    // the InspectorControlsSlot tree. So we re-create the
    // Provider in this subtree.
    const value = !(0,external_lodash_namespaceObject.isEmpty)(fillProps) ? fillProps : null;
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToolsPanelContext.Provider, {
      value: value
    }, children);
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/utils.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */


/**
 * Removed falsy values from nested object.
 *
 * @param {*} object
 * @return {*} Object cleaned from falsy values
 */

const cleanEmptyObject = object => {
  if (!(0,external_lodash_namespaceObject.isObject)(object) || Array.isArray(object)) {
    return object;
  }

  const cleanedNestedObjects = (0,external_lodash_namespaceObject.pickBy)((0,external_lodash_namespaceObject.mapValues)(object, cleanEmptyObject), external_lodash_namespaceObject.identity);
  return (0,external_lodash_namespaceObject.isEmpty)(cleanedNestedObjects) ? undefined : cleanedNestedObjects;
};
function immutableSet(object, path, value) {
  return (0,external_lodash_namespaceObject.setWith)(object ? (0,external_lodash_namespaceObject.clone)(object) : {}, path, value, external_lodash_namespaceObject.clone);
}
function transformStyles(activeSupports, migrationPaths, result, source, index, results) {
  var _source$;

  // If there are no active supports return early.
  if ((0,external_lodash_namespaceObject.every)(activeSupports, isActive => !isActive)) {
    return result;
  } // If the condition verifies we are probably in the presence of a wrapping transform
  // e.g: nesting paragraphs in a group or columns and in that case the styles should not be transformed.


  if (results.length === 1 && result.innerBlocks.length === source.length) {
    return result;
  } // For cases where we have a transform from one block to multiple blocks
  // or multiple blocks to one block we apply the styles of the first source block
  // to the result(s).


  let referenceBlockAttributes = (_source$ = source[0]) === null || _source$ === void 0 ? void 0 : _source$.attributes; // If we are in presence of transform between more than one block in the source
  // that has more than one block in the result
  // we apply the styles on source N to the result N,
  // if source N does not exists we do nothing.

  if (results.length > 1 && source.length > 1) {
    if (source[index]) {
      var _source$index;

      referenceBlockAttributes = (_source$index = source[index]) === null || _source$index === void 0 ? void 0 : _source$index.attributes;
    } else {
      return result;
    }
  }

  let returnBlock = result;
  (0,external_lodash_namespaceObject.forEach)(activeSupports, (isActive, support) => {
    if (isActive) {
      migrationPaths[support].forEach(path => {
        const styleValue = (0,external_lodash_namespaceObject.get)(referenceBlockAttributes, path);

        if (styleValue) {
          returnBlock = { ...returnBlock,
            attributes: immutableSet(returnBlock.attributes, path, styleValue)
          };
        }
      });
    }
  });
  return returnBlock;
}
/**
 * Check whether serialization of specific block support feature or set should
 * be skipped.
 *
 * @param {string|Object} blockType  Block name or block type object.
 * @param {string}        featureSet Name of block support feature set.
 * @param {string}        feature    Name of the individual feature to check.
 *
 * @return {boolean} Whether serialization should occur.
 */

function shouldSkipSerialization(blockType, featureSet, feature) {
  const support = (0,external_wp_blocks_namespaceObject.getBlockSupport)(blockType, featureSet);
  const skipSerialization = support === null || support === void 0 ? void 0 : support.__experimentalSkipSerialization;

  if (Array.isArray(skipSerialization)) {
    return skipSerialization.includes(feature);
  }

  return skipSerialization;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inspector-controls/block-support-tools-panel.js


/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */



function BlockSupportToolsPanel(_ref) {
  let {
    children,
    group,
    label
  } = _ref;
  const {
    updateBlockAttributes
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const {
    getBlockAttributes,
    getMultiSelectedBlockClientIds,
    getSelectedBlockClientId,
    hasMultiSelection
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const panelId = getSelectedBlockClientId();
  const resetAll = (0,external_wp_element_namespaceObject.useCallback)(function () {
    let resetFilters = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : [];
    const newAttributes = {};
    const clientIds = hasMultiSelection() ? getMultiSelectedBlockClientIds() : [panelId];
    clientIds.forEach(clientId => {
      const {
        style
      } = getBlockAttributes(clientId);
      let newBlockAttributes = {
        style
      };
      resetFilters.forEach(resetFilter => {
        newBlockAttributes = { ...newBlockAttributes,
          ...resetFilter(newBlockAttributes)
        };
      }); // Enforce a cleaned style object.

      newBlockAttributes = { ...newBlockAttributes,
        style: cleanEmptyObject(newBlockAttributes.style)
      };
      newAttributes[clientId] = newBlockAttributes;
    });
    updateBlockAttributes(clientIds, newAttributes, true);
  }, [cleanEmptyObject, getBlockAttributes, getMultiSelectedBlockClientIds, hasMultiSelection, panelId, updateBlockAttributes]);
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToolsPanel, {
    className: `${group}-block-support-panel`,
    label: label,
    resetAll: resetAll,
    key: panelId,
    panelId: panelId,
    hasInnerWrapper: true,
    shouldRenderPlaceholderItems: true // Required to maintain fills ordering.
    ,
    __experimentalFirstVisibleItemClass: "first",
    __experimentalLastVisibleItemClass: "last"
  }, children);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inspector-controls/block-support-slot-container.js



/**
 * WordPress dependencies
 */


function BlockSupportSlotContainer(_ref) {
  let {
    Slot,
    ...props
  } = _ref;
  const toolsPanelContext = (0,external_wp_element_namespaceObject.useContext)(external_wp_components_namespaceObject.__experimentalToolsPanelContext);
  return (0,external_wp_element_namespaceObject.createElement)(Slot, _extends({}, props, {
    fillProps: toolsPanelContext,
    bubblesVirtually: true
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inspector-controls/slot.js



/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */




function InspectorControlsSlot(_ref) {
  var _groups$group;

  let {
    __experimentalGroup: group = 'default',
    label,
    ...props
  } = _ref;
  const Slot = (_groups$group = inspector_controls_groups[group]) === null || _groups$group === void 0 ? void 0 : _groups$group.Slot;
  const slot = (0,external_wp_components_namespaceObject.__experimentalUseSlot)(Slot === null || Slot === void 0 ? void 0 : Slot.__unstableName);

  if (!Slot || !slot) {
    typeof process !== "undefined" && process.env && "production" !== "production" ? 0 : void 0;
    return null;
  }

  const hasFills = Boolean(slot.fills && slot.fills.length);

  if (!hasFills) {
    return null;
  }

  if (label) {
    return (0,external_wp_element_namespaceObject.createElement)(BlockSupportToolsPanel, {
      group: group,
      label: label
    }, (0,external_wp_element_namespaceObject.createElement)(BlockSupportSlotContainer, _extends({}, props, {
      Slot: Slot
    })));
  }

  return (0,external_wp_element_namespaceObject.createElement)(Slot, _extends({}, props, {
    bubblesVirtually: true
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inspector-controls/index.js



/**
 * Internal dependencies
 */


const InspectorControls = InspectorControlsFill;
InspectorControls.Slot = InspectorControlsSlot; // This is just here for backward compatibility.

const InspectorAdvancedControls = props => {
  return (0,external_wp_element_namespaceObject.createElement)(InspectorControlsFill, _extends({}, props, {
    __experimentalGroup: "advanced"
  }));
};

InspectorAdvancedControls.Slot = props => {
  return (0,external_wp_element_namespaceObject.createElement)(InspectorControlsSlot, _extends({}, props, {
    __experimentalGroup: "advanced"
  }));
};

InspectorAdvancedControls.slotName = 'InspectorAdvancedControls';
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/inspector-controls/README.md
 */

/* harmony default export */ var inspector_controls = (InspectorControls);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/margin.js


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */




/**
 * Determines if there is margin support.
 *
 * @param {string|Object} blockType Block name or Block Type object.
 *
 * @return {boolean} Whether there is support.
 */

function hasMarginSupport(blockType) {
  const support = (0,external_wp_blocks_namespaceObject.getBlockSupport)(blockType, SPACING_SUPPORT_KEY);
  return !!(true === support || support !== null && support !== void 0 && support.margin);
}
/**
 * Checks if there is a current value in the margin block support attributes.
 *
 * @param {Object} props Block props.
 * @return {boolean}      Whether or not the block has a margin value set.
 */

function hasMarginValue(props) {
  var _props$attributes$sty, _props$attributes$sty2;

  return ((_props$attributes$sty = props.attributes.style) === null || _props$attributes$sty === void 0 ? void 0 : (_props$attributes$sty2 = _props$attributes$sty.spacing) === null || _props$attributes$sty2 === void 0 ? void 0 : _props$attributes$sty2.margin) !== undefined;
}
/**
 * Resets the margin block support attributes. This can be used when disabling
 * the margin support controls for a block via a `ToolsPanel`.
 *
 * @param {Object} props               Block props.
 * @param {Object} props.attributes    Block's attributes.
 * @param {Object} props.setAttributes Function to set block's attributes.
 */

function resetMargin(_ref) {
  let {
    attributes = {},
    setAttributes
  } = _ref;
  const {
    style
  } = attributes;
  setAttributes({
    style: cleanEmptyObject({ ...style,
      spacing: { ...(style === null || style === void 0 ? void 0 : style.spacing),
        margin: undefined
      }
    })
  });
}
/**
 * Custom hook that checks if margin settings have been disabled.
 *
 * @param {string} name The name of the block.
 *
 * @return {boolean} Whether margin setting is disabled.
 */

function useIsMarginDisabled() {
  let {
    name: blockName
  } = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  const isDisabled = !useSetting('spacing.margin');
  const isInvalid = !useIsDimensionsSupportValid(blockName, 'margin');
  return !hasMarginSupport(blockName) || isDisabled || isInvalid;
}
/**
 * Inspector control panel containing the margin related configuration
 *
 * @param {Object} props Block props.
 *
 * @return {WPElement} Margin edit element.
 */

function MarginEdit(props) {
  var _style$spacing;

  const {
    name: blockName,
    attributes: {
      style
    },
    setAttributes
  } = props;
  const units = (0,external_wp_components_namespaceObject.__experimentalUseCustomUnits)({
    availableUnits: useSetting('spacing.units') || ['%', 'px', 'em', 'rem', 'vw']
  });
  const sides = useCustomSides(blockName, 'margin');
  const splitOnAxis = sides && sides.some(side => AXIAL_SIDES.includes(side));

  if (useIsMarginDisabled(props)) {
    return null;
  }

  const onChange = next => {
    const newStyle = { ...style,
      spacing: { ...(style === null || style === void 0 ? void 0 : style.spacing),
        margin: next
      }
    };
    setAttributes({
      style: cleanEmptyObject(newStyle)
    });
  };

  const onChangeShowVisualizer = next => {
    const newStyle = { ...style,
      visualizers: {
        margin: next
      }
    };
    setAttributes({
      style: cleanEmptyObject(newStyle)
    });
  };

  return external_wp_element_namespaceObject.Platform.select({
    web: (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalBoxControl, {
      values: style === null || style === void 0 ? void 0 : (_style$spacing = style.spacing) === null || _style$spacing === void 0 ? void 0 : _style$spacing.margin,
      onChange: onChange,
      onChangeShowVisualizer: onChangeShowVisualizer,
      label: (0,external_wp_i18n_namespaceObject.__)('Margin'),
      sides: sides,
      units: units,
      allowReset: false,
      splitOnAxis: splitOnAxis
    })),
    native: null
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/padding.js


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */




/**
 * Determines if there is padding support.
 *
 * @param {string|Object} blockType Block name or Block Type object.
 *
 * @return {boolean} Whether there is support.
 */

function hasPaddingSupport(blockType) {
  const support = (0,external_wp_blocks_namespaceObject.getBlockSupport)(blockType, SPACING_SUPPORT_KEY);
  return !!(true === support || support !== null && support !== void 0 && support.padding);
}
/**
 * Checks if there is a current value in the padding block support attributes.
 *
 * @param {Object} props Block props.
 * @return {boolean}      Whether or not the block has a padding value set.
 */

function hasPaddingValue(props) {
  var _props$attributes$sty, _props$attributes$sty2;

  return ((_props$attributes$sty = props.attributes.style) === null || _props$attributes$sty === void 0 ? void 0 : (_props$attributes$sty2 = _props$attributes$sty.spacing) === null || _props$attributes$sty2 === void 0 ? void 0 : _props$attributes$sty2.padding) !== undefined;
}
/**
 * Resets the padding block support attributes. This can be used when disabling
 * the padding support controls for a block via a `ToolsPanel`.
 *
 * @param {Object} props               Block props.
 * @param {Object} props.attributes    Block's attributes.
 * @param {Object} props.setAttributes Function to set block's attributes.
 */

function resetPadding(_ref) {
  let {
    attributes = {},
    setAttributes
  } = _ref;
  const {
    style
  } = attributes;
  setAttributes({
    style: cleanEmptyObject({ ...style,
      spacing: { ...(style === null || style === void 0 ? void 0 : style.spacing),
        padding: undefined
      }
    })
  });
}
/**
 * Custom hook that checks if padding settings have been disabled.
 *
 * @param {string} name The name of the block.
 *
 * @return {boolean} Whether padding setting is disabled.
 */

function useIsPaddingDisabled() {
  let {
    name: blockName
  } = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  const isDisabled = !useSetting('spacing.padding');
  const isInvalid = !useIsDimensionsSupportValid(blockName, 'padding');
  return !hasPaddingSupport(blockName) || isDisabled || isInvalid;
}
/**
 * Inspector control panel containing the padding related configuration
 *
 * @param {Object} props
 *
 * @return {WPElement} Padding edit element.
 */

function PaddingEdit(props) {
  var _style$spacing;

  const {
    name: blockName,
    attributes: {
      style
    },
    setAttributes
  } = props;
  const units = (0,external_wp_components_namespaceObject.__experimentalUseCustomUnits)({
    availableUnits: useSetting('spacing.units') || ['%', 'px', 'em', 'rem', 'vw']
  });
  const sides = useCustomSides(blockName, 'padding');
  const splitOnAxis = sides && sides.some(side => AXIAL_SIDES.includes(side));

  if (useIsPaddingDisabled(props)) {
    return null;
  }

  const onChange = next => {
    const newStyle = { ...style,
      spacing: { ...(style === null || style === void 0 ? void 0 : style.spacing),
        padding: next
      }
    };
    setAttributes({
      style: cleanEmptyObject(newStyle)
    });
  };

  const onChangeShowVisualizer = next => {
    const newStyle = { ...style,
      visualizers: {
        padding: next
      }
    };
    setAttributes({
      style: cleanEmptyObject(newStyle)
    });
  };

  return external_wp_element_namespaceObject.Platform.select({
    web: (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalBoxControl, {
      values: style === null || style === void 0 ? void 0 : (_style$spacing = style.spacing) === null || _style$spacing === void 0 ? void 0 : _style$spacing.padding,
      onChange: onChange,
      onChangeShowVisualizer: onChangeShowVisualizer,
      label: (0,external_wp_i18n_namespaceObject.__)('Padding'),
      sides: sides,
      units: units,
      allowReset: false,
      splitOnAxis: splitOnAxis
    })),
    native: null
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/dimensions.js


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */





const SPACING_SUPPORT_KEY = 'spacing';
const ALL_SIDES = ['top', 'right', 'bottom', 'left'];
const AXIAL_SIDES = ['vertical', 'horizontal'];
/**
 * Inspector controls for dimensions support.
 *
 * @param {Object} props Block props.
 *
 * @return {WPElement} Inspector controls for spacing support features.
 */

function DimensionsPanel(props) {
  const isGapDisabled = useIsGapDisabled(props);
  const isPaddingDisabled = useIsPaddingDisabled(props);
  const isMarginDisabled = useIsMarginDisabled(props);
  const isDisabled = useIsDimensionsDisabled(props);
  const isSupported = hasDimensionsSupport(props.name);

  if (isDisabled || !isSupported) {
    return null;
  }

  const defaultSpacingControls = (0,external_wp_blocks_namespaceObject.getBlockSupport)(props.name, [SPACING_SUPPORT_KEY, '__experimentalDefaultControls']);

  const createResetAllFilter = attribute => newAttributes => {
    var _newAttributes$style;

    return { ...newAttributes,
      style: { ...newAttributes.style,
        spacing: { ...((_newAttributes$style = newAttributes.style) === null || _newAttributes$style === void 0 ? void 0 : _newAttributes$style.spacing),
          [attribute]: undefined
        }
      }
    };
  };

  return (0,external_wp_element_namespaceObject.createElement)(inspector_controls, {
    __experimentalGroup: "dimensions"
  }, !isPaddingDisabled && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToolsPanelItem, {
    hasValue: () => hasPaddingValue(props),
    label: (0,external_wp_i18n_namespaceObject.__)('Padding'),
    onDeselect: () => resetPadding(props),
    resetAllFilter: createResetAllFilter('padding'),
    isShownByDefault: defaultSpacingControls === null || defaultSpacingControls === void 0 ? void 0 : defaultSpacingControls.padding,
    panelId: props.clientId
  }, (0,external_wp_element_namespaceObject.createElement)(PaddingEdit, props)), !isMarginDisabled && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToolsPanelItem, {
    hasValue: () => hasMarginValue(props),
    label: (0,external_wp_i18n_namespaceObject.__)('Margin'),
    onDeselect: () => resetMargin(props),
    resetAllFilter: createResetAllFilter('margin'),
    isShownByDefault: defaultSpacingControls === null || defaultSpacingControls === void 0 ? void 0 : defaultSpacingControls.margin,
    panelId: props.clientId
  }, (0,external_wp_element_namespaceObject.createElement)(MarginEdit, props)), !isGapDisabled && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToolsPanelItem, {
    hasValue: () => hasGapValue(props),
    label: (0,external_wp_i18n_namespaceObject.__)('Block spacing'),
    onDeselect: () => resetGap(props),
    resetAllFilter: createResetAllFilter('blockGap'),
    isShownByDefault: defaultSpacingControls === null || defaultSpacingControls === void 0 ? void 0 : defaultSpacingControls.blockGap,
    panelId: props.clientId
  }, (0,external_wp_element_namespaceObject.createElement)(GapEdit, props)));
}
/**
 * Determine whether there is dimensions related block support.
 *
 * @param {string} blockName Block name.
 *
 * @return {boolean} Whether there is support.
 */

function hasDimensionsSupport(blockName) {
  if (external_wp_element_namespaceObject.Platform.OS !== 'web') {
    return false;
  }

  return hasGapSupport(blockName) || hasPaddingSupport(blockName) || hasMarginSupport(blockName);
}
/**
 * Determines whether dimensions support has been disabled.
 *
 * @param {Object} props Block properties.
 *
 * @return {boolean} If spacing support is completely disabled.
 */

const useIsDimensionsDisabled = function () {
  let props = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  const gapDisabled = useIsGapDisabled(props);
  const paddingDisabled = useIsPaddingDisabled(props);
  const marginDisabled = useIsMarginDisabled(props);
  return gapDisabled && paddingDisabled && marginDisabled;
};
/**
 * Custom hook to retrieve which padding/margin/blockGap is supported
 * e.g. top, right, bottom or left.
 *
 * Sides are opted into by default. It is only if a specific side is set to
 * false that it is omitted.
 *
 * @param {string} blockName Block name.
 * @param {string} feature   The feature custom sides relate to e.g. padding or margins.
 *
 * @return {?string[]} Strings representing the custom sides available.
 */


function useCustomSides(blockName, feature) {
  var _support$feature;

  const support = (0,external_wp_blocks_namespaceObject.getBlockSupport)(blockName, SPACING_SUPPORT_KEY); // Skip when setting is boolean as theme isn't setting arbitrary sides.

  if (!support || typeof support[feature] === 'boolean') {
    return;
  } // Return if the setting is an array of sides (e.g. `[ 'top', 'bottom' ]`).


  if (Array.isArray(support[feature])) {
    return support[feature];
  } // Finally, attempt to return `.sides` if the setting is an object.


  if ((_support$feature = support[feature]) !== null && _support$feature !== void 0 && _support$feature.sides) {
    return support[feature].sides;
  }
}
/**
 * Custom hook to determine whether the sides configured in the
 * block support are valid. A dimension property cannot declare
 * support for a mix of axial and individual sides.
 *
 * @param {string} blockName Block name.
 * @param {string} feature   The feature custom sides relate to e.g. padding or margins.
 *
 * @return {boolean} If the feature has a valid configuration of sides.
 */

function useIsDimensionsSupportValid(blockName, feature) {
  const sides = useCustomSides(blockName, feature);

  if (sides && sides.some(side => ALL_SIDES.includes(side)) && sides.some(side => AXIAL_SIDES.includes(side))) {
    // eslint-disable-next-line no-console
    console.warn(`The ${feature} support for the "${blockName}" block can not be configured to support both axial and arbitrary sides.`);
    return false;
  }

  return true;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/gap.js


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */





/**
 * Determines if there is gap support.
 *
 * @param {string|Object} blockType Block name or Block Type object.
 * @return {boolean}                Whether there is support.
 */

function hasGapSupport(blockType) {
  const support = (0,external_wp_blocks_namespaceObject.getBlockSupport)(blockType, SPACING_SUPPORT_KEY);
  return !!(true === support || support !== null && support !== void 0 && support.blockGap);
}
/**
 * Checks if there is a current value in the gap block support attributes.
 *
 * @param {Object} props Block props.
 * @return {boolean}      Whether or not the block has a gap value set.
 */

function hasGapValue(props) {
  var _props$attributes$sty, _props$attributes$sty2;

  return ((_props$attributes$sty = props.attributes.style) === null || _props$attributes$sty === void 0 ? void 0 : (_props$attributes$sty2 = _props$attributes$sty.spacing) === null || _props$attributes$sty2 === void 0 ? void 0 : _props$attributes$sty2.blockGap) !== undefined;
}
/**
 * Returns a BoxControl object value from a given blockGap style value.
 * The string check is for backwards compatibility before Gutenberg supported
 * split gap values (row and column) and the value was a string n + unit.
 *
 * @param {string? | Object?} blockGapValue A block gap string or axial object value, e.g., '10px' or { top: '10px', left: '10px'}.
 * @return {Object|null}                    A value to pass to the BoxControl component.
 */

function getGapBoxControlValueFromStyle(blockGapValue) {
  if (!blockGapValue) {
    return null;
  }

  const isValueString = typeof blockGapValue === 'string';
  return {
    top: isValueString ? blockGapValue : blockGapValue === null || blockGapValue === void 0 ? void 0 : blockGapValue.top,
    left: isValueString ? blockGapValue : blockGapValue === null || blockGapValue === void 0 ? void 0 : blockGapValue.left
  };
}
/**
 * Returns a CSS value for the `gap` property from a given blockGap style.
 *
 * @param {string? | Object?} blockGapValue A block gap string or axial object value, e.g., '10px' or { top: '10px', left: '10px'}.
 * @param {string?}           defaultValue  A default gap value.
 * @return {string|null}                    The concatenated gap value (row and column).
 */

function getGapCSSValue(blockGapValue) {
  let defaultValue = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : '0';
  const blockGapBoxControlValue = getGapBoxControlValueFromStyle(blockGapValue);

  if (!blockGapBoxControlValue) {
    return null;
  }

  const row = (blockGapBoxControlValue === null || blockGapBoxControlValue === void 0 ? void 0 : blockGapBoxControlValue.top) || defaultValue;
  const column = (blockGapBoxControlValue === null || blockGapBoxControlValue === void 0 ? void 0 : blockGapBoxControlValue.left) || defaultValue;
  return row === column ? row : `${row} ${column}`;
}
/**
 * Resets the gap block support attribute. This can be used when disabling
 * the gap support controls for a block via a progressive discovery panel.
 *
 * @param {Object} props               Block props.
 * @param {Object} props.attributes    Block's attributes.
 * @param {Object} props.setAttributes Function to set block's attributes.
 */

function resetGap(_ref) {
  let {
    attributes = {},
    setAttributes
  } = _ref;
  const {
    style
  } = attributes;
  setAttributes({
    style: { ...style,
      spacing: { ...(style === null || style === void 0 ? void 0 : style.spacing),
        blockGap: undefined
      }
    }
  });
}
/**
 * Custom hook that checks if gap settings have been disabled.
 *
 * @param {string} name The name of the block.
 * @return {boolean}     Whether the gap setting is disabled.
 */

function useIsGapDisabled() {
  let {
    name: blockName
  } = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  const isDisabled = !useSetting('spacing.blockGap');
  return !hasGapSupport(blockName) || isDisabled;
}
/**
 * Inspector control panel containing the gap related configuration
 *
 * @param {Object} props
 *
 * @return {WPElement} Gap edit element.
 */

function GapEdit(props) {
  var _style$spacing;

  const {
    clientId,
    attributes: {
      style
    },
    name: blockName,
    setAttributes
  } = props;
  const units = (0,external_wp_components_namespaceObject.__experimentalUseCustomUnits)({
    availableUnits: useSetting('spacing.units') || ['%', 'px', 'em', 'rem', 'vw']
  });
  const sides = useCustomSides(blockName, 'blockGap');
  const ref = useBlockRef(clientId);

  if (useIsGapDisabled(props)) {
    return null;
  }

  const splitOnAxis = sides && sides.some(side => AXIAL_SIDES.includes(side));

  const onChange = next => {
    var _window;

    let blockGap = next; // If splitOnAxis activated we need to return a BoxControl object to the BoxControl component.

    if (!!next && splitOnAxis) {
      blockGap = { ...getGapBoxControlValueFromStyle(next)
      };
    }

    const newStyle = { ...style,
      spacing: { ...(style === null || style === void 0 ? void 0 : style.spacing),
        blockGap
      }
    };
    setAttributes({
      style: cleanEmptyObject(newStyle)
    }); // In Safari, changing the `gap` CSS value on its own will not trigger the layout
    // to be recalculated / re-rendered. To force the updated gap to re-render, here
    // we replace the block's node with itself.

    const isSafari = ((_window = window) === null || _window === void 0 ? void 0 : _window.navigator.userAgent) && window.navigator.userAgent.includes('Safari') && !window.navigator.userAgent.includes('Chrome ') && !window.navigator.userAgent.includes('Chromium ');

    if (ref.current && isSafari) {
      var _ref$current$parentNo;

      (_ref$current$parentNo = ref.current.parentNode) === null || _ref$current$parentNo === void 0 ? void 0 : _ref$current$parentNo.replaceChild(ref.current, ref.current);
    }
  };

  const gapValue = getGapBoxControlValueFromStyle(style === null || style === void 0 ? void 0 : (_style$spacing = style.spacing) === null || _style$spacing === void 0 ? void 0 : _style$spacing.blockGap); // The BoxControl component expects a full complement of side values.
  // Gap row and column values translate to top/bottom and left/right respectively.

  const boxControlGapValue = splitOnAxis ? { ...gapValue,
    right: gapValue === null || gapValue === void 0 ? void 0 : gapValue.left,
    bottom: gapValue === null || gapValue === void 0 ? void 0 : gapValue.top
  } : gapValue === null || gapValue === void 0 ? void 0 : gapValue.top;
  return external_wp_element_namespaceObject.Platform.select({
    web: (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, splitOnAxis ? (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalBoxControl, {
      label: (0,external_wp_i18n_namespaceObject.__)('Block spacing'),
      min: 0,
      onChange: onChange,
      units: units,
      sides: sides,
      values: boxControlGapValue,
      allowReset: false,
      splitOnAxis: splitOnAxis
    }) : (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalUnitControl, {
      label: (0,external_wp_i18n_namespaceObject.__)('Block spacing'),
      __unstableInputWidth: "80px",
      min: 0,
      onChange: onChange,
      units: units // Default to `row` for combined values.
      ,
      value: boxControlGapValue
    })),
    native: null
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-vertical-alignment-control/icons.js


/**
 * WordPress dependencies
 */

const alignBottom = (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Path, {
  d: "M15 4H9v11h6V4zM4 18.5V20h16v-1.5H4z"
}));
const alignCenter = (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Path, {
  d: "M20 11h-5V4H9v7H4v1.5h5V20h6v-7.5h5z"
}));
const alignTop = (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Path, {
  d: "M9 20h6V9H9v11zM4 4v1.5h16V4H4z"
}));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-vertical-alignment-control/ui.js



/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


const BLOCK_ALIGNMENTS_CONTROLS = {
  top: {
    icon: alignTop,
    title: (0,external_wp_i18n_namespaceObject._x)('Align top', 'Block vertical alignment setting')
  },
  center: {
    icon: alignCenter,
    title: (0,external_wp_i18n_namespaceObject._x)('Align middle', 'Block vertical alignment setting')
  },
  bottom: {
    icon: alignBottom,
    title: (0,external_wp_i18n_namespaceObject._x)('Align bottom', 'Block vertical alignment setting')
  }
};
const DEFAULT_CONTROLS = ['top', 'center', 'bottom'];
const DEFAULT_CONTROL = 'top';
const POPOVER_PROPS = {
  isAlternate: true
};

function BlockVerticalAlignmentUI(_ref) {
  let {
    value,
    onChange,
    controls = DEFAULT_CONTROLS,
    isCollapsed = true,
    isToolbar
  } = _ref;

  function applyOrUnset(align) {
    return () => onChange(value === align ? undefined : align);
  }

  const activeAlignment = BLOCK_ALIGNMENTS_CONTROLS[value];
  const defaultAlignmentControl = BLOCK_ALIGNMENTS_CONTROLS[DEFAULT_CONTROL];
  const UIComponent = isToolbar ? external_wp_components_namespaceObject.ToolbarGroup : external_wp_components_namespaceObject.ToolbarDropdownMenu;
  const extraProps = isToolbar ? {
    isCollapsed
  } : {};
  return (0,external_wp_element_namespaceObject.createElement)(UIComponent, _extends({
    popoverProps: POPOVER_PROPS,
    icon: activeAlignment ? activeAlignment.icon : defaultAlignmentControl.icon,
    label: (0,external_wp_i18n_namespaceObject._x)('Change vertical alignment', 'Block vertical alignment setting label'),
    controls: controls.map(control => {
      return { ...BLOCK_ALIGNMENTS_CONTROLS[control],
        isActive: value === control,
        role: isCollapsed ? 'menuitemradio' : undefined,
        onClick: applyOrUnset(control)
      };
    })
  }, extraProps));
}
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/block-vertical-alignment-toolbar/README.md
 */


/* harmony default export */ var ui = (BlockVerticalAlignmentUI);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-vertical-alignment-control/index.js



/**
 * Internal dependencies
 */


const BlockVerticalAlignmentControl = props => {
  return (0,external_wp_element_namespaceObject.createElement)(ui, _extends({}, props, {
    isToolbar: false
  }));
};

const BlockVerticalAlignmentToolbar = props => {
  return (0,external_wp_element_namespaceObject.createElement)(ui, _extends({}, props, {
    isToolbar: true
  }));
};
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/block-vertical-alignment-control/README.md
 */




;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/justify-content-control/ui.js



/**
 * WordPress dependencies
 */



const icons = {
  left: justify_left,
  center: justify_center,
  right: justify_right,
  'space-between': justify_space_between
};

function JustifyContentUI(_ref) {
  let {
    allowedControls = ['left', 'center', 'right', 'space-between'],
    isCollapsed = true,
    onChange,
    value,
    popoverProps,
    isToolbar
  } = _ref;

  // If the control is already selected we want a click
  // again on the control to deselect the item, so we
  // call onChange( undefined )
  const handleClick = next => {
    if (next === value) {
      onChange(undefined);
    } else {
      onChange(next);
    }
  };

  const icon = value ? icons[value] : icons.left;
  const allControls = [{
    name: 'left',
    icon: justify_left,
    title: (0,external_wp_i18n_namespaceObject.__)('Justify items left'),
    isActive: 'left' === value,
    onClick: () => handleClick('left')
  }, {
    name: 'center',
    icon: justify_center,
    title: (0,external_wp_i18n_namespaceObject.__)('Justify items center'),
    isActive: 'center' === value,
    onClick: () => handleClick('center')
  }, {
    name: 'right',
    icon: justify_right,
    title: (0,external_wp_i18n_namespaceObject.__)('Justify items right'),
    isActive: 'right' === value,
    onClick: () => handleClick('right')
  }, {
    name: 'space-between',
    icon: justify_space_between,
    title: (0,external_wp_i18n_namespaceObject.__)('Space between items'),
    isActive: 'space-between' === value,
    onClick: () => handleClick('space-between')
  }];
  const UIComponent = isToolbar ? external_wp_components_namespaceObject.ToolbarGroup : external_wp_components_namespaceObject.ToolbarDropdownMenu;
  const extraProps = isToolbar ? {
    isCollapsed
  } : {};
  return (0,external_wp_element_namespaceObject.createElement)(UIComponent, _extends({
    icon: icon,
    popoverProps: popoverProps,
    label: (0,external_wp_i18n_namespaceObject.__)('Change items justification'),
    controls: allControls.filter(elem => allowedControls.includes(elem.name))
  }, extraProps));
}

/* harmony default export */ var justify_content_control_ui = (JustifyContentUI);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/justify-content-control/index.js



/**
 * Internal dependencies
 */


const JustifyContentControl = props => {
  return (0,external_wp_element_namespaceObject.createElement)(justify_content_control_ui, _extends({}, props, {
    isToolbar: false
  }));
};

const JustifyToolbar = props => {
  return (0,external_wp_element_namespaceObject.createElement)(justify_content_control_ui, _extends({}, props, {
    isToolbar: true
  }));
};
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/justify-content-control/README.md
 */




;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/layouts/flex.js


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */





 // Used with the default, horizontal flex orientation.

const justifyContentMap = {
  left: 'flex-start',
  right: 'flex-end',
  center: 'center',
  'space-between': 'space-between'
}; // Used with the vertical (column) flex orientation.

const alignItemsMap = {
  left: 'flex-start',
  right: 'flex-end',
  center: 'center'
};
const verticalAlignmentMap = {
  top: 'flex-start',
  center: 'center',
  bottom: 'flex-end'
};
const flexWrapOptions = ['wrap', 'nowrap'];
/* harmony default export */ var flex = ({
  name: 'flex',
  label: (0,external_wp_i18n_namespaceObject.__)('Flex'),
  inspectorControls: function FlexLayoutInspectorControls(_ref) {
    let {
      layout = {},
      onChange,
      layoutBlockSupport = {}
    } = _ref;
    const {
      allowOrientation = true
    } = layoutBlockSupport;
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Flex, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.FlexItem, null, (0,external_wp_element_namespaceObject.createElement)(FlexLayoutJustifyContentControl, {
      layout: layout,
      onChange: onChange
    })), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.FlexItem, null, allowOrientation && (0,external_wp_element_namespaceObject.createElement)(OrientationControl, {
      layout: layout,
      onChange: onChange
    }))), (0,external_wp_element_namespaceObject.createElement)(FlexWrapControl, {
      layout: layout,
      onChange: onChange
    }));
  },
  toolBarControls: function FlexLayoutToolbarControls(_ref2) {
    let {
      layout = {},
      onChange,
      layoutBlockSupport
    } = _ref2;

    if (layoutBlockSupport !== null && layoutBlockSupport !== void 0 && layoutBlockSupport.allowSwitching) {
      return null;
    }

    const {
      allowVerticalAlignment = true
    } = layoutBlockSupport;
    return (0,external_wp_element_namespaceObject.createElement)(block_controls, {
      group: "block",
      __experimentalShareWithChildBlocks: true
    }, (0,external_wp_element_namespaceObject.createElement)(FlexLayoutJustifyContentControl, {
      layout: layout,
      onChange: onChange,
      isToolbar: true
    }), allowVerticalAlignment && (layout === null || layout === void 0 ? void 0 : layout.orientation) !== 'vertical' && (0,external_wp_element_namespaceObject.createElement)(FlexLayoutVerticalAlignmentControl, {
      layout: layout,
      onChange: onChange,
      isToolbar: true
    }));
  },
  save: function FlexLayoutStyle(_ref3) {
    var _style$spacing, _style$spacing2;

    let {
      selector,
      layout,
      style,
      blockName
    } = _ref3;
    const {
      orientation = 'horizontal'
    } = layout;
    const blockGapSupport = useSetting('spacing.blockGap');
    const fallbackValue = (0,external_wp_blocks_namespaceObject.getBlockSupport)(blockName, ['spacing', 'blockGap', '__experimentalDefault']) || '0.5em';
    const hasBlockGapStylesSupport = blockGapSupport !== null; // If a block's block.json skips serialization for spacing or spacing.blockGap,
    // don't apply the user-defined value to the styles.

    const blockGapValue = style !== null && style !== void 0 && (_style$spacing = style.spacing) !== null && _style$spacing !== void 0 && _style$spacing.blockGap && !shouldSkipSerialization(blockName, 'spacing', 'blockGap') ? getGapCSSValue(style === null || style === void 0 ? void 0 : (_style$spacing2 = style.spacing) === null || _style$spacing2 === void 0 ? void 0 : _style$spacing2.blockGap, fallbackValue) : `var( --wp--style--block-gap, ${fallbackValue} )`;
    const justifyContent = justifyContentMap[layout.justifyContent] || justifyContentMap.left;
    const flexWrap = flexWrapOptions.includes(layout.flexWrap) ? layout.flexWrap : 'wrap';
    const verticalAlignment = verticalAlignmentMap[layout.verticalAlignment] || verticalAlignmentMap.center;
    const rowOrientation = `
		flex-direction: row;
		align-items: ${verticalAlignment};
		justify-content: ${justifyContent};
		`;
    const alignItems = alignItemsMap[layout.justifyContent] || alignItemsMap.left;
    const columnOrientation = `
		flex-direction: column;
		align-items: ${alignItems};
		`;
    return (0,external_wp_element_namespaceObject.createElement)("style", null, `
				${appendSelectors(selector)} {
					display: flex;
					flex-wrap: ${flexWrap};
					gap: ${hasBlockGapStylesSupport ? blockGapValue : fallbackValue};
					${orientation === 'horizontal' ? rowOrientation : columnOrientation}
				}

				${appendSelectors(selector, '> *')} {
					margin: 0;
				}
			`);
  },

  getOrientation(layout) {
    const {
      orientation = 'horizontal'
    } = layout;
    return orientation;
  },

  getAlignments() {
    return [];
  }

});

function FlexLayoutVerticalAlignmentControl(_ref4) {
  let {
    layout,
    onChange,
    isToolbar = false
  } = _ref4;
  const {
    verticalAlignment = verticalAlignmentMap.center
  } = layout;

  const onVerticalAlignmentChange = value => {
    onChange({ ...layout,
      verticalAlignment: value
    });
  };

  if (isToolbar) {
    return (0,external_wp_element_namespaceObject.createElement)(BlockVerticalAlignmentControl, {
      onChange: onVerticalAlignmentChange,
      value: verticalAlignment
    });
  }

  const verticalAlignmentOptions = [{
    value: 'flex-start',
    label: (0,external_wp_i18n_namespaceObject.__)('Align items top')
  }, {
    value: 'center',
    label: (0,external_wp_i18n_namespaceObject.__)('Align items center')
  }, {
    value: 'flex-end',
    label: (0,external_wp_i18n_namespaceObject.__)('Align items bottom')
  }];
  return (0,external_wp_element_namespaceObject.createElement)("fieldset", {
    className: "block-editor-hooks__flex-layout-vertical-alignment-control"
  }, (0,external_wp_element_namespaceObject.createElement)("legend", null, (0,external_wp_i18n_namespaceObject.__)('Vertical alignment')), (0,external_wp_element_namespaceObject.createElement)("div", null, verticalAlignmentOptions.map((value, icon, label) => {
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
      key: value,
      label: label,
      icon: icon,
      isPressed: verticalAlignment === value,
      onClick: () => onVerticalAlignmentChange(value)
    });
  })));
}

function FlexLayoutJustifyContentControl(_ref5) {
  let {
    layout,
    onChange,
    isToolbar = false
  } = _ref5;
  const {
    justifyContent = 'left',
    orientation = 'horizontal'
  } = layout;

  const onJustificationChange = value => {
    onChange({ ...layout,
      justifyContent: value
    });
  };

  const allowedControls = ['left', 'center', 'right'];

  if (orientation === 'horizontal') {
    allowedControls.push('space-between');
  }

  if (isToolbar) {
    return (0,external_wp_element_namespaceObject.createElement)(JustifyContentControl, {
      allowedControls: allowedControls,
      value: justifyContent,
      onChange: onJustificationChange,
      popoverProps: {
        position: 'bottom right',
        isAlternate: true
      }
    });
  }

  const justificationOptions = [{
    value: 'left',
    icon: justify_left,
    label: (0,external_wp_i18n_namespaceObject.__)('Justify items left')
  }, {
    value: 'center',
    icon: justify_center,
    label: (0,external_wp_i18n_namespaceObject.__)('Justify items center')
  }, {
    value: 'right',
    icon: justify_right,
    label: (0,external_wp_i18n_namespaceObject.__)('Justify items right')
  }];

  if (orientation === 'horizontal') {
    justificationOptions.push({
      value: 'space-between',
      icon: justify_space_between,
      label: (0,external_wp_i18n_namespaceObject.__)('Space between items')
    });
  }

  return (0,external_wp_element_namespaceObject.createElement)("fieldset", {
    className: "block-editor-hooks__flex-layout-justification-controls"
  }, (0,external_wp_element_namespaceObject.createElement)("legend", null, (0,external_wp_i18n_namespaceObject.__)('Justification')), (0,external_wp_element_namespaceObject.createElement)("div", null, justificationOptions.map(_ref6 => {
    let {
      value,
      icon,
      label
    } = _ref6;
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
      key: value,
      label: label,
      icon: icon,
      isPressed: justifyContent === value,
      onClick: () => onJustificationChange(value)
    });
  })));
}

function FlexWrapControl(_ref7) {
  let {
    layout,
    onChange
  } = _ref7;
  const {
    flexWrap = 'wrap'
  } = layout;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToggleControl, {
    label: (0,external_wp_i18n_namespaceObject.__)('Allow to wrap to multiple lines'),
    onChange: value => {
      onChange({ ...layout,
        flexWrap: value ? 'wrap' : 'nowrap'
      });
    },
    checked: flexWrap === 'wrap'
  });
}

function OrientationControl(_ref8) {
  let {
    layout,
    onChange
  } = _ref8;
  const {
    orientation = 'horizontal'
  } = layout;
  return (0,external_wp_element_namespaceObject.createElement)("fieldset", {
    className: "block-editor-hooks__flex-layout-orientation-controls"
  }, (0,external_wp_element_namespaceObject.createElement)("legend", null, (0,external_wp_i18n_namespaceObject.__)('Orientation')), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    label: 'horizontal',
    icon: arrow_right,
    isPressed: orientation === 'horizontal',
    onClick: () => onChange({ ...layout,
      orientation: 'horizontal'
    })
  }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    label: 'vertical',
    icon: arrow_down,
    isPressed: orientation === 'vertical',
    onClick: () => onChange({ ...layout,
      orientation: 'vertical'
    })
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/icon/index.js
/**
 * WordPress dependencies
 */

/** @typedef {{icon: JSX.Element, size?: number} & import('@wordpress/primitives').SVGProps} IconProps */

/**
 * Return an SVG icon.
 *
 * @param {IconProps} props icon is the SVG component to render
 *                          size is a number specifiying the icon size in pixels
 *                          Other props will be passed to wrapped SVG component
 *
 * @return {JSX.Element}  Icon component
 */

function Icon(_ref) {
  let {
    icon,
    size = 24,
    ...props
  } = _ref;
  return (0,external_wp_element_namespaceObject.cloneElement)(icon, {
    width: size,
    height: size,
    ...props
  });
}

/* harmony default export */ var build_module_icon = (Icon);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/layouts/flow.js


/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */





/* harmony default export */ var flow = ({
  name: 'default',
  label: (0,external_wp_i18n_namespaceObject.__)('Flow'),
  inspectorControls: function DefaultLayoutInspectorControls(_ref) {
    let {
      layout,
      onChange
    } = _ref;
    const {
      wideSize,
      contentSize
    } = layout;
    const units = (0,external_wp_components_namespaceObject.__experimentalUseCustomUnits)({
      availableUnits: useSetting('spacing.units') || ['%', 'px', 'em', 'rem', 'vw']
    });
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "block-editor-hooks__layout-controls"
    }, (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "block-editor-hooks__layout-controls-unit"
    }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalUnitControl, {
      label: (0,external_wp_i18n_namespaceObject.__)('Content'),
      labelPosition: "top",
      __unstableInputWidth: "80px",
      value: contentSize || wideSize || '',
      onChange: nextWidth => {
        nextWidth = 0 > parseFloat(nextWidth) ? '0' : nextWidth;
        onChange({ ...layout,
          contentSize: nextWidth
        });
      },
      units: units
    }), (0,external_wp_element_namespaceObject.createElement)(build_module_icon, {
      icon: position_center
    })), (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "block-editor-hooks__layout-controls-unit"
    }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalUnitControl, {
      label: (0,external_wp_i18n_namespaceObject.__)('Wide'),
      labelPosition: "top",
      __unstableInputWidth: "80px",
      value: wideSize || contentSize || '',
      onChange: nextWidth => {
        nextWidth = 0 > parseFloat(nextWidth) ? '0' : nextWidth;
        onChange({ ...layout,
          wideSize: nextWidth
        });
      },
      units: units
    }), (0,external_wp_element_namespaceObject.createElement)(build_module_icon, {
      icon: stretch_wide
    }))), (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "block-editor-hooks__layout-controls-reset"
    }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
      variant: "secondary",
      isSmall: true,
      disabled: !contentSize && !wideSize,
      onClick: () => onChange({
        contentSize: undefined,
        wideSize: undefined,
        inherit: false
      })
    }, (0,external_wp_i18n_namespaceObject.__)('Reset'))), (0,external_wp_element_namespaceObject.createElement)("p", {
      className: "block-editor-hooks__layout-controls-helptext"
    }, (0,external_wp_i18n_namespaceObject.__)('Customize the width for all elements that are assigned to the center or wide columns.')));
  },
  toolBarControls: function DefaultLayoutToolbarControls() {
    return null;
  },
  save: function DefaultLayoutStyle(_ref2) {
    var _style$spacing;

    let {
      selector,
      layout = {},
      style,
      blockName
    } = _ref2;
    const {
      contentSize,
      wideSize
    } = layout;
    const blockGapSupport = useSetting('spacing.blockGap');
    const hasBlockGapStylesSupport = blockGapSupport !== null;
    const blockGapStyleValue = getGapBoxControlValueFromStyle(style === null || style === void 0 ? void 0 : (_style$spacing = style.spacing) === null || _style$spacing === void 0 ? void 0 : _style$spacing.blockGap); // If a block's block.json skips serialization for spacing or
    // spacing.blockGap, don't apply the user-defined value to the styles.

    const blockGapValue = blockGapStyleValue !== null && blockGapStyleValue !== void 0 && blockGapStyleValue.top && !shouldSkipSerialization(blockName, 'spacing', 'blockGap') ? blockGapStyleValue === null || blockGapStyleValue === void 0 ? void 0 : blockGapStyleValue.top : 'var( --wp--style--block-gap )';
    let output = !!contentSize || !!wideSize ? `
					${appendSelectors(selector, '> :where(:not(.alignleft):not(.alignright))')} {
						max-width: ${contentSize !== null && contentSize !== void 0 ? contentSize : wideSize};
						margin-left: auto !important;
						margin-right: auto !important;
					}
					${appendSelectors(selector, '> .alignwide')}  {
						max-width: ${wideSize !== null && wideSize !== void 0 ? wideSize : contentSize};
					}
					${appendSelectors(selector, '> .alignfull')} {
						max-width: none;
					}
				` : '';
    output += `
			${appendSelectors(selector, '> .alignleft')} {
				float: left;
				margin-inline-start: 0;
				margin-inline-end: 2em;
			}
			${appendSelectors(selector, '> .alignright')} {
				float: right;
				margin-inline-start: 2em;
				margin-inline-end: 0;
			}

			${appendSelectors(selector, '> .aligncenter')} {
				margin-left: auto !important;
				margin-right: auto !important;
			}
		`;

    if (hasBlockGapStylesSupport) {
      output += `
				${appendSelectors(selector, '> *')} {
					margin-block-start: 0;
					margin-block-end: 0;
				}
				${appendSelectors(selector, '> * + *')} {
					margin-block-start: ${blockGapValue};
				}
			`;
    }

    return (0,external_wp_element_namespaceObject.createElement)("style", null, output);
  },

  getOrientation() {
    return 'vertical';
  },

  getAlignments(layout) {
    const alignmentInfo = getAlignmentsInfo(layout);

    if (layout.alignments !== undefined) {
      if (!layout.alignments.includes('none')) {
        layout.alignments.unshift('none');
      }

      return layout.alignments.map(alignment => ({
        name: alignment,
        info: alignmentInfo[alignment]
      }));
    }

    const {
      contentSize,
      wideSize
    } = layout;
    const alignments = [{
      name: 'left'
    }, {
      name: 'center'
    }, {
      name: 'right'
    }];

    if (contentSize) {
      alignments.unshift({
        name: 'full'
      });
    }

    if (wideSize) {
      alignments.unshift({
        name: 'wide',
        info: alignmentInfo.wide
      });
    }

    alignments.unshift({
      name: 'none',
      info: alignmentInfo.none
    });
    return alignments;
  }

});
/**
 * Helper method to assign contextual info to clarify
 * alignment settings.
 *
 * Besides checking if `contentSize` and `wideSize` have a
 * value, we now show this information only if their values
 * are not a `css var`. This needs to change when parsing
 * css variables land.
 *
 * @see https://github.com/WordPress/gutenberg/pull/34710#issuecomment-918000752
 *
 * @param {Object} layout The layout object.
 * @return {Object} An object with contextual info per alignment.
 */

function getAlignmentsInfo(layout) {
  const {
    contentSize,
    wideSize
  } = layout;
  const alignmentInfo = {};
  const sizeRegex = /^(?!0)\d+(px|em|rem|vw|vh|%)?$/i;

  if (sizeRegex.test(contentSize)) {
    // translators: %s: container size (i.e. 600px etc)
    alignmentInfo.none = (0,external_wp_i18n_namespaceObject.sprintf)((0,external_wp_i18n_namespaceObject.__)('Max %s wide'), contentSize);
  }

  if (sizeRegex.test(wideSize)) {
    // translators: %s: container size (i.e. 600px etc)
    alignmentInfo.wide = (0,external_wp_i18n_namespaceObject.sprintf)((0,external_wp_i18n_namespaceObject.__)('Max %s wide'), wideSize);
  }

  return alignmentInfo;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/layouts/index.js
/**
 * Internal dependencies
 */


const layoutTypes = [flow, flex];
/**
 * Retrieves a layout type by name.
 *
 * @param {string} name - The name of the layout type.
 * @return {Object} Layout type.
 */

function getLayoutType() {
  let name = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 'default';
  return layoutTypes.find(layoutType => layoutType.name === name);
}
/**
 * Retrieves the available layout types.
 *
 * @return {Array} Layout types.
 */

function getLayoutTypes() {
  return layoutTypes;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/layout.js



/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */


const defaultLayout = {
  type: 'default'
};
const Layout = (0,external_wp_element_namespaceObject.createContext)(defaultLayout);
/**
 * Allows to define the layout.
 */

const LayoutProvider = Layout.Provider;
/**
 * React hook used to retrieve the layout config.
 */

function useLayout() {
  return (0,external_wp_element_namespaceObject.useContext)(Layout);
}
function LayoutStyle(_ref) {
  let {
    layout = {},
    ...props
  } = _ref;
  const layoutType = getLayoutType(layout.type);

  if (layoutType) {
    return (0,external_wp_element_namespaceObject.createElement)(layoutType.save, _extends({
      layout: layout
    }, props));
  }

  return null;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-alignment-control/use-available-alignments.js
/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */




const use_available_alignments_DEFAULT_CONTROLS = ['none', 'left', 'center', 'right', 'wide', 'full'];
const WIDE_CONTROLS = ['wide', 'full'];
function useAvailableAlignments() {
  let controls = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : use_available_alignments_DEFAULT_CONTROLS;

  // Always add the `none` option if not exists.
  if (!controls.includes('none')) {
    controls = ['none', ...controls];
  }

  const {
    wideControlsEnabled = false,
    themeSupportsLayout
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getSettings
    } = select(store);
    const settings = getSettings();
    return {
      wideControlsEnabled: settings.alignWide,
      themeSupportsLayout: settings.supportsLayout
    };
  }, []);
  const layout = useLayout();
  const layoutType = getLayoutType(layout === null || layout === void 0 ? void 0 : layout.type);
  const layoutAlignments = layoutType.getAlignments(layout);

  if (themeSupportsLayout) {
    const alignments = layoutAlignments.filter(_ref => {
      let {
        name: alignmentName
      } = _ref;
      return controls.includes(alignmentName);
    }); // While we treat `none` as an alignment, we shouldn't return it if no
    // other alignments exist.

    if (alignments.length === 1 && alignments[0].name === 'none') {
      return [];
    }

    return alignments;
  } // Starting here, it's the fallback for themes not supporting the layout config.


  if (layoutType.name !== 'default') {
    return [];
  }

  const {
    alignments: availableAlignments = use_available_alignments_DEFAULT_CONTROLS
  } = layout;
  const enabledControls = controls.filter(control => (layout.alignments || // Ignore the global wideAlignment check if the layout explicitely defines alignments.
  wideControlsEnabled || !WIDE_CONTROLS.includes(control)) && availableAlignments.includes(control)).map(enabledControl => ({
    name: enabledControl
  })); // While we treat `none` as an alignment, we shouldn't return it if no
  // other alignments exist.

  if (enabledControls.length === 1 && enabledControls[0].name === 'none') {
    return [];
  }

  return enabledControls;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-alignment-control/ui.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */


const ui_BLOCK_ALIGNMENTS_CONTROLS = {
  none: {
    icon: align_none,
    title: (0,external_wp_i18n_namespaceObject._x)('None', 'Alignment option')
  },
  left: {
    icon: position_left,
    title: (0,external_wp_i18n_namespaceObject.__)('Align left')
  },
  center: {
    icon: position_center,
    title: (0,external_wp_i18n_namespaceObject.__)('Align center')
  },
  right: {
    icon: position_right,
    title: (0,external_wp_i18n_namespaceObject.__)('Align right')
  },
  wide: {
    icon: stretch_wide,
    title: (0,external_wp_i18n_namespaceObject.__)('Wide width')
  },
  full: {
    icon: stretch_full_width,
    title: (0,external_wp_i18n_namespaceObject.__)('Full width')
  }
};
const ui_DEFAULT_CONTROL = 'none';
const ui_POPOVER_PROPS = {
  isAlternate: true
};

function BlockAlignmentUI(_ref) {
  let {
    value,
    onChange,
    controls,
    isToolbar,
    isCollapsed = true
  } = _ref;
  const enabledControls = useAvailableAlignments(controls);
  const hasEnabledControls = !!enabledControls.length;

  if (!hasEnabledControls) {
    return null;
  }

  function onChangeAlignment(align) {
    onChange([value, 'none'].includes(align) ? undefined : align);
  }

  const activeAlignmentControl = ui_BLOCK_ALIGNMENTS_CONTROLS[value];
  const defaultAlignmentControl = ui_BLOCK_ALIGNMENTS_CONTROLS[ui_DEFAULT_CONTROL];
  const UIComponent = isToolbar ? external_wp_components_namespaceObject.ToolbarGroup : external_wp_components_namespaceObject.ToolbarDropdownMenu;
  const commonProps = {
    popoverProps: ui_POPOVER_PROPS,
    icon: activeAlignmentControl ? activeAlignmentControl.icon : defaultAlignmentControl.icon,
    label: (0,external_wp_i18n_namespaceObject.__)('Align'),
    toggleProps: {
      describedBy: (0,external_wp_i18n_namespaceObject.__)('Change alignment')
    }
  };
  const extraProps = isToolbar || external_wp_element_namespaceObject.Platform.isNative ? {
    isCollapsed: isToolbar ? isCollapsed : undefined,
    controls: enabledControls.map(_ref2 => {
      let {
        name: controlName
      } = _ref2;
      return { ...ui_BLOCK_ALIGNMENTS_CONTROLS[controlName],
        isActive: value === controlName || !value && controlName === 'none',
        role: isCollapsed ? 'menuitemradio' : undefined,
        onClick: () => onChangeAlignment(controlName)
      };
    })
  } : {
    children: _ref3 => {
      let {
        onClose
      } = _ref3;
      return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuGroup, {
        className: "block-editor-block-alignment-control__menu-group"
      }, enabledControls.map(_ref4 => {
        let {
          name: controlName,
          info
        } = _ref4;
        const {
          icon,
          title
        } = ui_BLOCK_ALIGNMENTS_CONTROLS[controlName]; // If no value is provided, mark as selected the `none` option.

        const isSelected = controlName === value || !value && controlName === 'none';
        return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
          key: controlName,
          icon: icon,
          iconPosition: "left",
          className: classnames_default()('components-dropdown-menu__menu-item', {
            'is-active': isSelected
          }),
          isSelected: isSelected,
          onClick: () => {
            onChangeAlignment(controlName);
            onClose();
          },
          role: "menuitemradio",
          info: info
        }, title);
      })));
    }
  };
  return (0,external_wp_element_namespaceObject.createElement)(UIComponent, _extends({}, commonProps, extraProps));
}

/* harmony default export */ var block_alignment_control_ui = (BlockAlignmentUI);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-alignment-control/index.js



/**
 * Internal dependencies
 */


const BlockAlignmentControl = props => {
  return (0,external_wp_element_namespaceObject.createElement)(block_alignment_control_ui, _extends({}, props, {
    isToolbar: false
  }));
};

const BlockAlignmentToolbar = props => {
  return (0,external_wp_element_namespaceObject.createElement)(block_alignment_control_ui, _extends({}, props, {
    isToolbar: true
  }));
};
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/block-alignment-control/README.md
 */




;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/align.js



/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */



/**
 * An array which includes all possible valid alignments,
 * used to validate if an alignment is valid or not.
 *
 * @constant
 * @type {string[]}
 */

const ALL_ALIGNMENTS = ['left', 'center', 'right', 'wide', 'full'];
/**
 * An array which includes all wide alignments.
 * In order for this alignments to be valid they need to be supported by the block,
 * and by the theme.
 *
 * @constant
 * @type {string[]}
 */

const WIDE_ALIGNMENTS = ['wide', 'full'];
/**
 * Returns the valid alignments.
 * Takes into consideration the aligns supported by a block, if the block supports wide controls or not and if theme supports wide controls or not.
 * Exported just for testing purposes, not exported outside the module.
 *
 * @param {?boolean|string[]} blockAlign          Aligns supported by the block.
 * @param {?boolean}          hasWideBlockSupport True if block supports wide alignments. And False otherwise.
 * @param {?boolean}          hasWideEnabled      True if theme supports wide alignments. And False otherwise.
 *
 * @return {string[]} Valid alignments.
 */

function getValidAlignments(blockAlign) {
  let hasWideBlockSupport = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : true;
  let hasWideEnabled = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : true;
  let validAlignments;

  if (Array.isArray(blockAlign)) {
    validAlignments = ALL_ALIGNMENTS.filter(value => blockAlign.includes(value));
  } else if (blockAlign === true) {
    // `true` includes all alignments...
    validAlignments = [...ALL_ALIGNMENTS];
  } else {
    validAlignments = [];
  }

  if (!hasWideEnabled || blockAlign === true && !hasWideBlockSupport) {
    return (0,external_lodash_namespaceObject.without)(validAlignments, ...WIDE_ALIGNMENTS);
  }

  return validAlignments;
}
/**
 * Filters registered block settings, extending attributes to include `align`.
 *
 * @param {Object} settings Original block settings.
 *
 * @return {Object} Filtered block settings.
 */

function addAttribute(settings) {
  // Allow blocks to specify their own attribute definition with default values if needed.
  if ((0,external_lodash_namespaceObject.has)(settings.attributes, ['align', 'type'])) {
    return settings;
  }

  if ((0,external_wp_blocks_namespaceObject.hasBlockSupport)(settings, 'align')) {
    // Gracefully handle if settings.attributes is undefined.
    settings.attributes = { ...settings.attributes,
      align: {
        type: 'string',
        // Allow for '' since it is used by updateAlignment function
        // in withToolbarControls for special cases with defined default values.
        enum: [...ALL_ALIGNMENTS, '']
      }
    };
  }

  return settings;
}
/**
 * Override the default edit UI to include new toolbar controls for block
 * alignment, if block defines support.
 *
 * @param {Function} BlockEdit Original component.
 *
 * @return {Function} Wrapped component.
 */

const withToolbarControls = (0,external_wp_compose_namespaceObject.createHigherOrderComponent)(BlockEdit => props => {
  const {
    name: blockName
  } = props; // Compute the block valid alignments by taking into account,
  // if the theme supports wide alignments or not and the layout's
  // availble alignments. We do that for conditionally rendering
  // Slot.

  const blockAllowedAlignments = getValidAlignments((0,external_wp_blocks_namespaceObject.getBlockSupport)(blockName, 'align'), (0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockName, 'alignWide', true));
  const validAlignments = useAvailableAlignments(blockAllowedAlignments).map(_ref => {
    let {
      name
    } = _ref;
    return name;
  });

  const updateAlignment = nextAlign => {
    if (!nextAlign) {
      var _blockType$attributes, _blockType$attributes2;

      const blockType = (0,external_wp_blocks_namespaceObject.getBlockType)(props.name);
      const blockDefaultAlign = blockType === null || blockType === void 0 ? void 0 : (_blockType$attributes = blockType.attributes) === null || _blockType$attributes === void 0 ? void 0 : (_blockType$attributes2 = _blockType$attributes.align) === null || _blockType$attributes2 === void 0 ? void 0 : _blockType$attributes2.default;

      if (blockDefaultAlign) {
        nextAlign = '';
      }
    }

    props.setAttributes({
      align: nextAlign
    });
  };

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, !!validAlignments.length && (0,external_wp_element_namespaceObject.createElement)(block_controls, {
    group: "block",
    __experimentalShareWithChildBlocks: true
  }, (0,external_wp_element_namespaceObject.createElement)(BlockAlignmentControl, {
    value: props.attributes.align,
    onChange: updateAlignment,
    controls: validAlignments
  })), (0,external_wp_element_namespaceObject.createElement)(BlockEdit, props));
}, 'withToolbarControls');
/**
 * Override the default block element to add alignment wrapper props.
 *
 * @param {Function} BlockListBlock Original component.
 *
 * @return {Function} Wrapped component.
 */

const withDataAlign = (0,external_wp_compose_namespaceObject.createHigherOrderComponent)(BlockListBlock => props => {
  const {
    name,
    attributes
  } = props;
  const {
    align
  } = attributes;
  const blockAllowedAlignments = getValidAlignments((0,external_wp_blocks_namespaceObject.getBlockSupport)(name, 'align'), (0,external_wp_blocks_namespaceObject.hasBlockSupport)(name, 'alignWide', true));
  const validAlignments = useAvailableAlignments(blockAllowedAlignments); // If an alignment is not assigned, there's no need to go through the
  // effort to validate or assign its value.

  if (align === undefined) {
    return (0,external_wp_element_namespaceObject.createElement)(BlockListBlock, props);
  }

  let wrapperProps = props.wrapperProps;

  if (validAlignments.some(alignment => alignment.name === align)) {
    wrapperProps = { ...wrapperProps,
      'data-align': align
    };
  }

  return (0,external_wp_element_namespaceObject.createElement)(BlockListBlock, _extends({}, props, {
    wrapperProps: wrapperProps
  }));
});
/**
 * Override props assigned to save component to inject alignment class name if
 * block supports it.
 *
 * @param {Object} props      Additional props applied to save element.
 * @param {Object} blockType  Block type.
 * @param {Object} attributes Block attributes.
 *
 * @return {Object} Filtered props applied to save element.
 */

function addAssignedAlign(props, blockType, attributes) {
  const {
    align
  } = attributes;
  const blockAlign = (0,external_wp_blocks_namespaceObject.getBlockSupport)(blockType, 'align');
  const hasWideBlockSupport = (0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockType, 'alignWide', true); // Compute valid alignments without taking into account if
  // the theme supports wide alignments or not.
  // This way changing themes does not impact the block save.

  const isAlignValid = getValidAlignments(blockAlign, hasWideBlockSupport).includes(align);

  if (isAlignValid) {
    props.className = classnames_default()(`align${align}`, props.className);
  }

  return props;
}
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.registerBlockType', 'core/align/addAttribute', addAttribute);
(0,external_wp_hooks_namespaceObject.addFilter)('editor.BlockListBlock', 'core/editor/align/with-data-align', withDataAlign);
(0,external_wp_hooks_namespaceObject.addFilter)('editor.BlockEdit', 'core/editor/align/with-toolbar-controls', withToolbarControls);
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.getSaveContent.extraProps', 'core/align/addAssignedAlign', addAssignedAlign);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/lock.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */


/**
 * Filters registered block settings, extending attributes to include `lock`.
 *
 * @param {Object} settings Original block settings.
 *
 * @return {Object} Filtered block settings.
 */

function lock_addAttribute(settings) {
  // Allow blocks to specify their own attribute definition with default values if needed.
  if ((0,external_lodash_namespaceObject.has)(settings.attributes, ['lock', 'type'])) {
    return settings;
  } // Gracefully handle if settings.attributes is undefined.


  settings.attributes = { ...settings.attributes,
    lock: {
      type: 'object'
    }
  };
  return settings;
}
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.registerBlockType', 'core/lock/addAttribute', lock_addAttribute);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/anchor.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */







/**
 * Internal dependencies
 */


/**
 * Regular expression matching invalid anchor characters for replacement.
 *
 * @type {RegExp}
 */

const ANCHOR_REGEX = /[\s#]/g;
const ANCHOR_SCHEMA = {
  type: 'string',
  source: 'attribute',
  attribute: 'id',
  selector: '*'
};
/**
 * Filters registered block settings, extending attributes with anchor using ID
 * of the first node.
 *
 * @param {Object} settings Original block settings.
 *
 * @return {Object} Filtered block settings.
 */

function anchor_addAttribute(settings) {
  // Allow blocks to specify their own attribute definition with default values if needed.
  if ((0,external_lodash_namespaceObject.has)(settings.attributes, ['anchor', 'type'])) {
    return settings;
  }

  if ((0,external_wp_blocks_namespaceObject.hasBlockSupport)(settings, 'anchor')) {
    // Gracefully handle if settings.attributes is undefined.
    settings.attributes = { ...settings.attributes,
      anchor: ANCHOR_SCHEMA
    };
  }

  return settings;
}
/**
 * Override the default edit UI to include a new block inspector control for
 * assigning the anchor ID, if block supports anchor.
 *
 * @param {WPComponent} BlockEdit Original component.
 *
 * @return {WPComponent} Wrapped component.
 */

const withInspectorControl = (0,external_wp_compose_namespaceObject.createHigherOrderComponent)(BlockEdit => {
  return props => {
    const hasAnchor = (0,external_wp_blocks_namespaceObject.hasBlockSupport)(props.name, 'anchor');

    if (hasAnchor && props.isSelected) {
      const isWeb = external_wp_element_namespaceObject.Platform.OS === 'web';
      const textControl = (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.TextControl, {
        className: "html-anchor-control",
        label: (0,external_wp_i18n_namespaceObject.__)('HTML anchor'),
        help: (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_i18n_namespaceObject.__)('Enter a word or two — without spaces — to make a unique web address just for this block, called an “anchor.” Then, you’ll be able to link directly to this section of your page.'), isWeb && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ExternalLink, {
          href: (0,external_wp_i18n_namespaceObject.__)('https://wordpress.org/support/article/page-jumps/')
        }, (0,external_wp_i18n_namespaceObject.__)('Learn more about anchors'))),
        value: props.attributes.anchor || '',
        placeholder: !isWeb ? (0,external_wp_i18n_namespaceObject.__)('Add an anchor') : null,
        onChange: nextValue => {
          nextValue = nextValue.replace(ANCHOR_REGEX, '-');
          props.setAttributes({
            anchor: nextValue
          });
        },
        autoCapitalize: "none",
        autoComplete: "off"
      });
      return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(BlockEdit, props), isWeb && (0,external_wp_element_namespaceObject.createElement)(inspector_controls, {
        __experimentalGroup: "advanced"
      }, textControl), !isWeb && props.name === 'core/heading' && (0,external_wp_element_namespaceObject.createElement)(inspector_controls, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.PanelBody, {
        title: (0,external_wp_i18n_namespaceObject.__)('Heading settings')
      }, textControl)));
    }

    return (0,external_wp_element_namespaceObject.createElement)(BlockEdit, props);
  };
}, 'withInspectorControl');
/**
 * Override props assigned to save component to inject anchor ID, if block
 * supports anchor. This is only applied if the block's save result is an
 * element and not a markup string.
 *
 * @param {Object} extraProps Additional props applied to save element.
 * @param {Object} blockType  Block type.
 * @param {Object} attributes Current block attributes.
 *
 * @return {Object} Filtered props applied to save element.
 */

function addSaveProps(extraProps, blockType, attributes) {
  if ((0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockType, 'anchor')) {
    extraProps.id = attributes.anchor === '' ? null : attributes.anchor;
  }

  return extraProps;
}
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.registerBlockType', 'core/anchor/attribute', anchor_addAttribute);
(0,external_wp_hooks_namespaceObject.addFilter)('editor.BlockEdit', 'core/editor/anchor/with-inspector-control', withInspectorControl);
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.getSaveContent.extraProps', 'core/anchor/save-props', addSaveProps);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/custom-class-name.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */


/**
 * Filters registered block settings, extending attributes with anchor using ID
 * of the first node.
 *
 * @param {Object} settings Original block settings.
 *
 * @return {Object} Filtered block settings.
 */

function custom_class_name_addAttribute(settings) {
  if ((0,external_wp_blocks_namespaceObject.hasBlockSupport)(settings, 'customClassName', true)) {
    // Gracefully handle if settings.attributes is undefined.
    settings.attributes = { ...settings.attributes,
      className: {
        type: 'string'
      }
    };
  }

  return settings;
}
/**
 * Override the default edit UI to include a new block inspector control for
 * assigning the custom class name, if block supports custom class name.
 *
 * @param {WPComponent} BlockEdit Original component.
 *
 * @return {WPComponent} Wrapped component.
 */

const custom_class_name_withInspectorControl = (0,external_wp_compose_namespaceObject.createHigherOrderComponent)(BlockEdit => {
  return props => {
    const hasCustomClassName = (0,external_wp_blocks_namespaceObject.hasBlockSupport)(props.name, 'customClassName', true);

    if (hasCustomClassName && props.isSelected) {
      return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(BlockEdit, props), (0,external_wp_element_namespaceObject.createElement)(inspector_controls, {
        __experimentalGroup: "advanced"
      }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.TextControl, {
        autoComplete: "off",
        label: (0,external_wp_i18n_namespaceObject.__)('Additional CSS class(es)'),
        value: props.attributes.className || '',
        onChange: nextValue => {
          props.setAttributes({
            className: nextValue !== '' ? nextValue : undefined
          });
        },
        help: (0,external_wp_i18n_namespaceObject.__)('Separate multiple classes with spaces.')
      })));
    }

    return (0,external_wp_element_namespaceObject.createElement)(BlockEdit, props);
  };
}, 'withInspectorControl');
/**
 * Override props assigned to save component to inject anchor ID, if block
 * supports anchor. This is only applied if the block's save result is an
 * element and not a markup string.
 *
 * @param {Object} extraProps Additional props applied to save element.
 * @param {Object} blockType  Block type.
 * @param {Object} attributes Current block attributes.
 *
 * @return {Object} Filtered props applied to save element.
 */

function custom_class_name_addSaveProps(extraProps, blockType, attributes) {
  if ((0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockType, 'customClassName', true) && attributes.className) {
    extraProps.className = classnames_default()(extraProps.className, attributes.className);
  }

  return extraProps;
}
function addTransforms(result, source, index, results) {
  if (!(0,external_wp_blocks_namespaceObject.hasBlockSupport)(result.name, 'customClassName', true)) {
    return result;
  } // If the condition verifies we are probably in the presence of a wrapping transform
  // e.g: nesting paragraphs in a group or columns and in that case the class should not be kept.


  if (results.length === 1 && result.innerBlocks.length === source.length) {
    return result;
  } // If we are transforming one block to multiple blocks or multiple blocks to one block,
  // we ignore the class during the transform.


  if (results.length === 1 && source.length > 1 || results.length > 1 && source.length === 1) {
    return result;
  } // If we are in presence of transform between one or more block in the source
  // that have one or more blocks in the result
  // we apply the class on source N to the result N,
  // if source N does not exists we do nothing.


  if (source[index]) {
    var _source$index;

    const originClassName = (_source$index = source[index]) === null || _source$index === void 0 ? void 0 : _source$index.attributes.className;

    if (originClassName) {
      return { ...result,
        attributes: { ...result.attributes,
          className: originClassName
        }
      };
    }
  }

  return result;
}
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.registerBlockType', 'core/custom-class-name/attribute', custom_class_name_addAttribute);
(0,external_wp_hooks_namespaceObject.addFilter)('editor.BlockEdit', 'core/editor/custom-class-name/with-inspector-control', custom_class_name_withInspectorControl);
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.getSaveContent.extraProps', 'core/custom-class-name/save-props', custom_class_name_addSaveProps);
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.switchToBlockType.transformedBlock', 'core/color/addTransforms', addTransforms);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/generated-class-name.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Override props assigned to save component to inject generated className if
 * block supports it. This is only applied if the block's save result is an
 * element and not a markup string.
 *
 * @param {Object} extraProps Additional props applied to save element.
 * @param {Object} blockType  Block type.
 *
 * @return {Object} Filtered props applied to save element.
 */

function addGeneratedClassName(extraProps, blockType) {
  // Adding the generated className.
  if ((0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockType, 'className', true)) {
    if (typeof extraProps.className === 'string') {
      // We have some extra classes and want to add the default classname
      // We use uniq to prevent duplicate classnames.
      extraProps.className = (0,external_lodash_namespaceObject.uniq)([(0,external_wp_blocks_namespaceObject.getBlockDefaultClassName)(blockType.name), ...extraProps.className.split(' ')]).join(' ').trim();
    } else {
      // There is no string in the className variable,
      // so we just dump the default name in there.
      extraProps.className = (0,external_wp_blocks_namespaceObject.getBlockDefaultClassName)(blockType.name);
    }
  }

  return extraProps;
}
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.getSaveContent.extraProps', 'core/generated-class-name/save-props', addGeneratedClassName);

;// CONCATENATED MODULE: ./node_modules/@wordpress/style-engine/build-module/styles/utils.js
/**
 * External dependencies
 */

/**
 * Internal dependencies
 */

function generateBoxRules(style, options, path, ruleKey) {
  const boxStyle = (0,external_lodash_namespaceObject.get)(style, path);

  if (!boxStyle) {
    return [];
  }

  const rules = [];

  if (typeof boxStyle === 'string') {
    rules.push({
      selector: options.selector,
      key: ruleKey,
      value: boxStyle
    });
  } else {
    const sideRules = ['top', 'right', 'bottom', 'left'].reduce((acc, side) => {
      const value = (0,external_lodash_namespaceObject.get)(boxStyle, [side]);

      if (value) {
        acc.push({
          selector: options.selector,
          key: `${ruleKey}${(0,external_lodash_namespaceObject.upperFirst)(side)}`,
          value
        });
      }

      return acc;
    }, []);
    rules.push(...sideRules);
  }

  return rules;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/style-engine/build-module/styles/padding.js
/**
 * Internal dependencies
 */

const padding = {
  name: 'padding',
  generate: (style, options) => {
    return generateBoxRules(style, options, ['spacing', 'padding'], 'padding');
  }
};
/* harmony default export */ var styles_padding = (padding);

;// CONCATENATED MODULE: ./node_modules/@wordpress/style-engine/build-module/styles/margin.js
/**
 * Internal dependencies
 */

const margin = {
  name: 'margin',
  generate: (style, options) => {
    return generateBoxRules(style, options, ['spacing', 'margin'], 'margin');
  }
};
/* harmony default export */ var styles_margin = (margin);

;// CONCATENATED MODULE: ./node_modules/@wordpress/style-engine/build-module/styles/index.js
/**
 * Internal dependencies
 */


const styleDefinitions = [styles_margin, styles_padding];

;// CONCATENATED MODULE: ./node_modules/@wordpress/style-engine/build-module/index.js
/**
 * External dependencies
 */

/**
 * Internal dependencies
 */


/**
 * Generates a stylesheet for a given style object and selector.
 *
 * @param  style   Style object.
 * @param  options Options object with settings to adjust how the styles are generated.
 *
 * @return generated stylesheet.
 */

function generate(style, options) {
  const rules = getCSSRules(style, options);
  const groupedRules = groupBy(rules, 'selector');
  const selectorRules = Object.keys(groupedRules).reduce((acc, subSelector) => {
    acc.push(`${subSelector} { ${groupedRules[subSelector].map(rule => `${kebabCase(rule.key)}: ${rule.value};`).join(' ')} }`);
    return acc;
  }, []);
  return selectorRules.join('\n');
}
/**
 * Returns a JSON representation of the generated CSS rules.
 *
 * @param  style   Style object.
 * @param  options Options object with settings to adjust how the styles are generated.
 *
 * @return generated styles.
 */

function getCSSRules(style, options) {
  const rules = [];
  styleDefinitions.forEach(definition => {
    rules.push(...definition.generate(style, options));
  });
  return rules;
}

;// CONCATENATED MODULE: external ["wp","dom"]
var external_wp_dom_namespaceObject = window["wp"]["dom"];
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-context/index.js


/**
 * WordPress dependencies
 */

/** @typedef {import('react').ReactNode} ReactNode */

/**
 * @typedef BlockContextProviderProps
 *
 * @property {Record<string,*>} value    Context value to merge with current
 *                                       value.
 * @property {ReactNode}        children Component children.
 */

/** @type {import('react').Context<Record<string,*>>} */

const block_context_Context = (0,external_wp_element_namespaceObject.createContext)({});
/**
 * Component which merges passed value with current consumed block context.
 *
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/block-context/README.md
 *
 * @param {BlockContextProviderProps} props
 */

function BlockContextProvider(_ref) {
  let {
    value,
    children
  } = _ref;
  const context = (0,external_wp_element_namespaceObject.useContext)(block_context_Context);
  const nextValue = (0,external_wp_element_namespaceObject.useMemo)(() => ({ ...context,
    ...value
  }), [context, value]);
  return (0,external_wp_element_namespaceObject.createElement)(block_context_Context.Provider, {
    value: nextValue,
    children: children
  });
}
/* harmony default export */ var block_context = (block_context_Context);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-edit/edit.js



/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */


/**
 * Default value used for blocks which do not define their own context needs,
 * used to guarantee that a block's `context` prop will always be an object. It
 * is assigned as a constant since it is always expected to be an empty object,
 * and in order to avoid unnecessary React reconciliations of a changing object.
 *
 * @type {{}}
 */

const DEFAULT_BLOCK_CONTEXT = {};
const Edit = props => {
  const {
    attributes = {},
    name
  } = props;
  const blockType = (0,external_wp_blocks_namespaceObject.getBlockType)(name);
  const blockContext = (0,external_wp_element_namespaceObject.useContext)(block_context); // Assign context values using the block type's declared context needs.

  const context = (0,external_wp_element_namespaceObject.useMemo)(() => {
    return blockType && blockType.usesContext ? (0,external_lodash_namespaceObject.pick)(blockContext, blockType.usesContext) : DEFAULT_BLOCK_CONTEXT;
  }, [blockType, blockContext]);

  if (!blockType) {
    return null;
  } // `edit` and `save` are functions or components describing the markup
  // with which a block is displayed. If `blockType` is valid, assign
  // them preferentially as the render value for the block.


  const Component = blockType.edit || blockType.save;

  if (blockType.apiVersion > 1) {
    return (0,external_wp_element_namespaceObject.createElement)(Component, _extends({}, props, {
      context: context
    }));
  } // Generate a class name for the block's editable form.


  const generatedClassName = (0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockType, 'className', true) ? (0,external_wp_blocks_namespaceObject.getBlockDefaultClassName)(name) : null;
  const className = classnames_default()(generatedClassName, attributes.className);
  return (0,external_wp_element_namespaceObject.createElement)(Component, _extends({}, props, {
    context: context,
    className: className
  }));
};
/* harmony default export */ var edit = ((0,external_wp_components_namespaceObject.withFilters)('editor.BlockEdit')(Edit));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-edit/index.js


/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */



/**
 * The `useBlockEditContext` hook provides information about the block this hook is being used in.
 * It returns an object with the `name`, `isSelected` state, and the `clientId` of the block.
 * It is useful if you want to create custom hooks that need access to the current blocks clientId
 * but don't want to rely on the data getting passed in as a parameter.
 *
 * @return {Object} Block edit context
 */


function BlockEdit(props) {
  const {
    name,
    isSelected,
    clientId
  } = props;
  const context = {
    name,
    isSelected,
    clientId
  };
  return (0,external_wp_element_namespaceObject.createElement)(Provider // It is important to return the same object if props haven't
  // changed to avoid  unnecessary rerenders.
  // See https://reactjs.org/docs/context.html#caveats.
  , {
    value: (0,external_wp_element_namespaceObject.useMemo)(() => context, Object.values(context))
  }, (0,external_wp_element_namespaceObject.createElement)(edit, props));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/more-horizontal.js


/**
 * WordPress dependencies
 */

const moreHorizontal = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M11 13h2v-2h-2v2zm-6 0h2v-2H5v2zm12-2v2h2v-2h-2z"
}));
/* harmony default export */ var more_horizontal = (moreHorizontal);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/warning/index.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */






function Warning(_ref) {
  let {
    className,
    actions,
    children,
    secondaryActions
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    style: {
      display: 'contents',
      all: 'initial'
    }
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: classnames_default()(className, 'block-editor-warning')
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-warning__contents"
  }, (0,external_wp_element_namespaceObject.createElement)("p", {
    className: "block-editor-warning__message"
  }, children), (external_wp_element_namespaceObject.Children.count(actions) > 0 || secondaryActions) && (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-warning__actions"
  }, external_wp_element_namespaceObject.Children.count(actions) > 0 && external_wp_element_namespaceObject.Children.map(actions, (action, i) => (0,external_wp_element_namespaceObject.createElement)("span", {
    key: i,
    className: "block-editor-warning__action"
  }, action)), secondaryActions && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.DropdownMenu, {
    className: "block-editor-warning__secondary",
    icon: more_horizontal,
    label: (0,external_wp_i18n_namespaceObject.__)('More options'),
    popoverProps: {
      position: 'bottom left',
      className: 'block-editor-warning__dropdown'
    },
    noIcons: true
  }, () => (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuGroup, null, secondaryActions.map((item, pos) => (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
    onClick: item.onClick,
    key: pos
  }, item.title))))))));
}
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/warning/README.md
 */


/* harmony default export */ var warning = (Warning);

// EXTERNAL MODULE: ./node_modules/diff/lib/diff/character.js
var character = __webpack_require__(1973);
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-compare/block-view.js


/**
 * WordPress dependencies
 */



function BlockView(_ref) {
  let {
    title,
    rawContent,
    renderedContent,
    action,
    actionText,
    className
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: className
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-compare__content"
  }, (0,external_wp_element_namespaceObject.createElement)("h2", {
    className: "block-editor-block-compare__heading"
  }, title), (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-compare__html"
  }, rawContent), (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-compare__preview edit-post-visual-editor"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.RawHTML, null, (0,external_wp_dom_namespaceObject.safeHTML)(renderedContent)))), (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-compare__action"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    variant: "secondary",
    tabIndex: "0",
    onClick: action
  }, actionText)));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-compare/index.js


/**
 * External dependencies
 */

 // diff doesn't tree-shake correctly, so we import from the individual
// module here, to avoid including too much of the library


/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */



function BlockCompare(_ref) {
  let {
    block,
    onKeep,
    onConvert,
    convertor,
    convertButtonText
  } = _ref;

  function getDifference(originalContent, newContent) {
    const difference = (0,character/* diffChars */.Kx)(originalContent, newContent);
    return difference.map((item, pos) => {
      const classes = classnames_default()({
        'block-editor-block-compare__added': item.added,
        'block-editor-block-compare__removed': item.removed
      });
      return (0,external_wp_element_namespaceObject.createElement)("span", {
        key: pos,
        className: classes
      }, item.value);
    });
  }

  function getConvertedContent(convertedBlock) {
    // The convertor may return an array of items or a single item.
    const newBlocks = (0,external_lodash_namespaceObject.castArray)(convertedBlock); // Get converted block details.

    const newContent = newBlocks.map(item => (0,external_wp_blocks_namespaceObject.getSaveContent)(item.name, item.attributes, item.innerBlocks));
    return newContent.join('');
  }

  const converted = getConvertedContent(convertor(block));
  const difference = getDifference(block.originalContent, converted);
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-compare__wrapper"
  }, (0,external_wp_element_namespaceObject.createElement)(BlockView, {
    title: (0,external_wp_i18n_namespaceObject.__)('Current'),
    className: "block-editor-block-compare__current",
    action: onKeep,
    actionText: (0,external_wp_i18n_namespaceObject.__)('Convert to HTML'),
    rawContent: block.originalContent,
    renderedContent: block.originalContent
  }), (0,external_wp_element_namespaceObject.createElement)(BlockView, {
    title: (0,external_wp_i18n_namespaceObject.__)('After Conversion'),
    className: "block-editor-block-compare__converted",
    action: onConvert,
    actionText: convertButtonText,
    rawContent: difference,
    renderedContent: converted
  }));
}

/* harmony default export */ var block_compare = (BlockCompare);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/block-invalid-warning.js


/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */




function BlockInvalidWarning(_ref) {
  let {
    convertToHTML,
    convertToBlocks,
    convertToClassic,
    attemptBlockRecovery,
    block
  } = _ref;
  const hasHTMLBlock = !!(0,external_wp_blocks_namespaceObject.getBlockType)('core/html');
  const [compare, setCompare] = (0,external_wp_element_namespaceObject.useState)(false);
  const onCompare = (0,external_wp_element_namespaceObject.useCallback)(() => setCompare(true), []);
  const onCompareClose = (0,external_wp_element_namespaceObject.useCallback)(() => setCompare(false), []); // We memo the array here to prevent the children components from being updated unexpectedly.

  const hiddenActions = (0,external_wp_element_namespaceObject.useMemo)(() => [{
    // translators: Button to fix block content
    title: (0,external_wp_i18n_namespaceObject._x)('Resolve', 'imperative verb'),
    onClick: onCompare
  }, hasHTMLBlock && {
    title: (0,external_wp_i18n_namespaceObject.__)('Convert to HTML'),
    onClick: convertToHTML
  }, {
    title: (0,external_wp_i18n_namespaceObject.__)('Convert to Classic Block'),
    onClick: convertToClassic
  }].filter(Boolean), [onCompare, convertToHTML, convertToClassic]);
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(warning, {
    actions: [(0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
      key: "recover",
      onClick: attemptBlockRecovery,
      variant: "primary"
    }, (0,external_wp_i18n_namespaceObject.__)('Attempt Block Recovery'))],
    secondaryActions: hiddenActions
  }, (0,external_wp_i18n_namespaceObject.__)('This block contains unexpected or invalid content.')), compare && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Modal, {
    title: // translators: Dialog title to fix block content
    (0,external_wp_i18n_namespaceObject.__)('Resolve Block'),
    onRequestClose: onCompareClose,
    className: "block-editor-block-compare"
  }, (0,external_wp_element_namespaceObject.createElement)(block_compare, {
    block: block,
    onKeep: convertToHTML,
    onConvert: convertToBlocks,
    convertor: blockToBlocks,
    convertButtonText: (0,external_wp_i18n_namespaceObject.__)('Convert to Blocks')
  })));
}

const blockToClassic = block => (0,external_wp_blocks_namespaceObject.createBlock)('core/freeform', {
  content: block.originalContent
});

const blockToHTML = block => (0,external_wp_blocks_namespaceObject.createBlock)('core/html', {
  content: block.originalContent
});

const blockToBlocks = block => (0,external_wp_blocks_namespaceObject.rawHandler)({
  HTML: block.originalContent
});

const recoverBlock = _ref2 => {
  let {
    name,
    attributes,
    innerBlocks
  } = _ref2;
  return (0,external_wp_blocks_namespaceObject.createBlock)(name, attributes, innerBlocks);
};

/* harmony default export */ var block_invalid_warning = ((0,external_wp_compose_namespaceObject.compose)([(0,external_wp_data_namespaceObject.withSelect)((select, _ref3) => {
  let {
    clientId
  } = _ref3;
  return {
    block: select(store).getBlock(clientId)
  };
}), (0,external_wp_data_namespaceObject.withDispatch)((dispatch, _ref4) => {
  let {
    block
  } = _ref4;
  const {
    replaceBlock
  } = dispatch(store);
  return {
    convertToClassic() {
      replaceBlock(block.clientId, blockToClassic(block));
    },

    convertToHTML() {
      replaceBlock(block.clientId, blockToHTML(block));
    },

    convertToBlocks() {
      replaceBlock(block.clientId, blockToBlocks(block));
    },

    attemptBlockRecovery() {
      replaceBlock(block.clientId, recoverBlock(block));
    }

  };
})])(BlockInvalidWarning));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/block-crash-warning.js


/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */


const block_crash_warning_warning = (0,external_wp_element_namespaceObject.createElement)(warning, {
  className: "block-editor-block-list__block-crash-warning"
}, (0,external_wp_i18n_namespaceObject.__)('This block has encountered an error and cannot be previewed.'));
/* harmony default export */ var block_crash_warning = (() => block_crash_warning_warning);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/block-crash-boundary.js
/**
 * WordPress dependencies
 */


class BlockCrashBoundary extends external_wp_element_namespaceObject.Component {
  constructor() {
    super(...arguments);
    this.state = {
      hasError: false
    };
  }

  componentDidCatch() {
    this.setState({
      hasError: true
    });
  }

  render() {
    if (this.state.hasError) {
      return this.props.fallback;
    }

    return this.props.children;
  }

}

/* harmony default export */ var block_crash_boundary = (BlockCrashBoundary);

// EXTERNAL MODULE: ./node_modules/react-autosize-textarea/lib/index.js
var lib = __webpack_require__(773);
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/block-html.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */



function BlockHTML(_ref) {
  let {
    clientId
  } = _ref;
  const [html, setHtml] = (0,external_wp_element_namespaceObject.useState)('');
  const block = (0,external_wp_data_namespaceObject.useSelect)(select => select(store).getBlock(clientId), [clientId]);
  const {
    updateBlock
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);

  const onChange = () => {
    const blockType = (0,external_wp_blocks_namespaceObject.getBlockType)(block.name);

    if (!blockType) {
      return;
    }

    const attributes = (0,external_wp_blocks_namespaceObject.getBlockAttributes)(blockType, html, block.attributes); // If html is empty  we reset the block to the default HTML and mark it as valid to avoid triggering an error

    const content = html ? html : (0,external_wp_blocks_namespaceObject.getSaveContent)(blockType, attributes);
    const [isValid] = html ? (0,external_wp_blocks_namespaceObject.validateBlock)({ ...block,
      attributes,
      originalContent: content
    }) : [true];
    updateBlock(clientId, {
      attributes,
      originalContent: content,
      isValid
    }); // Ensure the state is updated if we reset so it displays the default content.

    if (!html) {
      setHtml({
        content
      });
    }
  };

  (0,external_wp_element_namespaceObject.useEffect)(() => {
    setHtml((0,external_wp_blocks_namespaceObject.getBlockContent)(block));
  }, [block]);
  return (0,external_wp_element_namespaceObject.createElement)(lib/* default */.Z, {
    className: "block-editor-block-list__block-html-textarea",
    value: html,
    onBlur: onChange,
    onChange: event => setHtml(event.target.value)
  });
}

/* harmony default export */ var block_html = (BlockHTML);

;// CONCATENATED MODULE: ./node_modules/@react-spring/rafz/dist/react-spring-rafz.esm.js
let updateQueue = makeQueue();
const raf = fn => schedule(fn, updateQueue);
let writeQueue = makeQueue();

raf.write = fn => schedule(fn, writeQueue);

let onStartQueue = makeQueue();

raf.onStart = fn => schedule(fn, onStartQueue);

let onFrameQueue = makeQueue();

raf.onFrame = fn => schedule(fn, onFrameQueue);

let onFinishQueue = makeQueue();

raf.onFinish = fn => schedule(fn, onFinishQueue);

let timeouts = [];

raf.setTimeout = (handler, ms) => {
  let time = raf.now() + ms;

  let cancel = () => {
    let i = timeouts.findIndex(t => t.cancel == cancel);
    if (~i) timeouts.splice(i, 1);
    pendingCount -= ~i ? 1 : 0;
  };

  let timeout = {
    time,
    handler,
    cancel
  };
  timeouts.splice(findTimeout(time), 0, timeout);
  pendingCount += 1;
  start();
  return timeout;
};

let findTimeout = time => ~(~timeouts.findIndex(t => t.time > time) || ~timeouts.length);

raf.cancel = fn => {
  onStartQueue.delete(fn);
  onFrameQueue.delete(fn);
  onFinishQueue.delete(fn);
  updateQueue.delete(fn);
  writeQueue.delete(fn);
};

raf.sync = fn => {
  sync = true;
  raf.batchedUpdates(fn);
  sync = false;
};

raf.throttle = fn => {
  let lastArgs;

  function queuedFn() {
    try {
      fn(...lastArgs);
    } finally {
      lastArgs = null;
    }
  }

  function throttled(...args) {
    lastArgs = args;
    raf.onStart(queuedFn);
  }

  throttled.handler = fn;

  throttled.cancel = () => {
    onStartQueue.delete(queuedFn);
    lastArgs = null;
  };

  return throttled;
};

let nativeRaf = typeof window != 'undefined' ? window.requestAnimationFrame : () => {};

raf.use = impl => nativeRaf = impl;

raf.now = typeof performance != 'undefined' ? () => performance.now() : Date.now;

raf.batchedUpdates = fn => fn();

raf.catch = console.error;
raf.frameLoop = 'always';

raf.advance = () => {
  if (raf.frameLoop !== 'demand') {
    console.warn('Cannot call the manual advancement of rafz whilst frameLoop is not set as demand');
  } else {
    update();
  }
};

let ts = -1;
let pendingCount = 0;
let sync = false;

function schedule(fn, queue) {
  if (sync) {
    queue.delete(fn);
    fn(0);
  } else {
    queue.add(fn);
    start();
  }
}

function start() {
  if (ts < 0) {
    ts = 0;

    if (raf.frameLoop !== 'demand') {
      nativeRaf(loop);
    }
  }
}

function stop() {
  ts = -1;
}

function loop() {
  if (~ts) {
    nativeRaf(loop);
    raf.batchedUpdates(update);
  }
}

function update() {
  let prevTs = ts;
  ts = raf.now();
  let count = findTimeout(ts);

  if (count) {
    eachSafely(timeouts.splice(0, count), t => t.handler());
    pendingCount -= count;
  }

  if (!pendingCount) {
    stop();
    return;
  }

  onStartQueue.flush();
  updateQueue.flush(prevTs ? Math.min(64, ts - prevTs) : 16.667);
  onFrameQueue.flush();
  writeQueue.flush();
  onFinishQueue.flush();
}

function makeQueue() {
  let next = new Set();
  let current = next;
  return {
    add(fn) {
      pendingCount += current == next && !next.has(fn) ? 1 : 0;
      next.add(fn);
    },

    delete(fn) {
      pendingCount -= current == next && next.has(fn) ? 1 : 0;
      return next.delete(fn);
    },

    flush(arg) {
      if (current.size) {
        next = new Set();
        pendingCount -= current.size;
        eachSafely(current, fn => fn(arg) && next.add(fn));
        pendingCount += next.size;
        current = next;
      }
    }

  };
}

function eachSafely(values, each) {
  values.forEach(value => {
    try {
      each(value);
    } catch (e) {
      raf.catch(e);
    }
  });
}

const __raf = {
  count() {
    return pendingCount;
  },

  isRunning() {
    return ts >= 0;
  },

  clear() {
    ts = -1;
    timeouts = [];
    onStartQueue = makeQueue();
    updateQueue = makeQueue();
    onFrameQueue = makeQueue();
    writeQueue = makeQueue();
    onFinishQueue = makeQueue();
    pendingCount = 0;
  }

};



// EXTERNAL MODULE: external "React"
var external_React_ = __webpack_require__(9196);
var external_React_default = /*#__PURE__*/__webpack_require__.n(external_React_);
;// CONCATENATED MODULE: ./node_modules/@react-spring/shared/dist/react-spring-shared.esm.js




function noop() {}
const defineHidden = (obj, key, value) => Object.defineProperty(obj, key, {
  value,
  writable: true,
  configurable: true
});
const react_spring_shared_esm_is = {
  arr: Array.isArray,
  obj: a => !!a && a.constructor.name === 'Object',
  fun: a => typeof a === 'function',
  str: a => typeof a === 'string',
  num: a => typeof a === 'number',
  und: a => a === undefined
};
function isEqual(a, b) {
  if (react_spring_shared_esm_is.arr(a)) {
    if (!react_spring_shared_esm_is.arr(b) || a.length !== b.length) return false;

    for (let i = 0; i < a.length; i++) {
      if (a[i] !== b[i]) return false;
    }

    return true;
  }

  return a === b;
}
const react_spring_shared_esm_each = (obj, fn) => obj.forEach(fn);
function eachProp(obj, fn, ctx) {
  if (react_spring_shared_esm_is.arr(obj)) {
    for (let i = 0; i < obj.length; i++) {
      fn.call(ctx, obj[i], `${i}`);
    }

    return;
  }

  for (const key in obj) {
    if (obj.hasOwnProperty(key)) {
      fn.call(ctx, obj[key], key);
    }
  }
}
const react_spring_shared_esm_toArray = a => react_spring_shared_esm_is.und(a) ? [] : react_spring_shared_esm_is.arr(a) ? a : [a];
function flush(queue, iterator) {
  if (queue.size) {
    const items = Array.from(queue);
    queue.clear();
    react_spring_shared_esm_each(items, iterator);
  }
}
const flushCalls = (queue, ...args) => flush(queue, fn => fn(...args));
const isSSR = () => typeof window === 'undefined' || !window.navigator || /ServerSideRendering|^Deno\//.test(window.navigator.userAgent);

let createStringInterpolator$1;
let to;
let colors$1 = null;
let skipAnimation = false;
let willAdvance = noop;
const react_spring_shared_esm_assign = globals => {
  if (globals.to) to = globals.to;
  if (globals.now) raf.now = globals.now;
  if (globals.colors !== undefined) colors$1 = globals.colors;
  if (globals.skipAnimation != null) skipAnimation = globals.skipAnimation;
  if (globals.createStringInterpolator) createStringInterpolator$1 = globals.createStringInterpolator;
  if (globals.requestAnimationFrame) raf.use(globals.requestAnimationFrame);
  if (globals.batchedUpdates) raf.batchedUpdates = globals.batchedUpdates;
  if (globals.willAdvance) willAdvance = globals.willAdvance;
  if (globals.frameLoop) raf.frameLoop = globals.frameLoop;
};

var globals = /*#__PURE__*/Object.freeze({
  __proto__: null,
  get createStringInterpolator () { return createStringInterpolator$1; },
  get to () { return to; },
  get colors () { return colors$1; },
  get skipAnimation () { return skipAnimation; },
  get willAdvance () { return willAdvance; },
  assign: react_spring_shared_esm_assign
});

const startQueue = new Set();
let currentFrame = [];
let prevFrame = [];
let priority = 0;
const frameLoop = {
  get idle() {
    return !startQueue.size && !currentFrame.length;
  },

  start(animation) {
    if (priority > animation.priority) {
      startQueue.add(animation);
      raf.onStart(flushStartQueue);
    } else {
      startSafely(animation);
      raf(advance);
    }
  },

  advance,

  sort(animation) {
    if (priority) {
      raf.onFrame(() => frameLoop.sort(animation));
    } else {
      const prevIndex = currentFrame.indexOf(animation);

      if (~prevIndex) {
        currentFrame.splice(prevIndex, 1);
        startUnsafely(animation);
      }
    }
  },

  clear() {
    currentFrame = [];
    startQueue.clear();
  }

};

function flushStartQueue() {
  startQueue.forEach(startSafely);
  startQueue.clear();
  raf(advance);
}

function startSafely(animation) {
  if (!currentFrame.includes(animation)) startUnsafely(animation);
}

function startUnsafely(animation) {
  currentFrame.splice(findIndex(currentFrame, other => other.priority > animation.priority), 0, animation);
}

function advance(dt) {
  const nextFrame = prevFrame;

  for (let i = 0; i < currentFrame.length; i++) {
    const animation = currentFrame[i];
    priority = animation.priority;

    if (!animation.idle) {
      willAdvance(animation);
      animation.advance(dt);

      if (!animation.idle) {
        nextFrame.push(animation);
      }
    }
  }

  priority = 0;
  prevFrame = currentFrame;
  prevFrame.length = 0;
  currentFrame = nextFrame;
  return currentFrame.length > 0;
}

function findIndex(arr, test) {
  const index = arr.findIndex(test);
  return index < 0 ? arr.length : index;
}

const colors = {
  transparent: 0x00000000,
  aliceblue: 0xf0f8ffff,
  antiquewhite: 0xfaebd7ff,
  aqua: 0x00ffffff,
  aquamarine: 0x7fffd4ff,
  azure: 0xf0ffffff,
  beige: 0xf5f5dcff,
  bisque: 0xffe4c4ff,
  black: 0x000000ff,
  blanchedalmond: 0xffebcdff,
  blue: 0x0000ffff,
  blueviolet: 0x8a2be2ff,
  brown: 0xa52a2aff,
  burlywood: 0xdeb887ff,
  burntsienna: 0xea7e5dff,
  cadetblue: 0x5f9ea0ff,
  chartreuse: 0x7fff00ff,
  chocolate: 0xd2691eff,
  coral: 0xff7f50ff,
  cornflowerblue: 0x6495edff,
  cornsilk: 0xfff8dcff,
  crimson: 0xdc143cff,
  cyan: 0x00ffffff,
  darkblue: 0x00008bff,
  darkcyan: 0x008b8bff,
  darkgoldenrod: 0xb8860bff,
  darkgray: 0xa9a9a9ff,
  darkgreen: 0x006400ff,
  darkgrey: 0xa9a9a9ff,
  darkkhaki: 0xbdb76bff,
  darkmagenta: 0x8b008bff,
  darkolivegreen: 0x556b2fff,
  darkorange: 0xff8c00ff,
  darkorchid: 0x9932ccff,
  darkred: 0x8b0000ff,
  darksalmon: 0xe9967aff,
  darkseagreen: 0x8fbc8fff,
  darkslateblue: 0x483d8bff,
  darkslategray: 0x2f4f4fff,
  darkslategrey: 0x2f4f4fff,
  darkturquoise: 0x00ced1ff,
  darkviolet: 0x9400d3ff,
  deeppink: 0xff1493ff,
  deepskyblue: 0x00bfffff,
  dimgray: 0x696969ff,
  dimgrey: 0x696969ff,
  dodgerblue: 0x1e90ffff,
  firebrick: 0xb22222ff,
  floralwhite: 0xfffaf0ff,
  forestgreen: 0x228b22ff,
  fuchsia: 0xff00ffff,
  gainsboro: 0xdcdcdcff,
  ghostwhite: 0xf8f8ffff,
  gold: 0xffd700ff,
  goldenrod: 0xdaa520ff,
  gray: 0x808080ff,
  green: 0x008000ff,
  greenyellow: 0xadff2fff,
  grey: 0x808080ff,
  honeydew: 0xf0fff0ff,
  hotpink: 0xff69b4ff,
  indianred: 0xcd5c5cff,
  indigo: 0x4b0082ff,
  ivory: 0xfffff0ff,
  khaki: 0xf0e68cff,
  lavender: 0xe6e6faff,
  lavenderblush: 0xfff0f5ff,
  lawngreen: 0x7cfc00ff,
  lemonchiffon: 0xfffacdff,
  lightblue: 0xadd8e6ff,
  lightcoral: 0xf08080ff,
  lightcyan: 0xe0ffffff,
  lightgoldenrodyellow: 0xfafad2ff,
  lightgray: 0xd3d3d3ff,
  lightgreen: 0x90ee90ff,
  lightgrey: 0xd3d3d3ff,
  lightpink: 0xffb6c1ff,
  lightsalmon: 0xffa07aff,
  lightseagreen: 0x20b2aaff,
  lightskyblue: 0x87cefaff,
  lightslategray: 0x778899ff,
  lightslategrey: 0x778899ff,
  lightsteelblue: 0xb0c4deff,
  lightyellow: 0xffffe0ff,
  lime: 0x00ff00ff,
  limegreen: 0x32cd32ff,
  linen: 0xfaf0e6ff,
  magenta: 0xff00ffff,
  maroon: 0x800000ff,
  mediumaquamarine: 0x66cdaaff,
  mediumblue: 0x0000cdff,
  mediumorchid: 0xba55d3ff,
  mediumpurple: 0x9370dbff,
  mediumseagreen: 0x3cb371ff,
  mediumslateblue: 0x7b68eeff,
  mediumspringgreen: 0x00fa9aff,
  mediumturquoise: 0x48d1ccff,
  mediumvioletred: 0xc71585ff,
  midnightblue: 0x191970ff,
  mintcream: 0xf5fffaff,
  mistyrose: 0xffe4e1ff,
  moccasin: 0xffe4b5ff,
  navajowhite: 0xffdeadff,
  navy: 0x000080ff,
  oldlace: 0xfdf5e6ff,
  olive: 0x808000ff,
  olivedrab: 0x6b8e23ff,
  orange: 0xffa500ff,
  orangered: 0xff4500ff,
  orchid: 0xda70d6ff,
  palegoldenrod: 0xeee8aaff,
  palegreen: 0x98fb98ff,
  paleturquoise: 0xafeeeeff,
  palevioletred: 0xdb7093ff,
  papayawhip: 0xffefd5ff,
  peachpuff: 0xffdab9ff,
  peru: 0xcd853fff,
  pink: 0xffc0cbff,
  plum: 0xdda0ddff,
  powderblue: 0xb0e0e6ff,
  purple: 0x800080ff,
  rebeccapurple: 0x663399ff,
  red: 0xff0000ff,
  rosybrown: 0xbc8f8fff,
  royalblue: 0x4169e1ff,
  saddlebrown: 0x8b4513ff,
  salmon: 0xfa8072ff,
  sandybrown: 0xf4a460ff,
  seagreen: 0x2e8b57ff,
  seashell: 0xfff5eeff,
  sienna: 0xa0522dff,
  silver: 0xc0c0c0ff,
  skyblue: 0x87ceebff,
  slateblue: 0x6a5acdff,
  slategray: 0x708090ff,
  slategrey: 0x708090ff,
  snow: 0xfffafaff,
  springgreen: 0x00ff7fff,
  steelblue: 0x4682b4ff,
  tan: 0xd2b48cff,
  teal: 0x008080ff,
  thistle: 0xd8bfd8ff,
  tomato: 0xff6347ff,
  turquoise: 0x40e0d0ff,
  violet: 0xee82eeff,
  wheat: 0xf5deb3ff,
  white: 0xffffffff,
  whitesmoke: 0xf5f5f5ff,
  yellow: 0xffff00ff,
  yellowgreen: 0x9acd32ff
};

const NUMBER = '[-+]?\\d*\\.?\\d+';
const PERCENTAGE = NUMBER + '%';

function call(...parts) {
  return '\\(\\s*(' + parts.join(')\\s*,\\s*(') + ')\\s*\\)';
}

const rgb = new RegExp('rgb' + call(NUMBER, NUMBER, NUMBER));
const rgba = new RegExp('rgba' + call(NUMBER, NUMBER, NUMBER, NUMBER));
const hsl = new RegExp('hsl' + call(NUMBER, PERCENTAGE, PERCENTAGE));
const hsla = new RegExp('hsla' + call(NUMBER, PERCENTAGE, PERCENTAGE, NUMBER));
const hex3 = /^#([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/;
const hex4 = /^#([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/;
const hex6 = /^#([0-9a-fA-F]{6})$/;
const hex8 = /^#([0-9a-fA-F]{8})$/;

function normalizeColor(color) {
  let match;

  if (typeof color === 'number') {
    return color >>> 0 === color && color >= 0 && color <= 0xffffffff ? color : null;
  }

  if (match = hex6.exec(color)) return parseInt(match[1] + 'ff', 16) >>> 0;

  if (colors$1 && colors$1[color] !== undefined) {
    return colors$1[color];
  }

  if (match = rgb.exec(color)) {
    return (parse255(match[1]) << 24 | parse255(match[2]) << 16 | parse255(match[3]) << 8 | 0x000000ff) >>> 0;
  }

  if (match = rgba.exec(color)) {
    return (parse255(match[1]) << 24 | parse255(match[2]) << 16 | parse255(match[3]) << 8 | parse1(match[4])) >>> 0;
  }

  if (match = hex3.exec(color)) {
    return parseInt(match[1] + match[1] + match[2] + match[2] + match[3] + match[3] + 'ff', 16) >>> 0;
  }

  if (match = hex8.exec(color)) return parseInt(match[1], 16) >>> 0;

  if (match = hex4.exec(color)) {
    return parseInt(match[1] + match[1] + match[2] + match[2] + match[3] + match[3] + match[4] + match[4], 16) >>> 0;
  }

  if (match = hsl.exec(color)) {
    return (hslToRgb(parse360(match[1]), parsePercentage(match[2]), parsePercentage(match[3])) | 0x000000ff) >>> 0;
  }

  if (match = hsla.exec(color)) {
    return (hslToRgb(parse360(match[1]), parsePercentage(match[2]), parsePercentage(match[3])) | parse1(match[4])) >>> 0;
  }

  return null;
}

function hue2rgb(p, q, t) {
  if (t < 0) t += 1;
  if (t > 1) t -= 1;
  if (t < 1 / 6) return p + (q - p) * 6 * t;
  if (t < 1 / 2) return q;
  if (t < 2 / 3) return p + (q - p) * (2 / 3 - t) * 6;
  return p;
}

function hslToRgb(h, s, l) {
  const q = l < 0.5 ? l * (1 + s) : l + s - l * s;
  const p = 2 * l - q;
  const r = hue2rgb(p, q, h + 1 / 3);
  const g = hue2rgb(p, q, h);
  const b = hue2rgb(p, q, h - 1 / 3);
  return Math.round(r * 255) << 24 | Math.round(g * 255) << 16 | Math.round(b * 255) << 8;
}

function parse255(str) {
  const int = parseInt(str, 10);
  if (int < 0) return 0;
  if (int > 255) return 255;
  return int;
}

function parse360(str) {
  const int = parseFloat(str);
  return (int % 360 + 360) % 360 / 360;
}

function parse1(str) {
  const num = parseFloat(str);
  if (num < 0) return 0;
  if (num > 1) return 255;
  return Math.round(num * 255);
}

function parsePercentage(str) {
  const int = parseFloat(str);
  if (int < 0) return 0;
  if (int > 100) return 1;
  return int / 100;
}

function colorToRgba(input) {
  let int32Color = normalizeColor(input);
  if (int32Color === null) return input;
  int32Color = int32Color || 0;
  let r = (int32Color & 0xff000000) >>> 24;
  let g = (int32Color & 0x00ff0000) >>> 16;
  let b = (int32Color & 0x0000ff00) >>> 8;
  let a = (int32Color & 0x000000ff) / 255;
  return `rgba(${r}, ${g}, ${b}, ${a})`;
}

const createInterpolator = (range, output, extrapolate) => {
  if (react_spring_shared_esm_is.fun(range)) {
    return range;
  }

  if (react_spring_shared_esm_is.arr(range)) {
    return createInterpolator({
      range,
      output: output,
      extrapolate
    });
  }

  if (react_spring_shared_esm_is.str(range.output[0])) {
    return createStringInterpolator$1(range);
  }

  const config = range;
  const outputRange = config.output;
  const inputRange = config.range || [0, 1];
  const extrapolateLeft = config.extrapolateLeft || config.extrapolate || 'extend';
  const extrapolateRight = config.extrapolateRight || config.extrapolate || 'extend';

  const easing = config.easing || (t => t);

  return input => {
    const range = findRange(input, inputRange);
    return interpolate(input, inputRange[range], inputRange[range + 1], outputRange[range], outputRange[range + 1], easing, extrapolateLeft, extrapolateRight, config.map);
  };
};

function interpolate(input, inputMin, inputMax, outputMin, outputMax, easing, extrapolateLeft, extrapolateRight, map) {
  let result = map ? map(input) : input;

  if (result < inputMin) {
    if (extrapolateLeft === 'identity') return result;else if (extrapolateLeft === 'clamp') result = inputMin;
  }

  if (result > inputMax) {
    if (extrapolateRight === 'identity') return result;else if (extrapolateRight === 'clamp') result = inputMax;
  }

  if (outputMin === outputMax) return outputMin;
  if (inputMin === inputMax) return input <= inputMin ? outputMin : outputMax;
  if (inputMin === -Infinity) result = -result;else if (inputMax === Infinity) result = result - inputMin;else result = (result - inputMin) / (inputMax - inputMin);
  result = easing(result);
  if (outputMin === -Infinity) result = -result;else if (outputMax === Infinity) result = result + outputMin;else result = result * (outputMax - outputMin) + outputMin;
  return result;
}

function findRange(input, inputRange) {
  for (var i = 1; i < inputRange.length - 1; ++i) if (inputRange[i] >= input) break;

  return i - 1;
}

function react_spring_shared_esm_extends() {
  react_spring_shared_esm_extends = Object.assign || function (target) {
    for (var i = 1; i < arguments.length; i++) {
      var source = arguments[i];

      for (var key in source) {
        if (Object.prototype.hasOwnProperty.call(source, key)) {
          target[key] = source[key];
        }
      }
    }

    return target;
  };

  return react_spring_shared_esm_extends.apply(this, arguments);
}

const $get = Symbol.for('FluidValue.get');
const $observers = Symbol.for('FluidValue.observers');

const hasFluidValue = arg => Boolean(arg && arg[$get]);

const getFluidValue = arg => arg && arg[$get] ? arg[$get]() : arg;

const getFluidObservers = target => target[$observers] || null;

function callFluidObserver(observer, event) {
  if (observer.eventObserved) {
    observer.eventObserved(event);
  } else {
    observer(event);
  }
}

function callFluidObservers(target, event) {
  let observers = target[$observers];

  if (observers) {
    observers.forEach(observer => {
      callFluidObserver(observer, event);
    });
  }
}

class FluidValue {
  constructor(get) {
    this[$get] = void 0;
    this[$observers] = void 0;

    if (!get && !(get = this.get)) {
      throw Error('Unknown getter');
    }

    setFluidGetter(this, get);
  }

}

const setFluidGetter = (target, get) => setHidden(target, $get, get);

function addFluidObserver(target, observer) {
  if (target[$get]) {
    let observers = target[$observers];

    if (!observers) {
      setHidden(target, $observers, observers = new Set());
    }

    if (!observers.has(observer)) {
      observers.add(observer);

      if (target.observerAdded) {
        target.observerAdded(observers.size, observer);
      }
    }
  }

  return observer;
}

function removeFluidObserver(target, observer) {
  let observers = target[$observers];

  if (observers && observers.has(observer)) {
    const count = observers.size - 1;

    if (count) {
      observers.delete(observer);
    } else {
      target[$observers] = null;
    }

    if (target.observerRemoved) {
      target.observerRemoved(count, observer);
    }
  }
}

const setHidden = (target, key, value) => Object.defineProperty(target, key, {
  value,
  writable: true,
  configurable: true
});

const numberRegex = /[+\-]?(?:0|[1-9]\d*)(?:\.\d*)?(?:[eE][+\-]?\d+)?/g;
const colorRegex = /(#(?:[0-9a-f]{2}){2,4}|(#[0-9a-f]{3})|(rgb|hsl)a?\((-?\d+%?[,\s]+){2,3}\s*[\d\.]+%?\))/gi;
const unitRegex = new RegExp(`(${numberRegex.source})(%|[a-z]+)`, 'i');
const rgbaRegex = /rgba\(([0-9\.-]+), ([0-9\.-]+), ([0-9\.-]+), ([0-9\.-]+)\)/gi;
const cssVariableRegex = /var\((--[a-zA-Z0-9-_]+),? ?([a-zA-Z0-9 ()%#.,-]+)?\)/;

const variableToRgba = input => {
  const [token, fallback] = parseCSSVariable(input);

  if (!token || isSSR()) {
    return input;
  }

  const value = window.getComputedStyle(document.documentElement).getPropertyValue(token);

  if (value) {
    return value.trim();
  } else if (fallback && fallback.startsWith('--')) {
    const _value = window.getComputedStyle(document.documentElement).getPropertyValue(fallback);

    if (_value) {
      return _value;
    } else {
      return input;
    }
  } else if (fallback && cssVariableRegex.test(fallback)) {
    return variableToRgba(fallback);
  } else if (fallback) {
    return fallback;
  }

  return input;
};

const parseCSSVariable = current => {
  const match = cssVariableRegex.exec(current);
  if (!match) return [,];
  const [, token, fallback] = match;
  return [token, fallback];
};

let namedColorRegex;

const rgbaRound = (_, p1, p2, p3, p4) => `rgba(${Math.round(p1)}, ${Math.round(p2)}, ${Math.round(p3)}, ${p4})`;

const createStringInterpolator = config => {
  if (!namedColorRegex) namedColorRegex = colors$1 ? new RegExp(`(${Object.keys(colors$1).join('|')})(?!\\w)`, 'g') : /^\b$/;
  const output = config.output.map(value => {
    return getFluidValue(value).replace(cssVariableRegex, variableToRgba).replace(colorRegex, colorToRgba).replace(namedColorRegex, colorToRgba);
  });
  const keyframes = output.map(value => value.match(numberRegex).map(Number));
  const outputRanges = keyframes[0].map((_, i) => keyframes.map(values => {
    if (!(i in values)) {
      throw Error('The arity of each "output" value must be equal');
    }

    return values[i];
  }));
  const interpolators = outputRanges.map(output => createInterpolator(react_spring_shared_esm_extends({}, config, {
    output
  })));
  return input => {
    var _output$find;

    const missingUnit = !unitRegex.test(output[0]) && ((_output$find = output.find(value => unitRegex.test(value))) == null ? void 0 : _output$find.replace(numberRegex, ''));
    let i = 0;
    return output[0].replace(numberRegex, () => `${interpolators[i++](input)}${missingUnit || ''}`).replace(rgbaRegex, rgbaRound);
  };
};

const prefix = 'react-spring: ';

const once = fn => {
  const func = fn;
  let called = false;

  if (typeof func != 'function') {
    throw new TypeError(`${prefix}once requires a function parameter`);
  }

  return (...args) => {
    if (!called) {
      func(...args);
      called = true;
    }
  };
};

const warnInterpolate = once(console.warn);
function react_spring_shared_esm_deprecateInterpolate() {
  warnInterpolate(`${prefix}The "interpolate" function is deprecated in v9 (use "to" instead)`);
}
const warnDirectCall = once(console.warn);
function deprecateDirectCall() {
  warnDirectCall(`${prefix}Directly calling start instead of using the api object is deprecated in v9 (use ".start" instead), this will be removed in later 0.X.0 versions`);
}

function isAnimatedString(value) {
  return react_spring_shared_esm_is.str(value) && (value[0] == '#' || /\d/.test(value) || !isSSR() && cssVariableRegex.test(value) || value in (colors$1 || {}));
}

const react_spring_shared_esm_useIsomorphicLayoutEffect = isSSR() ? external_React_.useEffect : external_React_.useLayoutEffect;

const useIsMounted = () => {
  const isMounted = (0,external_React_.useRef)(false);
  react_spring_shared_esm_useIsomorphicLayoutEffect(() => {
    isMounted.current = true;
    return () => {
      isMounted.current = false;
    };
  }, []);
  return isMounted;
};

function react_spring_shared_esm_useForceUpdate() {
  const update = (0,external_React_.useState)()[1];
  const isMounted = useIsMounted();
  return () => {
    if (isMounted.current) {
      update(Math.random());
    }
  };
}

function useMemoOne(getResult, inputs) {
  const [initial] = (0,external_React_.useState)(() => ({
    inputs,
    result: getResult()
  }));
  const committed = (0,external_React_.useRef)();
  const prevCache = committed.current;
  let cache = prevCache;

  if (cache) {
    const useCache = Boolean(inputs && cache.inputs && areInputsEqual(inputs, cache.inputs));

    if (!useCache) {
      cache = {
        inputs,
        result: getResult()
      };
    }
  } else {
    cache = initial;
  }

  (0,external_React_.useEffect)(() => {
    committed.current = cache;

    if (prevCache == initial) {
      initial.inputs = initial.result = undefined;
    }
  }, [cache]);
  return cache.result;
}

function areInputsEqual(next, prev) {
  if (next.length !== prev.length) {
    return false;
  }

  for (let i = 0; i < next.length; i++) {
    if (next[i] !== prev[i]) {
      return false;
    }
  }

  return true;
}

const react_spring_shared_esm_useOnce = effect => (0,external_React_.useEffect)(effect, emptyDeps);
const emptyDeps = [];

function react_spring_shared_esm_usePrev(value) {
  const prevRef = (0,external_React_.useRef)();
  (0,external_React_.useEffect)(() => {
    prevRef.current = value;
  });
  return prevRef.current;
}

const useReducedMotion = () => {
  const [reducedMotion, setReducedMotion] = useState(null);
  react_spring_shared_esm_useIsomorphicLayoutEffect(() => {
    const mql = window.matchMedia('(prefers-reduced-motion)');

    const handleMediaChange = e => {
      setReducedMotion(e.matches);
      react_spring_shared_esm_assign({
        skipAnimation: e.matches
      });
    };

    handleMediaChange(mql);
    mql.addEventListener('change', handleMediaChange);
    return () => {
      mql.removeEventListener('change', handleMediaChange);
    };
  }, []);
  return reducedMotion;
};



;// CONCATENATED MODULE: ./node_modules/@react-spring/animated/dist/react-spring-animated.esm.js




const $node = Symbol.for('Animated:node');
const isAnimated = value => !!value && value[$node] === value;
const getAnimated = owner => owner && owner[$node];
const setAnimated = (owner, node) => defineHidden(owner, $node, node);
const getPayload = owner => owner && owner[$node] && owner[$node].getPayload();
class Animated {
  constructor() {
    this.payload = void 0;
    setAnimated(this, this);
  }

  getPayload() {
    return this.payload || [];
  }

}

class AnimatedValue extends Animated {
  constructor(_value) {
    super();
    this.done = true;
    this.elapsedTime = void 0;
    this.lastPosition = void 0;
    this.lastVelocity = void 0;
    this.v0 = void 0;
    this.durationProgress = 0;
    this._value = _value;

    if (react_spring_shared_esm_is.num(this._value)) {
      this.lastPosition = this._value;
    }
  }

  static create(value) {
    return new AnimatedValue(value);
  }

  getPayload() {
    return [this];
  }

  getValue() {
    return this._value;
  }

  setValue(value, step) {
    if (react_spring_shared_esm_is.num(value)) {
      this.lastPosition = value;

      if (step) {
        value = Math.round(value / step) * step;

        if (this.done) {
          this.lastPosition = value;
        }
      }
    }

    if (this._value === value) {
      return false;
    }

    this._value = value;
    return true;
  }

  reset() {
    const {
      done
    } = this;
    this.done = false;

    if (react_spring_shared_esm_is.num(this._value)) {
      this.elapsedTime = 0;
      this.durationProgress = 0;
      this.lastPosition = this._value;
      if (done) this.lastVelocity = null;
      this.v0 = null;
    }
  }

}

class AnimatedString extends AnimatedValue {
  constructor(value) {
    super(0);
    this._string = null;
    this._toString = void 0;
    this._toString = createInterpolator({
      output: [value, value]
    });
  }

  static create(value) {
    return new AnimatedString(value);
  }

  getValue() {
    let value = this._string;
    return value == null ? this._string = this._toString(this._value) : value;
  }

  setValue(value) {
    if (react_spring_shared_esm_is.str(value)) {
      if (value == this._string) {
        return false;
      }

      this._string = value;
      this._value = 1;
    } else if (super.setValue(value)) {
      this._string = null;
    } else {
      return false;
    }

    return true;
  }

  reset(goal) {
    if (goal) {
      this._toString = createInterpolator({
        output: [this.getValue(), goal]
      });
    }

    this._value = 0;
    super.reset();
  }

}

const TreeContext = {
  dependencies: null
};

class AnimatedObject extends Animated {
  constructor(source) {
    super();
    this.source = source;
    this.setValue(source);
  }

  getValue(animated) {
    const values = {};
    eachProp(this.source, (source, key) => {
      if (isAnimated(source)) {
        values[key] = source.getValue(animated);
      } else if (hasFluidValue(source)) {
        values[key] = getFluidValue(source);
      } else if (!animated) {
        values[key] = source;
      }
    });
    return values;
  }

  setValue(source) {
    this.source = source;
    this.payload = this._makePayload(source);
  }

  reset() {
    if (this.payload) {
      react_spring_shared_esm_each(this.payload, node => node.reset());
    }
  }

  _makePayload(source) {
    if (source) {
      const payload = new Set();
      eachProp(source, this._addToPayload, payload);
      return Array.from(payload);
    }
  }

  _addToPayload(source) {
    if (TreeContext.dependencies && hasFluidValue(source)) {
      TreeContext.dependencies.add(source);
    }

    const payload = getPayload(source);

    if (payload) {
      react_spring_shared_esm_each(payload, node => this.add(node));
    }
  }

}

class AnimatedArray extends AnimatedObject {
  constructor(source) {
    super(source);
  }

  static create(source) {
    return new AnimatedArray(source);
  }

  getValue() {
    return this.source.map(node => node.getValue());
  }

  setValue(source) {
    const payload = this.getPayload();

    if (source.length == payload.length) {
      return payload.map((node, i) => node.setValue(source[i])).some(Boolean);
    }

    super.setValue(source.map(makeAnimated));
    return true;
  }

}

function makeAnimated(value) {
  const nodeType = isAnimatedString(value) ? AnimatedString : AnimatedValue;
  return nodeType.create(value);
}

function getAnimatedType(value) {
  const parentNode = getAnimated(value);
  return parentNode ? parentNode.constructor : react_spring_shared_esm_is.arr(value) ? AnimatedArray : isAnimatedString(value) ? AnimatedString : AnimatedValue;
}

function react_spring_animated_esm_extends() {
  react_spring_animated_esm_extends = Object.assign || function (target) {
    for (var i = 1; i < arguments.length; i++) {
      var source = arguments[i];

      for (var key in source) {
        if (Object.prototype.hasOwnProperty.call(source, key)) {
          target[key] = source[key];
        }
      }
    }

    return target;
  };

  return react_spring_animated_esm_extends.apply(this, arguments);
}

const withAnimated = (Component, host) => {
  const hasInstance = !react_spring_shared_esm_is.fun(Component) || Component.prototype && Component.prototype.isReactComponent;
  return (0,external_React_.forwardRef)((givenProps, givenRef) => {
    const instanceRef = (0,external_React_.useRef)(null);
    const ref = hasInstance && (0,external_React_.useCallback)(value => {
      instanceRef.current = updateRef(givenRef, value);
    }, [givenRef]);
    const [props, deps] = getAnimatedState(givenProps, host);
    const forceUpdate = react_spring_shared_esm_useForceUpdate();

    const callback = () => {
      const instance = instanceRef.current;

      if (hasInstance && !instance) {
        return;
      }

      const didUpdate = instance ? host.applyAnimatedValues(instance, props.getValue(true)) : false;

      if (didUpdate === false) {
        forceUpdate();
      }
    };

    const observer = new PropsObserver(callback, deps);
    const observerRef = (0,external_React_.useRef)();
    react_spring_shared_esm_useIsomorphicLayoutEffect(() => {
      observerRef.current = observer;
      react_spring_shared_esm_each(deps, dep => addFluidObserver(dep, observer));
      return () => {
        if (observerRef.current) {
          react_spring_shared_esm_each(observerRef.current.deps, dep => removeFluidObserver(dep, observerRef.current));
          raf.cancel(observerRef.current.update);
        }
      };
    });
    (0,external_React_.useEffect)(callback, []);
    react_spring_shared_esm_useOnce(() => () => {
      const observer = observerRef.current;
      react_spring_shared_esm_each(observer.deps, dep => removeFluidObserver(dep, observer));
    });
    const usedProps = host.getComponentProps(props.getValue());
    return external_React_.createElement(Component, react_spring_animated_esm_extends({}, usedProps, {
      ref: ref
    }));
  });
};

class PropsObserver {
  constructor(update, deps) {
    this.update = update;
    this.deps = deps;
  }

  eventObserved(event) {
    if (event.type == 'change') {
      raf.write(this.update);
    }
  }

}

function getAnimatedState(props, host) {
  const dependencies = new Set();
  TreeContext.dependencies = dependencies;
  if (props.style) props = react_spring_animated_esm_extends({}, props, {
    style: host.createAnimatedStyle(props.style)
  });
  props = new AnimatedObject(props);
  TreeContext.dependencies = null;
  return [props, dependencies];
}

function updateRef(ref, value) {
  if (ref) {
    if (react_spring_shared_esm_is.fun(ref)) ref(value);else ref.current = value;
  }

  return value;
}

const cacheKey = Symbol.for('AnimatedComponent');
const createHost = (components, {
  applyAnimatedValues: _applyAnimatedValues = () => false,
  createAnimatedStyle: _createAnimatedStyle = style => new AnimatedObject(style),
  getComponentProps: _getComponentProps = props => props
} = {}) => {
  const hostConfig = {
    applyAnimatedValues: _applyAnimatedValues,
    createAnimatedStyle: _createAnimatedStyle,
    getComponentProps: _getComponentProps
  };

  const animated = Component => {
    const displayName = getDisplayName(Component) || 'Anonymous';

    if (react_spring_shared_esm_is.str(Component)) {
      Component = animated[Component] || (animated[Component] = withAnimated(Component, hostConfig));
    } else {
      Component = Component[cacheKey] || (Component[cacheKey] = withAnimated(Component, hostConfig));
    }

    Component.displayName = `Animated(${displayName})`;
    return Component;
  };

  eachProp(components, (Component, key) => {
    if (react_spring_shared_esm_is.arr(components)) {
      key = getDisplayName(Component);
    }

    animated[key] = animated(Component);
  });
  return {
    animated
  };
};

const getDisplayName = arg => react_spring_shared_esm_is.str(arg) ? arg : arg && react_spring_shared_esm_is.str(arg.displayName) ? arg.displayName : react_spring_shared_esm_is.fun(arg) && arg.name || null;



;// CONCATENATED MODULE: ./node_modules/@react-spring/core/dist/react-spring-core.esm.js








function react_spring_core_esm_extends() {
  react_spring_core_esm_extends = Object.assign || function (target) {
    for (var i = 1; i < arguments.length; i++) {
      var source = arguments[i];

      for (var key in source) {
        if (Object.prototype.hasOwnProperty.call(source, key)) {
          target[key] = source[key];
        }
      }
    }

    return target;
  };

  return react_spring_core_esm_extends.apply(this, arguments);
}

function callProp(value, ...args) {
  return react_spring_shared_esm_is.fun(value) ? value(...args) : value;
}
const matchProp = (value, key) => value === true || !!(key && value && (react_spring_shared_esm_is.fun(value) ? value(key) : react_spring_shared_esm_toArray(value).includes(key)));
const resolveProp = (prop, key) => react_spring_shared_esm_is.obj(prop) ? key && prop[key] : prop;
const getDefaultProp = (props, key) => props.default === true ? props[key] : props.default ? props.default[key] : undefined;

const noopTransform = value => value;

const getDefaultProps = (props, transform = noopTransform) => {
  let keys = DEFAULT_PROPS;

  if (props.default && props.default !== true) {
    props = props.default;
    keys = Object.keys(props);
  }

  const defaults = {};

  for (const key of keys) {
    const value = transform(props[key], key);

    if (!react_spring_shared_esm_is.und(value)) {
      defaults[key] = value;
    }
  }

  return defaults;
};
const DEFAULT_PROPS = ['config', 'onProps', 'onStart', 'onChange', 'onPause', 'onResume', 'onRest'];
const RESERVED_PROPS = {
  config: 1,
  from: 1,
  to: 1,
  ref: 1,
  loop: 1,
  reset: 1,
  pause: 1,
  cancel: 1,
  reverse: 1,
  immediate: 1,
  default: 1,
  delay: 1,
  onProps: 1,
  onStart: 1,
  onChange: 1,
  onPause: 1,
  onResume: 1,
  onRest: 1,
  onResolve: 1,
  items: 1,
  trail: 1,
  sort: 1,
  expires: 1,
  initial: 1,
  enter: 1,
  update: 1,
  leave: 1,
  children: 1,
  onDestroyed: 1,
  keys: 1,
  callId: 1,
  parentId: 1
};

function getForwardProps(props) {
  const forward = {};
  let count = 0;
  eachProp(props, (value, prop) => {
    if (!RESERVED_PROPS[prop]) {
      forward[prop] = value;
      count++;
    }
  });

  if (count) {
    return forward;
  }
}

function inferTo(props) {
  const to = getForwardProps(props);

  if (to) {
    const out = {
      to
    };
    eachProp(props, (val, key) => key in to || (out[key] = val));
    return out;
  }

  return react_spring_core_esm_extends({}, props);
}
function computeGoal(value) {
  value = getFluidValue(value);
  return react_spring_shared_esm_is.arr(value) ? value.map(computeGoal) : isAnimatedString(value) ? globals.createStringInterpolator({
    range: [0, 1],
    output: [value, value]
  })(1) : value;
}
function hasProps(props) {
  for (const _ in props) return true;

  return false;
}
function isAsyncTo(to) {
  return react_spring_shared_esm_is.fun(to) || react_spring_shared_esm_is.arr(to) && react_spring_shared_esm_is.obj(to[0]);
}
function detachRefs(ctrl, ref) {
  var _ctrl$ref;

  (_ctrl$ref = ctrl.ref) == null ? void 0 : _ctrl$ref.delete(ctrl);
  ref == null ? void 0 : ref.delete(ctrl);
}
function replaceRef(ctrl, ref) {
  if (ref && ctrl.ref !== ref) {
    var _ctrl$ref2;

    (_ctrl$ref2 = ctrl.ref) == null ? void 0 : _ctrl$ref2.delete(ctrl);
    ref.add(ctrl);
    ctrl.ref = ref;
  }
}

function useChain(refs, timeSteps, timeFrame = 1000) {
  useIsomorphicLayoutEffect(() => {
    if (timeSteps) {
      let prevDelay = 0;
      each(refs, (ref, i) => {
        const controllers = ref.current;

        if (controllers.length) {
          let delay = timeFrame * timeSteps[i];
          if (isNaN(delay)) delay = prevDelay;else prevDelay = delay;
          each(controllers, ctrl => {
            each(ctrl.queue, props => {
              const memoizedDelayProp = props.delay;

              props.delay = key => delay + callProp(memoizedDelayProp || 0, key);
            });
          });
          ref.start();
        }
      });
    } else {
      let p = Promise.resolve();
      each(refs, ref => {
        const controllers = ref.current;

        if (controllers.length) {
          const queues = controllers.map(ctrl => {
            const q = ctrl.queue;
            ctrl.queue = [];
            return q;
          });
          p = p.then(() => {
            each(controllers, (ctrl, i) => each(queues[i] || [], update => ctrl.queue.push(update)));
            return Promise.all(ref.start());
          });
        }
      });
    }
  });
}

const config = {
  default: {
    tension: 170,
    friction: 26
  },
  gentle: {
    tension: 120,
    friction: 14
  },
  wobbly: {
    tension: 180,
    friction: 12
  },
  stiff: {
    tension: 210,
    friction: 20
  },
  slow: {
    tension: 280,
    friction: 60
  },
  molasses: {
    tension: 280,
    friction: 120
  }
};
const c1 = 1.70158;
const c2 = c1 * 1.525;
const c3 = c1 + 1;
const c4 = 2 * Math.PI / 3;
const c5 = 2 * Math.PI / 4.5;

const bounceOut = x => {
  const n1 = 7.5625;
  const d1 = 2.75;

  if (x < 1 / d1) {
    return n1 * x * x;
  } else if (x < 2 / d1) {
    return n1 * (x -= 1.5 / d1) * x + 0.75;
  } else if (x < 2.5 / d1) {
    return n1 * (x -= 2.25 / d1) * x + 0.9375;
  } else {
    return n1 * (x -= 2.625 / d1) * x + 0.984375;
  }
};

const easings = {
  linear: x => x,
  easeInQuad: x => x * x,
  easeOutQuad: x => 1 - (1 - x) * (1 - x),
  easeInOutQuad: x => x < 0.5 ? 2 * x * x : 1 - Math.pow(-2 * x + 2, 2) / 2,
  easeInCubic: x => x * x * x,
  easeOutCubic: x => 1 - Math.pow(1 - x, 3),
  easeInOutCubic: x => x < 0.5 ? 4 * x * x * x : 1 - Math.pow(-2 * x + 2, 3) / 2,
  easeInQuart: x => x * x * x * x,
  easeOutQuart: x => 1 - Math.pow(1 - x, 4),
  easeInOutQuart: x => x < 0.5 ? 8 * x * x * x * x : 1 - Math.pow(-2 * x + 2, 4) / 2,
  easeInQuint: x => x * x * x * x * x,
  easeOutQuint: x => 1 - Math.pow(1 - x, 5),
  easeInOutQuint: x => x < 0.5 ? 16 * x * x * x * x * x : 1 - Math.pow(-2 * x + 2, 5) / 2,
  easeInSine: x => 1 - Math.cos(x * Math.PI / 2),
  easeOutSine: x => Math.sin(x * Math.PI / 2),
  easeInOutSine: x => -(Math.cos(Math.PI * x) - 1) / 2,
  easeInExpo: x => x === 0 ? 0 : Math.pow(2, 10 * x - 10),
  easeOutExpo: x => x === 1 ? 1 : 1 - Math.pow(2, -10 * x),
  easeInOutExpo: x => x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? Math.pow(2, 20 * x - 10) / 2 : (2 - Math.pow(2, -20 * x + 10)) / 2,
  easeInCirc: x => 1 - Math.sqrt(1 - Math.pow(x, 2)),
  easeOutCirc: x => Math.sqrt(1 - Math.pow(x - 1, 2)),
  easeInOutCirc: x => x < 0.5 ? (1 - Math.sqrt(1 - Math.pow(2 * x, 2))) / 2 : (Math.sqrt(1 - Math.pow(-2 * x + 2, 2)) + 1) / 2,
  easeInBack: x => c3 * x * x * x - c1 * x * x,
  easeOutBack: x => 1 + c3 * Math.pow(x - 1, 3) + c1 * Math.pow(x - 1, 2),
  easeInOutBack: x => x < 0.5 ? Math.pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2) / 2 : (Math.pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2,
  easeInElastic: x => x === 0 ? 0 : x === 1 ? 1 : -Math.pow(2, 10 * x - 10) * Math.sin((x * 10 - 10.75) * c4),
  easeOutElastic: x => x === 0 ? 0 : x === 1 ? 1 : Math.pow(2, -10 * x) * Math.sin((x * 10 - 0.75) * c4) + 1,
  easeInOutElastic: x => x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? -(Math.pow(2, 20 * x - 10) * Math.sin((20 * x - 11.125) * c5)) / 2 : Math.pow(2, -20 * x + 10) * Math.sin((20 * x - 11.125) * c5) / 2 + 1,
  easeInBounce: x => 1 - bounceOut(1 - x),
  easeOutBounce: bounceOut,
  easeInOutBounce: x => x < 0.5 ? (1 - bounceOut(1 - 2 * x)) / 2 : (1 + bounceOut(2 * x - 1)) / 2
};

const defaults = react_spring_core_esm_extends({}, config.default, {
  mass: 1,
  damping: 1,
  easing: easings.linear,
  clamp: false
});

class AnimationConfig {
  constructor() {
    this.tension = void 0;
    this.friction = void 0;
    this.frequency = void 0;
    this.damping = void 0;
    this.mass = void 0;
    this.velocity = 0;
    this.restVelocity = void 0;
    this.precision = void 0;
    this.progress = void 0;
    this.duration = void 0;
    this.easing = void 0;
    this.clamp = void 0;
    this.bounce = void 0;
    this.decay = void 0;
    this.round = void 0;
    Object.assign(this, defaults);
  }

}
function mergeConfig(config, newConfig, defaultConfig) {
  if (defaultConfig) {
    defaultConfig = react_spring_core_esm_extends({}, defaultConfig);
    sanitizeConfig(defaultConfig, newConfig);
    newConfig = react_spring_core_esm_extends({}, defaultConfig, newConfig);
  }

  sanitizeConfig(config, newConfig);
  Object.assign(config, newConfig);

  for (const key in defaults) {
    if (config[key] == null) {
      config[key] = defaults[key];
    }
  }

  let {
    mass,
    frequency,
    damping
  } = config;

  if (!react_spring_shared_esm_is.und(frequency)) {
    if (frequency < 0.01) frequency = 0.01;
    if (damping < 0) damping = 0;
    config.tension = Math.pow(2 * Math.PI / frequency, 2) * mass;
    config.friction = 4 * Math.PI * damping * mass / frequency;
  }

  return config;
}

function sanitizeConfig(config, props) {
  if (!react_spring_shared_esm_is.und(props.decay)) {
    config.duration = undefined;
  } else {
    const isTensionConfig = !react_spring_shared_esm_is.und(props.tension) || !react_spring_shared_esm_is.und(props.friction);

    if (isTensionConfig || !react_spring_shared_esm_is.und(props.frequency) || !react_spring_shared_esm_is.und(props.damping) || !react_spring_shared_esm_is.und(props.mass)) {
      config.duration = undefined;
      config.decay = undefined;
    }

    if (isTensionConfig) {
      config.frequency = undefined;
    }
  }
}

const emptyArray = [];
class Animation {
  constructor() {
    this.changed = false;
    this.values = emptyArray;
    this.toValues = null;
    this.fromValues = emptyArray;
    this.to = void 0;
    this.from = void 0;
    this.config = new AnimationConfig();
    this.immediate = false;
  }

}

function scheduleProps(callId, {
  key,
  props,
  defaultProps,
  state,
  actions
}) {
  return new Promise((resolve, reject) => {
    var _props$cancel;

    let delay;
    let timeout;
    let cancel = matchProp((_props$cancel = props.cancel) != null ? _props$cancel : defaultProps == null ? void 0 : defaultProps.cancel, key);

    if (cancel) {
      onStart();
    } else {
      if (!react_spring_shared_esm_is.und(props.pause)) {
        state.paused = matchProp(props.pause, key);
      }

      let pause = defaultProps == null ? void 0 : defaultProps.pause;

      if (pause !== true) {
        pause = state.paused || matchProp(pause, key);
      }

      delay = callProp(props.delay || 0, key);

      if (pause) {
        state.resumeQueue.add(onResume);
        actions.pause();
      } else {
        actions.resume();
        onResume();
      }
    }

    function onPause() {
      state.resumeQueue.add(onResume);
      state.timeouts.delete(timeout);
      timeout.cancel();
      delay = timeout.time - raf.now();
    }

    function onResume() {
      if (delay > 0 && !globals.skipAnimation) {
        state.delayed = true;
        timeout = raf.setTimeout(onStart, delay);
        state.pauseQueue.add(onPause);
        state.timeouts.add(timeout);
      } else {
        onStart();
      }
    }

    function onStart() {
      if (state.delayed) {
        state.delayed = false;
      }

      state.pauseQueue.delete(onPause);
      state.timeouts.delete(timeout);

      if (callId <= (state.cancelId || 0)) {
        cancel = true;
      }

      try {
        actions.start(react_spring_core_esm_extends({}, props, {
          callId,
          cancel
        }), resolve);
      } catch (err) {
        reject(err);
      }
    }
  });
}

const getCombinedResult = (target, results) => results.length == 1 ? results[0] : results.some(result => result.cancelled) ? getCancelledResult(target.get()) : results.every(result => result.noop) ? getNoopResult(target.get()) : getFinishedResult(target.get(), results.every(result => result.finished));
const getNoopResult = value => ({
  value,
  noop: true,
  finished: true,
  cancelled: false
});
const getFinishedResult = (value, finished, cancelled = false) => ({
  value,
  finished,
  cancelled
});
const getCancelledResult = value => ({
  value,
  cancelled: true,
  finished: false
});

function runAsync(to, props, state, target) {
  const {
    callId,
    parentId,
    onRest
  } = props;
  const {
    asyncTo: prevTo,
    promise: prevPromise
  } = state;

  if (!parentId && to === prevTo && !props.reset) {
    return prevPromise;
  }

  return state.promise = (async () => {
    state.asyncId = callId;
    state.asyncTo = to;
    const defaultProps = getDefaultProps(props, (value, key) => key === 'onRest' ? undefined : value);
    let preventBail;
    let bail;
    const bailPromise = new Promise((resolve, reject) => (preventBail = resolve, bail = reject));

    const bailIfEnded = bailSignal => {
      const bailResult = callId <= (state.cancelId || 0) && getCancelledResult(target) || callId !== state.asyncId && getFinishedResult(target, false);

      if (bailResult) {
        bailSignal.result = bailResult;
        bail(bailSignal);
        throw bailSignal;
      }
    };

    const animate = (arg1, arg2) => {
      const bailSignal = new BailSignal();
      const skipAnimationSignal = new SkipAniamtionSignal();
      return (async () => {
        if (globals.skipAnimation) {
          stopAsync(state);
          skipAnimationSignal.result = getFinishedResult(target, false);
          bail(skipAnimationSignal);
          throw skipAnimationSignal;
        }

        bailIfEnded(bailSignal);
        const props = react_spring_shared_esm_is.obj(arg1) ? react_spring_core_esm_extends({}, arg1) : react_spring_core_esm_extends({}, arg2, {
          to: arg1
        });
        props.parentId = callId;
        eachProp(defaultProps, (value, key) => {
          if (react_spring_shared_esm_is.und(props[key])) {
            props[key] = value;
          }
        });
        const result = await target.start(props);
        bailIfEnded(bailSignal);

        if (state.paused) {
          await new Promise(resume => {
            state.resumeQueue.add(resume);
          });
        }

        return result;
      })();
    };

    let result;

    if (globals.skipAnimation) {
      stopAsync(state);
      return getFinishedResult(target, false);
    }

    try {
      let animating;

      if (react_spring_shared_esm_is.arr(to)) {
        animating = (async queue => {
          for (const props of queue) {
            await animate(props);
          }
        })(to);
      } else {
          animating = Promise.resolve(to(animate, target.stop.bind(target)));
        }

      await Promise.all([animating.then(preventBail), bailPromise]);
      result = getFinishedResult(target.get(), true, false);
    } catch (err) {
      if (err instanceof BailSignal) {
        result = err.result;
      } else if (err instanceof SkipAniamtionSignal) {
        result = err.result;
      } else {
        throw err;
      }
    } finally {
      if (callId == state.asyncId) {
        state.asyncId = parentId;
        state.asyncTo = parentId ? prevTo : undefined;
        state.promise = parentId ? prevPromise : undefined;
      }
    }

    if (react_spring_shared_esm_is.fun(onRest)) {
      raf.batchedUpdates(() => {
        onRest(result, target, target.item);
      });
    }

    return result;
  })();
}
function stopAsync(state, cancelId) {
  flush(state.timeouts, t => t.cancel());
  state.pauseQueue.clear();
  state.resumeQueue.clear();
  state.asyncId = state.asyncTo = state.promise = undefined;
  if (cancelId) state.cancelId = cancelId;
}
class BailSignal extends Error {
  constructor() {
    super('An async animation has been interrupted. You see this error because you ' + 'forgot to use `await` or `.catch(...)` on its returned promise.');
    this.result = void 0;
  }

}
class SkipAniamtionSignal extends Error {
  constructor() {
    super('SkipAnimationSignal');
    this.result = void 0;
  }

}

const isFrameValue = value => value instanceof FrameValue;
let nextId$1 = 1;
class FrameValue extends FluidValue {
  constructor(...args) {
    super(...args);
    this.id = nextId$1++;
    this.key = void 0;
    this._priority = 0;
  }

  get priority() {
    return this._priority;
  }

  set priority(priority) {
    if (this._priority != priority) {
      this._priority = priority;

      this._onPriorityChange(priority);
    }
  }

  get() {
    const node = getAnimated(this);
    return node && node.getValue();
  }

  to(...args) {
    return globals.to(this, args);
  }

  interpolate(...args) {
    react_spring_shared_esm_deprecateInterpolate();
    return globals.to(this, args);
  }

  toJSON() {
    return this.get();
  }

  observerAdded(count) {
    if (count == 1) this._attach();
  }

  observerRemoved(count) {
    if (count == 0) this._detach();
  }

  _attach() {}

  _detach() {}

  _onChange(value, idle = false) {
    callFluidObservers(this, {
      type: 'change',
      parent: this,
      value,
      idle
    });
  }

  _onPriorityChange(priority) {
    if (!this.idle) {
      frameLoop.sort(this);
    }

    callFluidObservers(this, {
      type: 'priority',
      parent: this,
      priority
    });
  }

}

const $P = Symbol.for('SpringPhase');
const HAS_ANIMATED = 1;
const IS_ANIMATING = 2;
const IS_PAUSED = 4;
const hasAnimated = target => (target[$P] & HAS_ANIMATED) > 0;
const isAnimating = target => (target[$P] & IS_ANIMATING) > 0;
const isPaused = target => (target[$P] & IS_PAUSED) > 0;
const setActiveBit = (target, active) => active ? target[$P] |= IS_ANIMATING | HAS_ANIMATED : target[$P] &= ~IS_ANIMATING;
const setPausedBit = (target, paused) => paused ? target[$P] |= IS_PAUSED : target[$P] &= ~IS_PAUSED;

class SpringValue extends FrameValue {
  constructor(arg1, arg2) {
    super();
    this.key = void 0;
    this.animation = new Animation();
    this.queue = void 0;
    this.defaultProps = {};
    this._state = {
      paused: false,
      delayed: false,
      pauseQueue: new Set(),
      resumeQueue: new Set(),
      timeouts: new Set()
    };
    this._pendingCalls = new Set();
    this._lastCallId = 0;
    this._lastToId = 0;
    this._memoizedDuration = 0;

    if (!react_spring_shared_esm_is.und(arg1) || !react_spring_shared_esm_is.und(arg2)) {
      const props = react_spring_shared_esm_is.obj(arg1) ? react_spring_core_esm_extends({}, arg1) : react_spring_core_esm_extends({}, arg2, {
        from: arg1
      });

      if (react_spring_shared_esm_is.und(props.default)) {
        props.default = true;
      }

      this.start(props);
    }
  }

  get idle() {
    return !(isAnimating(this) || this._state.asyncTo) || isPaused(this);
  }

  get goal() {
    return getFluidValue(this.animation.to);
  }

  get velocity() {
    const node = getAnimated(this);
    return node instanceof AnimatedValue ? node.lastVelocity || 0 : node.getPayload().map(node => node.lastVelocity || 0);
  }

  get hasAnimated() {
    return hasAnimated(this);
  }

  get isAnimating() {
    return isAnimating(this);
  }

  get isPaused() {
    return isPaused(this);
  }

  get isDelayed() {
    return this._state.delayed;
  }

  advance(dt) {
    let idle = true;
    let changed = false;
    const anim = this.animation;
    let {
      config,
      toValues
    } = anim;
    const payload = getPayload(anim.to);

    if (!payload && hasFluidValue(anim.to)) {
      toValues = react_spring_shared_esm_toArray(getFluidValue(anim.to));
    }

    anim.values.forEach((node, i) => {
      if (node.done) return;
      const to = node.constructor == AnimatedString ? 1 : payload ? payload[i].lastPosition : toValues[i];
      let finished = anim.immediate;
      let position = to;

      if (!finished) {
        position = node.lastPosition;

        if (config.tension <= 0) {
          node.done = true;
          return;
        }

        let elapsed = node.elapsedTime += dt;
        const from = anim.fromValues[i];
        const v0 = node.v0 != null ? node.v0 : node.v0 = react_spring_shared_esm_is.arr(config.velocity) ? config.velocity[i] : config.velocity;
        let velocity;

        if (!react_spring_shared_esm_is.und(config.duration)) {
          let p = 1;

          if (config.duration > 0) {
            if (this._memoizedDuration !== config.duration) {
              this._memoizedDuration = config.duration;

              if (node.durationProgress > 0) {
                node.elapsedTime = config.duration * node.durationProgress;
                elapsed = node.elapsedTime += dt;
              }
            }

            p = (config.progress || 0) + elapsed / this._memoizedDuration;
            p = p > 1 ? 1 : p < 0 ? 0 : p;
            node.durationProgress = p;
          }

          position = from + config.easing(p) * (to - from);
          velocity = (position - node.lastPosition) / dt;
          finished = p == 1;
        } else if (config.decay) {
            const decay = config.decay === true ? 0.998 : config.decay;
            const e = Math.exp(-(1 - decay) * elapsed);
            position = from + v0 / (1 - decay) * (1 - e);
            finished = Math.abs(node.lastPosition - position) < 0.1;
            velocity = v0 * e;
          } else {
              velocity = node.lastVelocity == null ? v0 : node.lastVelocity;
              const precision = config.precision || (from == to ? 0.005 : Math.min(1, Math.abs(to - from) * 0.001));
              const restVelocity = config.restVelocity || precision / 10;
              const bounceFactor = config.clamp ? 0 : config.bounce;
              const canBounce = !react_spring_shared_esm_is.und(bounceFactor);
              const isGrowing = from == to ? node.v0 > 0 : from < to;
              let isMoving;
              let isBouncing = false;
              const step = 1;
              const numSteps = Math.ceil(dt / step);

              for (let n = 0; n < numSteps; ++n) {
                isMoving = Math.abs(velocity) > restVelocity;

                if (!isMoving) {
                  finished = Math.abs(to - position) <= precision;

                  if (finished) {
                    break;
                  }
                }

                if (canBounce) {
                  isBouncing = position == to || position > to == isGrowing;

                  if (isBouncing) {
                    velocity = -velocity * bounceFactor;
                    position = to;
                  }
                }

                const springForce = -config.tension * 0.000001 * (position - to);
                const dampingForce = -config.friction * 0.001 * velocity;
                const acceleration = (springForce + dampingForce) / config.mass;
                velocity = velocity + acceleration * step;
                position = position + velocity * step;
              }
            }

        node.lastVelocity = velocity;

        if (Number.isNaN(position)) {
          console.warn(`Got NaN while animating:`, this);
          finished = true;
        }
      }

      if (payload && !payload[i].done) {
        finished = false;
      }

      if (finished) {
        node.done = true;
      } else {
        idle = false;
      }

      if (node.setValue(position, config.round)) {
        changed = true;
      }
    });
    const node = getAnimated(this);
    const currVal = node.getValue();

    if (idle) {
      const finalVal = getFluidValue(anim.to);

      if ((currVal !== finalVal || changed) && !config.decay) {
        node.setValue(finalVal);

        this._onChange(finalVal);
      } else if (changed && config.decay) {
        this._onChange(currVal);
      }

      this._stop();
    } else if (changed) {
      this._onChange(currVal);
    }
  }

  set(value) {
    raf.batchedUpdates(() => {
      this._stop();

      this._focus(value);

      this._set(value);
    });
    return this;
  }

  pause() {
    this._update({
      pause: true
    });
  }

  resume() {
    this._update({
      pause: false
    });
  }

  finish() {
    if (isAnimating(this)) {
      const {
        to,
        config
      } = this.animation;
      raf.batchedUpdates(() => {
        this._onStart();

        if (!config.decay) {
          this._set(to, false);
        }

        this._stop();
      });
    }

    return this;
  }

  update(props) {
    const queue = this.queue || (this.queue = []);
    queue.push(props);
    return this;
  }

  start(to, arg2) {
    let queue;

    if (!react_spring_shared_esm_is.und(to)) {
      queue = [react_spring_shared_esm_is.obj(to) ? to : react_spring_core_esm_extends({}, arg2, {
        to
      })];
    } else {
      queue = this.queue || [];
      this.queue = [];
    }

    return Promise.all(queue.map(props => {
      const up = this._update(props);

      return up;
    })).then(results => getCombinedResult(this, results));
  }

  stop(cancel) {
    const {
      to
    } = this.animation;

    this._focus(this.get());

    stopAsync(this._state, cancel && this._lastCallId);
    raf.batchedUpdates(() => this._stop(to, cancel));
    return this;
  }

  reset() {
    this._update({
      reset: true
    });
  }

  eventObserved(event) {
    if (event.type == 'change') {
      this._start();
    } else if (event.type == 'priority') {
      this.priority = event.priority + 1;
    }
  }

  _prepareNode(props) {
    const key = this.key || '';
    let {
      to,
      from
    } = props;
    to = react_spring_shared_esm_is.obj(to) ? to[key] : to;

    if (to == null || isAsyncTo(to)) {
      to = undefined;
    }

    from = react_spring_shared_esm_is.obj(from) ? from[key] : from;

    if (from == null) {
      from = undefined;
    }

    const range = {
      to,
      from
    };

    if (!hasAnimated(this)) {
      if (props.reverse) [to, from] = [from, to];
      from = getFluidValue(from);

      if (!react_spring_shared_esm_is.und(from)) {
        this._set(from);
      } else if (!getAnimated(this)) {
          this._set(to);
        }
    }

    return range;
  }

  _update(_ref, isLoop) {
    let props = react_spring_core_esm_extends({}, _ref);

    const {
      key,
      defaultProps
    } = this;
    if (props.default) Object.assign(defaultProps, getDefaultProps(props, (value, prop) => /^on/.test(prop) ? resolveProp(value, key) : value));
    mergeActiveFn(this, props, 'onProps');
    sendEvent(this, 'onProps', props, this);

    const range = this._prepareNode(props);

    if (Object.isFrozen(this)) {
      throw Error('Cannot animate a `SpringValue` object that is frozen. ' + 'Did you forget to pass your component to `animated(...)` before animating its props?');
    }

    const state = this._state;
    return scheduleProps(++this._lastCallId, {
      key,
      props,
      defaultProps,
      state,
      actions: {
        pause: () => {
          if (!isPaused(this)) {
            setPausedBit(this, true);
            flushCalls(state.pauseQueue);
            sendEvent(this, 'onPause', getFinishedResult(this, checkFinished(this, this.animation.to)), this);
          }
        },
        resume: () => {
          if (isPaused(this)) {
            setPausedBit(this, false);

            if (isAnimating(this)) {
              this._resume();
            }

            flushCalls(state.resumeQueue);
            sendEvent(this, 'onResume', getFinishedResult(this, checkFinished(this, this.animation.to)), this);
          }
        },
        start: this._merge.bind(this, range)
      }
    }).then(result => {
      if (props.loop && result.finished && !(isLoop && result.noop)) {
        const nextProps = createLoopUpdate(props);

        if (nextProps) {
          return this._update(nextProps, true);
        }
      }

      return result;
    });
  }

  _merge(range, props, resolve) {
    if (props.cancel) {
      this.stop(true);
      return resolve(getCancelledResult(this));
    }

    const hasToProp = !react_spring_shared_esm_is.und(range.to);
    const hasFromProp = !react_spring_shared_esm_is.und(range.from);

    if (hasToProp || hasFromProp) {
      if (props.callId > this._lastToId) {
        this._lastToId = props.callId;
      } else {
        return resolve(getCancelledResult(this));
      }
    }

    const {
      key,
      defaultProps,
      animation: anim
    } = this;
    const {
      to: prevTo,
      from: prevFrom
    } = anim;
    let {
      to = prevTo,
      from = prevFrom
    } = range;

    if (hasFromProp && !hasToProp && (!props.default || react_spring_shared_esm_is.und(to))) {
      to = from;
    }

    if (props.reverse) [to, from] = [from, to];
    const hasFromChanged = !isEqual(from, prevFrom);

    if (hasFromChanged) {
      anim.from = from;
    }

    from = getFluidValue(from);
    const hasToChanged = !isEqual(to, prevTo);

    if (hasToChanged) {
      this._focus(to);
    }

    const hasAsyncTo = isAsyncTo(props.to);
    const {
      config
    } = anim;
    const {
      decay,
      velocity
    } = config;

    if (hasToProp || hasFromProp) {
      config.velocity = 0;
    }

    if (props.config && !hasAsyncTo) {
      mergeConfig(config, callProp(props.config, key), props.config !== defaultProps.config ? callProp(defaultProps.config, key) : void 0);
    }

    let node = getAnimated(this);

    if (!node || react_spring_shared_esm_is.und(to)) {
      return resolve(getFinishedResult(this, true));
    }

    const reset = react_spring_shared_esm_is.und(props.reset) ? hasFromProp && !props.default : !react_spring_shared_esm_is.und(from) && matchProp(props.reset, key);
    const value = reset ? from : this.get();
    const goal = computeGoal(to);
    const isAnimatable = react_spring_shared_esm_is.num(goal) || react_spring_shared_esm_is.arr(goal) || isAnimatedString(goal);
    const immediate = !hasAsyncTo && (!isAnimatable || matchProp(defaultProps.immediate || props.immediate, key));

    if (hasToChanged) {
      const nodeType = getAnimatedType(to);

      if (nodeType !== node.constructor) {
        if (immediate) {
          node = this._set(goal);
        } else throw Error(`Cannot animate between ${node.constructor.name} and ${nodeType.name}, as the "to" prop suggests`);
      }
    }

    const goalType = node.constructor;
    let started = hasFluidValue(to);
    let finished = false;

    if (!started) {
      const hasValueChanged = reset || !hasAnimated(this) && hasFromChanged;

      if (hasToChanged || hasValueChanged) {
        finished = isEqual(computeGoal(value), goal);
        started = !finished;
      }

      if (!isEqual(anim.immediate, immediate) && !immediate || !isEqual(config.decay, decay) || !isEqual(config.velocity, velocity)) {
        started = true;
      }
    }

    if (finished && isAnimating(this)) {
      if (anim.changed && !reset) {
        started = true;
      } else if (!started) {
          this._stop(prevTo);
        }
    }

    if (!hasAsyncTo) {
      if (started || hasFluidValue(prevTo)) {
        anim.values = node.getPayload();
        anim.toValues = hasFluidValue(to) ? null : goalType == AnimatedString ? [1] : react_spring_shared_esm_toArray(goal);
      }

      if (anim.immediate != immediate) {
        anim.immediate = immediate;

        if (!immediate && !reset) {
          this._set(prevTo);
        }
      }

      if (started) {
        const {
          onRest
        } = anim;
        react_spring_shared_esm_each(ACTIVE_EVENTS, type => mergeActiveFn(this, props, type));
        const result = getFinishedResult(this, checkFinished(this, prevTo));
        flushCalls(this._pendingCalls, result);

        this._pendingCalls.add(resolve);

        if (anim.changed) raf.batchedUpdates(() => {
          anim.changed = !reset;
          onRest == null ? void 0 : onRest(result, this);

          if (reset) {
            callProp(defaultProps.onRest, result);
          } else {
              anim.onStart == null ? void 0 : anim.onStart(result, this);
            }
        });
      }
    }

    if (reset) {
      this._set(value);
    }

    if (hasAsyncTo) {
      resolve(runAsync(props.to, props, this._state, this));
    } else if (started) {
        this._start();
      } else if (isAnimating(this) && !hasToChanged) {
          this._pendingCalls.add(resolve);
        } else {
            resolve(getNoopResult(value));
          }
  }

  _focus(value) {
    const anim = this.animation;

    if (value !== anim.to) {
      if (getFluidObservers(this)) {
        this._detach();
      }

      anim.to = value;

      if (getFluidObservers(this)) {
        this._attach();
      }
    }
  }

  _attach() {
    let priority = 0;
    const {
      to
    } = this.animation;

    if (hasFluidValue(to)) {
      addFluidObserver(to, this);

      if (isFrameValue(to)) {
        priority = to.priority + 1;
      }
    }

    this.priority = priority;
  }

  _detach() {
    const {
      to
    } = this.animation;

    if (hasFluidValue(to)) {
      removeFluidObserver(to, this);
    }
  }

  _set(arg, idle = true) {
    const value = getFluidValue(arg);

    if (!react_spring_shared_esm_is.und(value)) {
      const oldNode = getAnimated(this);

      if (!oldNode || !isEqual(value, oldNode.getValue())) {
        const nodeType = getAnimatedType(value);

        if (!oldNode || oldNode.constructor != nodeType) {
          setAnimated(this, nodeType.create(value));
        } else {
          oldNode.setValue(value);
        }

        if (oldNode) {
          raf.batchedUpdates(() => {
            this._onChange(value, idle);
          });
        }
      }
    }

    return getAnimated(this);
  }

  _onStart() {
    const anim = this.animation;

    if (!anim.changed) {
      anim.changed = true;
      sendEvent(this, 'onStart', getFinishedResult(this, checkFinished(this, anim.to)), this);
    }
  }

  _onChange(value, idle) {
    if (!idle) {
      this._onStart();

      callProp(this.animation.onChange, value, this);
    }

    callProp(this.defaultProps.onChange, value, this);

    super._onChange(value, idle);
  }

  _start() {
    const anim = this.animation;
    getAnimated(this).reset(getFluidValue(anim.to));

    if (!anim.immediate) {
      anim.fromValues = anim.values.map(node => node.lastPosition);
    }

    if (!isAnimating(this)) {
      setActiveBit(this, true);

      if (!isPaused(this)) {
        this._resume();
      }
    }
  }

  _resume() {
    if (globals.skipAnimation) {
      this.finish();
    } else {
      frameLoop.start(this);
    }
  }

  _stop(goal, cancel) {
    if (isAnimating(this)) {
      setActiveBit(this, false);
      const anim = this.animation;
      react_spring_shared_esm_each(anim.values, node => {
        node.done = true;
      });

      if (anim.toValues) {
        anim.onChange = anim.onPause = anim.onResume = undefined;
      }

      callFluidObservers(this, {
        type: 'idle',
        parent: this
      });
      const result = cancel ? getCancelledResult(this.get()) : getFinishedResult(this.get(), checkFinished(this, goal != null ? goal : anim.to));
      flushCalls(this._pendingCalls, result);

      if (anim.changed) {
        anim.changed = false;
        sendEvent(this, 'onRest', result, this);
      }
    }
  }

}

function checkFinished(target, to) {
  const goal = computeGoal(to);
  const value = computeGoal(target.get());
  return isEqual(value, goal);
}

function createLoopUpdate(props, loop = props.loop, to = props.to) {
  let loopRet = callProp(loop);

  if (loopRet) {
    const overrides = loopRet !== true && inferTo(loopRet);
    const reverse = (overrides || props).reverse;
    const reset = !overrides || overrides.reset;
    return createUpdate(react_spring_core_esm_extends({}, props, {
      loop,
      default: false,
      pause: undefined,
      to: !reverse || isAsyncTo(to) ? to : undefined,
      from: reset ? props.from : undefined,
      reset
    }, overrides));
  }
}
function createUpdate(props) {
  const {
    to,
    from
  } = props = inferTo(props);
  const keys = new Set();
  if (react_spring_shared_esm_is.obj(to)) findDefined(to, keys);
  if (react_spring_shared_esm_is.obj(from)) findDefined(from, keys);
  props.keys = keys.size ? Array.from(keys) : null;
  return props;
}
function declareUpdate(props) {
  const update = createUpdate(props);

  if (react_spring_shared_esm_is.und(update.default)) {
    update.default = getDefaultProps(update);
  }

  return update;
}

function findDefined(values, keys) {
  eachProp(values, (value, key) => value != null && keys.add(key));
}

const ACTIVE_EVENTS = ['onStart', 'onRest', 'onChange', 'onPause', 'onResume'];

function mergeActiveFn(target, props, type) {
  target.animation[type] = props[type] !== getDefaultProp(props, type) ? resolveProp(props[type], target.key) : undefined;
}

function sendEvent(target, type, ...args) {
  var _target$animation$typ, _target$animation, _target$defaultProps$, _target$defaultProps;

  (_target$animation$typ = (_target$animation = target.animation)[type]) == null ? void 0 : _target$animation$typ.call(_target$animation, ...args);
  (_target$defaultProps$ = (_target$defaultProps = target.defaultProps)[type]) == null ? void 0 : _target$defaultProps$.call(_target$defaultProps, ...args);
}

const BATCHED_EVENTS = ['onStart', 'onChange', 'onRest'];
let nextId = 1;
class Controller {
  constructor(props, flush) {
    this.id = nextId++;
    this.springs = {};
    this.queue = [];
    this.ref = void 0;
    this._flush = void 0;
    this._initialProps = void 0;
    this._lastAsyncId = 0;
    this._active = new Set();
    this._changed = new Set();
    this._started = false;
    this._item = void 0;
    this._state = {
      paused: false,
      pauseQueue: new Set(),
      resumeQueue: new Set(),
      timeouts: new Set()
    };
    this._events = {
      onStart: new Map(),
      onChange: new Map(),
      onRest: new Map()
    };
    this._onFrame = this._onFrame.bind(this);

    if (flush) {
      this._flush = flush;
    }

    if (props) {
      this.start(react_spring_core_esm_extends({
        default: true
      }, props));
    }
  }

  get idle() {
    return !this._state.asyncTo && Object.values(this.springs).every(spring => {
      return spring.idle && !spring.isDelayed && !spring.isPaused;
    });
  }

  get item() {
    return this._item;
  }

  set item(item) {
    this._item = item;
  }

  get() {
    const values = {};
    this.each((spring, key) => values[key] = spring.get());
    return values;
  }

  set(values) {
    for (const key in values) {
      const value = values[key];

      if (!react_spring_shared_esm_is.und(value)) {
        this.springs[key].set(value);
      }
    }
  }

  update(props) {
    if (props) {
      this.queue.push(createUpdate(props));
    }

    return this;
  }

  start(props) {
    let {
      queue
    } = this;

    if (props) {
      queue = react_spring_shared_esm_toArray(props).map(createUpdate);
    } else {
      this.queue = [];
    }

    if (this._flush) {
      return this._flush(this, queue);
    }

    prepareKeys(this, queue);
    return flushUpdateQueue(this, queue);
  }

  stop(arg, keys) {
    if (arg !== !!arg) {
      keys = arg;
    }

    if (keys) {
      const springs = this.springs;
      react_spring_shared_esm_each(react_spring_shared_esm_toArray(keys), key => springs[key].stop(!!arg));
    } else {
      stopAsync(this._state, this._lastAsyncId);
      this.each(spring => spring.stop(!!arg));
    }

    return this;
  }

  pause(keys) {
    if (react_spring_shared_esm_is.und(keys)) {
      this.start({
        pause: true
      });
    } else {
      const springs = this.springs;
      react_spring_shared_esm_each(react_spring_shared_esm_toArray(keys), key => springs[key].pause());
    }

    return this;
  }

  resume(keys) {
    if (react_spring_shared_esm_is.und(keys)) {
      this.start({
        pause: false
      });
    } else {
      const springs = this.springs;
      react_spring_shared_esm_each(react_spring_shared_esm_toArray(keys), key => springs[key].resume());
    }

    return this;
  }

  each(iterator) {
    eachProp(this.springs, iterator);
  }

  _onFrame() {
    const {
      onStart,
      onChange,
      onRest
    } = this._events;
    const active = this._active.size > 0;
    const changed = this._changed.size > 0;

    if (active && !this._started || changed && !this._started) {
      this._started = true;
      flush(onStart, ([onStart, result]) => {
        result.value = this.get();
        onStart(result, this, this._item);
      });
    }

    const idle = !active && this._started;
    const values = changed || idle && onRest.size ? this.get() : null;

    if (changed && onChange.size) {
      flush(onChange, ([onChange, result]) => {
        result.value = values;
        onChange(result, this, this._item);
      });
    }

    if (idle) {
      this._started = false;
      flush(onRest, ([onRest, result]) => {
        result.value = values;
        onRest(result, this, this._item);
      });
    }
  }

  eventObserved(event) {
    if (event.type == 'change') {
      this._changed.add(event.parent);

      if (!event.idle) {
        this._active.add(event.parent);
      }
    } else if (event.type == 'idle') {
      this._active.delete(event.parent);
    } else return;

    raf.onFrame(this._onFrame);
  }

}
function flushUpdateQueue(ctrl, queue) {
  return Promise.all(queue.map(props => flushUpdate(ctrl, props))).then(results => getCombinedResult(ctrl, results));
}
async function flushUpdate(ctrl, props, isLoop) {
  const {
    keys,
    to,
    from,
    loop,
    onRest,
    onResolve
  } = props;
  const defaults = react_spring_shared_esm_is.obj(props.default) && props.default;

  if (loop) {
    props.loop = false;
  }

  if (to === false) props.to = null;
  if (from === false) props.from = null;
  const asyncTo = react_spring_shared_esm_is.arr(to) || react_spring_shared_esm_is.fun(to) ? to : undefined;

  if (asyncTo) {
    props.to = undefined;
    props.onRest = undefined;

    if (defaults) {
      defaults.onRest = undefined;
    }
  } else {
      react_spring_shared_esm_each(BATCHED_EVENTS, key => {
        const handler = props[key];

        if (react_spring_shared_esm_is.fun(handler)) {
          const queue = ctrl['_events'][key];

          props[key] = ({
            finished,
            cancelled
          }) => {
            const result = queue.get(handler);

            if (result) {
              if (!finished) result.finished = false;
              if (cancelled) result.cancelled = true;
            } else {
              queue.set(handler, {
                value: null,
                finished: finished || false,
                cancelled: cancelled || false
              });
            }
          };

          if (defaults) {
            defaults[key] = props[key];
          }
        }
      });
    }

  const state = ctrl['_state'];

  if (props.pause === !state.paused) {
    state.paused = props.pause;
    flushCalls(props.pause ? state.pauseQueue : state.resumeQueue);
  } else if (state.paused) {
      props.pause = true;
    }

  const promises = (keys || Object.keys(ctrl.springs)).map(key => ctrl.springs[key].start(props));
  const cancel = props.cancel === true || getDefaultProp(props, 'cancel') === true;

  if (asyncTo || cancel && state.asyncId) {
    promises.push(scheduleProps(++ctrl['_lastAsyncId'], {
      props,
      state,
      actions: {
        pause: noop,
        resume: noop,

        start(props, resolve) {
          if (cancel) {
            stopAsync(state, ctrl['_lastAsyncId']);
            resolve(getCancelledResult(ctrl));
          } else {
            props.onRest = onRest;
            resolve(runAsync(asyncTo, props, state, ctrl));
          }
        }

      }
    }));
  }

  if (state.paused) {
    await new Promise(resume => {
      state.resumeQueue.add(resume);
    });
  }

  const result = getCombinedResult(ctrl, await Promise.all(promises));

  if (loop && result.finished && !(isLoop && result.noop)) {
    const nextProps = createLoopUpdate(props, loop, to);

    if (nextProps) {
      prepareKeys(ctrl, [nextProps]);
      return flushUpdate(ctrl, nextProps, true);
    }
  }

  if (onResolve) {
    raf.batchedUpdates(() => onResolve(result, ctrl, ctrl.item));
  }

  return result;
}
function getSprings(ctrl, props) {
  const springs = react_spring_core_esm_extends({}, ctrl.springs);

  if (props) {
    react_spring_shared_esm_each(react_spring_shared_esm_toArray(props), props => {
      if (react_spring_shared_esm_is.und(props.keys)) {
        props = createUpdate(props);
      }

      if (!react_spring_shared_esm_is.obj(props.to)) {
        props = react_spring_core_esm_extends({}, props, {
          to: undefined
        });
      }

      prepareSprings(springs, props, key => {
        return createSpring(key);
      });
    });
  }

  setSprings(ctrl, springs);
  return springs;
}
function setSprings(ctrl, springs) {
  eachProp(springs, (spring, key) => {
    if (!ctrl.springs[key]) {
      ctrl.springs[key] = spring;
      addFluidObserver(spring, ctrl);
    }
  });
}

function createSpring(key, observer) {
  const spring = new SpringValue();
  spring.key = key;

  if (observer) {
    addFluidObserver(spring, observer);
  }

  return spring;
}

function prepareSprings(springs, props, create) {
  if (props.keys) {
    react_spring_shared_esm_each(props.keys, key => {
      const spring = springs[key] || (springs[key] = create(key));
      spring['_prepareNode'](props);
    });
  }
}

function prepareKeys(ctrl, queue) {
  react_spring_shared_esm_each(queue, props => {
    prepareSprings(ctrl.springs, props, key => {
      return createSpring(key, ctrl);
    });
  });
}

function _objectWithoutPropertiesLoose(source, excluded) {
  if (source == null) return {};
  var target = {};
  var sourceKeys = Object.keys(source);
  var key, i;

  for (i = 0; i < sourceKeys.length; i++) {
    key = sourceKeys[i];
    if (excluded.indexOf(key) >= 0) continue;
    target[key] = source[key];
  }

  return target;
}

const _excluded$3 = ["children"];
const SpringContext = _ref => {
  let {
    children
  } = _ref,
      props = _objectWithoutPropertiesLoose(_ref, _excluded$3);

  const inherited = (0,external_React_.useContext)(ctx);
  const pause = props.pause || !!inherited.pause,
        immediate = props.immediate || !!inherited.immediate;
  props = useMemoOne(() => ({
    pause,
    immediate
  }), [pause, immediate]);
  const {
    Provider
  } = ctx;
  return external_React_.createElement(Provider, {
    value: props
  }, children);
};
const ctx = makeContext(SpringContext, {});
SpringContext.Provider = ctx.Provider;
SpringContext.Consumer = ctx.Consumer;

function makeContext(target, init) {
  Object.assign(target, external_React_.createContext(init));
  target.Provider._context = target;
  target.Consumer._context = target;
  return target;
}

const SpringRef = () => {
  const current = [];

  const SpringRef = function SpringRef(props) {
    deprecateDirectCall();
    const results = [];
    react_spring_shared_esm_each(current, (ctrl, i) => {
      if (react_spring_shared_esm_is.und(props)) {
        results.push(ctrl.start());
      } else {
        const update = _getProps(props, ctrl, i);

        if (update) {
          results.push(ctrl.start(update));
        }
      }
    });
    return results;
  };

  SpringRef.current = current;

  SpringRef.add = function (ctrl) {
    if (!current.includes(ctrl)) {
      current.push(ctrl);
    }
  };

  SpringRef.delete = function (ctrl) {
    const i = current.indexOf(ctrl);
    if (~i) current.splice(i, 1);
  };

  SpringRef.pause = function () {
    react_spring_shared_esm_each(current, ctrl => ctrl.pause(...arguments));
    return this;
  };

  SpringRef.resume = function () {
    react_spring_shared_esm_each(current, ctrl => ctrl.resume(...arguments));
    return this;
  };

  SpringRef.set = function (values) {
    react_spring_shared_esm_each(current, ctrl => ctrl.set(values));
  };

  SpringRef.start = function (props) {
    const results = [];
    react_spring_shared_esm_each(current, (ctrl, i) => {
      if (react_spring_shared_esm_is.und(props)) {
        results.push(ctrl.start());
      } else {
        const update = this._getProps(props, ctrl, i);

        if (update) {
          results.push(ctrl.start(update));
        }
      }
    });
    return results;
  };

  SpringRef.stop = function () {
    react_spring_shared_esm_each(current, ctrl => ctrl.stop(...arguments));
    return this;
  };

  SpringRef.update = function (props) {
    react_spring_shared_esm_each(current, (ctrl, i) => ctrl.update(this._getProps(props, ctrl, i)));
    return this;
  };

  const _getProps = function _getProps(arg, ctrl, index) {
    return react_spring_shared_esm_is.fun(arg) ? arg(index, ctrl) : arg;
  };

  SpringRef._getProps = _getProps;
  return SpringRef;
};

function useSprings(length, props, deps) {
  const propsFn = react_spring_shared_esm_is.fun(props) && props;
  if (propsFn && !deps) deps = [];
  const ref = (0,external_React_.useMemo)(() => propsFn || arguments.length == 3 ? SpringRef() : void 0, []);
  const layoutId = (0,external_React_.useRef)(0);
  const forceUpdate = react_spring_shared_esm_useForceUpdate();
  const state = (0,external_React_.useMemo)(() => ({
    ctrls: [],
    queue: [],

    flush(ctrl, updates) {
      const springs = getSprings(ctrl, updates);
      const canFlushSync = layoutId.current > 0 && !state.queue.length && !Object.keys(springs).some(key => !ctrl.springs[key]);
      return canFlushSync ? flushUpdateQueue(ctrl, updates) : new Promise(resolve => {
        setSprings(ctrl, springs);
        state.queue.push(() => {
          resolve(flushUpdateQueue(ctrl, updates));
        });
        forceUpdate();
      });
    }

  }), []);
  const ctrls = (0,external_React_.useRef)([...state.ctrls]);
  const updates = [];
  const prevLength = react_spring_shared_esm_usePrev(length) || 0;
  (0,external_React_.useMemo)(() => {
    react_spring_shared_esm_each(ctrls.current.slice(length, prevLength), ctrl => {
      detachRefs(ctrl, ref);
      ctrl.stop(true);
    });
    ctrls.current.length = length;
    declareUpdates(prevLength, length);
  }, [length]);
  (0,external_React_.useMemo)(() => {
    declareUpdates(0, Math.min(prevLength, length));
  }, deps);

  function declareUpdates(startIndex, endIndex) {
    for (let i = startIndex; i < endIndex; i++) {
      const ctrl = ctrls.current[i] || (ctrls.current[i] = new Controller(null, state.flush));
      const update = propsFn ? propsFn(i, ctrl) : props[i];

      if (update) {
        updates[i] = declareUpdate(update);
      }
    }
  }

  const springs = ctrls.current.map((ctrl, i) => getSprings(ctrl, updates[i]));
  const context = (0,external_React_.useContext)(SpringContext);
  const prevContext = react_spring_shared_esm_usePrev(context);
  const hasContext = context !== prevContext && hasProps(context);
  react_spring_shared_esm_useIsomorphicLayoutEffect(() => {
    layoutId.current++;
    state.ctrls = ctrls.current;
    const {
      queue
    } = state;

    if (queue.length) {
      state.queue = [];
      react_spring_shared_esm_each(queue, cb => cb());
    }

    react_spring_shared_esm_each(ctrls.current, (ctrl, i) => {
      ref == null ? void 0 : ref.add(ctrl);

      if (hasContext) {
        ctrl.start({
          default: context
        });
      }

      const update = updates[i];

      if (update) {
        replaceRef(ctrl, update.ref);

        if (ctrl.ref) {
          ctrl.queue.push(update);
        } else {
          ctrl.start(update);
        }
      }
    });
  });
  react_spring_shared_esm_useOnce(() => () => {
    react_spring_shared_esm_each(state.ctrls, ctrl => ctrl.stop(true));
  });
  const values = springs.map(x => react_spring_core_esm_extends({}, x));
  return ref ? [values, ref] : values;
}

function useSpring(props, deps) {
  const isFn = react_spring_shared_esm_is.fun(props);
  const [[values], ref] = useSprings(1, isFn ? props : [props], isFn ? deps || [] : deps);
  return isFn || arguments.length == 2 ? [values, ref] : values;
}

const initSpringRef = () => SpringRef();

const useSpringRef = () => useState(initSpringRef)[0];

function useTrail(length, propsArg, deps) {
  var _passedRef;

  const propsFn = is.fun(propsArg) && propsArg;
  if (propsFn && !deps) deps = [];
  let reverse = true;
  let passedRef = undefined;
  const result = useSprings(length, (i, ctrl) => {
    const props = propsFn ? propsFn(i, ctrl) : propsArg;
    passedRef = props.ref;
    reverse = reverse && props.reverse;
    return props;
  }, deps || [{}]);
  const ref = (_passedRef = passedRef) != null ? _passedRef : result[1];
  useIsomorphicLayoutEffect(() => {
    each(ref.current, (ctrl, i) => {
      const parent = ref.current[i + (reverse ? 1 : -1)];

      if (parent) {
        ctrl.start({
          to: parent.springs
        });
      } else {
        ctrl.start();
      }
    });
  }, deps);

  if (propsFn || arguments.length == 3) {
    ref['_getProps'] = (propsArg, ctrl, i) => {
      const props = is.fun(propsArg) ? propsArg(i, ctrl) : propsArg;

      if (props) {
        const parent = ref.current[i + (props.reverse ? 1 : -1)];
        if (parent) props.to = parent.springs;
        return props;
      }
    };

    return result;
  }

  ref['start'] = propsArg => {
    const results = [];
    each(ref.current, (ctrl, i) => {
      const props = is.fun(propsArg) ? propsArg(i, ctrl) : propsArg;
      const parent = ref.current[i + (reverse ? 1 : -1)];

      if (parent) {
        results.push(ctrl.start(react_spring_core_esm_extends({}, props, {
          to: parent.springs
        })));
      } else {
        results.push(ctrl.start(react_spring_core_esm_extends({}, props)));
      }
    });
    return results;
  };

  return result[0];
}

let TransitionPhase;

(function (TransitionPhase) {
  TransitionPhase["MOUNT"] = "mount";
  TransitionPhase["ENTER"] = "enter";
  TransitionPhase["UPDATE"] = "update";
  TransitionPhase["LEAVE"] = "leave";
})(TransitionPhase || (TransitionPhase = {}));

function useTransition(data, props, deps) {
  const propsFn = is.fun(props) && props;
  const {
    reset,
    sort,
    trail = 0,
    expires = true,
    exitBeforeEnter = false,
    onDestroyed,
    ref: propsRef,
    config: propsConfig
  } = propsFn ? propsFn() : props;
  const ref = useMemo(() => propsFn || arguments.length == 3 ? SpringRef() : void 0, []);
  const items = toArray(data);
  const transitions = [];
  const usedTransitions = useRef(null);
  const prevTransitions = reset ? null : usedTransitions.current;
  useIsomorphicLayoutEffect(() => {
    usedTransitions.current = transitions;
  });
  useOnce(() => {
    each(transitions, t => {
      ref == null ? void 0 : ref.add(t.ctrl);
      t.ctrl.ref = ref;
    });
    return () => {
      each(usedTransitions.current, t => {
        if (t.expired) {
          clearTimeout(t.expirationId);
        }

        detachRefs(t.ctrl, ref);
        t.ctrl.stop(true);
      });
    };
  });
  const keys = getKeys(items, propsFn ? propsFn() : props, prevTransitions);
  const expired = reset && usedTransitions.current || [];
  useIsomorphicLayoutEffect(() => each(expired, ({
    ctrl,
    item,
    key
  }) => {
    detachRefs(ctrl, ref);
    callProp(onDestroyed, item, key);
  }));
  const reused = [];
  if (prevTransitions) each(prevTransitions, (t, i) => {
    if (t.expired) {
      clearTimeout(t.expirationId);
      expired.push(t);
    } else {
      i = reused[i] = keys.indexOf(t.key);
      if (~i) transitions[i] = t;
    }
  });
  each(items, (item, i) => {
    if (!transitions[i]) {
      transitions[i] = {
        key: keys[i],
        item,
        phase: TransitionPhase.MOUNT,
        ctrl: new Controller()
      };
      transitions[i].ctrl.item = item;
    }
  });

  if (reused.length) {
    let i = -1;
    const {
      leave
    } = propsFn ? propsFn() : props;
    each(reused, (keyIndex, prevIndex) => {
      const t = prevTransitions[prevIndex];

      if (~keyIndex) {
        i = transitions.indexOf(t);
        transitions[i] = react_spring_core_esm_extends({}, t, {
          item: items[keyIndex]
        });
      } else if (leave) {
        transitions.splice(++i, 0, t);
      }
    });
  }

  if (is.fun(sort)) {
    transitions.sort((a, b) => sort(a.item, b.item));
  }

  let delay = -trail;
  const forceUpdate = useForceUpdate();
  const defaultProps = getDefaultProps(props);
  const changes = new Map();
  const exitingTransitions = useRef(new Map());
  const forceChange = useRef(false);
  each(transitions, (t, i) => {
    const key = t.key;
    const prevPhase = t.phase;
    const p = propsFn ? propsFn() : props;
    let to;
    let phase;
    let propsDelay = callProp(p.delay || 0, key);

    if (prevPhase == TransitionPhase.MOUNT) {
      to = p.enter;
      phase = TransitionPhase.ENTER;
    } else {
      const isLeave = keys.indexOf(key) < 0;

      if (prevPhase != TransitionPhase.LEAVE) {
        if (isLeave) {
          to = p.leave;
          phase = TransitionPhase.LEAVE;
        } else if (to = p.update) {
          phase = TransitionPhase.UPDATE;
        } else return;
      } else if (!isLeave) {
        to = p.enter;
        phase = TransitionPhase.ENTER;
      } else return;
    }

    to = callProp(to, t.item, i);
    to = is.obj(to) ? inferTo(to) : {
      to
    };

    if (!to.config) {
      const config = propsConfig || defaultProps.config;
      to.config = callProp(config, t.item, i, phase);
    }

    delay += trail;

    const payload = react_spring_core_esm_extends({}, defaultProps, {
      delay: propsDelay + delay,
      ref: propsRef,
      immediate: p.immediate,
      reset: false
    }, to);

    if (phase == TransitionPhase.ENTER && is.und(payload.from)) {
      const _p = propsFn ? propsFn() : props;

      const from = is.und(_p.initial) || prevTransitions ? _p.from : _p.initial;
      payload.from = callProp(from, t.item, i);
    }

    const {
      onResolve
    } = payload;

    payload.onResolve = result => {
      callProp(onResolve, result);
      const transitions = usedTransitions.current;
      const t = transitions.find(t => t.key === key);
      if (!t) return;

      if (result.cancelled && t.phase != TransitionPhase.UPDATE) {
        return;
      }

      if (t.ctrl.idle) {
        const idle = transitions.every(t => t.ctrl.idle);

        if (t.phase == TransitionPhase.LEAVE) {
          const expiry = callProp(expires, t.item);

          if (expiry !== false) {
            const expiryMs = expiry === true ? 0 : expiry;
            t.expired = true;

            if (!idle && expiryMs > 0) {
              if (expiryMs <= 0x7fffffff) t.expirationId = setTimeout(forceUpdate, expiryMs);
              return;
            }
          }
        }

        if (idle && transitions.some(t => t.expired)) {
          exitingTransitions.current.delete(t);

          if (exitBeforeEnter) {
            forceChange.current = true;
          }

          forceUpdate();
        }
      }
    };

    const springs = getSprings(t.ctrl, payload);

    if (phase === TransitionPhase.LEAVE && exitBeforeEnter) {
      exitingTransitions.current.set(t, {
        phase,
        springs,
        payload
      });
    } else {
      changes.set(t, {
        phase,
        springs,
        payload
      });
    }
  });
  const context = useContext(SpringContext);
  const prevContext = usePrev(context);
  const hasContext = context !== prevContext && hasProps(context);
  useIsomorphicLayoutEffect(() => {
    if (hasContext) {
      each(transitions, t => {
        t.ctrl.start({
          default: context
        });
      });
    }
  }, [context]);
  each(changes, (_, t) => {
    if (exitingTransitions.current.size) {
      const ind = transitions.findIndex(state => state.key === t.key);
      transitions.splice(ind, 1);
    }
  });
  useIsomorphicLayoutEffect(() => {
    each(exitingTransitions.current.size ? exitingTransitions.current : changes, ({
      phase,
      payload
    }, t) => {
      const {
        ctrl
      } = t;
      t.phase = phase;
      ref == null ? void 0 : ref.add(ctrl);

      if (hasContext && phase == TransitionPhase.ENTER) {
        ctrl.start({
          default: context
        });
      }

      if (payload) {
        replaceRef(ctrl, payload.ref);

        if ((ctrl.ref || ref) && !forceChange.current) {
          ctrl.update(payload);
        } else {
          ctrl.start(payload);

          if (forceChange.current) {
            forceChange.current = false;
          }
        }
      }
    });
  }, reset ? void 0 : deps);

  const renderTransitions = render => React.createElement(React.Fragment, null, transitions.map((t, i) => {
    const {
      springs
    } = changes.get(t) || t.ctrl;
    const elem = render(react_spring_core_esm_extends({}, springs), t.item, t, i);
    return elem && elem.type ? React.createElement(elem.type, react_spring_core_esm_extends({}, elem.props, {
      key: is.str(t.key) || is.num(t.key) ? t.key : t.ctrl.id,
      ref: elem.ref
    })) : elem;
  }));

  return ref ? [renderTransitions, ref] : renderTransitions;
}
let nextKey = 1;

function getKeys(items, {
  key,
  keys = key
}, prevTransitions) {
  if (keys === null) {
    const reused = new Set();
    return items.map(item => {
      const t = prevTransitions && prevTransitions.find(t => t.item === item && t.phase !== TransitionPhase.LEAVE && !reused.has(t));

      if (t) {
        reused.add(t);
        return t.key;
      }

      return nextKey++;
    });
  }

  return is.und(keys) ? items : is.fun(keys) ? items.map(keys) : toArray(keys);
}

const _excluded$2 = (/* unused pure expression or super */ null && (["children"]));
function Spring(_ref) {
  let {
    children
  } = _ref,
      props = _objectWithoutPropertiesLoose(_ref, _excluded$2);

  return children(useSpring(props));
}

const _excluded$1 = (/* unused pure expression or super */ null && (["items", "children"]));
function Trail(_ref) {
  let {
    items,
    children
  } = _ref,
      props = _objectWithoutPropertiesLoose(_ref, _excluded$1);

  const trails = useTrail(items.length, props);
  return items.map((item, index) => {
    const result = children(item, index);
    return is.fun(result) ? result(trails[index]) : result;
  });
}

const _excluded = (/* unused pure expression or super */ null && (["items", "children"]));
function Transition(_ref) {
  let {
    items,
    children
  } = _ref,
      props = _objectWithoutPropertiesLoose(_ref, _excluded);

  return useTransition(items, props)(children);
}

class Interpolation extends FrameValue {
  constructor(source, args) {
    super();
    this.key = void 0;
    this.idle = true;
    this.calc = void 0;
    this._active = new Set();
    this.source = source;
    this.calc = createInterpolator(...args);

    const value = this._get();

    const nodeType = getAnimatedType(value);
    setAnimated(this, nodeType.create(value));
  }

  advance(_dt) {
    const value = this._get();

    const oldValue = this.get();

    if (!isEqual(value, oldValue)) {
      getAnimated(this).setValue(value);

      this._onChange(value, this.idle);
    }

    if (!this.idle && checkIdle(this._active)) {
      becomeIdle(this);
    }
  }

  _get() {
    const inputs = react_spring_shared_esm_is.arr(this.source) ? this.source.map(getFluidValue) : react_spring_shared_esm_toArray(getFluidValue(this.source));
    return this.calc(...inputs);
  }

  _start() {
    if (this.idle && !checkIdle(this._active)) {
      this.idle = false;
      react_spring_shared_esm_each(getPayload(this), node => {
        node.done = false;
      });

      if (globals.skipAnimation) {
        raf.batchedUpdates(() => this.advance());
        becomeIdle(this);
      } else {
        frameLoop.start(this);
      }
    }
  }

  _attach() {
    let priority = 1;
    react_spring_shared_esm_each(react_spring_shared_esm_toArray(this.source), source => {
      if (hasFluidValue(source)) {
        addFluidObserver(source, this);
      }

      if (isFrameValue(source)) {
        if (!source.idle) {
          this._active.add(source);
        }

        priority = Math.max(priority, source.priority + 1);
      }
    });
    this.priority = priority;

    this._start();
  }

  _detach() {
    react_spring_shared_esm_each(react_spring_shared_esm_toArray(this.source), source => {
      if (hasFluidValue(source)) {
        removeFluidObserver(source, this);
      }
    });

    this._active.clear();

    becomeIdle(this);
  }

  eventObserved(event) {
    if (event.type == 'change') {
      if (event.idle) {
        this.advance();
      } else {
        this._active.add(event.parent);

        this._start();
      }
    } else if (event.type == 'idle') {
        this._active.delete(event.parent);
      } else if (event.type == 'priority') {
          this.priority = react_spring_shared_esm_toArray(this.source).reduce((highest, parent) => Math.max(highest, (isFrameValue(parent) ? parent.priority : 0) + 1), 0);
        }
  }

}

function isIdle(source) {
  return source.idle !== false;
}

function checkIdle(active) {
  return !active.size || Array.from(active).every(isIdle);
}

function becomeIdle(self) {
  if (!self.idle) {
    self.idle = true;
    react_spring_shared_esm_each(getPayload(self), node => {
      node.done = true;
    });
    callFluidObservers(self, {
      type: 'idle',
      parent: self
    });
  }
}

const react_spring_core_esm_to = (source, ...args) => new Interpolation(source, args);
const react_spring_core_esm_interpolate = (source, ...args) => (deprecateInterpolate(), new Interpolation(source, args));

globals.assign({
  createStringInterpolator: createStringInterpolator,
  to: (source, args) => new Interpolation(source, args)
});
const react_spring_core_esm_update = frameLoop.advance;



;// CONCATENATED MODULE: external "ReactDOM"
var external_ReactDOM_namespaceObject = window["ReactDOM"];
;// CONCATENATED MODULE: ./node_modules/@react-spring/web/dist/react-spring-web.esm.js






function react_spring_web_esm_objectWithoutPropertiesLoose(source, excluded) {
  if (source == null) return {};
  var target = {};
  var sourceKeys = Object.keys(source);
  var key, i;

  for (i = 0; i < sourceKeys.length; i++) {
    key = sourceKeys[i];
    if (excluded.indexOf(key) >= 0) continue;
    target[key] = source[key];
  }

  return target;
}

const react_spring_web_esm_excluded$2 = ["style", "children", "scrollTop", "scrollLeft"];
const isCustomPropRE = /^--/;

function dangerousStyleValue(name, value) {
  if (value == null || typeof value === 'boolean' || value === '') return '';
  if (typeof value === 'number' && value !== 0 && !isCustomPropRE.test(name) && !(isUnitlessNumber.hasOwnProperty(name) && isUnitlessNumber[name])) return value + 'px';
  return ('' + value).trim();
}

const attributeCache = {};
function applyAnimatedValues(instance, props) {
  if (!instance.nodeType || !instance.setAttribute) {
    return false;
  }

  const isFilterElement = instance.nodeName === 'filter' || instance.parentNode && instance.parentNode.nodeName === 'filter';

  const _ref = props,
        {
    style,
    children,
    scrollTop,
    scrollLeft
  } = _ref,
        attributes = react_spring_web_esm_objectWithoutPropertiesLoose(_ref, react_spring_web_esm_excluded$2);

  const values = Object.values(attributes);
  const names = Object.keys(attributes).map(name => isFilterElement || instance.hasAttribute(name) ? name : attributeCache[name] || (attributeCache[name] = name.replace(/([A-Z])/g, n => '-' + n.toLowerCase())));

  if (children !== void 0) {
    instance.textContent = children;
  }

  for (let name in style) {
    if (style.hasOwnProperty(name)) {
      const value = dangerousStyleValue(name, style[name]);

      if (isCustomPropRE.test(name)) {
        instance.style.setProperty(name, value);
      } else {
        instance.style[name] = value;
      }
    }
  }

  names.forEach((name, i) => {
    instance.setAttribute(name, values[i]);
  });

  if (scrollTop !== void 0) {
    instance.scrollTop = scrollTop;
  }

  if (scrollLeft !== void 0) {
    instance.scrollLeft = scrollLeft;
  }
}
let isUnitlessNumber = {
  animationIterationCount: true,
  borderImageOutset: true,
  borderImageSlice: true,
  borderImageWidth: true,
  boxFlex: true,
  boxFlexGroup: true,
  boxOrdinalGroup: true,
  columnCount: true,
  columns: true,
  flex: true,
  flexGrow: true,
  flexPositive: true,
  flexShrink: true,
  flexNegative: true,
  flexOrder: true,
  gridRow: true,
  gridRowEnd: true,
  gridRowSpan: true,
  gridRowStart: true,
  gridColumn: true,
  gridColumnEnd: true,
  gridColumnSpan: true,
  gridColumnStart: true,
  fontWeight: true,
  lineClamp: true,
  lineHeight: true,
  opacity: true,
  order: true,
  orphans: true,
  tabSize: true,
  widows: true,
  zIndex: true,
  zoom: true,
  fillOpacity: true,
  floodOpacity: true,
  stopOpacity: true,
  strokeDasharray: true,
  strokeDashoffset: true,
  strokeMiterlimit: true,
  strokeOpacity: true,
  strokeWidth: true
};

const prefixKey = (prefix, key) => prefix + key.charAt(0).toUpperCase() + key.substring(1);

const prefixes = ['Webkit', 'Ms', 'Moz', 'O'];
isUnitlessNumber = Object.keys(isUnitlessNumber).reduce((acc, prop) => {
  prefixes.forEach(prefix => acc[prefixKey(prefix, prop)] = acc[prop]);
  return acc;
}, isUnitlessNumber);

const react_spring_web_esm_excluded$1 = ["x", "y", "z"];
const domTransforms = /^(matrix|translate|scale|rotate|skew)/;
const pxTransforms = /^(translate)/;
const degTransforms = /^(rotate|skew)/;

const addUnit = (value, unit) => react_spring_shared_esm_is.num(value) && value !== 0 ? value + unit : value;

const isValueIdentity = (value, id) => react_spring_shared_esm_is.arr(value) ? value.every(v => isValueIdentity(v, id)) : react_spring_shared_esm_is.num(value) ? value === id : parseFloat(value) === id;

class AnimatedStyle extends AnimatedObject {
  constructor(_ref) {
    let {
      x,
      y,
      z
    } = _ref,
        style = react_spring_web_esm_objectWithoutPropertiesLoose(_ref, react_spring_web_esm_excluded$1);

    const inputs = [];
    const transforms = [];

    if (x || y || z) {
      inputs.push([x || 0, y || 0, z || 0]);
      transforms.push(xyz => [`translate3d(${xyz.map(v => addUnit(v, 'px')).join(',')})`, isValueIdentity(xyz, 0)]);
    }

    eachProp(style, (value, key) => {
      if (key === 'transform') {
        inputs.push([value || '']);
        transforms.push(transform => [transform, transform === '']);
      } else if (domTransforms.test(key)) {
        delete style[key];
        if (react_spring_shared_esm_is.und(value)) return;
        const unit = pxTransforms.test(key) ? 'px' : degTransforms.test(key) ? 'deg' : '';
        inputs.push(react_spring_shared_esm_toArray(value));
        transforms.push(key === 'rotate3d' ? ([x, y, z, deg]) => [`rotate3d(${x},${y},${z},${addUnit(deg, unit)})`, isValueIdentity(deg, 0)] : input => [`${key}(${input.map(v => addUnit(v, unit)).join(',')})`, isValueIdentity(input, key.startsWith('scale') ? 1 : 0)]);
      }
    });

    if (inputs.length) {
      style.transform = new FluidTransform(inputs, transforms);
    }

    super(style);
  }

}

class FluidTransform extends FluidValue {
  constructor(inputs, transforms) {
    super();
    this._value = null;
    this.inputs = inputs;
    this.transforms = transforms;
  }

  get() {
    return this._value || (this._value = this._get());
  }

  _get() {
    let transform = '';
    let identity = true;
    react_spring_shared_esm_each(this.inputs, (input, i) => {
      const arg1 = getFluidValue(input[0]);
      const [t, id] = this.transforms[i](react_spring_shared_esm_is.arr(arg1) ? arg1 : input.map(getFluidValue));
      transform += ' ' + t;
      identity = identity && id;
    });
    return identity ? 'none' : transform;
  }

  observerAdded(count) {
    if (count == 1) react_spring_shared_esm_each(this.inputs, input => react_spring_shared_esm_each(input, value => hasFluidValue(value) && addFluidObserver(value, this)));
  }

  observerRemoved(count) {
    if (count == 0) react_spring_shared_esm_each(this.inputs, input => react_spring_shared_esm_each(input, value => hasFluidValue(value) && removeFluidObserver(value, this)));
  }

  eventObserved(event) {
    if (event.type == 'change') {
      this._value = null;
    }

    callFluidObservers(this, event);
  }

}

const primitives = ['a', 'abbr', 'address', 'area', 'article', 'aside', 'audio', 'b', 'base', 'bdi', 'bdo', 'big', 'blockquote', 'body', 'br', 'button', 'canvas', 'caption', 'cite', 'code', 'col', 'colgroup', 'data', 'datalist', 'dd', 'del', 'details', 'dfn', 'dialog', 'div', 'dl', 'dt', 'em', 'embed', 'fieldset', 'figcaption', 'figure', 'footer', 'form', 'h1', 'h2', 'h3', 'h4', 'h5', 'h6', 'head', 'header', 'hgroup', 'hr', 'html', 'i', 'iframe', 'img', 'input', 'ins', 'kbd', 'keygen', 'label', 'legend', 'li', 'link', 'main', 'map', 'mark', 'menu', 'menuitem', 'meta', 'meter', 'nav', 'noscript', 'object', 'ol', 'optgroup', 'option', 'output', 'p', 'param', 'picture', 'pre', 'progress', 'q', 'rp', 'rt', 'ruby', 's', 'samp', 'script', 'section', 'select', 'small', 'source', 'span', 'strong', 'style', 'sub', 'summary', 'sup', 'table', 'tbody', 'td', 'textarea', 'tfoot', 'th', 'thead', 'time', 'title', 'tr', 'track', 'u', 'ul', 'var', 'video', 'wbr', 'circle', 'clipPath', 'defs', 'ellipse', 'foreignObject', 'g', 'image', 'line', 'linearGradient', 'mask', 'path', 'pattern', 'polygon', 'polyline', 'radialGradient', 'rect', 'stop', 'svg', 'text', 'tspan'];

const react_spring_web_esm_excluded = ["scrollTop", "scrollLeft"];
globals.assign({
  batchedUpdates: external_ReactDOM_namespaceObject.unstable_batchedUpdates,
  createStringInterpolator: createStringInterpolator,
  colors: colors
});
const host = createHost(primitives, {
  applyAnimatedValues,
  createAnimatedStyle: style => new AnimatedStyle(style),
  getComponentProps: _ref => {
    let props = react_spring_web_esm_objectWithoutPropertiesLoose(_ref, react_spring_web_esm_excluded);

    return props;
  }
});
const animated = host.animated;



;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/use-moving-animation/index.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */




/**
 * Simple reducer used to increment a counter.
 *
 * @param {number} state Previous counter value.
 * @return {number} New state value.
 */

const counterReducer = state => state + 1;

const getAbsolutePosition = element => {
  return {
    top: element.offsetTop,
    left: element.offsetLeft
  };
};
/**
 * Hook used to compute the styles required to move a div into a new position.
 *
 * The way this animation works is the following:
 *  - It first renders the element as if there was no animation.
 *  - It takes a snapshot of the position of the block to use it
 *    as a destination point for the animation.
 *  - It restores the element to the previous position using a CSS transform
 *  - It uses the "resetAnimation" flag to reset the animation
 *    from the beginning in order to animate to the new destination point.
 *
 * @param {Object}  $1                          Options
 * @param {boolean} $1.isSelected               Whether it's the current block or not.
 * @param {boolean} $1.adjustScrolling          Adjust the scroll position to the current block.
 * @param {boolean} $1.enableAnimation          Enable/Disable animation.
 * @param {*}       $1.triggerAnimationOnChange Variable used to trigger the animation if it changes.
 */


function useMovingAnimation(_ref) {
  let {
    isSelected,
    adjustScrolling,
    enableAnimation,
    triggerAnimationOnChange
  } = _ref;
  const ref = (0,external_wp_element_namespaceObject.useRef)();
  const prefersReducedMotion = (0,external_wp_compose_namespaceObject.useReducedMotion)() || !enableAnimation;
  const [triggeredAnimation, triggerAnimation] = (0,external_wp_element_namespaceObject.useReducer)(counterReducer, 0);
  const [finishedAnimation, endAnimation] = (0,external_wp_element_namespaceObject.useReducer)(counterReducer, 0);
  const [transform, setTransform] = (0,external_wp_element_namespaceObject.useState)({
    x: 0,
    y: 0
  });
  const previous = (0,external_wp_element_namespaceObject.useMemo)(() => ref.current ? getAbsolutePosition(ref.current) : null, [triggerAnimationOnChange]); // Calculate the previous position of the block relative to the viewport and
  // return a function to maintain that position by scrolling.

  const preserveScrollPosition = (0,external_wp_element_namespaceObject.useMemo)(() => {
    if (!adjustScrolling || !ref.current) {
      return () => {};
    }

    const scrollContainer = (0,external_wp_dom_namespaceObject.getScrollContainer)(ref.current);

    if (!scrollContainer) {
      return () => {};
    }

    const prevRect = ref.current.getBoundingClientRect();
    return () => {
      const blockRect = ref.current.getBoundingClientRect();
      const diff = blockRect.top - prevRect.top;

      if (diff) {
        scrollContainer.scrollTop += diff;
      }
    };
  }, [triggerAnimationOnChange, adjustScrolling]);
  (0,external_wp_element_namespaceObject.useLayoutEffect)(() => {
    if (triggeredAnimation) {
      endAnimation();
    }
  }, [triggeredAnimation]);
  (0,external_wp_element_namespaceObject.useLayoutEffect)(() => {
    if (!previous) {
      return;
    }

    if (prefersReducedMotion) {
      // If the animation is disabled and the scroll needs to be adjusted,
      // just move directly to the final scroll position.
      preserveScrollPosition();
      return;
    }

    ref.current.style.transform = '';
    const destination = getAbsolutePosition(ref.current);
    triggerAnimation();
    setTransform({
      x: Math.round(previous.left - destination.left),
      y: Math.round(previous.top - destination.top)
    });
  }, [triggerAnimationOnChange]); // Only called when either the x or y value changes.

  function onFrameChange(_ref2) {
    let {
      x,
      y
    } = _ref2;

    if (!ref.current) {
      return;
    }

    const isMoving = x === 0 && y === 0;
    ref.current.style.transformOrigin = isMoving ? '' : 'center';
    ref.current.style.transform = isMoving ? '' : `translate3d(${x}px,${y}px,0)`;
    ref.current.style.zIndex = !isSelected || isMoving ? '' : '1';
    preserveScrollPosition();
  } // Called for every frame computed by useSpring.


  function onChange(_ref3) {
    let {
      value
    } = _ref3;
    let {
      x,
      y
    } = value;
    x = Math.round(x);
    y = Math.round(y);

    if (x !== onChange.x || y !== onChange.y) {
      onFrameChange({
        x,
        y
      });
      onChange.x = x;
      onChange.y = y;
    }
  }

  onChange.x = 0;
  onChange.y = 0;
  useSpring({
    from: {
      x: transform.x,
      y: transform.y
    },
    to: {
      x: 0,
      y: 0
    },
    reset: triggeredAnimation !== finishedAnimation,
    config: {
      mass: 5,
      tension: 2000,
      friction: 200
    },
    immediate: prefersReducedMotion,
    onChange
  });
  return ref;
}

/* harmony default export */ var use_moving_animation = (useMovingAnimation);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/utils/dom.js
const BLOCK_SELECTOR = '.block-editor-block-list__block';
const APPENDER_SELECTOR = '.block-list-appender';
const BLOCK_APPENDER_CLASS = '.block-editor-button-block-appender';
/**
 * Returns true if two elements are contained within the same block.
 *
 * @param {Element} a First element.
 * @param {Element} b Second element.
 *
 * @return {boolean} Whether elements are in the same block.
 */

function isInSameBlock(a, b) {
  return a.closest(BLOCK_SELECTOR) === b.closest(BLOCK_SELECTOR);
}
/**
 * Returns true if an element is considered part of the block and not its inner
 * blocks or appender.
 *
 * @param {Element} blockElement Block container element.
 * @param {Element} element      Element.
 *
 * @return {boolean} Whether an element is considered part of the block and not
 *                   its inner blocks or appender.
 */

function isInsideRootBlock(blockElement, element) {
  const parentBlock = element.closest([BLOCK_SELECTOR, APPENDER_SELECTOR, BLOCK_APPENDER_CLASS].join(','));
  return parentBlock === blockElement;
}
/**
 * Finds the block client ID given any DOM node inside the block.
 *
 * @param {Node?} node DOM node.
 *
 * @return {string|undefined} Client ID or undefined if the node is not part of
 *                            a block.
 */

function getBlockClientId(node) {
  while (node && node.nodeType !== node.ELEMENT_NODE) {
    node = node.parentNode;
  }

  if (!node) {
    return;
  }

  const elementNode =
  /** @type {Element} */
  node;
  const blockNode = elementNode.closest(BLOCK_SELECTOR);

  if (!blockNode) {
    return;
  }

  return blockNode.id.slice('block-'.length);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/use-block-props/use-focus-first-element.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */



/** @typedef {import('@wordpress/element').RefObject} RefObject */

/**
 * Returns the initial position if the block needs to be focussed, `undefined`
 * otherwise. The initial position is either 0 (start) or -1 (end).
 *
 * @param {string} clientId Block client ID.
 *
 * @return {number} The initial position, either 0 (start) or -1 (end).
 */

function useInitialPosition(clientId) {
  return (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getSelectedBlocksInitialCaretPosition,
      isNavigationMode,
      isBlockSelected
    } = select(store);

    if (!isBlockSelected(clientId)) {
      return;
    }

    if (isNavigationMode()) {
      return;
    } // If there's no initial position, return 0 to focus the start.


    return getSelectedBlocksInitialCaretPosition();
  }, [clientId]);
}
/**
 * Transitions focus to the block or inner tabbable when the block becomes
 * selected and an initial position is set.
 *
 * @param {string} clientId Block client ID.
 *
 * @return {RefObject} React ref with the block element.
 */


function useFocusFirstElement(clientId) {
  const ref = (0,external_wp_element_namespaceObject.useRef)();
  const initialPosition = useInitialPosition(clientId);
  const {
    isBlockSelected,
    isMultiSelecting
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    // Check if the block is still selected at the time this effect runs.
    if (!isBlockSelected(clientId) || isMultiSelecting()) {
      return;
    }

    if (initialPosition === undefined || initialPosition === null) {
      return;
    }

    if (!ref.current) {
      return;
    }

    const {
      ownerDocument
    } = ref.current; // Do not focus the block if it already contains the active element.

    if (ref.current.contains(ownerDocument.activeElement)) {
      return;
    } // Find all tabbables within node.


    const textInputs = external_wp_dom_namespaceObject.focus.tabbable.find(ref.current).filter(node => (0,external_wp_dom_namespaceObject.isTextField)(node)); // If reversed (e.g. merge via backspace), use the last in the set of
    // tabbables.

    const isReverse = -1 === initialPosition;
    const target = (isReverse ? external_lodash_namespaceObject.last : external_lodash_namespaceObject.first)(textInputs) || ref.current;

    if (!isInsideRootBlock(ref.current, target)) {
      ref.current.focus();
      return;
    } // Check to see if element is focussable before a generic caret insert.


    if (!ref.current.getAttribute('contenteditable')) {
      const focusElement = external_wp_dom_namespaceObject.focus.tabbable.findNext(ref.current); // Make sure focusElement is valid, contained in the same block, and a form field.

      if (focusElement && isInsideRootBlock(ref.current, focusElement) && (0,external_wp_dom_namespaceObject.isFormElement)(focusElement)) {
        focusElement.focus();
        return;
      }
    }

    (0,external_wp_dom_namespaceObject.placeCaretAtHorizontalEdge)(target, isReverse);
  }, [initialPosition, clientId]);
  return ref;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/use-block-props/use-is-hovered.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */



function listener(event) {
  if (event.defaultPrevented) {
    return;
  }

  const action = event.type === 'mouseover' ? 'add' : 'remove';
  event.preventDefault();
  event.currentTarget.classList[action]('is-hovered');
}
/**
 * Adds `is-hovered` class when the block is hovered and in navigation or
 * outline mode.
 */


function useIsHovered() {
  const isEnabled = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      isNavigationMode,
      getSettings
    } = select(store);
    return isNavigationMode() || getSettings().outlineMode;
  }, []);
  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    if (isEnabled) {
      node.addEventListener('mouseout', listener);
      node.addEventListener('mouseover', listener);
      return () => {
        node.removeEventListener('mouseout', listener);
        node.removeEventListener('mouseover', listener); // Remove class in case it lingers.

        node.classList.remove('is-hovered');
      };
    }
  }, [isEnabled]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/use-block-props/use-block-class-names.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */


/**
 * Returns the class names used for the different states of the block.
 *
 * @param {string} clientId The block client ID.
 *
 * @return {string} The class names.
 */

function useBlockClassNames(clientId) {
  return (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      isBlockBeingDragged,
      isBlockHighlighted,
      isBlockSelected,
      isBlockMultiSelected,
      getBlockName,
      getSettings,
      hasSelectedInnerBlock,
      isTyping,
      __experimentalGetActiveBlockIdByBlockNames: getActiveBlockIdByBlockNames
    } = select(store);
    const {
      __experimentalSpotlightEntityBlocks: spotlightEntityBlocks,
      outlineMode
    } = getSettings();
    const isDragging = isBlockBeingDragged(clientId);
    const isSelected = isBlockSelected(clientId);
    const name = getBlockName(clientId);
    const checkDeep = true; // "ancestor" is the more appropriate label due to "deep" check.

    const isAncestorOfSelectedBlock = hasSelectedInnerBlock(clientId, checkDeep);
    const activeEntityBlockId = getActiveBlockIdByBlockNames(spotlightEntityBlocks);
    return classnames_default()({
      'is-selected': isSelected,
      'is-highlighted': isBlockHighlighted(clientId),
      'is-multi-selected': isBlockMultiSelected(clientId),
      'is-reusable': (0,external_wp_blocks_namespaceObject.isReusableBlock)((0,external_wp_blocks_namespaceObject.getBlockType)(name)),
      'is-dragging': isDragging,
      'has-child-selected': isAncestorOfSelectedBlock,
      'has-active-entity': activeEntityBlockId,
      // Determine if there is an active entity area to spotlight.
      'is-active-entity': activeEntityBlockId === clientId,
      'remove-outline': isSelected && outlineMode && isTyping()
    });
  }, [clientId]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/use-block-props/use-block-default-class-name.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


/**
 * Returns the default class name if the block is a light block and it supports
 * `className`.
 *
 * @param {string} clientId The block client ID.
 *
 * @return {string} The class name, e.g. `wp-block-paragraph`.
 */

function useBlockDefaultClassName(clientId) {
  return (0,external_wp_data_namespaceObject.useSelect)(select => {
    const name = select(store).getBlockName(clientId);
    const blockType = (0,external_wp_blocks_namespaceObject.getBlockType)(name);
    const hasLightBlockWrapper = (blockType === null || blockType === void 0 ? void 0 : blockType.apiVersion) > 1;

    if (!hasLightBlockWrapper) {
      return;
    }

    return (0,external_wp_blocks_namespaceObject.getBlockDefaultClassName)(name);
  }, [clientId]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/use-block-props/use-block-custom-class-name.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


/**
 * Returns the custom class name if the block is a light block.
 *
 * @param {string} clientId The block client ID.
 *
 * @return {string} The custom class name.
 */

function useBlockCustomClassName(clientId) {
  // It's good for this to be a separate selector because it will be executed
  // on every attribute change, while the other selectors are not re-evaluated
  // as much.
  return (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getBlockName,
      getBlockAttributes
    } = select(store);
    const attributes = getBlockAttributes(clientId);

    if (!(attributes !== null && attributes !== void 0 && attributes.className)) {
      return;
    }

    const blockType = (0,external_wp_blocks_namespaceObject.getBlockType)(getBlockName(clientId));
    const hasLightBlockWrapper = (blockType === null || blockType === void 0 ? void 0 : blockType.apiVersion) > 1;

    if (!hasLightBlockWrapper) {
      return;
    }

    return attributes.className;
  }, [clientId]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/use-block-props/use-block-moving-mode-class-names.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


/**
 * Returns the class names used for block moving mode.
 *
 * @param {string} clientId The block client ID to insert above.
 *
 * @return {string} The class names.
 */

function useBlockMovingModeClassNames(clientId) {
  return (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      hasBlockMovingClientId,
      canInsertBlockType,
      getBlockName,
      getBlockRootClientId,
      isBlockSelected
    } = select(store); // The classes are only relevant for the selected block. Avoid
    // re-rendering all blocks!

    if (!isBlockSelected(clientId)) {
      return;
    }

    const movingClientId = hasBlockMovingClientId();

    if (!movingClientId) {
      return;
    }

    return classnames_default()('is-block-moving-mode', {
      'can-insert-moving-block': canInsertBlockType(getBlockName(movingClientId), getBlockRootClientId(clientId))
    });
  }, [clientId]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/use-block-props/use-focus-handler.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */



/**
 * Selects the block if it receives focus.
 *
 * @param {string} clientId Block client ID.
 */

function useFocusHandler(clientId) {
  const {
    isBlockSelected
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const {
    selectBlock,
    selectionChange
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    /**
     * Marks the block as selected when focused and not already
     * selected. This specifically handles the case where block does not
     * set focus on its own (via `setFocus`), typically if there is no
     * focusable input in the block.
     *
     * @param {FocusEvent} event Focus event.
     */
    function onFocus(event) {
      // When the whole editor is editable, let writing flow handle
      // selection.
      if (node.parentElement.closest('[contenteditable="true"]')) {
        return;
      } // Check synchronously because a non-selected block might be
      // getting data through `useSelect` asynchronously.


      if (isBlockSelected(clientId)) {
        // Potentially change selection away from rich text.
        if (!event.target.isContentEditable) {
          selectionChange(clientId);
        }

        return;
      } // If an inner block is focussed, that block is resposible for
      // setting the selected block.


      if (!isInsideRootBlock(node, event.target)) {
        return;
      }

      selectBlock(clientId);
    }

    node.addEventListener('focusin', onFocus);
    return () => {
      node.removeEventListener('focusin', onFocus);
    };
  }, [isBlockSelected, selectBlock]);
}

;// CONCATENATED MODULE: external ["wp","keycodes"]
var external_wp_keycodes_namespaceObject = window["wp"]["keycodes"];
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/use-block-props/use-selected-block-event-handlers.js
/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */


/**
 * Adds block behaviour:
 *   - Removes the block on BACKSPACE.
 *   - Inserts a default block on ENTER.
 *   - Disables dragging of block contents.
 *
 * @param {string} clientId Block client ID.
 */

function useEventHandlers(clientId) {
  const isSelected = (0,external_wp_data_namespaceObject.useSelect)(select => select(store).isBlockSelected(clientId), [clientId]);
  const {
    getBlockRootClientId,
    getBlockIndex
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const {
    insertDefaultBlock,
    removeBlock
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    if (!isSelected) {
      return;
    }
    /**
     * Interprets keydown event intent to remove or insert after block if
     * key event occurs on wrapper node. This can occur when the block has
     * no text fields of its own, particularly after initial insertion, to
     * allow for easy deletion and continuous writing flow to add additional
     * content.
     *
     * @param {KeyboardEvent} event Keydown event.
     */


    function onKeyDown(event) {
      const {
        keyCode,
        target
      } = event;

      if (keyCode !== external_wp_keycodes_namespaceObject.ENTER && keyCode !== external_wp_keycodes_namespaceObject.BACKSPACE && keyCode !== external_wp_keycodes_namespaceObject.DELETE) {
        return;
      }

      if (target !== node || (0,external_wp_dom_namespaceObject.isTextField)(target)) {
        return;
      }

      event.preventDefault();

      if (keyCode === external_wp_keycodes_namespaceObject.ENTER) {
        insertDefaultBlock({}, getBlockRootClientId(clientId), getBlockIndex(clientId) + 1);
      } else {
        removeBlock(clientId);
      }
    }
    /**
     * Prevents default dragging behavior within a block. To do: we must
     * handle this in the future and clean up the drag target.
     *
     * @param {DragEvent} event Drag event.
     */


    function onDragStart(event) {
      event.preventDefault();
    }

    node.addEventListener('keydown', onKeyDown);
    node.addEventListener('dragstart', onDragStart);
    return () => {
      node.removeEventListener('keydown', onKeyDown);
      node.removeEventListener('dragstart', onDragStart);
    };
  }, [clientId, isSelected, getBlockRootClientId, getBlockIndex, insertDefaultBlock, removeBlock]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/use-block-props/use-nav-mode-exit.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


/**
 * Allows navigation mode to be exited by clicking in the selected block.
 *
 * @param {string} clientId Block client ID.
 */

function useNavModeExit(clientId) {
  const {
    isNavigationMode,
    isBlockSelected
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const {
    setNavigationMode,
    selectBlock
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    function onMouseDown(event) {
      // Don't select a block if it's already handled by a child
      // block.
      if (isNavigationMode() && !event.defaultPrevented) {
        // Prevent focus from moving to the block.
        event.preventDefault(); // When clicking on a selected block, exit navigation mode.

        if (isBlockSelected(clientId)) {
          setNavigationMode(false);
        } else {
          selectBlock(clientId);
        }
      }
    }

    node.addEventListener('mousedown', onMouseDown);
    return () => {
      node.addEventListener('mousedown', onMouseDown);
    };
  }, [clientId, isNavigationMode, isBlockSelected, setNavigationMode]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/use-block-props/use-intersection-observer.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


function useIntersectionObserver() {
  const observer = (0,external_wp_element_namespaceObject.useContext)(IntersectionObserver);
  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    if (observer) {
      observer.observe(node);
      return () => {
        observer.unobserve(node);
      };
    }
  }, [observer]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/use-block-props/index.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */







/**
 * Internal dependencies
 */
















/**
 * If the block count exceeds the threshold, we disable the reordering animation
 * to avoid laginess.
 */

const BLOCK_ANIMATION_THRESHOLD = 200;
/**
 * This hook is used to lightly mark an element as a block element. The element
 * should be the outermost element of a block. Call this hook and pass the
 * returned props to the element to mark as a block. If you define a ref for the
 * element, it is important to pass the ref to this hook, which the hook in turn
 * will pass to the component through the props it returns. Optionally, you can
 * also pass any other props through this hook, and they will be merged and
 * returned.
 *
 * @param {Object}  props                    Optional. Props to pass to the element. Must contain
 *                                           the ref if one is defined.
 * @param {Object}  options                  Options for internal use only.
 * @param {boolean} options.__unstableIsHtml
 *
 * @return {Object} Props to pass to the element to mark as a block.
 */

function useBlockProps() {
  let props = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  let {
    __unstableIsHtml
  } = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
  const {
    clientId,
    className,
    wrapperProps = {},
    isAligned
  } = (0,external_wp_element_namespaceObject.useContext)(BlockListBlockContext);
  const {
    index,
    mode,
    name,
    blockApiVersion,
    blockTitle,
    isPartOfSelection,
    adjustScrolling,
    enableAnimation
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getBlockIndex,
      getBlockMode,
      getBlockName,
      isTyping,
      getGlobalBlockCount,
      isBlockSelected,
      isBlockMultiSelected,
      isAncestorMultiSelected,
      isFirstMultiSelectedBlock
    } = select(store);
    const isSelected = isBlockSelected(clientId);
    const isPartOfMultiSelection = isBlockMultiSelected(clientId) || isAncestorMultiSelected(clientId);
    const blockName = getBlockName(clientId);
    const blockType = (0,external_wp_blocks_namespaceObject.getBlockType)(blockName);
    return {
      index: getBlockIndex(clientId),
      mode: getBlockMode(clientId),
      name: blockName,
      blockApiVersion: (blockType === null || blockType === void 0 ? void 0 : blockType.apiVersion) || 1,
      blockTitle: blockType === null || blockType === void 0 ? void 0 : blockType.title,
      isPartOfSelection: isSelected || isPartOfMultiSelection,
      adjustScrolling: isSelected || isFirstMultiSelectedBlock(clientId),
      enableAnimation: !isTyping() && getGlobalBlockCount() <= BLOCK_ANIMATION_THRESHOLD
    };
  }, [clientId]); // translators: %s: Type of block (i.e. Text, Image etc)

  const blockLabel = (0,external_wp_i18n_namespaceObject.sprintf)((0,external_wp_i18n_namespaceObject.__)('Block: %s'), blockTitle);
  const htmlSuffix = mode === 'html' && !__unstableIsHtml ? '-visual' : '';
  const mergedRefs = (0,external_wp_compose_namespaceObject.useMergeRefs)([props.ref, useFocusFirstElement(clientId), useBlockRefProvider(clientId), useFocusHandler(clientId), useEventHandlers(clientId), useNavModeExit(clientId), useIsHovered(), useIntersectionObserver(), use_moving_animation({
    isSelected: isPartOfSelection,
    adjustScrolling,
    enableAnimation,
    triggerAnimationOnChange: index
  })]);
  const blockEditContext = useBlockEditContext(); // Ensures it warns only inside the `edit` implementation for the block.

  if (blockApiVersion < 2 && clientId === blockEditContext.clientId) {
    typeof process !== "undefined" && process.env && "production" !== "production" ? 0 : void 0;
  }

  return { ...wrapperProps,
    ...props,
    ref: mergedRefs,
    id: `block-${clientId}${htmlSuffix}`,
    tabIndex: 0,
    role: 'document',
    'aria-label': blockLabel,
    'data-block': clientId,
    'data-type': name,
    'data-title': blockTitle,
    className: classnames_default()( // The wp-block className is important for editor styles.
    classnames_default()('block-editor-block-list__block', {
      'wp-block': !isAligned
    }), className, props.className, wrapperProps.className, useBlockClassNames(clientId), useBlockDefaultClassName(clientId), useBlockCustomClassName(clientId), useBlockMovingModeClassNames(clientId)),
    style: { ...wrapperProps.style,
      ...props.style
    }
  };
}
/**
 * Call within a save function to get the props for the block wrapper.
 *
 * @param {Object} props Optional. Props to pass to the element.
 */

useBlockProps.save = external_wp_blocks_namespaceObject.__unstableGetBlockProps;

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/block.js


/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */







/**
 * Internal dependencies
 */








const BlockListBlockContext = (0,external_wp_element_namespaceObject.createContext)();
/**
 * Merges wrapper props with special handling for classNames and styles.
 *
 * @param {Object} propsA
 * @param {Object} propsB
 *
 * @return {Object} Merged props.
 */

function mergeWrapperProps(propsA, propsB) {
  const newProps = { ...propsA,
    ...propsB
  };

  if (propsA && propsB && propsA.className && propsB.className) {
    newProps.className = classnames_default()(propsA.className, propsB.className);
  }

  if (propsA && propsB && propsA.style && propsB.style) {
    newProps.style = { ...propsA.style,
      ...propsB.style
    };
  }

  return newProps;
}

function Block(_ref) {
  let {
    children,
    isHtml,
    ...props
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)("div", useBlockProps(props, {
    __unstableIsHtml: isHtml
  }), children);
}

function BlockListBlock(_ref2) {
  var _wrapperProps;

  let {
    block: {
      __unstableBlockSource
    },
    mode,
    isLocked,
    canRemove,
    clientId,
    isSelected,
    isSelectionEnabled,
    className,
    name,
    isValid,
    attributes,
    wrapperProps,
    setAttributes,
    onReplace,
    onInsertBlocksAfter,
    onMerge,
    toggleSelection
  } = _ref2;
  const themeSupportsLayout = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getSettings
    } = select(store);
    return getSettings().supportsLayout;
  }, []);
  const {
    removeBlock
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const onRemove = (0,external_wp_element_namespaceObject.useCallback)(() => removeBlock(clientId), [clientId]); // We wrap the BlockEdit component in a div that hides it when editing in
  // HTML mode. This allows us to render all of the ancillary pieces
  // (InspectorControls, etc.) which are inside `BlockEdit` but not
  // `BlockHTML`, even in HTML mode.

  let blockEdit = (0,external_wp_element_namespaceObject.createElement)(BlockEdit, {
    name: name,
    isSelected: isSelected,
    attributes: attributes,
    setAttributes: setAttributes,
    insertBlocksAfter: isLocked ? undefined : onInsertBlocksAfter,
    onReplace: canRemove ? onReplace : undefined,
    onRemove: canRemove ? onRemove : undefined,
    mergeBlocks: canRemove ? onMerge : undefined,
    clientId: clientId,
    isSelectionEnabled: isSelectionEnabled,
    toggleSelection: toggleSelection
  });
  const blockType = (0,external_wp_blocks_namespaceObject.getBlockType)(name); // Determine whether the block has props to apply to the wrapper.

  if (blockType !== null && blockType !== void 0 && blockType.getEditWrapperProps) {
    wrapperProps = mergeWrapperProps(wrapperProps, blockType.getEditWrapperProps(attributes));
  }

  const isAligned = wrapperProps && !!wrapperProps['data-align'] && !themeSupportsLayout; // For aligned blocks, provide a wrapper element so the block can be
  // positioned relative to the block column.
  // This is only kept for classic themes that don't support layout
  // Historically we used to rely on extra divs and data-align to
  // provide the alignments styles in the editor.
  // Due to the differences between frontend and backend, we migrated
  // to the layout feature, and we're now aligning the markup of frontend
  // and backend.

  if (isAligned) {
    blockEdit = (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "wp-block",
      "data-align": wrapperProps['data-align']
    }, blockEdit);
  }

  let block;

  if (!isValid) {
    const saveContent = __unstableBlockSource ? (0,external_wp_blocks_namespaceObject.serializeRawBlock)(__unstableBlockSource) : (0,external_wp_blocks_namespaceObject.getSaveContent)(blockType, attributes);
    block = (0,external_wp_element_namespaceObject.createElement)(Block, {
      className: "has-warning"
    }, (0,external_wp_element_namespaceObject.createElement)(block_invalid_warning, {
      clientId: clientId
    }), (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.RawHTML, null, (0,external_wp_dom_namespaceObject.safeHTML)(saveContent)));
  } else if (mode === 'html') {
    // Render blockEdit so the inspector controls don't disappear.
    // See #8969.
    block = (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)("div", {
      style: {
        display: 'none'
      }
    }, blockEdit), (0,external_wp_element_namespaceObject.createElement)(Block, {
      isHtml: true
    }, (0,external_wp_element_namespaceObject.createElement)(block_html, {
      clientId: clientId
    })));
  } else if ((blockType === null || blockType === void 0 ? void 0 : blockType.apiVersion) > 1) {
    block = blockEdit;
  } else {
    block = (0,external_wp_element_namespaceObject.createElement)(Block, wrapperProps, blockEdit);
  }

  const value = {
    clientId,
    className: (_wrapperProps = wrapperProps) !== null && _wrapperProps !== void 0 && _wrapperProps['data-align'] && themeSupportsLayout ? classnames_default()(className, `align${wrapperProps['data-align']}`) : className,
    wrapperProps: (0,external_lodash_namespaceObject.omit)(wrapperProps, ['data-align']),
    isAligned
  };
  const memoizedValue = (0,external_wp_element_namespaceObject.useMemo)(() => value, Object.values(value));
  return (0,external_wp_element_namespaceObject.createElement)(BlockListBlockContext.Provider, {
    value: memoizedValue
  }, (0,external_wp_element_namespaceObject.createElement)(block_crash_boundary, {
    fallback: (0,external_wp_element_namespaceObject.createElement)(Block, {
      className: "has-warning"
    }, (0,external_wp_element_namespaceObject.createElement)(block_crash_warning, null))
  }, block));
}

const applyWithSelect = (0,external_wp_data_namespaceObject.withSelect)((select, _ref3) => {
  let {
    clientId,
    rootClientId
  } = _ref3;
  const {
    isBlockSelected,
    getBlockMode,
    isSelectionEnabled,
    getTemplateLock,
    __unstableGetBlockWithoutInnerBlocks,
    canRemoveBlock,
    canMoveBlock
  } = select(store);

  const block = __unstableGetBlockWithoutInnerBlocks(clientId);

  const isSelected = isBlockSelected(clientId);
  const templateLock = getTemplateLock(rootClientId);
  const canRemove = canRemoveBlock(clientId, rootClientId);
  const canMove = canMoveBlock(clientId, rootClientId); // The fallback to `{}` is a temporary fix.
  // This function should never be called when a block is not present in
  // the state. It happens now because the order in withSelect rendering
  // is not correct.

  const {
    name,
    attributes,
    isValid
  } = block || {}; // Do not add new properties here, use `useSelect` instead to avoid
  // leaking new props to the public API (editor.BlockListBlock filter).

  return {
    mode: getBlockMode(clientId),
    isSelectionEnabled: isSelectionEnabled(),
    isLocked: !!templateLock,
    canRemove,
    canMove,
    // Users of the editor.BlockListBlock filter used to be able to
    // access the block prop.
    // Ideally these blocks would rely on the clientId prop only.
    // This is kept for backward compatibility reasons.
    block,
    name,
    attributes,
    isValid,
    isSelected
  };
});
const applyWithDispatch = (0,external_wp_data_namespaceObject.withDispatch)((dispatch, ownProps, _ref4) => {
  let {
    select
  } = _ref4;
  const {
    updateBlockAttributes,
    insertBlocks,
    mergeBlocks,
    replaceBlocks,
    toggleSelection,
    __unstableMarkLastChangeAsPersistent
  } = dispatch(store); // Do not add new properties here, use `useDispatch` instead to avoid
  // leaking new props to the public API (editor.BlockListBlock filter).

  return {
    setAttributes(newAttributes) {
      const {
        getMultiSelectedBlockClientIds
      } = select(store);
      const multiSelectedBlockClientIds = getMultiSelectedBlockClientIds();
      const {
        clientId
      } = ownProps;
      const clientIds = multiSelectedBlockClientIds.length ? multiSelectedBlockClientIds : [clientId];
      updateBlockAttributes(clientIds, newAttributes);
    },

    onInsertBlocks(blocks, index) {
      const {
        rootClientId
      } = ownProps;
      insertBlocks(blocks, index, rootClientId);
    },

    onInsertBlocksAfter(blocks) {
      const {
        clientId,
        rootClientId
      } = ownProps;
      const {
        getBlockIndex
      } = select(store);
      const index = getBlockIndex(clientId);
      insertBlocks(blocks, index + 1, rootClientId);
    },

    onMerge(forward) {
      const {
        clientId
      } = ownProps;
      const {
        getPreviousBlockClientId,
        getNextBlockClientId
      } = select(store);

      if (forward) {
        const nextBlockClientId = getNextBlockClientId(clientId);

        if (nextBlockClientId) {
          mergeBlocks(clientId, nextBlockClientId);
        }
      } else {
        const previousBlockClientId = getPreviousBlockClientId(clientId);

        if (previousBlockClientId) {
          mergeBlocks(previousBlockClientId, clientId);
        }
      }
    },

    onReplace(blocks, indexToSelect, initialPosition) {
      if (blocks.length && !(0,external_wp_blocks_namespaceObject.isUnmodifiedDefaultBlock)(blocks[blocks.length - 1])) {
        __unstableMarkLastChangeAsPersistent();
      }

      replaceBlocks([ownProps.clientId], blocks, indexToSelect, initialPosition);
    },

    toggleSelection(selectionEnabled) {
      toggleSelection(selectionEnabled);
    }

  };
});
/* harmony default export */ var block = ((0,external_wp_compose_namespaceObject.compose)(external_wp_compose_namespaceObject.pure, applyWithSelect, applyWithDispatch, // Block is sometimes not mounted at the right time, causing it be undefined
// see issue for more info
// https://github.com/WordPress/gutenberg/issues/17013
(0,external_wp_compose_namespaceObject.ifCondition)(_ref5 => {
  let {
    block
  } = _ref5;
  return !!block;
}), (0,external_wp_components_namespaceObject.withFilters)('editor.BlockListBlock'))(BlockListBlock));

;// CONCATENATED MODULE: external ["wp","htmlEntities"]
var external_wp_htmlEntities_namespaceObject = window["wp"]["htmlEntities"];
;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/plus.js


/**
 * WordPress dependencies
 */

const plus = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M18 11.2h-5.2V6h-1.6v5.2H6v1.6h5.2V18h1.6v-5.2H18z"
}));
/* harmony default export */ var library_plus = (plus);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/tips.js


/**
 * WordPress dependencies
 */



const globalTips = [(0,external_wp_element_namespaceObject.createInterpolateElement)((0,external_wp_i18n_namespaceObject.__)('While writing, you can press <kbd>/</kbd> to quickly insert new blocks.'), {
  kbd: (0,external_wp_element_namespaceObject.createElement)("kbd", null)
}), (0,external_wp_element_namespaceObject.createInterpolateElement)((0,external_wp_i18n_namespaceObject.__)('Indent a list by pressing <kbd>space</kbd> at the beginning of a line.'), {
  kbd: (0,external_wp_element_namespaceObject.createElement)("kbd", null)
}), (0,external_wp_element_namespaceObject.createInterpolateElement)((0,external_wp_i18n_namespaceObject.__)('Outdent a list by pressing <kbd>backspace</kbd> at the beginning of a line.'), {
  kbd: (0,external_wp_element_namespaceObject.createElement)("kbd", null)
}), (0,external_wp_i18n_namespaceObject.__)('Drag files into the editor to automatically insert media blocks.'), (0,external_wp_i18n_namespaceObject.__)("Change a block's type by pressing the block icon on the toolbar.")];

function Tips() {
  const [randomIndex] = (0,external_wp_element_namespaceObject.useState)( // Disable Reason: I'm not generating an HTML id.
  // eslint-disable-next-line no-restricted-syntax
  Math.floor(Math.random() * globalTips.length));
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Tip, null, globalTips[randomIndex]);
}

/* harmony default export */ var tips = (Tips);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/block-default.js


/**
 * WordPress dependencies
 */

const blockDefault = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M19 8h-1V6h-5v2h-2V6H6v2H5c-1.1 0-2 .9-2 2v8c0 1.1.9 2 2 2h14c1.1 0 2-.9 2-2v-8c0-1.1-.9-2-2-2zm.5 10c0 .3-.2.5-.5.5H5c-.3 0-.5-.2-.5-.5v-8c0-.3.2-.5.5-.5h14c.3 0 .5.2.5.5v8z"
}));
/* harmony default export */ var block_default = (blockDefault);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-icon/index.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */





function BlockIcon(_ref) {
  var _icon;

  let {
    icon,
    showColors = false,
    className
  } = _ref;

  if (((_icon = icon) === null || _icon === void 0 ? void 0 : _icon.src) === 'block-default') {
    icon = {
      src: block_default
    };
  }

  const renderedIcon = (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Icon, {
    icon: icon && icon.src ? icon.src : icon
  });
  const style = showColors ? {
    backgroundColor: icon && icon.background,
    color: icon && icon.foreground
  } : {};
  return (0,external_wp_element_namespaceObject.createElement)("span", {
    style: style,
    className: classnames_default()('block-editor-block-icon', className, {
      'has-colors': showColors
    })
  }, renderedIcon);
}
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/block-icon/README.md
 */


/* harmony default export */ var block_icon = ((0,external_wp_element_namespaceObject.memo)(BlockIcon));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-card/index.js


/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */



function BlockCard(_ref) {
  let {
    title,
    icon,
    description,
    blockType
  } = _ref;

  if (blockType) {
    external_wp_deprecated_default()('`blockType` property in `BlockCard component`', {
      since: '5.7',
      alternative: '`title, icon and description` properties'
    });
    ({
      title,
      icon,
      description
    } = blockType);
  }

  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-card"
  }, (0,external_wp_element_namespaceObject.createElement)(block_icon, {
    icon: icon,
    showColors: true
  }), (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-card__content"
  }, (0,external_wp_element_namespaceObject.createElement)("h2", {
    className: "block-editor-block-card__title"
  }, title), (0,external_wp_element_namespaceObject.createElement)("span", {
    className: "block-editor-block-card__description"
  }, description)));
}

/* harmony default export */ var block_card = (BlockCard);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/provider/with-registry-provider.js



/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */



const withRegistryProvider = (0,external_wp_compose_namespaceObject.createHigherOrderComponent)(WrappedComponent => {
  return (0,external_wp_data_namespaceObject.withRegistry)(_ref => {
    let {
      useSubRegistry = true,
      registry,
      ...props
    } = _ref;

    if (!useSubRegistry) {
      return (0,external_wp_element_namespaceObject.createElement)(WrappedComponent, _extends({
        registry: registry
      }, props));
    }

    const [subRegistry, setSubRegistry] = (0,external_wp_element_namespaceObject.useState)(null);
    (0,external_wp_element_namespaceObject.useEffect)(() => {
      const newRegistry = (0,external_wp_data_namespaceObject.createRegistry)({}, registry);
      newRegistry.registerStore(STORE_NAME, storeConfig);
      setSubRegistry(newRegistry);
    }, [registry]);

    if (!subRegistry) {
      return null;
    }

    return (0,external_wp_element_namespaceObject.createElement)(external_wp_data_namespaceObject.RegistryProvider, {
      value: subRegistry
    }, (0,external_wp_element_namespaceObject.createElement)(WrappedComponent, _extends({
      registry: subRegistry
    }, props)));
  });
}, 'withRegistryProvider');
/* harmony default export */ var with_registry_provider = (withRegistryProvider);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/provider/use-block-sync.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */


/**
 * A function to call when the block value has been updated in the block-editor
 * store.
 *
 * @callback onBlockUpdate
 * @param {Object[]} blocks  The updated blocks.
 * @param {Object}   options The updated block options, such as selectionStart
 *                           and selectionEnd.
 */

/**
 * useBlockSync is a side effect which handles bidirectional sync between the
 * block-editor store and a controlling data source which provides blocks. This
 * is most commonly used by the BlockEditorProvider to synchronize the contents
 * of the block-editor store with the root entity, like a post.
 *
 * Another example would be the template part block, which provides blocks from
 * a separate entity data source than a root entity. This hook syncs edits to
 * the template part in the block editor back to the entity and vice-versa.
 *
 * Here are some of its basic functions:
 * - Initalizes the block-editor store for the given clientID to the blocks
 *   given via props.
 * - Adds incoming changes (like undo) to the block-editor store.
 * - Adds outgoing changes (like editing content) to the controlling entity,
 *   determining if a change should be considered persistent or not.
 * - Handles edge cases and race conditions which occur in those operations.
 * - Ignores changes which happen to other entities (like nested inner block
 *   controllers.
 * - Passes selection state from the block-editor store to the controlling entity.
 *
 * @param {Object}        props           Props for the block sync hook
 * @param {string}        props.clientId  The client ID of the inner block controller.
 *                                        If none is passed, then it is assumed to be a
 *                                        root controller rather than an inner block
 *                                        controller.
 * @param {Object[]}      props.value     The control value for the blocks. This value
 *                                        is used to initalize the block-editor store
 *                                        and for resetting the blocks to incoming
 *                                        changes like undo.
 * @param {Object}        props.selection The selection state responsible to restore the selection on undo/redo.
 * @param {onBlockUpdate} props.onChange  Function to call when a persistent
 *                                        change has been made in the block-editor blocks
 *                                        for the given clientId. For example, after
 *                                        this function is called, an entity is marked
 *                                        dirty because it has changes to save.
 * @param {onBlockUpdate} props.onInput   Function to call when a non-persistent
 *                                        change has been made in the block-editor blocks
 *                                        for the given clientId. When this is called,
 *                                        controlling sources do not become dirty.
 */

function useBlockSync(_ref) {
  let {
    clientId = null,
    value: controlledBlocks,
    selection: controlledSelection,
    onChange = external_lodash_namespaceObject.noop,
    onInput = external_lodash_namespaceObject.noop
  } = _ref;
  const registry = (0,external_wp_data_namespaceObject.useRegistry)();
  const {
    resetBlocks,
    resetSelection,
    replaceInnerBlocks,
    setHasControlledInnerBlocks,
    __unstableMarkNextChangeAsNotPersistent
  } = registry.dispatch(store);
  const {
    getBlockName,
    getBlocks
  } = registry.select(store);
  const isControlled = (0,external_wp_data_namespaceObject.useSelect)(select => {
    return !clientId || select(store).areInnerBlocksControlled(clientId);
  }, [clientId]);
  const pendingChanges = (0,external_wp_element_namespaceObject.useRef)({
    incoming: null,
    outgoing: []
  });
  const subscribed = (0,external_wp_element_namespaceObject.useRef)(false);

  const setControlledBlocks = () => {
    if (!controlledBlocks) {
      return;
    } // We don't need to persist this change because we only replace
    // controlled inner blocks when the change was caused by an entity,
    // and so it would already be persisted.


    __unstableMarkNextChangeAsNotPersistent();

    if (clientId) {
      // It is important to batch here because otherwise,
      // as soon as `setHasControlledInnerBlocks` is called
      // the effect to restore might be triggered
      // before the actual blocks get set properly in state.
      registry.batch(() => {
        setHasControlledInnerBlocks(clientId, true);
        const storeBlocks = controlledBlocks.map(block => (0,external_wp_blocks_namespaceObject.cloneBlock)(block));

        if (subscribed.current) {
          pendingChanges.current.incoming = storeBlocks;
        }

        __unstableMarkNextChangeAsNotPersistent();

        replaceInnerBlocks(clientId, storeBlocks);
      });
    } else {
      if (subscribed.current) {
        pendingChanges.current.incoming = controlledBlocks;
      }

      resetBlocks(controlledBlocks);
    }
  }; // Add a subscription to the block-editor registry to detect when changes
  // have been made. This lets us inform the data source of changes. This
  // is an effect so that the subscriber can run synchronously without
  // waiting for React renders for changes.


  const onInputRef = (0,external_wp_element_namespaceObject.useRef)(onInput);
  const onChangeRef = (0,external_wp_element_namespaceObject.useRef)(onChange);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    onInputRef.current = onInput;
    onChangeRef.current = onChange;
  }, [onInput, onChange]); // Determine if blocks need to be reset when they change.

  (0,external_wp_element_namespaceObject.useEffect)(() => {
    if (pendingChanges.current.outgoing.includes(controlledBlocks)) {
      // Skip block reset if the value matches expected outbound sync
      // triggered by this component by a preceding change detection.
      // Only skip if the value matches expectation, since a reset should
      // still occur if the value is modified (not equal by reference),
      // to allow that the consumer may apply modifications to reflect
      // back on the editor.
      if ((0,external_lodash_namespaceObject.last)(pendingChanges.current.outgoing) === controlledBlocks) {
        pendingChanges.current.outgoing = [];
      }
    } else if (getBlocks(clientId) !== controlledBlocks) {
      // Reset changing value in all other cases than the sync described
      // above. Since this can be reached in an update following an out-
      // bound sync, unset the outbound value to avoid considering it in
      // subsequent renders.
      pendingChanges.current.outgoing = [];
      setControlledBlocks();

      if (controlledSelection) {
        resetSelection(controlledSelection.selectionStart, controlledSelection.selectionEnd, controlledSelection.initialPosition);
      }
    }
  }, [controlledBlocks, clientId]);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    // When the block becomes uncontrolled, it means its inner state has been reset
    // we need to take the blocks again from the external value property.
    if (!isControlled) {
      pendingChanges.current.outgoing = [];
      setControlledBlocks();
    }
  }, [isControlled]);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    const {
      getSelectionStart,
      getSelectionEnd,
      getSelectedBlocksInitialCaretPosition,
      isLastBlockChangePersistent,
      __unstableIsLastBlockChangeIgnored,
      areInnerBlocksControlled
    } = registry.select(store);
    let blocks = getBlocks(clientId);
    let isPersistent = isLastBlockChangePersistent();
    let previousAreBlocksDifferent = false;
    subscribed.current = true;
    const unsubscribe = registry.subscribe(() => {
      // Sometimes, when changing block lists, lingering subscriptions
      // might trigger before they are cleaned up. If the block for which
      // the subscription runs is no longer in the store, this would clear
      // its parent entity's block list. To avoid this, we bail out if
      // the subscription is triggering for a block (`clientId !== null`)
      // and its block name can't be found because it's not on the list.
      // (`getBlockName( clientId ) === null`).
      if (clientId !== null && getBlockName(clientId) === null) return; // When RESET_BLOCKS on parent blocks get called, the controlled blocks
      // can reset to uncontrolled, in these situations, it means we need to populate
      // the blocks again from the external blocks (the value property here)
      // and we should stop triggering onChange

      const isStillControlled = !clientId || areInnerBlocksControlled(clientId);

      if (!isStillControlled) {
        return;
      }

      const newIsPersistent = isLastBlockChangePersistent();
      const newBlocks = getBlocks(clientId);
      const areBlocksDifferent = newBlocks !== blocks;
      blocks = newBlocks;

      if (areBlocksDifferent && (pendingChanges.current.incoming || __unstableIsLastBlockChangeIgnored())) {
        pendingChanges.current.incoming = null;
        isPersistent = newIsPersistent;
        return;
      } // Since we often dispatch an action to mark the previous action as
      // persistent, we need to make sure that the blocks changed on the
      // previous action before committing the change.


      const didPersistenceChange = previousAreBlocksDifferent && !areBlocksDifferent && newIsPersistent && !isPersistent;

      if (areBlocksDifferent || didPersistenceChange) {
        isPersistent = newIsPersistent; // We know that onChange/onInput will update controlledBlocks.
        // We need to be aware that it was caused by an outgoing change
        // so that we do not treat it as an incoming change later on,
        // which would cause a block reset.

        pendingChanges.current.outgoing.push(blocks); // Inform the controlling entity that changes have been made to
        // the block-editor store they should be aware about.

        const updateParent = isPersistent ? onChangeRef.current : onInputRef.current;
        updateParent(blocks, {
          selection: {
            selectionStart: getSelectionStart(),
            selectionEnd: getSelectionEnd(),
            initialPosition: getSelectedBlocksInitialCaretPosition()
          }
        });
      }

      previousAreBlocksDifferent = areBlocksDifferent;
    });
    return () => unsubscribe();
  }, [registry, clientId]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/provider/index.js


/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */





/** @typedef {import('@wordpress/data').WPDataRegistry} WPDataRegistry */

function BlockEditorProvider(props) {
  const {
    children,
    settings
  } = props;
  const {
    updateSettings
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    updateSettings(settings);
  }, [settings]); // Syncs the entity provider with changes in the block-editor store.

  useBlockSync(props);
  return (0,external_wp_element_namespaceObject.createElement)(BlockRefsProvider, null, children);
}

/* harmony default export */ var provider = (with_registry_provider(BlockEditorProvider));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-preview/live.js


/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */


function LiveBlockPreview(_ref) {
  let {
    onClick
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    tabIndex: 0,
    role: "button",
    onClick: onClick,
    onKeyPress: onClick
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Disabled, null, (0,external_wp_element_namespaceObject.createElement)(BlockList, null)));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-selection-clearer/index.js



/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


/**
 * Pass the returned ref callback to an element that should clear block
 * selection. Selection will only be cleared if the element is clicked directly,
 * not if a child element is clicked.
 *
 * @return {import('react').RefCallback} Ref callback.
 */

function useBlockSelectionClearer() {
  const {
    hasSelectedBlock,
    hasMultiSelection
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const {
    clearSelectedBlock
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    function onMouseDown(event) {
      if (!hasSelectedBlock() && !hasMultiSelection()) {
        return;
      } // Only handle clicks on the element, not the children.


      if (event.target !== node) {
        return;
      }

      clearSelectedBlock();
    }

    node.addEventListener('mousedown', onMouseDown);
    return () => {
      node.removeEventListener('mousedown', onMouseDown);
    };
  }, [hasSelectedBlock, hasMultiSelection, clearSelectedBlock]);
}
function BlockSelectionClearer(props) {
  return (0,external_wp_element_namespaceObject.createElement)("div", _extends({
    ref: useBlockSelectionClearer()
  }, props));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/writing-flow/use-multi-selection.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */




function selector(select) {
  const {
    isMultiSelecting,
    getMultiSelectedBlockClientIds,
    hasMultiSelection,
    getSelectedBlockClientId,
    getSelectedBlocksInitialCaretPosition,
    __unstableIsFullySelected
  } = select(store);
  return {
    isMultiSelecting: isMultiSelecting(),
    multiSelectedBlockClientIds: getMultiSelectedBlockClientIds(),
    hasMultiSelection: hasMultiSelection(),
    selectedBlockClientId: getSelectedBlockClientId(),
    initialPosition: getSelectedBlocksInitialCaretPosition(),
    isFullSelection: __unstableIsFullySelected()
  };
}

function useMultiSelection() {
  const {
    initialPosition,
    isMultiSelecting,
    multiSelectedBlockClientIds,
    hasMultiSelection,
    selectedBlockClientId,
    isFullSelection
  } = (0,external_wp_data_namespaceObject.useSelect)(selector, []);
  const selectedRef = useBlockRef(selectedBlockClientId); // These must be in the right DOM order.

  const startRef = useBlockRef((0,external_lodash_namespaceObject.first)(multiSelectedBlockClientIds));
  const endRef = useBlockRef((0,external_lodash_namespaceObject.last)(multiSelectedBlockClientIds));
  /**
   * When the component updates, and there is multi selection, we need to
   * select the entire block contents.
   */

  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    const {
      ownerDocument
    } = node;
    const {
      defaultView
    } = ownerDocument; // Allow initialPosition to bypass focus behavior. This is useful
    // for the list view or other areas where we don't want to transfer
    // focus to the editor canvas.

    if (initialPosition === undefined || initialPosition === null) {
      return;
    }

    if (!hasMultiSelection || isMultiSelecting) {
      if (!selectedBlockClientId || isMultiSelecting) {
        return;
      }

      const selection = defaultView.getSelection();

      if (selection.rangeCount && !selection.isCollapsed) {
        const blockNode = selectedRef.current;
        const {
          startContainer,
          endContainer
        } = selection.getRangeAt(0);

        if (!!blockNode && (!blockNode.contains(startContainer) || !blockNode.contains(endContainer))) {
          selection.removeAllRanges();
        }
      }

      return;
    }

    const {
      length
    } = multiSelectedBlockClientIds;

    if (length < 2) {
      return;
    }

    if (!isFullSelection) {
      return;
    } // Allow cross contentEditable selection by temporarily making
    // all content editable. We can't rely on using the store and
    // React because re-rending happens too slowly. We need to be
    // able to select across instances immediately.


    node.contentEditable = true; // For some browsers, like Safari, it is important that focus happens
    // BEFORE selection.

    node.focus(); // The block refs might not be immediately available
    // when dragging blocks into another block.

    if (!startRef.current || !endRef.current) {
      return;
    }

    const selection = defaultView.getSelection();
    const range = ownerDocument.createRange(); // These must be in the right DOM order.

    range.setStartBefore(startRef.current);
    range.setEndAfter(endRef.current);
    selection.removeAllRanges();
    selection.addRange(range);
  }, [hasMultiSelection, isMultiSelecting, multiSelectedBlockClientIds, selectedBlockClientId, initialPosition, isFullSelection]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/writing-flow/use-tab-nav.js


/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */


function useTabNav() {
  const container = (0,external_wp_element_namespaceObject.useRef)();
  const focusCaptureBeforeRef = (0,external_wp_element_namespaceObject.useRef)();
  const focusCaptureAfterRef = (0,external_wp_element_namespaceObject.useRef)();
  const lastFocus = (0,external_wp_element_namespaceObject.useRef)();
  const {
    hasMultiSelection,
    getSelectedBlockClientId,
    getBlockCount
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const {
    setNavigationMode
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const isNavigationMode = (0,external_wp_data_namespaceObject.useSelect)(select => select(store).isNavigationMode(), []); // Don't allow tabbing to this element in Navigation mode.

  const focusCaptureTabIndex = !isNavigationMode ? '0' : undefined; // Reference that holds the a flag for enabling or disabling
  // capturing on the focus capture elements.

  const noCapture = (0,external_wp_element_namespaceObject.useRef)();

  function onFocusCapture(event) {
    // Do not capture incoming focus if set by us in WritingFlow.
    if (noCapture.current) {
      noCapture.current = null;
    } else if (hasMultiSelection()) {
      container.current.focus();
    } else if (getSelectedBlockClientId()) {
      lastFocus.current.focus();
    } else {
      setNavigationMode(true);
      const isBefore = // eslint-disable-next-line no-bitwise
      event.target.compareDocumentPosition(container.current) & event.target.DOCUMENT_POSITION_FOLLOWING;
      const action = isBefore ? 'findNext' : 'findPrevious';
      external_wp_dom_namespaceObject.focus.tabbable[action](event.target).focus();
    }
  }

  const before = (0,external_wp_element_namespaceObject.createElement)("div", {
    ref: focusCaptureBeforeRef,
    tabIndex: focusCaptureTabIndex,
    onFocus: onFocusCapture
  });
  const after = (0,external_wp_element_namespaceObject.createElement)("div", {
    ref: focusCaptureAfterRef,
    tabIndex: focusCaptureTabIndex,
    onFocus: onFocusCapture
  });
  const ref = (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    function onKeyDown(event) {
      if (event.defaultPrevented) {
        return;
      }

      if (event.keyCode === external_wp_keycodes_namespaceObject.ESCAPE && !hasMultiSelection()) {
        event.preventDefault();
        setNavigationMode(true);
        return;
      } // In Edit mode, Tab should focus the first tabbable element after
      // the content, which is normally the sidebar (with block controls)
      // and Shift+Tab should focus the first tabbable element before the
      // content, which is normally the block toolbar.
      // Arrow keys can be used, and Tab and arrow keys can be used in
      // Navigation mode (press Esc), to navigate through blocks.


      if (event.keyCode !== external_wp_keycodes_namespaceObject.TAB) {
        return;
      }

      const isShift = event.shiftKey;
      const direction = isShift ? 'findPrevious' : 'findNext';

      if (!hasMultiSelection() && !getSelectedBlockClientId()) {
        // Preserve the behaviour of entering navigation mode when
        // tabbing into the content without a block selection.
        // `onFocusCapture` already did this previously, but we need to
        // do it again here because after clearing block selection,
        // focus land on the writing flow container and pressing Tab
        // will no longer send focus through the focus capture element.
        if (event.target === node) setNavigationMode(true);
        return;
      } // Allow tabbing from the block wrapper to a form element,
      // and between form elements rendered in a block,
      // such as inside a placeholder. Form elements are generally
      // meant to be UI rather than part of the content. Ideally
      // these are not rendered in the content and perhaps in the
      // future they can be rendered in an iframe or shadow DOM.


      if (((0,external_wp_dom_namespaceObject.isFormElement)(event.target) || event.target.getAttribute('data-block') === getSelectedBlockClientId()) && (0,external_wp_dom_namespaceObject.isFormElement)(external_wp_dom_namespaceObject.focus.tabbable[direction](event.target))) {
        return;
      }

      const next = isShift ? focusCaptureBeforeRef : focusCaptureAfterRef; // Disable focus capturing on the focus capture element, so it
      // doesn't refocus this block and so it allows default behaviour
      // (moving focus to the next tabbable element).

      noCapture.current = true; // Focusing the focus capture element, which is located above and
      // below the editor, should not scroll the page all the way up or
      // down.

      next.current.focus({
        preventScroll: true
      });
    }

    function onFocusOut(event) {
      lastFocus.current = event.target;
      const {
        ownerDocument
      } = node; // If focus disappears due to there being no blocks, move focus to
      // the writing flow wrapper.

      if (!event.relatedTarget && ownerDocument.activeElement === ownerDocument.body && getBlockCount() === 0) {
        node.focus();
      }
    } // When tabbing back to an element in block list, this event handler prevents scrolling if the
    // focus capture divs (before/after) are outside of the viewport. (For example shift+tab back to a paragraph
    // when focus is on a sidebar element. This prevents the scrollable writing area from jumping either to the
    // top or bottom of the document.
    //
    // Note that it isn't possible to disable scrolling in the onFocus event. We need to intercept this
    // earlier in the keypress handler, and call focus( { preventScroll: true } ) instead.
    // https://developer.mozilla.org/en-US/docs/Web/API/HTMLOrForeignElement/focus#parameters


    function preventScrollOnTab(event) {
      var _event$target;

      if (event.keyCode !== external_wp_keycodes_namespaceObject.TAB) {
        return;
      }

      if (((_event$target = event.target) === null || _event$target === void 0 ? void 0 : _event$target.getAttribute('role')) === 'region') {
        return;
      }

      if (container.current === event.target) {
        return;
      }

      const isShift = event.shiftKey;
      const direction = isShift ? 'findPrevious' : 'findNext';
      const target = external_wp_dom_namespaceObject.focus.tabbable[direction](event.target); // Only do something when the next tabbable is a focus capture div (before/after)

      if (target === focusCaptureBeforeRef.current || target === focusCaptureAfterRef.current) {
        event.preventDefault();
        target.focus({
          preventScroll: true
        });
      }
    }

    const {
      ownerDocument
    } = node;
    const {
      defaultView
    } = ownerDocument;
    defaultView.addEventListener('keydown', preventScrollOnTab);
    node.addEventListener('keydown', onKeyDown);
    node.addEventListener('focusout', onFocusOut);
    return () => {
      defaultView.removeEventListener('keydown', preventScrollOnTab);
      node.removeEventListener('keydown', onKeyDown);
      node.removeEventListener('focusout', onFocusOut);
    };
  }, []);
  const mergedRefs = (0,external_wp_compose_namespaceObject.useMergeRefs)([container, ref]);
  return [before, mergedRefs, after];
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/writing-flow/use-arrow-nav.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */



/**
 * Returns true if the element should consider edge navigation upon a keyboard
 * event of the given directional key code, or false otherwise.
 *
 * @param {Element} element     HTML element to test.
 * @param {number}  keyCode     KeyboardEvent keyCode to test.
 * @param {boolean} hasModifier Whether a modifier is pressed.
 *
 * @return {boolean} Whether element should consider edge navigation.
 */

function isNavigationCandidate(element, keyCode, hasModifier) {
  const isVertical = keyCode === external_wp_keycodes_namespaceObject.UP || keyCode === external_wp_keycodes_namespaceObject.DOWN; // Currently, all elements support unmodified vertical navigation.

  if (isVertical && !hasModifier) {
    return true;
  } // Native inputs should not navigate horizontally.


  const {
    tagName
  } = element;
  return tagName !== 'INPUT' && tagName !== 'TEXTAREA';
}
/**
 * Returns the optimal tab target from the given focused element in the desired
 * direction. A preference is made toward text fields, falling back to the block
 * focus stop if no other candidates exist for the block.
 *
 * @param {Element} target           Currently focused text field.
 * @param {boolean} isReverse        True if considering as the first field.
 * @param {Element} containerElement Element containing all blocks.
 * @param {boolean} onlyVertical     Whether to only consider tabbable elements
 *                                   that are visually above or under the
 *                                   target.
 *
 * @return {?Element} Optimal tab target, if one exists.
 */

function getClosestTabbable(target, isReverse, containerElement, onlyVertical) {
  // Since the current focus target is not guaranteed to be a text field, find
  // all focusables. Tabbability is considered later.
  let focusableNodes = external_wp_dom_namespaceObject.focus.focusable.find(containerElement);

  if (isReverse) {
    focusableNodes = (0,external_lodash_namespaceObject.reverse)(focusableNodes);
  } // Consider as candidates those focusables after the current target. It's
  // assumed this can only be reached if the target is focusable (on its
  // keydown event), so no need to verify it exists in the set.


  focusableNodes = focusableNodes.slice(focusableNodes.indexOf(target) + 1);
  let targetRect;

  if (onlyVertical) {
    targetRect = target.getBoundingClientRect();
  }

  function isTabCandidate(node) {
    // Not a candidate if the node is not tabbable.
    if (!external_wp_dom_namespaceObject.focus.tabbable.isTabbableIndex(node)) {
      return false;
    } // Skip focusable elements such as links within content editable nodes.


    if (node.isContentEditable && node.contentEditable !== 'true') {
      return false;
    }

    if (onlyVertical) {
      const nodeRect = node.getBoundingClientRect();

      if (nodeRect.left >= targetRect.right || nodeRect.right <= targetRect.left) {
        return false;
      }
    }

    return true;
  }

  return (0,external_lodash_namespaceObject.find)(focusableNodes, isTabCandidate);
}
function useArrowNav() {
  const {
    getSelectedBlockClientId,
    getMultiSelectedBlocksEndClientId,
    getPreviousBlockClientId,
    getNextBlockClientId,
    getSettings,
    hasMultiSelection
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    // Here a DOMRect is stored while moving the caret vertically so
    // vertical position of the start position can be restored. This is to
    // recreate browser behaviour across blocks.
    let verticalRect;

    function onMouseDown() {
      verticalRect = null;
    }
    /**
     * Returns true if the given target field is the last in its block which
     * can be considered for tab transition. For example, in a block with
     * two text fields, this would return true when reversing from the first
     * of the two fields, but false when reversing from the second.
     *
     * @param {Element} target    Currently focused text field.
     * @param {boolean} isReverse True if considering as the first field.
     *
     * @return {boolean} Whether field is at edge for tab transition.
     */


    function isTabbableEdge(target, isReverse) {
      const closestTabbable = getClosestTabbable(target, isReverse, node);
      return !closestTabbable || !isInSameBlock(target, closestTabbable);
    }

    function onKeyDown(event) {
      const {
        keyCode,
        target
      } = event;
      const isUp = keyCode === external_wp_keycodes_namespaceObject.UP;
      const isDown = keyCode === external_wp_keycodes_namespaceObject.DOWN;
      const isLeft = keyCode === external_wp_keycodes_namespaceObject.LEFT;
      const isRight = keyCode === external_wp_keycodes_namespaceObject.RIGHT;
      const isReverse = isUp || isLeft;
      const isHorizontal = isLeft || isRight;
      const isVertical = isUp || isDown;
      const isNav = isHorizontal || isVertical;
      const isShift = event.shiftKey;
      const hasModifier = isShift || event.ctrlKey || event.altKey || event.metaKey;
      const isNavEdge = isVertical ? external_wp_dom_namespaceObject.isVerticalEdge : external_wp_dom_namespaceObject.isHorizontalEdge;
      const {
        ownerDocument
      } = node;
      const {
        defaultView
      } = ownerDocument;

      if (hasMultiSelection()) {
        return;
      } // When presing any key other than up or down, the initial vertical
      // position must ALWAYS be reset. The vertical position is saved so
      // it can be restored as well as possible on sebsequent vertical
      // arrow key presses. It may not always be possible to restore the
      // exact same position (such as at an empty line), so it wouldn't be
      // good to compute the position right before any vertical arrow key
      // press.


      if (!isVertical) {
        verticalRect = null;
      } else if (!verticalRect) {
        verticalRect = (0,external_wp_dom_namespaceObject.computeCaretRect)(defaultView);
      } // Abort if navigation has already been handled (e.g. RichText
      // inline boundaries).


      if (event.defaultPrevented) {
        return;
      }

      if (!isNav) {
        return;
      } // Abort if our current target is not a candidate for navigation
      // (e.g. preserve native input behaviors).


      if (!isNavigationCandidate(target, keyCode, hasModifier)) {
        return;
      } // In the case of RTL scripts, right means previous and left means
      // next, which is the exact reverse of LTR.


      const isReverseDir = (0,external_wp_dom_namespaceObject.isRTL)(target) ? !isReverse : isReverse;
      const {
        keepCaretInsideBlock
      } = getSettings();
      const selectedBlockClientId = getSelectedBlockClientId();

      if (isShift) {
        const selectionEndClientId = getMultiSelectedBlocksEndClientId();
        const selectionBeforeEndClientId = getPreviousBlockClientId(selectionEndClientId || selectedBlockClientId);
        const selectionAfterEndClientId = getNextBlockClientId(selectionEndClientId || selectedBlockClientId);

        if ( // Ensure that there is a target block.
        (isReverse && selectionBeforeEndClientId || !isReverse && selectionAfterEndClientId) && isTabbableEdge(target, isReverse) && isNavEdge(target, isReverse)) {
          node.contentEditable = true; // Firefox doesn't automatically move focus.

          node.focus();
        }
      } else if (isVertical && (0,external_wp_dom_namespaceObject.isVerticalEdge)(target, isReverse) && !keepCaretInsideBlock) {
        const closestTabbable = getClosestTabbable(target, isReverse, node, true);

        if (closestTabbable) {
          (0,external_wp_dom_namespaceObject.placeCaretAtVerticalEdge)(closestTabbable, isReverse, verticalRect);
          event.preventDefault();
        }
      } else if (isHorizontal && defaultView.getSelection().isCollapsed && (0,external_wp_dom_namespaceObject.isHorizontalEdge)(target, isReverseDir) && !keepCaretInsideBlock) {
        const closestTabbable = getClosestTabbable(target, isReverseDir, node);
        (0,external_wp_dom_namespaceObject.placeCaretAtHorizontalEdge)(closestTabbable, isReverse);
        event.preventDefault();
      }
    }

    node.addEventListener('mousedown', onMouseDown);
    node.addEventListener('keydown', onKeyDown);
    return () => {
      node.removeEventListener('mousedown', onMouseDown);
      node.removeEventListener('keydown', onKeyDown);
    };
  }, []);
}

;// CONCATENATED MODULE: external ["wp","keyboardShortcuts"]
var external_wp_keyboardShortcuts_namespaceObject = window["wp"]["keyboardShortcuts"];
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/writing-flow/use-select-all.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */


function useSelectAll() {
  const {
    getBlockOrder,
    getSelectedBlockClientIds,
    getBlockRootClientId
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const {
    multiSelect
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const isMatch = (0,external_wp_keyboardShortcuts_namespaceObject.__unstableUseShortcutEventMatch)();
  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    function onKeyDown(event) {
      if (!isMatch('core/block-editor/select-all', event)) {
        return;
      }

      const selectedClientIds = getSelectedBlockClientIds();

      if (selectedClientIds.length < 2 && !(0,external_wp_dom_namespaceObject.isEntirelySelected)(event.target)) {
        return;
      }

      const [firstSelectedClientId] = selectedClientIds;
      const rootClientId = getBlockRootClientId(firstSelectedClientId);
      let blockClientIds = getBlockOrder(rootClientId); // If we have selected all sibling nested blocks, try selecting up a
      // level. See: https://github.com/WordPress/gutenberg/pull/31859/

      if (selectedClientIds.length === blockClientIds.length) {
        blockClientIds = getBlockOrder(getBlockRootClientId(rootClientId));
      }

      const firstClientId = (0,external_lodash_namespaceObject.first)(blockClientIds);
      const lastClientId = (0,external_lodash_namespaceObject.last)(blockClientIds);

      if (firstClientId === lastClientId) {
        return;
      }

      multiSelect(firstClientId, lastClientId);
      event.preventDefault();
    }

    node.addEventListener('keydown', onKeyDown);
    return () => {
      node.removeEventListener('keydown', onKeyDown);
    };
  }, []);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/writing-flow/use-drag-selection.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


/**
 * Sets the `contenteditable` wrapper element to `value`.
 *
 * @param {HTMLElement} node  Block element.
 * @param {boolean}     value `contentEditable` value (true or false)
 */

function setContentEditableWrapper(node, value) {
  node.contentEditable = value; // Firefox doesn't automatically move focus.

  if (value) node.focus();
}
/**
 * Sets a multi-selection based on the native selection across blocks.
 */


function useDragSelection() {
  const {
    startMultiSelect,
    stopMultiSelect
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const {
    isSelectionEnabled,
    hasMultiSelection
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    const {
      ownerDocument
    } = node;
    const {
      defaultView
    } = ownerDocument;
    let anchorElement;
    let rafId;

    function onMouseUp() {
      stopMultiSelect(); // Equivalent to attaching the listener once.

      defaultView.removeEventListener('mouseup', onMouseUp); // The browser selection won't have updated yet at this point,
      // so wait until the next animation frame to get the browser
      // selection.

      rafId = defaultView.requestAnimationFrame(() => {
        if (hasMultiSelection()) {
          return;
        } // If the selection is complete (on mouse up), and no
        // multiple blocks have been selected, set focus back to the
        // anchor element. if the anchor element contains the
        // selection. Additionally, the contentEditable wrapper can
        // now be disabled again.


        setContentEditableWrapper(node, false);
        const selection = defaultView.getSelection();

        if (selection.rangeCount) {
          const {
            commonAncestorContainer
          } = selection.getRangeAt(0);

          if (anchorElement.contains(commonAncestorContainer)) {
            anchorElement.focus();
          }
        }
      });
    }

    function onMouseLeave(_ref) {
      let {
        buttons,
        target
      } = _ref;

      // The primary button must be pressed to initiate selection.
      // See https://developer.mozilla.org/en-US/docs/Web/API/MouseEvent/buttons
      if (buttons !== 1) {
        return;
      } // Check the attribute, not the contentEditable attribute. All
      // child elements of the content editable wrapper are editable
      // and return true for this property. We only want to start
      // multi selecting when the mouse leaves the wrapper.


      if (!target.getAttribute('contenteditable')) {
        return;
      }

      if (!isSelectionEnabled()) {
        return;
      }

      anchorElement = ownerDocument.activeElement;
      startMultiSelect(); // `onSelectionStart` is called after `mousedown` and
      // `mouseleave` (from a block). The selection ends when
      // `mouseup` happens anywhere in the window.

      defaultView.addEventListener('mouseup', onMouseUp); // Allow cross contentEditable selection by temporarily making
      // all content editable. We can't rely on using the store and
      // React because re-rending happens too slowly. We need to be
      // able to select across instances immediately.

      setContentEditableWrapper(node, true);
    }

    node.addEventListener('mouseout', onMouseLeave);
    return () => {
      node.removeEventListener('mouseout', onMouseLeave);
      defaultView.removeEventListener('mouseup', onMouseUp);
      defaultView.cancelAnimationFrame(rafId);
    };
  }, [startMultiSelect, stopMultiSelect, isSelectionEnabled, hasMultiSelection]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/writing-flow/use-selection-observer.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */



/**
 * Extract the selection start node from the selection. When the anchor node is
 * not a text node, the selection offset is the index of a child node.
 *
 * @param {Selection} selection The selection.
 *
 * @return {Element} The selection start node.
 */

function extractSelectionStartNode(selection) {
  const {
    anchorNode,
    anchorOffset
  } = selection;

  if (anchorNode.nodeType === anchorNode.TEXT_NODE) {
    return anchorNode;
  }

  return anchorNode.childNodes[anchorOffset];
}
/**
 * Extract the selection end node from the selection. When the focus node is not
 * a text node, the selection offset is the index of a child node. The selection
 * reaches up to but excluding that child node.
 *
 * @param {Selection} selection The selection.
 *
 * @return {Element} The selection start node.
 */


function extractSelectionEndNode(selection) {
  const {
    focusNode,
    focusOffset
  } = selection;

  if (focusNode.nodeType === focusNode.TEXT_NODE) {
    return focusNode;
  }

  return focusNode.childNodes[focusOffset - 1];
}

function findDepth(a, b) {
  let depth = 0;

  while (a[depth] === b[depth]) {
    depth++;
  }

  return depth;
}
/**
 * Sets the `contenteditable` wrapper element to `value`.
 *
 * @param {HTMLElement} node  Block element.
 * @param {boolean}     value `contentEditable` value (true or false)
 */


function use_selection_observer_setContentEditableWrapper(node, value) {
  node.contentEditable = value; // Firefox doesn't automatically move focus.

  if (value) node.focus();
}
/**
 * Sets a multi-selection based on the native selection across blocks.
 */


function useSelectionObserver() {
  const {
    multiSelect,
    selectBlock,
    selectionChange
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const {
    getBlockParents,
    getBlockSelectionStart
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    const {
      ownerDocument
    } = node;
    const {
      defaultView
    } = ownerDocument;

    function onSelectionChange(event) {
      const selection = defaultView.getSelection(); // If no selection is found, end multi selection and disable the
      // contentEditable wrapper.

      if (!selection.rangeCount) {
        use_selection_observer_setContentEditableWrapper(node, false);
        return;
      } // If selection is collapsed and we haven't used `shift+click`,
      // end multi selection and disable the contentEditable wrapper.
      // We have to check about `shift+click` case because elements
      // that don't support text selection might be involved, and we might
      // update the clientIds to multi-select blocks.
      // For now we check if the event is a `mouse` event.


      const isClickShift = event.shiftKey && event.type === 'mouseup';

      if (selection.isCollapsed && !isClickShift) {
        use_selection_observer_setContentEditableWrapper(node, false);
        return;
      }

      let startClientId = getBlockClientId(extractSelectionStartNode(selection));
      let endClientId = getBlockClientId(extractSelectionEndNode(selection)); // If the selection has changed and we had pressed `shift+click`,
      // we need to check if in an element that doesn't support
      // text selection has been clicked.

      if (isClickShift) {
        const selectedClientId = getBlockSelectionStart();
        const clickedClientId = getBlockClientId(event.target); // `endClientId` is not defined if we end the selection by clicking a non-selectable block.
        // We need to check if there was already a selection with a non-selectable focusNode.

        const focusNodeIsNonSelectable = clickedClientId !== endClientId;

        if (startClientId === endClientId && selection.isCollapsed || !endClientId || focusNodeIsNonSelectable) {
          endClientId = clickedClientId;
        } // Handle the case when we have a non-selectable block
        // selected and click another one.


        if (startClientId !== selectedClientId) {
          startClientId = selectedClientId;
        }
      } // If the selection did not involve a block, return.


      if (startClientId === undefined && endClientId === undefined) {
        use_selection_observer_setContentEditableWrapper(node, false);
        return;
      }

      const isSingularSelection = startClientId === endClientId;

      if (isSingularSelection) {
        selectBlock(startClientId);
      } else {
        const startPath = [...getBlockParents(startClientId), startClientId];
        const endPath = [...getBlockParents(endClientId), endClientId];
        const depth = findDepth(startPath, endPath);
        multiSelect(startPath[depth], endPath[depth]);
      }
    }

    function addListeners() {
      ownerDocument.addEventListener('selectionchange', onSelectionChange);
      defaultView.addEventListener('mouseup', onSelectionChange);
    }

    function removeListeners() {
      ownerDocument.removeEventListener('selectionchange', onSelectionChange);
      defaultView.removeEventListener('mouseup', onSelectionChange);
    }

    function resetListeners() {
      removeListeners();
      addListeners();
    }

    addListeners(); // We must allow rich text to set selection first. This ensures that
    // our `selectionchange` listener is always reset to be called after
    // the rich text one.

    node.addEventListener('focusin', resetListeners);
    return () => {
      removeListeners();
      node.removeEventListener('focusin', resetListeners);
    };
  }, [multiSelect, selectBlock, selectionChange, getBlockParents]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/writing-flow/use-click-selection.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */



function useClickSelection() {
  const {
    selectBlock
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const {
    isSelectionEnabled,
    getBlockSelectionStart,
    hasMultiSelection
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    function onMouseDown(event) {
      // The main button.
      // https://developer.mozilla.org/en-US/docs/Web/API/MouseEvent/button
      if (!isSelectionEnabled() || event.button !== 0) {
        return;
      }

      const startClientId = getBlockSelectionStart();
      const clickedClientId = getBlockClientId(event.target);

      if (event.shiftKey) {
        if (startClientId !== clickedClientId) {
          node.contentEditable = true; // Firefox doesn't automatically move focus.

          node.focus();
        }
      } else if (hasMultiSelection()) {
        // Allow user to escape out of a multi-selection to a
        // singular selection of a block via click. This is handled
        // here since focus handling excludes blocks when there is
        // multiselection, as focus can be incurred by starting a
        // multiselection (focus moved to first block's multi-
        // controls).
        selectBlock(clickedClientId);
      }
    }

    node.addEventListener('mousedown', onMouseDown);
    return () => {
      node.removeEventListener('mousedown', onMouseDown);
    };
  }, [selectBlock, isSelectionEnabled, getBlockSelectionStart, hasMultiSelection]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/writing-flow/use-input.js
/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */


/**
 * Handles input for selections across blocks.
 */

function useInput() {
  const {
    __unstableIsFullySelected,
    getSelectedBlockClientIds,
    __unstableIsSelectionMergeable,
    hasMultiSelection
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const {
    replaceBlocks,
    __unstableSplitSelection,
    removeBlocks,
    __unstableDeleteSelection,
    __unstableExpandSelection
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    function onKeyDown(event) {
      if (event.defaultPrevented) {
        return;
      }

      if (!hasMultiSelection()) {
        return;
      }

      if (event.keyCode === external_wp_keycodes_namespaceObject.ENTER) {
        node.contentEditable = false;
        event.preventDefault();

        if (__unstableIsFullySelected()) {
          replaceBlocks(getSelectedBlockClientIds(), (0,external_wp_blocks_namespaceObject.createBlock)((0,external_wp_blocks_namespaceObject.getDefaultBlockName)()));
        } else {
          __unstableSplitSelection();
        }
      } else if (event.keyCode === external_wp_keycodes_namespaceObject.BACKSPACE || event.keyCode === external_wp_keycodes_namespaceObject.DELETE) {
        node.contentEditable = false;
        event.preventDefault();

        if (__unstableIsFullySelected()) {
          removeBlocks(getSelectedBlockClientIds());
        } else if (__unstableIsSelectionMergeable()) {
          __unstableDeleteSelection(event.keyCode === external_wp_keycodes_namespaceObject.DELETE);
        } else {
          __unstableExpandSelection();
        }
      } else if ( // If key.length is longer than 1, it's a control key that doesn't
      // input anything.
      event.key.length === 1 && !(event.metaKey || event.ctrlKey)) {
        node.contentEditable = false;

        if (__unstableIsSelectionMergeable()) {
          __unstableDeleteSelection(event.keyCode === external_wp_keycodes_namespaceObject.DELETE);
        } else {
          event.preventDefault(); // Safari does not stop default behaviour with either
          // event.preventDefault() or node.contentEditable = false, so
          // remove the selection to stop browser manipulation.

          node.ownerDocument.defaultView.getSelection().removeAllRanges();
        }
      }
    }

    function onCompositionStart(event) {
      if (!hasMultiSelection()) {
        return;
      }

      node.contentEditable = false;

      if (__unstableIsSelectionMergeable()) {
        __unstableDeleteSelection();
      } else {
        event.preventDefault(); // Safari does not stop default behaviour with either
        // event.preventDefault() or node.contentEditable = false, so
        // remove the selection to stop browser manipulation.

        node.ownerDocument.defaultView.getSelection().removeAllRanges();
      }
    }

    node.addEventListener('keydown', onKeyDown);
    node.addEventListener('compositionstart', onCompositionStart);
    return () => {
      node.removeEventListener('keydown', onKeyDown);
      node.removeEventListener('compositionstart', onCompositionStart);
    };
  }, []);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/writing-flow/index.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */










function useWritingFlow() {
  const [before, ref, after] = useTabNav();
  const hasMultiSelection = (0,external_wp_data_namespaceObject.useSelect)(select => select(store).hasMultiSelection(), []);
  return [before, (0,external_wp_compose_namespaceObject.useMergeRefs)([ref, useInput(), useDragSelection(), useSelectionObserver(), useClickSelection(), useMultiSelection(), useSelectAll(), useArrowNav(), (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    node.tabIndex = -1;
    node.contentEditable = hasMultiSelection;

    if (!hasMultiSelection) {
      return;
    }

    node.setAttribute('aria-label', (0,external_wp_i18n_namespaceObject.__)('Multiple selected blocks'));
    return () => {
      node.removeAttribute('aria-label');
    };
  }, [hasMultiSelection])]), after];
}

function WritingFlow(_ref, forwardedRef) {
  let {
    children,
    ...props
  } = _ref;
  const [before, ref, after] = useWritingFlow();
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, before, (0,external_wp_element_namespaceObject.createElement)("div", _extends({}, props, {
    ref: (0,external_wp_compose_namespaceObject.useMergeRefs)([ref, forwardedRef]),
    className: classnames_default()(props.className, 'block-editor-writing-flow')
  }), children), after);
}
/**
 * Handles selection and navigation across blocks. This component should be
 * wrapped around BlockList.
 *
 * @param {Object}    props          Component properties.
 * @param {WPElement} props.children Children to be rendered.
 */


/* harmony default export */ var writing_flow = ((0,external_wp_element_namespaceObject.forwardRef)(WritingFlow));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/iframe/index.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */



const BODY_CLASS_NAME = 'editor-styles-wrapper';
const BLOCK_PREFIX = 'wp-block';
/**
 * Clones stylesheets targetting the editor canvas to the given document. A
 * stylesheet is considered targetting the editor a canvas if it contains the
 * `editor-styles-wrapper`, `wp-block`, or `wp-block-*` class selectors.
 *
 * Ideally, this hook should be removed in the future and styles should be added
 * explicitly as editor styles.
 */

function useStylesCompatibility() {
  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    // Search the document for stylesheets targetting the editor canvas.
    Array.from(document.styleSheets).forEach(styleSheet => {
      try {
        // May fail for external styles.
        // eslint-disable-next-line no-unused-expressions
        styleSheet.cssRules;
      } catch (e) {
        return;
      }

      const {
        ownerNode,
        cssRules
      } = styleSheet;

      if (!cssRules) {
        return;
      } // Generally, ignore inline styles. We add inline styles belonging to a
      // stylesheet later, which may or may not match the selectors.


      if (ownerNode.tagName !== 'LINK') {
        return;
      } // Don't try to add the reset styles, which were removed as a dependency
      // from `edit-blocks` for the iframe since we don't need to reset admin
      // styles.


      if (ownerNode.id === 'wp-reset-editor-styles-css') {
        return;
      }

      const isMatch = Array.from(cssRules).find(_ref => {
        let {
          selectorText
        } = _ref;
        return selectorText && (selectorText.includes(`.${BODY_CLASS_NAME}`) || selectorText.includes(`.${BLOCK_PREFIX}`));
      });

      if (isMatch && !node.ownerDocument.getElementById(ownerNode.id)) {
        // Display warning once we have a way to add style dependencies to the editor.
        // See: https://github.com/WordPress/gutenberg/pull/37466.
        node.appendChild(ownerNode.cloneNode(true)); // Add inline styles belonging to the stylesheet.

        const inlineCssId = ownerNode.id.replace('-css', '-inline-css');
        const inlineCssElement = document.getElementById(inlineCssId);

        if (inlineCssElement) {
          node.appendChild(inlineCssElement.cloneNode(true));
        }
      }
    });
  }, []);
}
/**
 * Bubbles some event types (keydown, keypress, and dragover) to parent document
 * document to ensure that the keyboard shortcuts and drag and drop work.
 *
 * Ideally, we should remove event bubbling in the future. Keyboard shortcuts
 * should be context dependent, e.g. actions on blocks like Cmd+A should not
 * work globally outside the block editor.
 *
 * @param {Document} doc Document to attach listeners to.
 */


function bubbleEvents(doc) {
  const {
    defaultView
  } = doc;
  const {
    frameElement
  } = defaultView;

  function bubbleEvent(event) {
    const prototype = Object.getPrototypeOf(event);
    const constructorName = prototype.constructor.name;
    const Constructor = window[constructorName];
    const init = {};

    for (const key in event) {
      init[key] = event[key];
    }

    if (event instanceof defaultView.MouseEvent) {
      const rect = frameElement.getBoundingClientRect();
      init.clientX += rect.left;
      init.clientY += rect.top;
    }

    const newEvent = new Constructor(event.type, init);
    const cancelled = !frameElement.dispatchEvent(newEvent);

    if (cancelled) {
      event.preventDefault();
    }
  }

  const eventTypes = ['dragover'];

  for (const name of eventTypes) {
    doc.addEventListener(name, bubbleEvent);
  }
}

function useParsedAssets(html) {
  return (0,external_wp_element_namespaceObject.useMemo)(() => {
    const doc = document.implementation.createHTMLDocument('');
    doc.body.innerHTML = html;
    return Array.from(doc.body.children);
  }, [html]);
}

async function loadScript(head, _ref2) {
  let {
    id,
    src
  } = _ref2;
  return new Promise((resolve, reject) => {
    const script = head.ownerDocument.createElement('script');
    script.id = id;

    if (src) {
      script.src = src;

      script.onload = () => resolve();

      script.onerror = () => reject();
    } else {
      resolve();
    }

    head.appendChild(script);
  });
}

function Iframe(_ref3, ref) {
  let {
    contentRef,
    children,
    head,
    tabIndex = 0,
    assets,
    ...props
  } = _ref3;
  const [, forceRender] = (0,external_wp_element_namespaceObject.useReducer)(() => ({}));
  const [iframeDocument, setIframeDocument] = (0,external_wp_element_namespaceObject.useState)();
  const [bodyClasses, setBodyClasses] = (0,external_wp_element_namespaceObject.useState)([]);
  const styles = useParsedAssets(assets === null || assets === void 0 ? void 0 : assets.styles);
  const scripts = useParsedAssets(assets === null || assets === void 0 ? void 0 : assets.scripts);
  const clearerRef = useBlockSelectionClearer();
  const [before, writingFlowRef, after] = useWritingFlow();
  const setRef = (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    function setDocumentIfReady() {
      const {
        contentDocument,
        ownerDocument
      } = node;
      const {
        readyState,
        documentElement
      } = contentDocument;

      if (readyState !== 'interactive' && readyState !== 'complete') {
        return false;
      }

      bubbleEvents(contentDocument);
      setIframeDocument(contentDocument);
      clearerRef(documentElement); // Ideally ALL classes that are added through get_body_class should
      // be added in the editor too, which we'll somehow have to get from
      // the server in the future (which will run the PHP filters).

      setBodyClasses(Array.from(ownerDocument.body.classList).filter(name => name.startsWith('admin-color-') || name.startsWith('post-type-') || name === 'wp-embed-responsive'));
      contentDocument.dir = ownerDocument.dir;
      documentElement.removeChild(contentDocument.head);
      documentElement.removeChild(contentDocument.body);
      return true;
    } // Document set with srcDoc is not immediately ready.


    node.addEventListener('load', setDocumentIfReady);
    return () => node.removeEventListener('load', setDocumentIfReady);
  }, []);
  const headRef = (0,external_wp_compose_namespaceObject.useRefEffect)(element => {
    scripts.reduce((promise, script) => promise.then(() => loadScript(element, script)), Promise.resolve()).finally(() => {
      // When script are loaded, re-render blocks to allow them
      // to initialise.
      forceRender();
    });
  }, []);
  const bodyRef = (0,external_wp_compose_namespaceObject.useMergeRefs)([contentRef, clearerRef, writingFlowRef]);
  const styleCompatibilityRef = useStylesCompatibility();
  head = (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)("style", null, 'body{margin:0}'), styles.map(_ref4 => {
    let {
      tagName,
      href,
      id,
      rel,
      media,
      textContent
    } = _ref4;
    const TagName = tagName.toLowerCase();

    if (TagName === 'style') {
      return (0,external_wp_element_namespaceObject.createElement)(TagName, {
        id,
        key: id
      }, textContent);
    }

    return (0,external_wp_element_namespaceObject.createElement)(TagName, {
      href,
      id,
      rel,
      media,
      key: id
    });
  }), head);
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, tabIndex >= 0 && before, (0,external_wp_element_namespaceObject.createElement)("iframe", _extends({}, props, {
    ref: (0,external_wp_compose_namespaceObject.useMergeRefs)([ref, setRef]),
    tabIndex: tabIndex // Correct doctype is required to enable rendering in standards mode
    ,
    srcDoc: "<!doctype html>",
    title: (0,external_wp_i18n_namespaceObject.__)('Editor canvas')
  }), iframeDocument && (0,external_wp_element_namespaceObject.createPortal)((0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)("head", {
    ref: headRef
  }, head), (0,external_wp_element_namespaceObject.createElement)("body", {
    ref: bodyRef,
    className: classnames_default()(BODY_CLASS_NAME, ...bodyClasses)
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    style: {
      display: 'none'
    },
    ref: styleCompatibilityRef
  }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalStyleProvider, {
    document: iframeDocument
  }, children))), iframeDocument.documentElement)), tabIndex >= 0 && after);
}

/* harmony default export */ var iframe = ((0,external_wp_element_namespaceObject.forwardRef)(Iframe));

;// CONCATENATED MODULE: ./node_modules/colord/index.mjs
var r={grad:.9,turn:360,rad:360/(2*Math.PI)},t=function(r){return"string"==typeof r?r.length>0:"number"==typeof r},n=function(r,t,n){return void 0===t&&(t=0),void 0===n&&(n=Math.pow(10,t)),Math.round(n*r)/n+0},e=function(r,t,n){return void 0===t&&(t=0),void 0===n&&(n=1),r>n?n:r>t?r:t},u=function(r){return(r=isFinite(r)?r%360:0)>0?r:r+360},a=function(r){return{r:e(r.r,0,255),g:e(r.g,0,255),b:e(r.b,0,255),a:e(r.a)}},o=function(r){return{r:n(r.r),g:n(r.g),b:n(r.b),a:n(r.a,3)}},i=/^#([0-9a-f]{3,8})$/i,s=function(r){var t=r.toString(16);return t.length<2?"0"+t:t},h=function(r){var t=r.r,n=r.g,e=r.b,u=r.a,a=Math.max(t,n,e),o=a-Math.min(t,n,e),i=o?a===t?(n-e)/o:a===n?2+(e-t)/o:4+(t-n)/o:0;return{h:60*(i<0?i+6:i),s:a?o/a*100:0,v:a/255*100,a:u}},b=function(r){var t=r.h,n=r.s,e=r.v,u=r.a;t=t/360*6,n/=100,e/=100;var a=Math.floor(t),o=e*(1-n),i=e*(1-(t-a)*n),s=e*(1-(1-t+a)*n),h=a%6;return{r:255*[e,i,o,o,s,e][h],g:255*[s,e,e,i,o,o][h],b:255*[o,o,s,e,e,i][h],a:u}},g=function(r){return{h:u(r.h),s:e(r.s,0,100),l:e(r.l,0,100),a:e(r.a)}},d=function(r){return{h:n(r.h),s:n(r.s),l:n(r.l),a:n(r.a,3)}},f=function(r){return b((n=(t=r).s,{h:t.h,s:(n*=((e=t.l)<50?e:100-e)/100)>0?2*n/(e+n)*100:0,v:e+n,a:t.a}));var t,n,e},c=function(r){return{h:(t=h(r)).h,s:(u=(200-(n=t.s))*(e=t.v)/100)>0&&u<200?n*e/100/(u<=100?u:200-u)*100:0,l:u/2,a:t.a};var t,n,e,u},l=/^hsla?\(\s*([+-]?\d*\.?\d+)(deg|rad|grad|turn)?\s*,\s*([+-]?\d*\.?\d+)%\s*,\s*([+-]?\d*\.?\d+)%\s*(?:,\s*([+-]?\d*\.?\d+)(%)?\s*)?\)$/i,p=/^hsla?\(\s*([+-]?\d*\.?\d+)(deg|rad|grad|turn)?\s+([+-]?\d*\.?\d+)%\s+([+-]?\d*\.?\d+)%\s*(?:\/\s*([+-]?\d*\.?\d+)(%)?\s*)?\)$/i,v=/^rgba?\(\s*([+-]?\d*\.?\d+)(%)?\s*,\s*([+-]?\d*\.?\d+)(%)?\s*,\s*([+-]?\d*\.?\d+)(%)?\s*(?:,\s*([+-]?\d*\.?\d+)(%)?\s*)?\)$/i,m=/^rgba?\(\s*([+-]?\d*\.?\d+)(%)?\s+([+-]?\d*\.?\d+)(%)?\s+([+-]?\d*\.?\d+)(%)?\s*(?:\/\s*([+-]?\d*\.?\d+)(%)?\s*)?\)$/i,y={string:[[function(r){var t=i.exec(r);return t?(r=t[1]).length<=4?{r:parseInt(r[0]+r[0],16),g:parseInt(r[1]+r[1],16),b:parseInt(r[2]+r[2],16),a:4===r.length?n(parseInt(r[3]+r[3],16)/255,2):1}:6===r.length||8===r.length?{r:parseInt(r.substr(0,2),16),g:parseInt(r.substr(2,2),16),b:parseInt(r.substr(4,2),16),a:8===r.length?n(parseInt(r.substr(6,2),16)/255,2):1}:null:null},"hex"],[function(r){var t=v.exec(r)||m.exec(r);return t?t[2]!==t[4]||t[4]!==t[6]?null:a({r:Number(t[1])/(t[2]?100/255:1),g:Number(t[3])/(t[4]?100/255:1),b:Number(t[5])/(t[6]?100/255:1),a:void 0===t[7]?1:Number(t[7])/(t[8]?100:1)}):null},"rgb"],[function(t){var n=l.exec(t)||p.exec(t);if(!n)return null;var e,u,a=g({h:(e=n[1],u=n[2],void 0===u&&(u="deg"),Number(e)*(r[u]||1)),s:Number(n[3]),l:Number(n[4]),a:void 0===n[5]?1:Number(n[5])/(n[6]?100:1)});return f(a)},"hsl"]],object:[[function(r){var n=r.r,e=r.g,u=r.b,o=r.a,i=void 0===o?1:o;return t(n)&&t(e)&&t(u)?a({r:Number(n),g:Number(e),b:Number(u),a:Number(i)}):null},"rgb"],[function(r){var n=r.h,e=r.s,u=r.l,a=r.a,o=void 0===a?1:a;if(!t(n)||!t(e)||!t(u))return null;var i=g({h:Number(n),s:Number(e),l:Number(u),a:Number(o)});return f(i)},"hsl"],[function(r){var n=r.h,a=r.s,o=r.v,i=r.a,s=void 0===i?1:i;if(!t(n)||!t(a)||!t(o))return null;var h=function(r){return{h:u(r.h),s:e(r.s,0,100),v:e(r.v,0,100),a:e(r.a)}}({h:Number(n),s:Number(a),v:Number(o),a:Number(s)});return b(h)},"hsv"]]},N=function(r,t){for(var n=0;n<t.length;n++){var e=t[n][0](r);if(e)return[e,t[n][1]]}return[null,void 0]},x=function(r){return"string"==typeof r?N(r.trim(),y.string):"object"==typeof r&&null!==r?N(r,y.object):[null,void 0]},I=function(r){return x(r)[1]},M=function(r,t){var n=c(r);return{h:n.h,s:e(n.s+100*t,0,100),l:n.l,a:n.a}},H=function(r){return(299*r.r+587*r.g+114*r.b)/1e3/255},$=function(r,t){var n=c(r);return{h:n.h,s:n.s,l:e(n.l+100*t,0,100),a:n.a}},j=function(){function r(r){this.parsed=x(r)[0],this.rgba=this.parsed||{r:0,g:0,b:0,a:1}}return r.prototype.isValid=function(){return null!==this.parsed},r.prototype.brightness=function(){return n(H(this.rgba),2)},r.prototype.isDark=function(){return H(this.rgba)<.5},r.prototype.isLight=function(){return H(this.rgba)>=.5},r.prototype.toHex=function(){return r=o(this.rgba),t=r.r,e=r.g,u=r.b,i=(a=r.a)<1?s(n(255*a)):"","#"+s(t)+s(e)+s(u)+i;var r,t,e,u,a,i},r.prototype.toRgb=function(){return o(this.rgba)},r.prototype.toRgbString=function(){return r=o(this.rgba),t=r.r,n=r.g,e=r.b,(u=r.a)<1?"rgba("+t+", "+n+", "+e+", "+u+")":"rgb("+t+", "+n+", "+e+")";var r,t,n,e,u},r.prototype.toHsl=function(){return d(c(this.rgba))},r.prototype.toHslString=function(){return r=d(c(this.rgba)),t=r.h,n=r.s,e=r.l,(u=r.a)<1?"hsla("+t+", "+n+"%, "+e+"%, "+u+")":"hsl("+t+", "+n+"%, "+e+"%)";var r,t,n,e,u},r.prototype.toHsv=function(){return r=h(this.rgba),{h:n(r.h),s:n(r.s),v:n(r.v),a:n(r.a,3)};var r},r.prototype.invert=function(){return w({r:255-(r=this.rgba).r,g:255-r.g,b:255-r.b,a:r.a});var r},r.prototype.saturate=function(r){return void 0===r&&(r=.1),w(M(this.rgba,r))},r.prototype.desaturate=function(r){return void 0===r&&(r=.1),w(M(this.rgba,-r))},r.prototype.grayscale=function(){return w(M(this.rgba,-1))},r.prototype.lighten=function(r){return void 0===r&&(r=.1),w($(this.rgba,r))},r.prototype.darken=function(r){return void 0===r&&(r=.1),w($(this.rgba,-r))},r.prototype.rotate=function(r){return void 0===r&&(r=15),this.hue(this.hue()+r)},r.prototype.alpha=function(r){return"number"==typeof r?w({r:(t=this.rgba).r,g:t.g,b:t.b,a:r}):n(this.rgba.a,3);var t},r.prototype.hue=function(r){var t=c(this.rgba);return"number"==typeof r?w({h:r,s:t.s,l:t.l,a:t.a}):n(t.h)},r.prototype.isEqual=function(r){return this.toHex()===w(r).toHex()},r}(),w=function(r){return r instanceof j?r:new j(r)},S=[],k=function(r){r.forEach(function(r){S.indexOf(r)<0&&(r(j,y),S.push(r))})},E=function(){return new j({r:255*Math.random(),g:255*Math.random(),b:255*Math.random()})};

;// CONCATENATED MODULE: ./node_modules/colord/plugins/names.mjs
/* harmony default export */ function names(e,f){var a={white:"#ffffff",bisque:"#ffe4c4",blue:"#0000ff",cadetblue:"#5f9ea0",chartreuse:"#7fff00",chocolate:"#d2691e",coral:"#ff7f50",antiquewhite:"#faebd7",aqua:"#00ffff",azure:"#f0ffff",whitesmoke:"#f5f5f5",papayawhip:"#ffefd5",plum:"#dda0dd",blanchedalmond:"#ffebcd",black:"#000000",gold:"#ffd700",goldenrod:"#daa520",gainsboro:"#dcdcdc",cornsilk:"#fff8dc",cornflowerblue:"#6495ed",burlywood:"#deb887",aquamarine:"#7fffd4",beige:"#f5f5dc",crimson:"#dc143c",cyan:"#00ffff",darkblue:"#00008b",darkcyan:"#008b8b",darkgoldenrod:"#b8860b",darkkhaki:"#bdb76b",darkgray:"#a9a9a9",darkgreen:"#006400",darkgrey:"#a9a9a9",peachpuff:"#ffdab9",darkmagenta:"#8b008b",darkred:"#8b0000",darkorchid:"#9932cc",darkorange:"#ff8c00",darkslateblue:"#483d8b",gray:"#808080",darkslategray:"#2f4f4f",darkslategrey:"#2f4f4f",deeppink:"#ff1493",deepskyblue:"#00bfff",wheat:"#f5deb3",firebrick:"#b22222",floralwhite:"#fffaf0",ghostwhite:"#f8f8ff",darkviolet:"#9400d3",magenta:"#ff00ff",green:"#008000",dodgerblue:"#1e90ff",grey:"#808080",honeydew:"#f0fff0",hotpink:"#ff69b4",blueviolet:"#8a2be2",forestgreen:"#228b22",lawngreen:"#7cfc00",indianred:"#cd5c5c",indigo:"#4b0082",fuchsia:"#ff00ff",brown:"#a52a2a",maroon:"#800000",mediumblue:"#0000cd",lightcoral:"#f08080",darkturquoise:"#00ced1",lightcyan:"#e0ffff",ivory:"#fffff0",lightyellow:"#ffffe0",lightsalmon:"#ffa07a",lightseagreen:"#20b2aa",linen:"#faf0e6",mediumaquamarine:"#66cdaa",lemonchiffon:"#fffacd",lime:"#00ff00",khaki:"#f0e68c",mediumseagreen:"#3cb371",limegreen:"#32cd32",mediumspringgreen:"#00fa9a",lightskyblue:"#87cefa",lightblue:"#add8e6",midnightblue:"#191970",lightpink:"#ffb6c1",mistyrose:"#ffe4e1",moccasin:"#ffe4b5",mintcream:"#f5fffa",lightslategray:"#778899",lightslategrey:"#778899",navajowhite:"#ffdead",navy:"#000080",mediumvioletred:"#c71585",powderblue:"#b0e0e6",palegoldenrod:"#eee8aa",oldlace:"#fdf5e6",paleturquoise:"#afeeee",mediumturquoise:"#48d1cc",mediumorchid:"#ba55d3",rebeccapurple:"#663399",lightsteelblue:"#b0c4de",mediumslateblue:"#7b68ee",thistle:"#d8bfd8",tan:"#d2b48c",orchid:"#da70d6",mediumpurple:"#9370db",purple:"#800080",pink:"#ffc0cb",skyblue:"#87ceeb",springgreen:"#00ff7f",palegreen:"#98fb98",red:"#ff0000",yellow:"#ffff00",slateblue:"#6a5acd",lavenderblush:"#fff0f5",peru:"#cd853f",palevioletred:"#db7093",violet:"#ee82ee",teal:"#008080",slategray:"#708090",slategrey:"#708090",aliceblue:"#f0f8ff",darkseagreen:"#8fbc8f",darkolivegreen:"#556b2f",greenyellow:"#adff2f",seagreen:"#2e8b57",seashell:"#fff5ee",tomato:"#ff6347",silver:"#c0c0c0",sienna:"#a0522d",lavender:"#e6e6fa",lightgreen:"#90ee90",orange:"#ffa500",orangered:"#ff4500",steelblue:"#4682b4",royalblue:"#4169e1",turquoise:"#40e0d0",yellowgreen:"#9acd32",salmon:"#fa8072",saddlebrown:"#8b4513",sandybrown:"#f4a460",rosybrown:"#bc8f8f",darksalmon:"#e9967a",lightgoldenrodyellow:"#fafad2",snow:"#fffafa",lightgrey:"#d3d3d3",lightgray:"#d3d3d3",dimgray:"#696969",dimgrey:"#696969",olivedrab:"#6b8e23",olive:"#808000"},r={};for(var d in a)r[a[d]]=d;var l={};e.prototype.toName=function(f){if(!(this.rgba.a||this.rgba.r||this.rgba.g||this.rgba.b))return"transparent";var d,i,n=r[this.toHex()];if(n)return n;if(null==f?void 0:f.closest){var o=this.toRgb(),t=1/0,b="black";if(!l.length)for(var c in a)l[c]=new e(a[c]).toRgb();for(var g in a){var u=(d=o,i=l[g],Math.pow(d.r-i.r,2)+Math.pow(d.g-i.g,2)+Math.pow(d.b-i.b,2));u<t&&(t=u,b=g)}return b}};f.string.push([function(f){var r=f.toLowerCase(),d="transparent"===r?"#0000":a[r];return d?new e(d).toRgb():null},"name"])}

;// CONCATENATED MODULE: ./node_modules/colord/plugins/a11y.mjs
var a11y_o=function(o){var t=o/255;return t<.04045?t/12.92:Math.pow((t+.055)/1.055,2.4)},a11y_t=function(t){return.2126*a11y_o(t.r)+.7152*a11y_o(t.g)+.0722*a11y_o(t.b)};/* harmony default export */ function a11y(o){o.prototype.luminance=function(){return o=a11y_t(this.rgba),void 0===(r=2)&&(r=0),void 0===n&&(n=Math.pow(10,r)),Math.round(n*o)/n+0;var o,r,n},o.prototype.contrast=function(r){void 0===r&&(r="#FFF");var n,a,i,e,v,u,d,c=r instanceof o?r:new o(r);return e=this.rgba,v=c.toRgb(),u=a11y_t(e),d=a11y_t(v),n=u>d?(u+.05)/(d+.05):(d+.05)/(u+.05),void 0===(a=2)&&(a=0),void 0===i&&(i=Math.pow(10,a)),Math.floor(i*n)/i+0},o.prototype.isReadable=function(o,t){return void 0===o&&(o="#FFF"),void 0===t&&(t={}),this.contrast(o)>=(e=void 0===(i=(r=t).size)?"normal":i,"AAA"===(a=void 0===(n=r.level)?"AA":n)&&"normal"===e?7:"AA"===a&&"large"===e?3:4.5);var r,n,a,i,e}}

// EXTERNAL MODULE: ./node_modules/traverse/index.js
var traverse = __webpack_require__(3124);
var traverse_default = /*#__PURE__*/__webpack_require__.n(traverse);
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/utils/transform-styles/ast/parse.js
/* eslint-disable @wordpress/no-unused-vars-before-return */
// Adapted from https://github.com/reworkcss/css
// because we needed to remove source map support.
// http://www.w3.org/TR/CSS21/grammar.htm
// https://github.com/visionmedia/css-parse/pull/49#issuecomment-30088027
const commentre = /\/\*[^*]*\*+([^/*][^*]*\*+)*\//g;
/* harmony default export */ function parse(css, options) {
  options = options || {};
  /**
   * Positional.
   */

  let lineno = 1;
  let column = 1;
  /**
   * Update lineno and column based on `str`.
   */

  function updatePosition(str) {
    const lines = str.match(/\n/g);

    if (lines) {
      lineno += lines.length;
    }

    const i = str.lastIndexOf('\n'); // eslint-disable-next-line no-bitwise

    column = ~i ? str.length - i : column + str.length;
  }
  /**
   * Mark position and patch `node.position`.
   */


  function position() {
    const start = {
      line: lineno,
      column
    };
    return function (node) {
      node.position = new Position(start);
      whitespace();
      return node;
    };
  }
  /**
   * Store position information for a node
   */


  function Position(start) {
    this.start = start;
    this.end = {
      line: lineno,
      column
    };
    this.source = options.source;
  }
  /**
   * Non-enumerable source string
   */


  Position.prototype.content = css;
  /**
   * Error `msg`.
   */

  const errorsList = [];

  function error(msg) {
    const err = new Error(options.source + ':' + lineno + ':' + column + ': ' + msg);
    err.reason = msg;
    err.filename = options.source;
    err.line = lineno;
    err.column = column;
    err.source = css;

    if (options.silent) {
      errorsList.push(err);
    } else {
      throw err;
    }
  }
  /**
   * Parse stylesheet.
   */


  function stylesheet() {
    const rulesList = rules();
    return {
      type: 'stylesheet',
      stylesheet: {
        source: options.source,
        rules: rulesList,
        parsingErrors: errorsList
      }
    };
  }
  /**
   * Opening brace.
   */


  function open() {
    return match(/^{\s*/);
  }
  /**
   * Closing brace.
   */


  function close() {
    return match(/^}/);
  }
  /**
   * Parse ruleset.
   */


  function rules() {
    let node;
    const accumulator = [];
    whitespace();
    comments(accumulator);

    while (css.length && css.charAt(0) !== '}' && (node = atrule() || rule())) {
      if (node !== false) {
        accumulator.push(node);
        comments(accumulator);
      }
    }

    return accumulator;
  }
  /**
   * Match `re` and return captures.
   */


  function match(re) {
    const m = re.exec(css);

    if (!m) {
      return;
    }

    const str = m[0];
    updatePosition(str);
    css = css.slice(str.length);
    return m;
  }
  /**
   * Parse whitespace.
   */


  function whitespace() {
    match(/^\s*/);
  }
  /**
   * Parse comments;
   */


  function comments(accumulator) {
    let c;
    accumulator = accumulator || []; // eslint-disable-next-line no-cond-assign

    while (c = comment()) {
      if (c !== false) {
        accumulator.push(c);
      }
    }

    return accumulator;
  }
  /**
   * Parse comment.
   */


  function comment() {
    const pos = position();

    if ('/' !== css.charAt(0) || '*' !== css.charAt(1)) {
      return;
    }

    let i = 2;

    while ('' !== css.charAt(i) && ('*' !== css.charAt(i) || '/' !== css.charAt(i + 1))) {
      ++i;
    }

    i += 2;

    if ('' === css.charAt(i - 1)) {
      return error('End of comment missing');
    }

    const str = css.slice(2, i - 2);
    column += 2;
    updatePosition(str);
    css = css.slice(i);
    column += 2;
    return pos({
      type: 'comment',
      comment: str
    });
  }
  /**
   * Parse selector.
   */


  function selector() {
    const m = match(/^([^{]+)/);

    if (!m) {
      return;
    } // FIXME: Remove all comments from selectors http://ostermiller.org/findcomment.html


    return trim(m[0]).replace(/\/\*([^*]|[\r\n]|(\*+([^*/]|[\r\n])))*\*\/+/g, '').replace(/"(?:\\"|[^"])*"|'(?:\\'|[^'])*'/g, function (matched) {
      return matched.replace(/,/g, '\u200C');
    }).split(/\s*(?![^(]*\)),\s*/).map(function (s) {
      return s.replace(/\u200C/g, ',');
    });
  }
  /**
   * Parse declaration.
   */


  function declaration() {
    const pos = position(); // prop.

    let prop = match(/^(\*?[-#\/\*\\\w]+(\[[0-9a-z_-]+\])?)\s*/);

    if (!prop) {
      return;
    }

    prop = trim(prop[0]); // :

    if (!match(/^:\s*/)) {
      return error("property missing ':'");
    } // val.


    const val = match(/^((?:'(?:\\'|.)*?'|"(?:\\"|.)*?"|\([^\)]*?\)|[^};])+)/);
    const ret = pos({
      type: 'declaration',
      property: prop.replace(commentre, ''),
      value: val ? trim(val[0]).replace(commentre, '') : ''
    }); // ;

    match(/^[;\s]*/);
    return ret;
  }
  /**
   * Parse declarations.
   */


  function declarations() {
    const decls = [];

    if (!open()) {
      return error("missing '{'");
    }

    comments(decls); // declarations.

    let decl; // eslint-disable-next-line no-cond-assign

    while (decl = declaration()) {
      if (decl !== false) {
        decls.push(decl);
        comments(decls);
      }
    }

    if (!close()) {
      return error("missing '}'");
    }

    return decls;
  }
  /**
   * Parse keyframe.
   */


  function keyframe() {
    let m;
    const vals = [];
    const pos = position(); // eslint-disable-next-line no-cond-assign

    while (m = match(/^((\d+\.\d+|\.\d+|\d+)%?|[a-z]+)\s*/)) {
      vals.push(m[1]);
      match(/^,\s*/);
    }

    if (!vals.length) {
      return;
    }

    return pos({
      type: 'keyframe',
      values: vals,
      declarations: declarations()
    });
  }
  /**
   * Parse keyframes.
   */


  function atkeyframes() {
    const pos = position();
    let m = match(/^@([-\w]+)?keyframes\s*/);

    if (!m) {
      return;
    }

    const vendor = m[1]; // identifier

    m = match(/^([-\w]+)\s*/);

    if (!m) {
      return error('@keyframes missing name');
    }

    const name = m[1];

    if (!open()) {
      return error("@keyframes missing '{'");
    }

    let frame;
    let frames = comments(); // eslint-disable-next-line no-cond-assign

    while (frame = keyframe()) {
      frames.push(frame);
      frames = frames.concat(comments());
    }

    if (!close()) {
      return error("@keyframes missing '}'");
    }

    return pos({
      type: 'keyframes',
      name,
      vendor,
      keyframes: frames
    });
  }
  /**
   * Parse supports.
   */


  function atsupports() {
    const pos = position();
    const m = match(/^@supports *([^{]+)/);

    if (!m) {
      return;
    }

    const supports = trim(m[1]);

    if (!open()) {
      return error("@supports missing '{'");
    }

    const style = comments().concat(rules());

    if (!close()) {
      return error("@supports missing '}'");
    }

    return pos({
      type: 'supports',
      supports,
      rules: style
    });
  }
  /**
   * Parse host.
   */


  function athost() {
    const pos = position();
    const m = match(/^@host\s*/);

    if (!m) {
      return;
    }

    if (!open()) {
      return error("@host missing '{'");
    }

    const style = comments().concat(rules());

    if (!close()) {
      return error("@host missing '}'");
    }

    return pos({
      type: 'host',
      rules: style
    });
  }
  /**
   * Parse media.
   */


  function atmedia() {
    const pos = position();
    const m = match(/^@media *([^{]+)/);

    if (!m) {
      return;
    }

    const media = trim(m[1]);

    if (!open()) {
      return error("@media missing '{'");
    }

    const style = comments().concat(rules());

    if (!close()) {
      return error("@media missing '}'");
    }

    return pos({
      type: 'media',
      media,
      rules: style
    });
  }
  /**
   * Parse custom-media.
   */


  function atcustommedia() {
    const pos = position();
    const m = match(/^@custom-media\s+(--[^\s]+)\s*([^{;]+);/);

    if (!m) {
      return;
    }

    return pos({
      type: 'custom-media',
      name: trim(m[1]),
      media: trim(m[2])
    });
  }
  /**
   * Parse paged media.
   */


  function atpage() {
    const pos = position();
    const m = match(/^@page */);

    if (!m) {
      return;
    }

    const sel = selector() || [];

    if (!open()) {
      return error("@page missing '{'");
    }

    let decls = comments(); // declarations.

    let decl; // eslint-disable-next-line no-cond-assign

    while (decl = declaration()) {
      decls.push(decl);
      decls = decls.concat(comments());
    }

    if (!close()) {
      return error("@page missing '}'");
    }

    return pos({
      type: 'page',
      selectors: sel,
      declarations: decls
    });
  }
  /**
   * Parse document.
   */


  function atdocument() {
    const pos = position();
    const m = match(/^@([-\w]+)?document *([^{]+)/);

    if (!m) {
      return;
    }

    const vendor = trim(m[1]);
    const doc = trim(m[2]);

    if (!open()) {
      return error("@document missing '{'");
    }

    const style = comments().concat(rules());

    if (!close()) {
      return error("@document missing '}'");
    }

    return pos({
      type: 'document',
      document: doc,
      vendor,
      rules: style
    });
  }
  /**
   * Parse font-face.
   */


  function atfontface() {
    const pos = position();
    const m = match(/^@font-face\s*/);

    if (!m) {
      return;
    }

    if (!open()) {
      return error("@font-face missing '{'");
    }

    let decls = comments(); // declarations.

    let decl; // eslint-disable-next-line no-cond-assign

    while (decl = declaration()) {
      decls.push(decl);
      decls = decls.concat(comments());
    }

    if (!close()) {
      return error("@font-face missing '}'");
    }

    return pos({
      type: 'font-face',
      declarations: decls
    });
  }
  /**
   * Parse import
   */


  const atimport = _compileAtrule('import');
  /**
   * Parse charset
   */


  const atcharset = _compileAtrule('charset');
  /**
   * Parse namespace
   */


  const atnamespace = _compileAtrule('namespace');
  /**
   * Parse non-block at-rules
   */


  function _compileAtrule(name) {
    const re = new RegExp('^@' + name + '\\s*([^;]+);');
    return function () {
      const pos = position();
      const m = match(re);

      if (!m) {
        return;
      }

      const ret = {
        type: name
      };
      ret[name] = m[1].trim();
      return pos(ret);
    };
  }
  /**
   * Parse at rule.
   */


  function atrule() {
    if (css[0] !== '@') {
      return;
    }

    return atkeyframes() || atmedia() || atcustommedia() || atsupports() || atimport() || atcharset() || atnamespace() || atdocument() || atpage() || athost() || atfontface();
  }
  /**
   * Parse rule.
   */


  function rule() {
    const pos = position();
    const sel = selector();

    if (!sel) {
      return error('selector missing');
    }

    comments();
    return pos({
      type: 'rule',
      selectors: sel,
      declarations: declarations()
    });
  }

  return addParent(stylesheet());
}
/**
 * Trim `str`.
 */

function trim(str) {
  return str ? str.replace(/^\s+|\s+$/g, '') : '';
}
/**
 * Adds non-enumerable parent node reference to each node.
 */


function addParent(obj, parent) {
  const isNode = obj && typeof obj.type === 'string';
  const childParent = isNode ? obj : parent;

  for (const k in obj) {
    const value = obj[k];

    if (Array.isArray(value)) {
      value.forEach(function (v) {
        addParent(v, childParent);
      });
    } else if (value && typeof value === 'object') {
      addParent(value, childParent);
    }
  }

  if (isNode) {
    Object.defineProperty(obj, 'parent', {
      configurable: true,
      writable: true,
      enumerable: false,
      value: parent || null
    });
  }

  return obj;
}
/* eslint-enable @wordpress/no-unused-vars-before-return */

// EXTERNAL MODULE: ./node_modules/inherits/inherits_browser.js
var inherits_browser = __webpack_require__(8575);
var inherits_browser_default = /*#__PURE__*/__webpack_require__.n(inherits_browser);
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/utils/transform-styles/ast/stringify/compiler.js
// Adapted from https://github.com/reworkcss/css
// because we needed to remove source map support.

/**
 * Expose `Compiler`.
 */
/* harmony default export */ var compiler = (Compiler);
/**
 * Initialize a compiler.
 */

function Compiler(opts) {
  this.options = opts || {};
}
/**
 * Emit `str`
 */


Compiler.prototype.emit = function (str) {
  return str;
};
/**
 * Visit `node`.
 */


Compiler.prototype.visit = function (node) {
  return this[node.type](node);
};
/**
 * Map visit over array of `nodes`, optionally using a `delim`
 */


Compiler.prototype.mapVisit = function (nodes, delim) {
  let buf = '';
  delim = delim || '';

  for (let i = 0, length = nodes.length; i < length; i++) {
    buf += this.visit(nodes[i]);

    if (delim && i < length - 1) {
      buf += this.emit(delim);
    }
  }

  return buf;
};

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/utils/transform-styles/ast/stringify/compress.js
// Adapted from https://github.com/reworkcss/css
// because we needed to remove source map support.

/**
 * External dependencies
 */

/**
 * Internal dependencies
 */


/**
 * Expose compiler.
 */

/* harmony default export */ var compress = (compress_Compiler);
/**
 * Initialize a new `Compiler`.
 */

function compress_Compiler(options) {
  compiler.call(this, options);
}
/**
 * Inherit from `Base.prototype`.
 */


inherits_browser_default()(compress_Compiler, compiler);
/**
 * Compile `node`.
 */

compress_Compiler.prototype.compile = function (node) {
  return node.stylesheet.rules.map(this.visit, this).join('');
};
/**
 * Visit comment node.
 */


compress_Compiler.prototype.comment = function (node) {
  return this.emit('', node.position);
};
/**
 * Visit import node.
 */


compress_Compiler.prototype.import = function (node) {
  return this.emit('@import ' + node.import + ';', node.position);
};
/**
 * Visit media node.
 */


compress_Compiler.prototype.media = function (node) {
  return this.emit('@media ' + node.media, node.position) + this.emit('{') + this.mapVisit(node.rules) + this.emit('}');
};
/**
 * Visit document node.
 */


compress_Compiler.prototype.document = function (node) {
  const doc = '@' + (node.vendor || '') + 'document ' + node.document;
  return this.emit(doc, node.position) + this.emit('{') + this.mapVisit(node.rules) + this.emit('}');
};
/**
 * Visit charset node.
 */


compress_Compiler.prototype.charset = function (node) {
  return this.emit('@charset ' + node.charset + ';', node.position);
};
/**
 * Visit namespace node.
 */


compress_Compiler.prototype.namespace = function (node) {
  return this.emit('@namespace ' + node.namespace + ';', node.position);
};
/**
 * Visit supports node.
 */


compress_Compiler.prototype.supports = function (node) {
  return this.emit('@supports ' + node.supports, node.position) + this.emit('{') + this.mapVisit(node.rules) + this.emit('}');
};
/**
 * Visit keyframes node.
 */


compress_Compiler.prototype.keyframes = function (node) {
  return this.emit('@' + (node.vendor || '') + 'keyframes ' + node.name, node.position) + this.emit('{') + this.mapVisit(node.keyframes) + this.emit('}');
};
/**
 * Visit keyframe node.
 */


compress_Compiler.prototype.keyframe = function (node) {
  const decls = node.declarations;
  return this.emit(node.values.join(','), node.position) + this.emit('{') + this.mapVisit(decls) + this.emit('}');
};
/**
 * Visit page node.
 */


compress_Compiler.prototype.page = function (node) {
  const sel = node.selectors.length ? node.selectors.join(', ') : '';
  return this.emit('@page ' + sel, node.position) + this.emit('{') + this.mapVisit(node.declarations) + this.emit('}');
};
/**
 * Visit font-face node.
 */


compress_Compiler.prototype['font-face'] = function (node) {
  return this.emit('@font-face', node.position) + this.emit('{') + this.mapVisit(node.declarations) + this.emit('}');
};
/**
 * Visit host node.
 */


compress_Compiler.prototype.host = function (node) {
  return this.emit('@host', node.position) + this.emit('{') + this.mapVisit(node.rules) + this.emit('}');
};
/**
 * Visit custom-media node.
 */


compress_Compiler.prototype['custom-media'] = function (node) {
  return this.emit('@custom-media ' + node.name + ' ' + node.media + ';', node.position);
};
/**
 * Visit rule node.
 */


compress_Compiler.prototype.rule = function (node) {
  const decls = node.declarations;

  if (!decls.length) {
    return '';
  }

  return this.emit(node.selectors.join(','), node.position) + this.emit('{') + this.mapVisit(decls) + this.emit('}');
};
/**
 * Visit declaration node.
 */


compress_Compiler.prototype.declaration = function (node) {
  return this.emit(node.property + ':' + node.value, node.position) + this.emit(';');
};

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/utils/transform-styles/ast/stringify/identity.js
/* eslint-disable @wordpress/no-unused-vars-before-return */
// Adapted from https://github.com/reworkcss/css
// because we needed to remove source map support.

/**
 * External dependencies
 */

/**
 * Internal dependencies
 */


/**
 * Expose compiler.
 */

/* harmony default export */ var identity = (identity_Compiler);
/**
 * Initialize a new `Compiler`.
 */

function identity_Compiler(options) {
  options = options || {};
  compiler.call(this, options);
  this.indentation = options.indent;
}
/**
 * Inherit from `Base.prototype`.
 */


inherits_browser_default()(identity_Compiler, compiler);
/**
 * Compile `node`.
 */

identity_Compiler.prototype.compile = function (node) {
  return this.stylesheet(node);
};
/**
 * Visit stylesheet node.
 */


identity_Compiler.prototype.stylesheet = function (node) {
  return this.mapVisit(node.stylesheet.rules, '\n\n');
};
/**
 * Visit comment node.
 */


identity_Compiler.prototype.comment = function (node) {
  return this.emit(this.indent() + '/*' + node.comment + '*/', node.position);
};
/**
 * Visit import node.
 */


identity_Compiler.prototype.import = function (node) {
  return this.emit('@import ' + node.import + ';', node.position);
};
/**
 * Visit media node.
 */


identity_Compiler.prototype.media = function (node) {
  return this.emit('@media ' + node.media, node.position) + this.emit(' {\n' + this.indent(1)) + this.mapVisit(node.rules, '\n\n') + this.emit(this.indent(-1) + '\n}');
};
/**
 * Visit document node.
 */


identity_Compiler.prototype.document = function (node) {
  const doc = '@' + (node.vendor || '') + 'document ' + node.document;
  return this.emit(doc, node.position) + this.emit(' ' + ' {\n' + this.indent(1)) + this.mapVisit(node.rules, '\n\n') + this.emit(this.indent(-1) + '\n}');
};
/**
 * Visit charset node.
 */


identity_Compiler.prototype.charset = function (node) {
  return this.emit('@charset ' + node.charset + ';', node.position);
};
/**
 * Visit namespace node.
 */


identity_Compiler.prototype.namespace = function (node) {
  return this.emit('@namespace ' + node.namespace + ';', node.position);
};
/**
 * Visit supports node.
 */


identity_Compiler.prototype.supports = function (node) {
  return this.emit('@supports ' + node.supports, node.position) + this.emit(' {\n' + this.indent(1)) + this.mapVisit(node.rules, '\n\n') + this.emit(this.indent(-1) + '\n}');
};
/**
 * Visit keyframes node.
 */


identity_Compiler.prototype.keyframes = function (node) {
  return this.emit('@' + (node.vendor || '') + 'keyframes ' + node.name, node.position) + this.emit(' {\n' + this.indent(1)) + this.mapVisit(node.keyframes, '\n') + this.emit(this.indent(-1) + '}');
};
/**
 * Visit keyframe node.
 */


identity_Compiler.prototype.keyframe = function (node) {
  const decls = node.declarations;
  return this.emit(this.indent()) + this.emit(node.values.join(', '), node.position) + this.emit(' {\n' + this.indent(1)) + this.mapVisit(decls, '\n') + this.emit(this.indent(-1) + '\n' + this.indent() + '}\n');
};
/**
 * Visit page node.
 */


identity_Compiler.prototype.page = function (node) {
  const sel = node.selectors.length ? node.selectors.join(', ') + ' ' : '';
  return this.emit('@page ' + sel, node.position) + this.emit('{\n') + this.emit(this.indent(1)) + this.mapVisit(node.declarations, '\n') + this.emit(this.indent(-1)) + this.emit('\n}');
};
/**
 * Visit font-face node.
 */


identity_Compiler.prototype['font-face'] = function (node) {
  return this.emit('@font-face ', node.position) + this.emit('{\n') + this.emit(this.indent(1)) + this.mapVisit(node.declarations, '\n') + this.emit(this.indent(-1)) + this.emit('\n}');
};
/**
 * Visit host node.
 */


identity_Compiler.prototype.host = function (node) {
  return this.emit('@host', node.position) + this.emit(' {\n' + this.indent(1)) + this.mapVisit(node.rules, '\n\n') + this.emit(this.indent(-1) + '\n}');
};
/**
 * Visit custom-media node.
 */


identity_Compiler.prototype['custom-media'] = function (node) {
  return this.emit('@custom-media ' + node.name + ' ' + node.media + ';', node.position);
};
/**
 * Visit rule node.
 */


identity_Compiler.prototype.rule = function (node) {
  const indent = this.indent();
  const decls = node.declarations;

  if (!decls.length) {
    return '';
  }

  return this.emit(node.selectors.map(function (s) {
    return indent + s;
  }).join(',\n'), node.position) + this.emit(' {\n') + this.emit(this.indent(1)) + this.mapVisit(decls, '\n') + this.emit(this.indent(-1)) + this.emit('\n' + this.indent() + '}');
};
/**
 * Visit declaration node.
 */


identity_Compiler.prototype.declaration = function (node) {
  return this.emit(this.indent()) + this.emit(node.property + ': ' + node.value, node.position) + this.emit(';');
};
/**
 * Increase, decrease or return current indentation.
 */


identity_Compiler.prototype.indent = function (level) {
  this.level = this.level || 1;

  if (null !== level) {
    this.level += level;
    return '';
  }

  return Array(this.level).join(this.indentation || '  ');
};
/* eslint-enable @wordpress/no-unused-vars-before-return */

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/utils/transform-styles/ast/stringify/index.js
// Adapted from https://github.com/reworkcss/css
// because we needed to remove source map support.

/**
 * Internal dependencies
 */


/**
 * Stringfy the given AST `node`.
 *
 * Options:
 *
 *  - `compress` space-optimized output
 *  - `sourcemap` return an object with `.code` and `.map`
 *
 * @param {Object} node
 * @param {Object} [options]
 * @return {string}
 */

/* harmony default export */ function stringify(node, options) {
  options = options || {};
  const compiler = options.compress ? new compress(options) : new identity(options);
  const code = compiler.compile(node);
  return code;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/utils/transform-styles/traverse.js
/**
 * External dependencies
 */

/**
 * Internal dependencies
 */



function traverseCSS(css, callback) {
  try {
    const parsed = parse(css);
    const updated = traverse_default().map(parsed, function (node) {
      if (!node) {
        return node;
      }

      const updatedNode = callback(node);
      return this.update(updatedNode);
    });
    return stringify(updated);
  } catch (err) {
    // eslint-disable-next-line no-console
    console.warn('Error while traversing the CSS: ' + err);
    return null;
  }
}

/* harmony default export */ var transform_styles_traverse = (traverseCSS);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/utils/transform-styles/transforms/url-rewrite.js
/**
 * Return `true` if the given path is http/https.
 *
 * @param {string} filePath path
 *
 * @return {boolean} is remote path.
 */
function isRemotePath(filePath) {
  return /^(?:https?:)?\/\//.test(filePath);
}
/**
 * Return `true` if the given filePath is an absolute url.
 *
 * @param {string} filePath path
 *
 * @return {boolean} is absolute path.
 */


function isAbsolutePath(filePath) {
  return /^\/(?!\/)/.test(filePath);
}
/**
 * Whether or not the url should be inluded.
 *
 * @param {Object} meta url meta info
 *
 * @return {boolean} is valid.
 */


function isValidURL(meta) {
  // Ignore hashes or data uris.
  if (meta.value.indexOf('data:') === 0 || meta.value.indexOf('#') === 0) {
    return false;
  }

  if (isAbsolutePath(meta.value)) {
    return false;
  } // Do not handle the http/https urls if `includeRemote` is false.


  if (isRemotePath(meta.value)) {
    return false;
  }

  return true;
}
/**
 * Get the absolute path of the url, relative to the basePath
 *
 * @param {string} str     the url
 * @param {string} baseURL base URL
 *
 * @return {string} the full path to the file
 */


function getResourcePath(str, baseURL) {
  return new URL(str, baseURL).toString();
}
/**
 * Process the single `url()` pattern
 *
 * @param {string} baseURL the base URL for relative URLs.
 *
 * @return {Promise} the Promise.
 */


function processURL(baseURL) {
  return meta => ({ ...meta,
    newUrl: 'url(' + meta.before + meta.quote + getResourcePath(meta.value, baseURL) + meta.quote + meta.after + ')'
  });
}
/**
 * Get all `url()`s, and return the meta info
 *
 * @param {string} value decl.value.
 *
 * @return {Array} the urls.
 */


function getURLs(value) {
  const reg = /url\((\s*)(['"]?)(.+?)\2(\s*)\)/g;
  let match;
  const URLs = [];

  while ((match = reg.exec(value)) !== null) {
    const meta = {
      source: match[0],
      before: match[1],
      quote: match[2],
      value: match[3],
      after: match[4]
    };

    if (isValidURL(meta)) {
      URLs.push(meta);
    }
  }

  return URLs;
}
/**
 * Replace the raw value's `url()` segment to the new value
 *
 * @param {string} raw  the raw value.
 * @param {Array}  URLs the URLs to replace.
 *
 * @return {string} the new value.
 */


function replaceURLs(raw, URLs) {
  URLs.forEach(item => {
    raw = raw.replace(item.source, item.newUrl);
  });
  return raw;
}

const rewrite = rootURL => node => {
  if (node.type === 'declaration') {
    const updatedURLs = getURLs(node.value).map(processURL(rootURL));
    return { ...node,
      value: replaceURLs(node.value, updatedURLs)
    };
  }

  return node;
};

/* harmony default export */ var url_rewrite = (rewrite);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/utils/transform-styles/transforms/wrap.js
/**
 * @constant string IS_ROOT_TAG Regex to check if the selector is a root tag selector.
 */
const IS_ROOT_TAG = /^(body|html|:root).*$/;
/**
 * Creates a callback to modify selectors so they only apply within a certain
 * namespace.
 *
 * @param {string}   namespace Namespace to prefix selectors with.
 * @param {string[]} ignore    Selectors to not prefix.
 *
 * @return {(node: Object) => Object} Callback to wrap selectors.
 */

const wrap = function (namespace) {
  let ignore = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : [];
  return node => {
    /**
     * Updates selector if necessary.
     *
     * @param {string} selector Selector to modify.
     *
     * @return {string} Updated selector.
     */
    const updateSelector = selector => {
      if (ignore.includes(selector.trim())) {
        return selector;
      } // Anything other than a root tag is always prefixed.


      {
        if (!selector.match(IS_ROOT_TAG)) {
          return namespace + ' ' + selector;
        }
      } // HTML and Body elements cannot be contained within our container so lets extract their styles.

      return selector.replace(/^(body|html|:root)/, namespace);
    };

    if (node.type === 'rule') {
      return { ...node,
        selectors: node.selectors.map(updateSelector)
      };
    }

    return node;
  };
};

/* harmony default export */ var transforms_wrap = (wrap);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/utils/transform-styles/index.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */




/**
 * Applies a series of CSS rule transforms to wrap selectors inside a given class and/or rewrite URLs depending on the parameters passed.
 *
 * @param {Array}  styles           CSS rules.
 * @param {string} wrapperClassName Wrapper Class Name.
 * @return {Array} converted rules.
 */

const transform_styles_transformStyles = function (styles) {
  let wrapperClassName = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : '';
  return (0,external_lodash_namespaceObject.map)(styles, _ref => {
    let {
      css,
      baseURL
    } = _ref;
    const transforms = [];

    if (wrapperClassName) {
      transforms.push(transforms_wrap(wrapperClassName));
    }

    if (baseURL) {
      transforms.push(url_rewrite(baseURL));
    }

    if (transforms.length) {
      return transform_styles_traverse(css, (0,external_wp_compose_namespaceObject.compose)(transforms));
    }

    return css;
  });
};

/* harmony default export */ var transform_styles = (transform_styles_transformStyles);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/editor-styles/index.js


/**
 * External dependencies
 */



/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


const EDITOR_STYLES_SELECTOR = '.editor-styles-wrapper';
k([names, a11y]);

function useDarkThemeBodyClassName(styles) {
  return (0,external_wp_element_namespaceObject.useCallback)(node => {
    if (!node) {
      return;
    }

    const {
      ownerDocument
    } = node;
    const {
      defaultView,
      body
    } = ownerDocument;
    const canvas = ownerDocument.querySelector(EDITOR_STYLES_SELECTOR);
    let backgroundColor;

    if (!canvas) {
      // The real .editor-styles-wrapper element might not exist in the
      // DOM, so calculate the background color by creating a fake
      // wrapper.
      const tempCanvas = ownerDocument.createElement('div');
      tempCanvas.classList.add('editor-styles-wrapper');
      body.appendChild(tempCanvas);
      backgroundColor = defaultView.getComputedStyle(tempCanvas, null).getPropertyValue('background-color');
      body.removeChild(tempCanvas);
    } else {
      backgroundColor = defaultView.getComputedStyle(canvas, null).getPropertyValue('background-color');
    }

    const colordBackgroundColor = w(backgroundColor); // If background is transparent, it should be treated as light color.

    if (colordBackgroundColor.luminance() > 0.5 || colordBackgroundColor.alpha() === 0) {
      body.classList.remove('is-dark-theme');
    } else {
      body.classList.add('is-dark-theme');
    }
  }, [styles]);
}

function EditorStyles(_ref) {
  let {
    styles
  } = _ref;
  const transformedStyles = (0,external_wp_element_namespaceObject.useMemo)(() => transform_styles(styles, EDITOR_STYLES_SELECTOR), [styles]);
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)("style", {
    ref: useDarkThemeBodyClassName(styles)
  }), transformedStyles.map((css, index) => (0,external_wp_element_namespaceObject.createElement)("style", {
    key: index
  }, css)));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-preview/auto.js


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */




 // This is used to avoid rendering the block list if the sizes change.

let MemoizedBlockList;
const MAX_HEIGHT = 2000;

function AutoBlockPreview(_ref) {
  let {
    viewportWidth,
    __experimentalPadding,
    __experimentalMinHeight
  } = _ref;
  const [containerResizeListener, {
    width: containerWidth
  }] = (0,external_wp_compose_namespaceObject.useResizeObserver)();
  const [contentResizeListener, {
    height: contentHeight
  }] = (0,external_wp_compose_namespaceObject.useResizeObserver)();
  const {
    styles,
    assets
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const settings = select(store).getSettings();
    return {
      styles: settings.styles,
      assets: settings.__unstableResolvedAssets
    };
  }, []); // Avoid scrollbars for pattern previews.

  const editorStyles = (0,external_wp_element_namespaceObject.useMemo)(() => {
    if (styles) {
      return [...styles, {
        css: 'body{height:auto;overflow:hidden;}',
        __unstableType: 'presets'
      }];
    }

    return styles;
  }, [styles]); // Initialize on render instead of module top level, to avoid circular dependency issues.

  MemoizedBlockList = MemoizedBlockList || (0,external_wp_compose_namespaceObject.pure)(BlockList);
  const scale = containerWidth / viewportWidth;
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-preview__container"
  }, containerResizeListener, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Disabled, {
    className: "block-editor-block-preview__content",
    style: {
      transform: `scale(${scale})`,
      height: contentHeight * scale,
      maxHeight: contentHeight > MAX_HEIGHT ? MAX_HEIGHT * scale : undefined,
      minHeight: __experimentalMinHeight
    }
  }, (0,external_wp_element_namespaceObject.createElement)(iframe, {
    head: (0,external_wp_element_namespaceObject.createElement)(EditorStyles, {
      styles: editorStyles
    }),
    assets: assets,
    contentRef: (0,external_wp_compose_namespaceObject.useRefEffect)(bodyElement => {
      const {
        ownerDocument: {
          documentElement
        }
      } = bodyElement;
      documentElement.classList.add('block-editor-block-preview__content-iframe');
      documentElement.style.position = 'absolute';
      documentElement.style.width = '100%';
      bodyElement.style.padding = __experimentalPadding + 'px'; // necessary for contentResizeListener to work.

      bodyElement.style.position = 'relative';
    }, []),
    "aria-hidden": true,
    tabIndex: -1,
    style: {
      position: 'absolute',
      width: viewportWidth,
      height: contentHeight,
      pointerEvents: 'none',
      // This is a catch-all max-height for patterns.
      // See: https://github.com/WordPress/gutenberg/pull/38175.
      maxHeight: MAX_HEIGHT,
      minHeight: scale < 1 && __experimentalMinHeight ? __experimentalMinHeight / scale : __experimentalMinHeight
    }
  }, contentResizeListener, (0,external_wp_element_namespaceObject.createElement)(MemoizedBlockList, {
    renderAppender: false
  }))));
}

/* harmony default export */ var auto = (AutoBlockPreview);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-preview/index.js


/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */






function BlockPreview(_ref) {
  let {
    blocks,
    __experimentalPadding = 0,
    viewportWidth = 1200,
    __experimentalLive = false,
    __experimentalOnClick,
    __experimentalMinHeight
  } = _ref;
  const originalSettings = (0,external_wp_data_namespaceObject.useSelect)(select => select(store).getSettings(), []);
  const settings = (0,external_wp_element_namespaceObject.useMemo)(() => {
    const _settings = { ...originalSettings
    };
    _settings.__experimentalBlockPatterns = [];
    return _settings;
  }, [originalSettings]);
  const renderedBlocks = (0,external_wp_element_namespaceObject.useMemo)(() => (0,external_lodash_namespaceObject.castArray)(blocks), [blocks]);

  if (!blocks || blocks.length === 0) {
    return null;
  }

  return (0,external_wp_element_namespaceObject.createElement)(provider, {
    value: renderedBlocks,
    settings: settings
  }, __experimentalLive ? (0,external_wp_element_namespaceObject.createElement)(LiveBlockPreview, {
    onClick: __experimentalOnClick
  }) : (0,external_wp_element_namespaceObject.createElement)(auto, {
    viewportWidth: viewportWidth,
    __experimentalPadding: __experimentalPadding,
    __experimentalMinHeight: __experimentalMinHeight
  }));
}
/**
 * BlockPreview renders a preview of a block or array of blocks.
 *
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/block-preview/README.md
 *
 * @param {Object}       preview               options for how the preview should be shown
 * @param {Array|Object} preview.blocks        A block instance (object) or an array of blocks to be previewed.
 * @param {number}       preview.viewportWidth Width of the preview container in pixels. Controls at what size the blocks will be rendered inside the preview. Default: 700.
 *
 * @return {WPComponent} The component to be rendered.
 */

/* harmony default export */ var block_preview = ((0,external_wp_element_namespaceObject.memo)(BlockPreview));
/**
 * This hook is used to lightly mark an element as a block preview wrapper
 * element. Call this hook and pass the returned props to the element to mark as
 * a block preview wrapper, automatically rendering inner blocks as children. If
 * you define a ref for the element, it is important to pass the ref to this
 * hook, which the hook in turn will pass to the component through the props it
 * returns. Optionally, you can also pass any other props through this hook, and
 * they will be merged and returned.
 *
 * @param {Object}    options                      Preview options.
 * @param {WPBlock[]} options.blocks               Block objects.
 * @param {Object}    options.props                Optional. Props to pass to the element. Must contain
 *                                                 the ref if one is defined.
 * @param {Object}    options.__experimentalLayout Layout settings to be used in the preview.
 *
 */

function useBlockPreview(_ref2) {
  let {
    blocks,
    props = {},
    __experimentalLayout
  } = _ref2;
  const originalSettings = (0,external_wp_data_namespaceObject.useSelect)(select => select(store).getSettings(), []);
  const disabledRef = (0,external_wp_compose_namespaceObject.__experimentalUseDisabled)();
  const ref = (0,external_wp_compose_namespaceObject.useMergeRefs)([props.ref, disabledRef]);
  const settings = (0,external_wp_element_namespaceObject.useMemo)(() => ({ ...originalSettings,
    __experimentalBlockPatterns: []
  }), [originalSettings]);
  const renderedBlocks = (0,external_wp_element_namespaceObject.useMemo)(() => (0,external_lodash_namespaceObject.castArray)(blocks), [blocks]);
  const children = (0,external_wp_element_namespaceObject.createElement)(provider, {
    value: renderedBlocks,
    settings: settings
  }, (0,external_wp_element_namespaceObject.createElement)(BlockListItems, {
    renderAppender: false,
    __experimentalLayout: __experimentalLayout
  }));
  return { ...props,
    ref,
    className: classnames_default()(props.className, 'block-editor-block-preview__live-content', 'components-disabled'),
    children: blocks !== null && blocks !== void 0 && blocks.length ? children : null
  };
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/preview-panel.js


/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */




function InserterPreviewPanel(_ref) {
  var _hoveredItemBlockType, _hoveredItemBlockType2;

  let {
    item
  } = _ref;
  const {
    name,
    title,
    icon,
    description,
    initialAttributes
  } = item;
  const hoveredItemBlockType = (0,external_wp_blocks_namespaceObject.getBlockType)(name);
  const isReusable = (0,external_wp_blocks_namespaceObject.isReusableBlock)(item);
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-inserter__preview-container"
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-inserter__preview"
  }, isReusable || hoveredItemBlockType !== null && hoveredItemBlockType !== void 0 && hoveredItemBlockType.example ? (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-inserter__preview-content"
  }, (0,external_wp_element_namespaceObject.createElement)(block_preview, {
    __experimentalPadding: 16,
    viewportWidth: (_hoveredItemBlockType = (_hoveredItemBlockType2 = hoveredItemBlockType.example) === null || _hoveredItemBlockType2 === void 0 ? void 0 : _hoveredItemBlockType2.viewportWidth) !== null && _hoveredItemBlockType !== void 0 ? _hoveredItemBlockType : 500,
    blocks: hoveredItemBlockType.example ? (0,external_wp_blocks_namespaceObject.getBlockFromExample)(item.name, {
      attributes: { ...hoveredItemBlockType.example.attributes,
        ...initialAttributes
      },
      innerBlocks: hoveredItemBlockType.example.innerBlocks
    }) : (0,external_wp_blocks_namespaceObject.createBlock)(name, initialAttributes)
  })) : (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-inserter__preview-content-missing"
  }, (0,external_wp_i18n_namespaceObject.__)('No Preview Available.'))), !isReusable && (0,external_wp_element_namespaceObject.createElement)(block_card, {
    title: title,
    icon: icon,
    description: description
  }));
}

/* harmony default export */ var preview_panel = (InserterPreviewPanel);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter-listbox/context.js
/**
 * WordPress dependencies
 */

const InserterListboxContext = (0,external_wp_element_namespaceObject.createContext)();
/* harmony default export */ var context = (InserterListboxContext);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter-listbox/item.js



/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */



function InserterListboxItem(_ref, ref) {
  let {
    isFirst,
    as: Component,
    children,
    ...props
  } = _ref;
  const state = (0,external_wp_element_namespaceObject.useContext)(context);
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__unstableCompositeItem, _extends({
    ref: ref,
    state: state,
    role: "option" // Use the CompositeItem `focusable` prop over Button's
    // isFocusable. The latter was shown to cause an issue
    // with tab order in the inserter list.
    ,
    focusable: true
  }, props), htmlProps => {
    const propsWithTabIndex = { ...htmlProps,
      tabIndex: isFirst ? 0 : htmlProps.tabIndex
    };

    if (Component) {
      return (0,external_wp_element_namespaceObject.createElement)(Component, propsWithTabIndex, children);
    }

    if (typeof children === 'function') {
      return children(propsWithTabIndex);
    }

    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, propsWithTabIndex, children);
  });
}

/* harmony default export */ var inserter_listbox_item = ((0,external_wp_element_namespaceObject.forwardRef)(InserterListboxItem));

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/drag-handle.js


/**
 * WordPress dependencies
 */

const dragHandle = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  width: "24",
  height: "24",
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M8 7h2V5H8v2zm0 6h2v-2H8v2zm0 6h2v-2H8v2zm6-14v2h2V5h-2zm0 8h2v-2h-2v2zm0 6h2v-2h-2v2z"
}));
/* harmony default export */ var drag_handle = (dragHandle);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-draggable/draggable-chip.js


/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */


function BlockDraggableChip(_ref) {
  let {
    count,
    icon
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-draggable-chip-wrapper"
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-draggable-chip"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Flex, {
    justify: "center",
    className: "block-editor-block-draggable-chip__content"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.FlexItem, null, icon ? (0,external_wp_element_namespaceObject.createElement)(block_icon, {
    icon: icon
  }) : (0,external_wp_i18n_namespaceObject.sprintf)(
  /* translators: %d: Number of blocks. */
  (0,external_wp_i18n_namespaceObject._n)('%d block', '%d blocks', count), count)), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.FlexItem, null, (0,external_wp_element_namespaceObject.createElement)(block_icon, {
    icon: drag_handle
  })))));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter-draggable-blocks/index.js


/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */



const InserterDraggableBlocks = _ref => {
  let {
    isEnabled,
    blocks,
    icon,
    children
  } = _ref;
  const transferData = {
    type: 'inserter',
    blocks
  };
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Draggable, {
    __experimentalTransferDataType: "wp-blocks",
    transferData: transferData,
    __experimentalDragComponent: (0,external_wp_element_namespaceObject.createElement)(BlockDraggableChip, {
      count: blocks.length,
      icon: icon
    })
  }, _ref2 => {
    let {
      onDraggableStart,
      onDraggableEnd
    } = _ref2;
    return children({
      draggable: isEnabled,
      onDragStart: isEnabled ? onDraggableStart : undefined,
      onDragEnd: isEnabled ? onDraggableEnd : undefined
    });
  });
};

/* harmony default export */ var inserter_draggable_blocks = (InserterDraggableBlocks);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter-list-item/index.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */




/**
 * Return true if platform is MacOS.
 *
 * @param {Object} _window window object by default; used for DI testing.
 *
 * @return {boolean} True if MacOS; false otherwise.
 */

function isAppleOS() {
  let _window = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : window;

  const {
    platform
  } = _window.navigator;
  return platform.indexOf('Mac') !== -1 || ['iPad', 'iPhone'].includes(platform);
}

function InserterListItem(_ref) {
  let {
    className,
    isFirst,
    item,
    onSelect,
    onHover,
    isDraggable,
    ...props
  } = _ref;
  const isDragging = (0,external_wp_element_namespaceObject.useRef)(false);
  const itemIconStyle = item.icon ? {
    backgroundColor: item.icon.background,
    color: item.icon.foreground
  } : {};
  const blocks = (0,external_wp_element_namespaceObject.useMemo)(() => {
    return [(0,external_wp_blocks_namespaceObject.createBlock)(item.name, item.initialAttributes, (0,external_wp_blocks_namespaceObject.createBlocksFromInnerBlocksTemplate)(item.innerBlocks))];
  }, [item.name, item.initialAttributes, item.initialAttributes]);
  return (0,external_wp_element_namespaceObject.createElement)(inserter_draggable_blocks, {
    isEnabled: isDraggable && !item.disabled,
    blocks: blocks,
    icon: item.icon
  }, _ref2 => {
    let {
      draggable,
      onDragStart,
      onDragEnd
    } = _ref2;
    return (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "block-editor-block-types-list__list-item",
      draggable: draggable,
      onDragStart: event => {
        isDragging.current = true;

        if (onDragStart) {
          onHover(null);
          onDragStart(event);
        }
      },
      onDragEnd: event => {
        isDragging.current = false;

        if (onDragEnd) {
          onDragEnd(event);
        }
      }
    }, (0,external_wp_element_namespaceObject.createElement)(inserter_listbox_item, _extends({
      isFirst: isFirst,
      className: classnames_default()('block-editor-block-types-list__item', className),
      disabled: item.isDisabled,
      onClick: event => {
        event.preventDefault();
        onSelect(item, isAppleOS() ? event.metaKey : event.ctrlKey);
        onHover(null);
      },
      onKeyDown: event => {
        const {
          keyCode
        } = event;

        if (keyCode === external_wp_keycodes_namespaceObject.ENTER) {
          event.preventDefault();
          onSelect(item, isAppleOS() ? event.metaKey : event.ctrlKey);
          onHover(null);
        }
      },
      onFocus: () => {
        if (isDragging.current) {
          return;
        }

        onHover(item);
      },
      onMouseEnter: () => {
        if (isDragging.current) {
          return;
        }

        onHover(item);
      },
      onMouseLeave: () => onHover(null),
      onBlur: () => onHover(null)
    }, props), (0,external_wp_element_namespaceObject.createElement)("span", {
      className: "block-editor-block-types-list__item-icon",
      style: itemIconStyle
    }, (0,external_wp_element_namespaceObject.createElement)(block_icon, {
      icon: item.icon,
      showColors: true
    })), (0,external_wp_element_namespaceObject.createElement)("span", {
      className: "block-editor-block-types-list__item-title"
    }, item.title)));
  });
}

/* harmony default export */ var inserter_list_item = ((0,external_wp_element_namespaceObject.memo)(InserterListItem));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter-listbox/group.js



/**
 * WordPress dependencies
 */




function InserterListboxGroup(props, ref) {
  const [shouldSpeak, setShouldSpeak] = (0,external_wp_element_namespaceObject.useState)(false);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    if (shouldSpeak) {
      (0,external_wp_a11y_namespaceObject.speak)((0,external_wp_i18n_namespaceObject.__)('Use left and right arrow keys to move through blocks'));
    }
  }, [shouldSpeak]);
  return (0,external_wp_element_namespaceObject.createElement)("div", _extends({
    ref: ref,
    role: "listbox",
    "aria-orientation": "horizontal",
    onFocus: () => {
      setShouldSpeak(true);
    },
    onBlur: event => {
      const focusingOutsideGroup = !event.currentTarget.contains(event.relatedTarget);

      if (focusingOutsideGroup) {
        setShouldSpeak(false);
      }
    }
  }, props));
}

/* harmony default export */ var group = ((0,external_wp_element_namespaceObject.forwardRef)(InserterListboxGroup));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter-listbox/row.js



/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */



function InserterListboxRow(props, ref) {
  const state = (0,external_wp_element_namespaceObject.useContext)(context);
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__unstableCompositeGroup, _extends({
    state: state,
    role: "presentation",
    ref: ref
  }, props));
}

/* harmony default export */ var inserter_listbox_row = ((0,external_wp_element_namespaceObject.forwardRef)(InserterListboxRow));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-types-list/index.js


/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */




function chunk(array, size) {
  const chunks = [];

  for (let i = 0, j = array.length; i < j; i += size) {
    chunks.push(array.slice(i, i + size));
  }

  return chunks;
}

function BlockTypesList(_ref) {
  let {
    items = [],
    onSelect,
    onHover = () => {},
    children,
    label,
    isDraggable = true
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)(group, {
    className: "block-editor-block-types-list",
    "aria-label": label
  }, chunk(items, 3).map((row, i) => (0,external_wp_element_namespaceObject.createElement)(inserter_listbox_row, {
    key: i
  }, row.map((item, j) => (0,external_wp_element_namespaceObject.createElement)(inserter_list_item, {
    key: item.id,
    item: item,
    className: (0,external_wp_blocks_namespaceObject.getBlockMenuDefaultClassName)(item.id),
    onSelect: onSelect,
    onHover: onHover,
    isDraggable: isDraggable,
    isFirst: i === 0 && j === 0
  })))), children);
}

/* harmony default export */ var block_types_list = (BlockTypesList);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/panel.js


/**
 * WordPress dependencies
 */


function InserterPanel(_ref) {
  let {
    title,
    icon,
    children
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-inserter__panel-header"
  }, (0,external_wp_element_namespaceObject.createElement)("h2", {
    className: "block-editor-inserter__panel-title"
  }, title), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Icon, {
    icon: icon
  })), (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-inserter__panel-content"
  }, children));
}

/* harmony default export */ var panel = (InserterPanel);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/hooks/use-block-types-state.js
/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */


/**
 * Retrieves the block types inserter state.
 *
 * @param {string=}  rootClientId Insertion's root client ID.
 * @param {Function} onInsert     function called when inserter a list of blocks.
 * @return {Array} Returns the block types state. (block types, categories, collections, onSelect handler)
 */

const useBlockTypesState = (rootClientId, onInsert) => {
  const {
    categories,
    collections,
    items
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getInserterItems
    } = select(store);
    const {
      getCategories,
      getCollections
    } = select(external_wp_blocks_namespaceObject.store);
    return {
      categories: getCategories(),
      collections: getCollections(),
      items: getInserterItems(rootClientId)
    };
  }, [rootClientId]);
  const onSelectItem = (0,external_wp_element_namespaceObject.useCallback)((_ref, shouldFocusBlock) => {
    let {
      name,
      initialAttributes,
      innerBlocks
    } = _ref;
    const insertedBlock = (0,external_wp_blocks_namespaceObject.createBlock)(name, initialAttributes, (0,external_wp_blocks_namespaceObject.createBlocksFromInnerBlocksTemplate)(innerBlocks));
    onInsert(insertedBlock, undefined, shouldFocusBlock);
  }, [onInsert]);
  return [items, categories, collections, onSelectItem];
};

/* harmony default export */ var use_block_types_state = (useBlockTypesState);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter-listbox/index.js


/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */






function InserterListbox(_ref) {
  let {
    children
  } = _ref;
  const compositeState = (0,external_wp_components_namespaceObject.__unstableUseCompositeState)({
    shift: true,
    wrap: 'horizontal'
  });
  return (0,external_wp_element_namespaceObject.createElement)(context.Provider, {
    value: compositeState
  }, children);
}

/* harmony default export */ var inserter_listbox = (InserterListbox);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/block-types-tab.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */






const getBlockNamespace = item => item.name.split('/')[0];

const MAX_SUGGESTED_ITEMS = 6;
/**
 * Shared reference to an empty array for cases where it is important to avoid
 * returning a new array reference on every invocation and rerendering the component.
 *
 * @type {Array}
 */

const block_types_tab_EMPTY_ARRAY = [];
function BlockTypesTab(_ref) {
  let {
    rootClientId,
    onInsert,
    onHover,
    showMostUsedBlocks
  } = _ref;
  const [items, categories, collections, onSelectItem] = use_block_types_state(rootClientId, onInsert);
  const suggestedItems = (0,external_wp_element_namespaceObject.useMemo)(() => {
    return (0,external_lodash_namespaceObject.orderBy)(items, ['frecency'], ['desc']).slice(0, MAX_SUGGESTED_ITEMS);
  }, [items]);
  const uncategorizedItems = (0,external_wp_element_namespaceObject.useMemo)(() => {
    return items.filter(item => !item.category);
  }, [items]);
  const itemsPerCategory = (0,external_wp_element_namespaceObject.useMemo)(() => {
    return (0,external_lodash_namespaceObject.flow)(itemList => itemList.filter(item => item.category && item.category !== 'reusable'), itemList => (0,external_lodash_namespaceObject.groupBy)(itemList, 'category'))(items);
  }, [items]);
  const itemsPerCollection = (0,external_wp_element_namespaceObject.useMemo)(() => {
    // Create a new Object to avoid mutating collection.
    const result = { ...collections
    };
    Object.keys(collections).forEach(namespace => {
      result[namespace] = items.filter(item => getBlockNamespace(item) === namespace);

      if (result[namespace].length === 0) {
        delete result[namespace];
      }
    });
    return result;
  }, [items, collections]); // Hide block preview on unmount.

  (0,external_wp_element_namespaceObject.useEffect)(() => () => onHover(null), []);
  /**
   * The inserter contains a big number of blocks and opening it is a costful operation.
   * The rendering is the most costful part of it, in order to improve the responsiveness
   * of the "opening" action, these lazy lists allow us to render the inserter category per category,
   * once all the categories are rendered, we start rendering the collections and the uncategorized block types.
   */

  const currentlyRenderedCategories = (0,external_wp_compose_namespaceObject.useAsyncList)(categories);
  const didRenderAllCategories = categories.length === currentlyRenderedCategories.length; // Async List requires an array.

  const collectionEntries = (0,external_wp_element_namespaceObject.useMemo)(() => {
    return Object.entries(collections);
  }, [collections]);
  const currentlyRenderedCollections = (0,external_wp_compose_namespaceObject.useAsyncList)(didRenderAllCategories ? collectionEntries : block_types_tab_EMPTY_ARRAY);
  return (0,external_wp_element_namespaceObject.createElement)(inserter_listbox, null, (0,external_wp_element_namespaceObject.createElement)("div", null, showMostUsedBlocks && !!suggestedItems.length && (0,external_wp_element_namespaceObject.createElement)(panel, {
    title: (0,external_wp_i18n_namespaceObject._x)('Most used', 'blocks')
  }, (0,external_wp_element_namespaceObject.createElement)(block_types_list, {
    items: suggestedItems,
    onSelect: onSelectItem,
    onHover: onHover,
    label: (0,external_wp_i18n_namespaceObject._x)('Most used', 'blocks')
  })), (0,external_lodash_namespaceObject.map)(currentlyRenderedCategories, category => {
    const categoryItems = itemsPerCategory[category.slug];

    if (!categoryItems || !categoryItems.length) {
      return null;
    }

    return (0,external_wp_element_namespaceObject.createElement)(panel, {
      key: category.slug,
      title: category.title,
      icon: category.icon
    }, (0,external_wp_element_namespaceObject.createElement)(block_types_list, {
      items: categoryItems,
      onSelect: onSelectItem,
      onHover: onHover,
      label: category.title
    }));
  }), didRenderAllCategories && uncategorizedItems.length > 0 && (0,external_wp_element_namespaceObject.createElement)(panel, {
    className: "block-editor-inserter__uncategorized-blocks-panel",
    title: (0,external_wp_i18n_namespaceObject.__)('Uncategorized')
  }, (0,external_wp_element_namespaceObject.createElement)(block_types_list, {
    items: uncategorizedItems,
    onSelect: onSelectItem,
    onHover: onHover,
    label: (0,external_wp_i18n_namespaceObject.__)('Uncategorized')
  })), (0,external_lodash_namespaceObject.map)(currentlyRenderedCollections, _ref2 => {
    let [namespace, collection] = _ref2;
    const collectionItems = itemsPerCollection[namespace];

    if (!collectionItems || !collectionItems.length) {
      return null;
    }

    return (0,external_wp_element_namespaceObject.createElement)(panel, {
      key: namespace,
      title: collection.title,
      icon: collection.icon
    }, (0,external_wp_element_namespaceObject.createElement)(block_types_list, {
      items: collectionItems,
      onSelect: onSelectItem,
      onHover: onHover,
      label: collection.title
    }));
  })));
}
/* harmony default export */ var block_types_tab = (BlockTypesTab);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/pattern-panel.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */





function PatternInserterPanel(_ref) {
  let {
    selectedCategory,
    patternCategories,
    onClickCategory,
    openPatternExplorer
  } = _ref;
  const isMobile = (0,external_wp_compose_namespaceObject.useViewportMatch)('medium', '<');

  const categoryOptions = () => {
    const options = [];
    patternCategories.map(patternCategory => {
      return options.push({
        value: patternCategory.name,
        label: patternCategory.label
      });
    });
    return options;
  };

  const onChangeSelect = selected => {
    onClickCategory(patternCategories.find(patternCategory => selected === patternCategory.name));
  };

  const className = classnames_default()('block-editor-inserter__panel-header', 'block-editor-inserter__panel-header-patterns'); // In iOS-based mobile devices, the onBlur will fire when selecting an option
  // from a Select element. To prevent closing the useDialog on iOS devices, we
  // stop propagating the onBlur event if there is no relatedTarget, which means
  // that the user most likely did not click on an element within the editor canvas.

  const onBlur = event => {
    if (!(event !== null && event !== void 0 && event.relatedTarget)) {
      event.stopPropagation();
    }
  };

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Flex, {
    justify: "space-between",
    align: "start",
    gap: "4",
    className: className
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.FlexItem, {
    isBlock: true
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.SelectControl, {
    className: "block-editor-inserter__panel-dropdown",
    label: (0,external_wp_i18n_namespaceObject.__)('Filter patterns'),
    hideLabelFromVision: true,
    value: selectedCategory.name,
    onChange: onChangeSelect,
    onBlur: onBlur,
    options: categoryOptions()
  })), !isMobile && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.FlexItem, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    variant: "secondary",
    className: "block-editor-inserter__patterns-explorer-expand",
    label: (0,external_wp_i18n_namespaceObject.__)('Explore all patterns'),
    onClick: () => openPatternExplorer()
  }, (0,external_wp_i18n_namespaceObject._x)('Explore', 'Label for showing all block patterns'))));
}

/* harmony default export */ var pattern_panel = (PatternInserterPanel);

;// CONCATENATED MODULE: external ["wp","notices"]
var external_wp_notices_namespaceObject = window["wp"]["notices"];
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/hooks/use-patterns-state.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */


/**
 * Retrieves the block patterns inserter state.
 *
 * @param {Function} onInsert     function called when inserter a list of blocks.
 * @param {string=}  rootClientId Insertion's root client ID.
 *
 * @return {Array} Returns the patterns state. (patterns, categories, onSelect handler)
 */

const usePatternsState = (onInsert, rootClientId) => {
  const {
    patternCategories,
    patterns
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      __experimentalGetAllowedPatterns,
      getSettings
    } = select(store);
    return {
      patterns: __experimentalGetAllowedPatterns(rootClientId),
      patternCategories: getSettings().__experimentalBlockPatternCategories
    };
  }, [rootClientId]);
  const {
    createSuccessNotice
  } = (0,external_wp_data_namespaceObject.useDispatch)(external_wp_notices_namespaceObject.store);
  const onClickPattern = (0,external_wp_element_namespaceObject.useCallback)((pattern, blocks) => {
    onInsert((0,external_lodash_namespaceObject.map)(blocks, block => (0,external_wp_blocks_namespaceObject.cloneBlock)(block)), pattern.name);
    createSuccessNotice((0,external_wp_i18n_namespaceObject.sprintf)(
    /* translators: %s: block pattern title. */
    (0,external_wp_i18n_namespaceObject.__)('Block pattern "%s" inserted.'), pattern.title), {
      type: 'snackbar'
    });
  }, []);
  return [patterns, patternCategories, onClickPattern];
};

/* harmony default export */ var use_patterns_state = (usePatternsState);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-patterns-list/index.js



/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */




function BlockPattern(_ref) {
  let {
    isDraggable,
    pattern,
    onClick,
    composite
  } = _ref;
  const {
    blocks,
    viewportWidth
  } = pattern;
  const instanceId = (0,external_wp_compose_namespaceObject.useInstanceId)(BlockPattern);
  const descriptionId = `block-editor-block-patterns-list__item-description-${instanceId}`;
  return (0,external_wp_element_namespaceObject.createElement)(inserter_draggable_blocks, {
    isEnabled: isDraggable,
    blocks: blocks
  }, _ref2 => {
    let {
      draggable,
      onDragStart,
      onDragEnd
    } = _ref2;
    return (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "block-editor-block-patterns-list__list-item",
      "aria-label": pattern.title,
      "aria-describedby": pattern.description ? descriptionId : undefined,
      draggable: draggable,
      onDragStart: onDragStart,
      onDragEnd: onDragEnd
    }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__unstableCompositeItem, _extends({
      role: "option",
      as: "div"
    }, composite, {
      className: "block-editor-block-patterns-list__item",
      onClick: () => onClick(pattern, blocks)
    }), (0,external_wp_element_namespaceObject.createElement)(block_preview, {
      blocks: blocks,
      viewportWidth: viewportWidth
    }), (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "block-editor-block-patterns-list__item-title"
    }, pattern.title), !!pattern.description && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.VisuallyHidden, {
      id: descriptionId
    }, pattern.description)));
  });
}

function BlockPatternPlaceholder() {
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-patterns-list__item is-placeholder"
  });
}

function BlockPatternList(_ref3) {
  let {
    isDraggable,
    blockPatterns,
    shownPatterns,
    onClickPattern,
    orientation,
    label = (0,external_wp_i18n_namespaceObject.__)('Block Patterns')
  } = _ref3;
  const composite = (0,external_wp_components_namespaceObject.__unstableUseCompositeState)({
    orientation
  });
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__unstableComposite, _extends({}, composite, {
    role: "listbox",
    className: "block-editor-block-patterns-list",
    "aria-label": label
  }), blockPatterns.map(pattern => {
    const isShown = shownPatterns.includes(pattern);
    return isShown ? (0,external_wp_element_namespaceObject.createElement)(BlockPattern, {
      key: pattern.name,
      pattern: pattern,
      onClick: onClickPattern,
      isDraggable: isDraggable,
      composite: composite
    }) : (0,external_wp_element_namespaceObject.createElement)(BlockPatternPlaceholder, {
      key: pattern.name
    });
  }));
}

/* harmony default export */ var block_patterns_list = (BlockPatternList);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/block-patterns-explorer/sidebar.js


/**
 * WordPress dependencies
 */



function PatternCategoriesList(_ref) {
  let {
    selectedCategory,
    patternCategories,
    onClickCategory
  } = _ref;
  const baseClassName = 'block-editor-block-patterns-explorer__sidebar';
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: `${baseClassName}__categories-list`
  }, patternCategories.map(_ref2 => {
    let {
      name,
      label
    } = _ref2;
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
      key: name,
      label: label,
      className: `${baseClassName}__categories-list__item`,
      isPressed: selectedCategory === name,
      onClick: () => {
        onClickCategory(name);
      }
    }, label);
  }));
}

function PatternsExplorerSearch(_ref3) {
  let {
    filterValue,
    setFilterValue
  } = _ref3;
  const baseClassName = 'block-editor-block-patterns-explorer__search';
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: baseClassName
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.SearchControl, {
    onChange: setFilterValue,
    value: filterValue,
    label: (0,external_wp_i18n_namespaceObject.__)('Search for patterns'),
    placeholder: (0,external_wp_i18n_namespaceObject.__)('Search')
  }));
}

function PatternExplorerSidebar(_ref4) {
  let {
    selectedCategory,
    patternCategories,
    onClickCategory,
    filterValue,
    setFilterValue
  } = _ref4;
  const baseClassName = 'block-editor-block-patterns-explorer__sidebar';
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: baseClassName
  }, (0,external_wp_element_namespaceObject.createElement)(PatternsExplorerSearch, {
    filterValue: filterValue,
    setFilterValue: setFilterValue
  }), !filterValue && (0,external_wp_element_namespaceObject.createElement)(PatternCategoriesList, {
    selectedCategory: selectedCategory,
    patternCategories: patternCategories,
    onClickCategory: onClickCategory
  }));
}

/* harmony default export */ var sidebar = (PatternExplorerSidebar);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/no-results.js


/**
 * WordPress dependencies
 */



function InserterNoResults() {
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-inserter__no-results"
  }, (0,external_wp_element_namespaceObject.createElement)(build_module_icon, {
    className: "block-editor-inserter__no-results-icon",
    icon: block_default
  }), (0,external_wp_element_namespaceObject.createElement)("p", null, (0,external_wp_i18n_namespaceObject.__)('No results found.')));
}

/* harmony default export */ var no_results = (InserterNoResults);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/hooks/use-insertion-point.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */


/**
 * @typedef WPInserterConfig
 *
 * @property {string=}   rootClientId   If set, insertion will be into the
 *                                      block with this ID.
 * @property {number=}   insertionIndex If set, insertion will be into this
 *                                      explicit position.
 * @property {string=}   clientId       If set, insertion will be after the
 *                                      block with this ID.
 * @property {boolean=}  isAppender     Whether the inserter is an appender
 *                                      or not.
 * @property {Function=} onSelect       Called after insertion.
 */

/**
 * Returns the insertion point state given the inserter config.
 *
 * @param {WPInserterConfig} config Inserter Config.
 * @return {Array} Insertion Point State (rootClientID, onInsertBlocks and onToggle).
 */

function useInsertionPoint(_ref) {
  let {
    rootClientId = '',
    insertionIndex,
    clientId,
    isAppender,
    onSelect,
    shouldFocusBlock = true
  } = _ref;
  const {
    getSelectedBlock
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const {
    destinationRootClientId,
    destinationIndex
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getSelectedBlockClientId,
      getBlockRootClientId,
      getBlockIndex,
      getBlockOrder
    } = select(store);
    const selectedBlockClientId = getSelectedBlockClientId();
    let _destinationRootClientId = rootClientId;

    let _destinationIndex;

    if (insertionIndex !== undefined) {
      // Insert into a specific index.
      _destinationIndex = insertionIndex;
    } else if (clientId) {
      // Insert after a specific client ID.
      _destinationIndex = getBlockIndex(clientId);
    } else if (!isAppender && selectedBlockClientId) {
      _destinationRootClientId = getBlockRootClientId(selectedBlockClientId);
      _destinationIndex = getBlockIndex(selectedBlockClientId) + 1;
    } else {
      // Insert at the end of the list.
      _destinationIndex = getBlockOrder(_destinationRootClientId).length;
    }

    return {
      destinationRootClientId: _destinationRootClientId,
      destinationIndex: _destinationIndex
    };
  }, [rootClientId, insertionIndex, clientId, isAppender]);
  const {
    replaceBlocks,
    insertBlocks,
    showInsertionPoint,
    hideInsertionPoint
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const onInsertBlocks = (0,external_wp_element_namespaceObject.useCallback)(function (blocks, meta) {
    let shouldForceFocusBlock = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false;
    const selectedBlock = getSelectedBlock();

    if (!isAppender && selectedBlock && (0,external_wp_blocks_namespaceObject.isUnmodifiedDefaultBlock)(selectedBlock)) {
      replaceBlocks(selectedBlock.clientId, blocks, null, shouldFocusBlock || shouldForceFocusBlock ? 0 : null, meta);
    } else {
      insertBlocks(blocks, destinationIndex, destinationRootClientId, true, shouldFocusBlock || shouldForceFocusBlock ? 0 : null, meta);
    }

    const message = (0,external_wp_i18n_namespaceObject.sprintf)( // translators: %d: the name of the block that has been added
    (0,external_wp_i18n_namespaceObject._n)('%d block added.', '%d blocks added.', (0,external_lodash_namespaceObject.castArray)(blocks).length), (0,external_lodash_namespaceObject.castArray)(blocks).length);
    (0,external_wp_a11y_namespaceObject.speak)(message);

    if (onSelect) {
      onSelect();
    }
  }, [isAppender, getSelectedBlock, replaceBlocks, insertBlocks, destinationRootClientId, destinationIndex, onSelect, shouldFocusBlock]);
  const onToggleInsertionPoint = (0,external_wp_element_namespaceObject.useCallback)(show => {
    if (show) {
      showInsertionPoint(destinationRootClientId, destinationIndex);
    } else {
      hideInsertionPoint();
    }
  }, [showInsertionPoint, hideInsertionPoint, destinationRootClientId, destinationIndex]);
  return [destinationRootClientId, onInsertBlocks, onToggleInsertionPoint];
}

/* harmony default export */ var use_insertion_point = (useInsertionPoint);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/search-items.js
/**
 * External dependencies
 */
 // Default search helpers.

const defaultGetName = item => item.name || '';

const defaultGetTitle = item => item.title;

const defaultGetDescription = item => item.description || '';

const defaultGetKeywords = item => item.keywords || [];

const defaultGetCategory = item => item.category;

const defaultGetCollection = () => null;
/**
 * Sanitizes the search input string.
 *
 * @param {string} input The search input to normalize.
 *
 * @return {string} The normalized search input.
 */


function normalizeSearchInput() {
  let input = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : '';
  // Disregard diacritics.
  //  Input: "média"
  input = (0,external_lodash_namespaceObject.deburr)(input); // Accommodate leading slash, matching autocomplete expectations.
  //  Input: "/media"

  input = input.replace(/^\//, ''); // Lowercase.
  //  Input: "MEDIA"

  input = input.toLowerCase();
  return input;
}
/**
 * Converts the search term into a list of normalized terms.
 *
 * @param {string} input The search term to normalize.
 *
 * @return {string[]} The normalized list of search terms.
 */


const getNormalizedSearchTerms = function () {
  let input = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : '';
  // Extract words.
  return (0,external_lodash_namespaceObject.words)(normalizeSearchInput(input));
};

const removeMatchingTerms = (unmatchedTerms, unprocessedTerms) => {
  return (0,external_lodash_namespaceObject.differenceWith)(unmatchedTerms, getNormalizedSearchTerms(unprocessedTerms), (unmatchedTerm, unprocessedTerm) => unprocessedTerm.includes(unmatchedTerm));
};

const searchBlockItems = (items, categories, collections, searchInput) => {
  const normalizedSearchTerms = getNormalizedSearchTerms(searchInput);

  if (normalizedSearchTerms.length === 0) {
    return items;
  }

  const config = {
    getCategory: item => {
      var _find;

      return (_find = (0,external_lodash_namespaceObject.find)(categories, {
        slug: item.category
      })) === null || _find === void 0 ? void 0 : _find.title;
    },
    getCollection: item => {
      var _collections$item$nam;

      return (_collections$item$nam = collections[item.name.split('/')[0]]) === null || _collections$item$nam === void 0 ? void 0 : _collections$item$nam.title;
    }
  };
  return searchItems(items, searchInput, config);
};
/**
 * Filters an item list given a search term.
 *
 * @param {Array}  items       Item list
 * @param {string} searchInput Search input.
 * @param {Object} config      Search Config.
 *
 * @return {Array} Filtered item list.
 */

const searchItems = function () {
  let items = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : [];
  let searchInput = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : '';
  let config = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
  const normalizedSearchTerms = getNormalizedSearchTerms(searchInput);

  if (normalizedSearchTerms.length === 0) {
    return items;
  }

  const rankedItems = items.map(item => {
    return [item, getItemSearchRank(item, searchInput, config)];
  }).filter(_ref => {
    let [, rank] = _ref;
    return rank > 0;
  });
  rankedItems.sort((_ref2, _ref3) => {
    let [, rank1] = _ref2;
    let [, rank2] = _ref3;
    return rank2 - rank1;
  });
  return rankedItems.map(_ref4 => {
    let [item] = _ref4;
    return item;
  });
};
/**
 * Get the search rank for a given item and a specific search term.
 * The better the match, the higher the rank.
 * If the rank equals 0, it should be excluded from the results.
 *
 * @param {Object} item       Item to filter.
 * @param {string} searchTerm Search term.
 * @param {Object} config     Search Config.
 *
 * @return {number} Search Rank.
 */

function getItemSearchRank(item, searchTerm) {
  let config = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
  const {
    getName = defaultGetName,
    getTitle = defaultGetTitle,
    getDescription = defaultGetDescription,
    getKeywords = defaultGetKeywords,
    getCategory = defaultGetCategory,
    getCollection = defaultGetCollection
  } = config;
  const name = getName(item);
  const title = getTitle(item);
  const description = getDescription(item);
  const keywords = getKeywords(item);
  const category = getCategory(item);
  const collection = getCollection(item);
  const normalizedSearchInput = normalizeSearchInput(searchTerm);
  const normalizedTitle = normalizeSearchInput(title);
  let rank = 0; // Prefers exact matches
  // Then prefers if the beginning of the title matches the search term
  // name, keywords, categories, collection, variations match come later.

  if (normalizedSearchInput === normalizedTitle) {
    rank += 30;
  } else if (normalizedTitle.startsWith(normalizedSearchInput)) {
    rank += 20;
  } else {
    const terms = [name, title, description, ...keywords, category, collection].join(' ');
    const normalizedSearchTerms = (0,external_lodash_namespaceObject.words)(normalizedSearchInput);
    const unmatchedTerms = removeMatchingTerms(normalizedSearchTerms, terms);

    if (unmatchedTerms.length === 0) {
      rank += 10;
    }
  } // Give a better rank to "core" namespaced items.


  if (rank !== 0 && name.startsWith('core/')) {
    const isCoreBlockVariation = name !== item.id; // Give a bit better rank to "core" blocks over "core" block variations.

    rank += isCoreBlockVariation ? 1 : 2;
  }

  return rank;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/block-patterns-explorer/patterns-list.js


/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */







const INITIAL_INSERTER_RESULTS = 2;

function PatternsListHeader(_ref) {
  let {
    filterValue,
    filteredBlockPatternsLength
  } = _ref;

  if (!filterValue) {
    return null;
  }

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalHeading, {
    level: 2,
    lineHeight: '48px',
    className: "block-editor-block-patterns-explorer__search-results-count"
  }, (0,external_wp_i18n_namespaceObject.sprintf)(
  /* translators: %d: number of patterns. %s: block pattern search query */
  (0,external_wp_i18n_namespaceObject._n)('%1$d pattern found for "%2$s"', '%1$d patterns found for "%2$s"', filteredBlockPatternsLength), filteredBlockPatternsLength, filterValue));
}

function PatternList(_ref2) {
  let {
    filterValue,
    selectedCategory,
    patternCategories
  } = _ref2;
  const debouncedSpeak = (0,external_wp_compose_namespaceObject.useDebounce)(external_wp_a11y_namespaceObject.speak, 500);
  const [destinationRootClientId, onInsertBlocks] = use_insertion_point({
    shouldFocusBlock: true
  });
  const [allPatterns,, onSelectBlockPattern] = use_patterns_state(onInsertBlocks, destinationRootClientId);
  const registeredPatternCategories = (0,external_wp_element_namespaceObject.useMemo)(() => patternCategories.map(patternCategory => patternCategory.name), [patternCategories]);
  const filteredBlockPatterns = (0,external_wp_element_namespaceObject.useMemo)(() => {
    if (!filterValue) {
      return allPatterns.filter(pattern => {
        var _pattern$categories, _pattern$categories2;

        return selectedCategory === 'uncategorized' ? !((_pattern$categories = pattern.categories) !== null && _pattern$categories !== void 0 && _pattern$categories.length) || pattern.categories.every(category => !registeredPatternCategories.includes(category)) : (_pattern$categories2 = pattern.categories) === null || _pattern$categories2 === void 0 ? void 0 : _pattern$categories2.includes(selectedCategory);
      });
    }

    return searchItems(allPatterns, filterValue);
  }, [filterValue, selectedCategory, allPatterns]); // Announce search results on change.

  (0,external_wp_element_namespaceObject.useEffect)(() => {
    if (!filterValue) {
      return;
    }

    const count = filteredBlockPatterns.length;
    const resultsFoundMessage = (0,external_wp_i18n_namespaceObject.sprintf)(
    /* translators: %d: number of results. */
    (0,external_wp_i18n_namespaceObject._n)('%d result found.', '%d results found.', count), count);
    debouncedSpeak(resultsFoundMessage);
  }, [filterValue, debouncedSpeak]);
  const currentShownPatterns = (0,external_wp_compose_namespaceObject.useAsyncList)(filteredBlockPatterns, {
    step: INITIAL_INSERTER_RESULTS
  });
  const hasItems = !!(filteredBlockPatterns !== null && filteredBlockPatterns !== void 0 && filteredBlockPatterns.length);
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-patterns-explorer__list"
  }, hasItems && (0,external_wp_element_namespaceObject.createElement)(PatternsListHeader, {
    filterValue: filterValue,
    filteredBlockPatternsLength: filteredBlockPatterns.length
  }), (0,external_wp_element_namespaceObject.createElement)(inserter_listbox, null, !hasItems && (0,external_wp_element_namespaceObject.createElement)(no_results, null), hasItems && (0,external_wp_element_namespaceObject.createElement)(block_patterns_list, {
    shownPatterns: currentShownPatterns,
    blockPatterns: filteredBlockPatterns,
    onClickPattern: onSelectBlockPattern,
    isDraggable: false
  })));
}

/* harmony default export */ var patterns_list = (PatternList);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/block-patterns-explorer/explorer.js


/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */




function PatternsExplorer(_ref) {
  let {
    initialCategory,
    patternCategories
  } = _ref;
  const [filterValue, setFilterValue] = (0,external_wp_element_namespaceObject.useState)('');
  const [selectedCategory, setSelectedCategory] = (0,external_wp_element_namespaceObject.useState)(initialCategory === null || initialCategory === void 0 ? void 0 : initialCategory.name);
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-patterns-explorer"
  }, (0,external_wp_element_namespaceObject.createElement)(sidebar, {
    selectedCategory: selectedCategory,
    patternCategories: patternCategories,
    onClickCategory: setSelectedCategory,
    filterValue: filterValue,
    setFilterValue: setFilterValue
  }), (0,external_wp_element_namespaceObject.createElement)(patterns_list, {
    filterValue: filterValue,
    selectedCategory: selectedCategory,
    patternCategories: patternCategories
  }));
}

function PatternsExplorerModal(_ref2) {
  let {
    onModalClose,
    ...restProps
  } = _ref2;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Modal, {
    title: (0,external_wp_i18n_namespaceObject.__)('Patterns'),
    closeLabel: (0,external_wp_i18n_namespaceObject.__)('Close'),
    onRequestClose: onModalClose,
    isFullScreen: true
  }, (0,external_wp_element_namespaceObject.createElement)(PatternsExplorer, restProps));
}

/* harmony default export */ var explorer = (PatternsExplorerModal);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/block-patterns-tab.js


/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */






function BlockPatternsCategory(_ref) {
  let {
    rootClientId,
    onInsert,
    selectedCategory,
    populatedCategories
  } = _ref;
  const [allPatterns,, onClick] = use_patterns_state(onInsert, rootClientId);
  const getPatternIndex = (0,external_wp_element_namespaceObject.useCallback)(pattern => {
    var _pattern$categories;

    if (!((_pattern$categories = pattern.categories) !== null && _pattern$categories !== void 0 && _pattern$categories.length)) {
      return Infinity;
    }

    const indexedCategories = populatedCategories.reduce((accumulator, _ref2, index) => {
      let {
        name
      } = _ref2;
      accumulator[name] = index;
      return accumulator;
    }, {});
    return Math.min(...pattern.categories.map(cat => indexedCategories[cat] !== undefined ? indexedCategories[cat] : Infinity));
  }, [populatedCategories]);
  const currentCategoryPatterns = (0,external_wp_element_namespaceObject.useMemo)(() => allPatterns.filter(pattern => {
    var _pattern$categories2;

    return selectedCategory.name === 'uncategorized' ? getPatternIndex(pattern) === Infinity : (_pattern$categories2 = pattern.categories) === null || _pattern$categories2 === void 0 ? void 0 : _pattern$categories2.includes(selectedCategory.name);
  }), [allPatterns, selectedCategory]); // Ordering the patterns is important for the async rendering.

  const orderedPatterns = (0,external_wp_element_namespaceObject.useMemo)(() => {
    return currentCategoryPatterns.sort((a, b) => {
      return getPatternIndex(a) - getPatternIndex(b);
    });
  }, [currentCategoryPatterns, getPatternIndex]);
  const currentShownPatterns = (0,external_wp_compose_namespaceObject.useAsyncList)(orderedPatterns);

  if (!currentCategoryPatterns.length) {
    return null;
  }

  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-inserter__panel-content"
  }, (0,external_wp_element_namespaceObject.createElement)(block_patterns_list, {
    shownPatterns: currentShownPatterns,
    blockPatterns: currentCategoryPatterns,
    onClickPattern: onClick,
    label: selectedCategory.label,
    orientation: "vertical",
    isDraggable: true
  }));
}

function BlockPatternsTabs(_ref3) {
  let {
    rootClientId,
    onInsert,
    onClickCategory,
    selectedCategory
  } = _ref3;
  const [showPatternsExplorer, setShowPatternsExplorer] = (0,external_wp_element_namespaceObject.useState)(false);
  const [allPatterns, allCategories] = use_patterns_state();
  const hasRegisteredCategory = (0,external_wp_element_namespaceObject.useCallback)(pattern => {
    if (!pattern.categories || !pattern.categories.length) {
      return false;
    }

    return pattern.categories.some(cat => allCategories.some(category => category.name === cat));
  }, [allCategories]); // Remove any empty categories.

  const populatedCategories = (0,external_wp_element_namespaceObject.useMemo)(() => {
    const categories = allCategories.filter(category => allPatterns.some(pattern => {
      var _pattern$categories3;

      return (_pattern$categories3 = pattern.categories) === null || _pattern$categories3 === void 0 ? void 0 : _pattern$categories3.includes(category.name);
    })).sort((_ref4, _ref5) => {
      let {
        name: currentName
      } = _ref4;
      let {
        name: nextName
      } = _ref5;

      if (![currentName, nextName].includes('featured')) {
        return 0;
      }

      return currentName === 'featured' ? -1 : 1;
    });

    if (allPatterns.some(pattern => !hasRegisteredCategory(pattern)) && !categories.find(category => category.name === 'uncategorized')) {
      categories.push({
        name: 'uncategorized',
        label: (0,external_wp_i18n_namespaceObject._x)('Uncategorized')
      });
    }

    return categories;
  }, [allPatterns, allCategories]);
  const patternCategory = selectedCategory ? selectedCategory : populatedCategories[0];
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(pattern_panel, {
    selectedCategory: patternCategory,
    patternCategories: populatedCategories,
    onClickCategory: onClickCategory,
    openPatternExplorer: () => setShowPatternsExplorer(true)
  }), !showPatternsExplorer && (0,external_wp_element_namespaceObject.createElement)(BlockPatternsCategory, {
    rootClientId: rootClientId,
    onInsert: onInsert,
    selectedCategory: patternCategory,
    populatedCategories: populatedCategories
  }), showPatternsExplorer && (0,external_wp_element_namespaceObject.createElement)(explorer, {
    initialCategory: patternCategory,
    patternCategories: populatedCategories,
    onModalClose: () => setShowPatternsExplorer(false)
  }));
}

/* harmony default export */ var block_patterns_tab = (BlockPatternsTabs);

;// CONCATENATED MODULE: external ["wp","url"]
var external_wp_url_namespaceObject = window["wp"]["url"];
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/reusable-blocks-tab.js


/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */






function ReusableBlocksList(_ref) {
  let {
    onHover,
    onInsert,
    rootClientId
  } = _ref;
  const [items,,, onSelectItem] = use_block_types_state(rootClientId, onInsert);
  const filteredItems = (0,external_wp_element_namespaceObject.useMemo)(() => {
    return items.filter(_ref2 => {
      let {
        category
      } = _ref2;
      return category === 'reusable';
    });
  }, [items]);

  if (filteredItems.length === 0) {
    return (0,external_wp_element_namespaceObject.createElement)(no_results, null);
  }

  return (0,external_wp_element_namespaceObject.createElement)(panel, {
    title: (0,external_wp_i18n_namespaceObject.__)('Reusable blocks')
  }, (0,external_wp_element_namespaceObject.createElement)(block_types_list, {
    items: filteredItems,
    onSelect: onSelectItem,
    onHover: onHover,
    label: (0,external_wp_i18n_namespaceObject.__)('Reusable blocks')
  }));
} // The unwrapped component is only exported for use by unit tests.

/**
 * List of reusable blocks shown in the "Reusable" tab of the inserter.
 *
 * @param {Object}   props              Component props.
 * @param {?string}  props.rootClientId Client id of block to insert into.
 * @param {Function} props.onInsert     Callback to run when item is inserted.
 * @param {Function} props.onHover      Callback to run when item is hovered.
 *
 * @return {WPComponent} The component.
 */


function ReusableBlocksTab(_ref3) {
  let {
    rootClientId,
    onInsert,
    onHover
  } = _ref3;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(ReusableBlocksList, {
    onHover: onHover,
    onInsert: onInsert,
    rootClientId: rootClientId
  }), (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-inserter__manage-reusable-blocks-container"
  }, (0,external_wp_element_namespaceObject.createElement)("a", {
    className: "block-editor-inserter__manage-reusable-blocks",
    href: (0,external_wp_url_namespaceObject.addQueryArgs)('edit.php', {
      post_type: 'wp_block'
    })
  }, (0,external_wp_i18n_namespaceObject.__)('Manage Reusable blocks'))));
}
/* harmony default export */ var reusable_blocks_tab = (ReusableBlocksTab);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter-menu-extension/index.js
/**
 * WordPress dependencies
 */

const {
  Fill: __unstableInserterMenuExtension,
  Slot
} = (0,external_wp_components_namespaceObject.createSlotFill)('__unstableInserterMenuExtension');
__unstableInserterMenuExtension.Slot = Slot;
/* harmony default export */ var inserter_menu_extension = (__unstableInserterMenuExtension);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/search-results.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */











const search_results_INITIAL_INSERTER_RESULTS = 9;
/**
 * Shared reference to an empty array for cases where it is important to avoid
 * returning a new array reference on every invocation and rerendering the component.
 *
 * @type {Array}
 */

const search_results_EMPTY_ARRAY = [];

function InserterSearchResults(_ref) {
  let {
    filterValue,
    onSelect,
    onHover,
    rootClientId,
    clientId,
    isAppender,
    __experimentalInsertionIndex,
    maxBlockPatterns,
    maxBlockTypes,
    showBlockDirectory = false,
    isDraggable = true,
    shouldFocusBlock = true,
    prioritizePatterns
  } = _ref;
  const debouncedSpeak = (0,external_wp_compose_namespaceObject.useDebounce)(external_wp_a11y_namespaceObject.speak, 500);
  const [destinationRootClientId, onInsertBlocks] = use_insertion_point({
    onSelect,
    rootClientId,
    clientId,
    isAppender,
    insertionIndex: __experimentalInsertionIndex,
    shouldFocusBlock
  });
  const [blockTypes, blockTypeCategories, blockTypeCollections, onSelectBlockType] = use_block_types_state(destinationRootClientId, onInsertBlocks);
  const [patterns,, onSelectBlockPattern] = use_patterns_state(onInsertBlocks, destinationRootClientId);
  const filteredBlockPatterns = (0,external_wp_element_namespaceObject.useMemo)(() => {
    if (maxBlockPatterns === 0) {
      return [];
    }

    const results = searchItems(patterns, filterValue);
    return maxBlockPatterns !== undefined ? results.slice(0, maxBlockPatterns) : results;
  }, [filterValue, patterns, maxBlockPatterns]);
  let maxBlockTypesToShow = maxBlockTypes;

  if (prioritizePatterns && filteredBlockPatterns.length > 2) {
    maxBlockTypesToShow = 0;
  }

  const filteredBlockTypes = (0,external_wp_element_namespaceObject.useMemo)(() => {
    if (maxBlockTypesToShow === 0) {
      return [];
    }

    const results = searchBlockItems((0,external_lodash_namespaceObject.orderBy)(blockTypes, ['frecency'], ['desc']), blockTypeCategories, blockTypeCollections, filterValue);
    return maxBlockTypesToShow !== undefined ? results.slice(0, maxBlockTypesToShow) : results;
  }, [filterValue, blockTypes, blockTypeCategories, blockTypeCollections, maxBlockTypes]); // Announce search results on change.

  (0,external_wp_element_namespaceObject.useEffect)(() => {
    if (!filterValue) {
      return;
    }

    const count = filteredBlockTypes.length + filteredBlockPatterns.length;
    const resultsFoundMessage = (0,external_wp_i18n_namespaceObject.sprintf)(
    /* translators: %d: number of results. */
    (0,external_wp_i18n_namespaceObject._n)('%d result found.', '%d results found.', count), count);
    debouncedSpeak(resultsFoundMessage);
  }, [filterValue, debouncedSpeak]);
  const currentShownBlockTypes = (0,external_wp_compose_namespaceObject.useAsyncList)(filteredBlockTypes, {
    step: search_results_INITIAL_INSERTER_RESULTS
  });
  const currentShownPatterns = (0,external_wp_compose_namespaceObject.useAsyncList)(currentShownBlockTypes.length === filteredBlockTypes.length ? filteredBlockPatterns : search_results_EMPTY_ARRAY);
  const hasItems = !(0,external_lodash_namespaceObject.isEmpty)(filteredBlockTypes) || !(0,external_lodash_namespaceObject.isEmpty)(filteredBlockPatterns);
  const blocksUI = !!filteredBlockTypes.length && (0,external_wp_element_namespaceObject.createElement)(panel, {
    title: (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.VisuallyHidden, null, (0,external_wp_i18n_namespaceObject.__)('Blocks'))
  }, (0,external_wp_element_namespaceObject.createElement)(block_types_list, {
    items: currentShownBlockTypes,
    onSelect: onSelectBlockType,
    onHover: onHover,
    label: (0,external_wp_i18n_namespaceObject.__)('Blocks'),
    isDraggable: isDraggable
  }));
  const patternsUI = !!filteredBlockPatterns.length && (0,external_wp_element_namespaceObject.createElement)(panel, {
    title: (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.VisuallyHidden, null, (0,external_wp_i18n_namespaceObject.__)('Block Patterns'))
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-inserter__quick-inserter-patterns"
  }, (0,external_wp_element_namespaceObject.createElement)(block_patterns_list, {
    shownPatterns: currentShownPatterns,
    blockPatterns: filteredBlockPatterns,
    onClickPattern: onSelectBlockPattern,
    isDraggable: isDraggable
  })));
  return (0,external_wp_element_namespaceObject.createElement)(inserter_listbox, null, !showBlockDirectory && !hasItems && (0,external_wp_element_namespaceObject.createElement)(no_results, null), prioritizePatterns ? patternsUI : blocksUI, !!filteredBlockTypes.length && !!filteredBlockPatterns.length && (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-inserter__quick-inserter-separator"
  }), prioritizePatterns ? blocksUI : patternsUI, showBlockDirectory && (0,external_wp_element_namespaceObject.createElement)(inserter_menu_extension.Slot, {
    fillProps: {
      onSelect: onSelectBlockType,
      onHover,
      filterValue,
      hasItems,
      rootClientId: destinationRootClientId
    }
  }, fills => {
    if (fills.length) {
      return fills;
    }

    if (!hasItems) {
      return (0,external_wp_element_namespaceObject.createElement)(no_results, null);
    }

    return null;
  }));
}

/* harmony default export */ var search_results = (InserterSearchResults);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/tabs.js


/**
 * WordPress dependencies
 */



const blocksTab = {
  name: 'blocks',

  /* translators: Blocks tab title in the block inserter. */
  title: (0,external_wp_i18n_namespaceObject.__)('Blocks')
};
const patternsTab = {
  name: 'patterns',

  /* translators: Patterns tab title in the block inserter. */
  title: (0,external_wp_i18n_namespaceObject.__)('Patterns')
};
const reusableBlocksTab = {
  name: 'reusable',

  /* translators: Reusable blocks tab title in the block inserter. */
  title: (0,external_wp_i18n_namespaceObject.__)('Reusable')
};

function InserterTabs(_ref) {
  let {
    children,
    showPatterns = false,
    showReusableBlocks = false,
    onSelect
  } = _ref;
  const tabs = (0,external_wp_element_namespaceObject.useMemo)(() => {
    const tempTabs = [blocksTab];

    if (showPatterns) {
      tempTabs.push(patternsTab);
    }

    if (showReusableBlocks) {
      tempTabs.push(reusableBlocksTab);
    }

    return tempTabs;
  }, [blocksTab, showPatterns, patternsTab, showReusableBlocks, reusableBlocksTab]);
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.TabPanel, {
    className: "block-editor-inserter__tabs",
    tabs: tabs,
    onSelect: onSelect
  }, children);
}

/* harmony default export */ var tabs = (InserterTabs);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/menu.js


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */











function InserterMenu(_ref, ref) {
  let {
    rootClientId,
    clientId,
    isAppender,
    __experimentalInsertionIndex,
    onSelect,
    showInserterHelpPanel,
    showMostUsedBlocks,
    __experimentalFilterValue = '',
    shouldFocusBlock = true
  } = _ref;
  const [filterValue, setFilterValue] = (0,external_wp_element_namespaceObject.useState)(__experimentalFilterValue);
  const [hoveredItem, setHoveredItem] = (0,external_wp_element_namespaceObject.useState)(null);
  const [selectedPatternCategory, setSelectedPatternCategory] = (0,external_wp_element_namespaceObject.useState)(null);
  const [destinationRootClientId, onInsertBlocks, onToggleInsertionPoint] = use_insertion_point({
    rootClientId,
    clientId,
    isAppender,
    insertionIndex: __experimentalInsertionIndex,
    shouldFocusBlock
  });
  const {
    showPatterns,
    hasReusableBlocks
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    var _getSettings$__experi;

    const {
      __experimentalGetAllowedPatterns,
      getSettings
    } = select(store);
    return {
      showPatterns: !!__experimentalGetAllowedPatterns(destinationRootClientId).length,
      hasReusableBlocks: !!((_getSettings$__experi = getSettings().__experimentalReusableBlocks) !== null && _getSettings$__experi !== void 0 && _getSettings$__experi.length)
    };
  }, [destinationRootClientId]);
  const onInsert = (0,external_wp_element_namespaceObject.useCallback)((blocks, meta, shouldForceFocusBlock) => {
    onInsertBlocks(blocks, meta, shouldForceFocusBlock);
    onSelect();
  }, [onInsertBlocks, onSelect]);
  const onInsertPattern = (0,external_wp_element_namespaceObject.useCallback)((blocks, patternName) => {
    onInsertBlocks(blocks, {
      patternName
    });
    onSelect();
  }, [onInsertBlocks, onSelect]);
  const onHover = (0,external_wp_element_namespaceObject.useCallback)(item => {
    onToggleInsertionPoint(!!item);
    setHoveredItem(item);
  }, [onToggleInsertionPoint, setHoveredItem]);
  const onClickPatternCategory = (0,external_wp_element_namespaceObject.useCallback)(patternCategory => {
    setSelectedPatternCategory(patternCategory);
  }, [setSelectedPatternCategory]);
  const blocksTab = (0,external_wp_element_namespaceObject.useMemo)(() => (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-inserter__block-list"
  }, (0,external_wp_element_namespaceObject.createElement)(block_types_tab, {
    rootClientId: destinationRootClientId,
    onInsert: onInsert,
    onHover: onHover,
    showMostUsedBlocks: showMostUsedBlocks
  })), showInserterHelpPanel && (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-inserter__tips"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.VisuallyHidden, {
    as: "h2"
  }, (0,external_wp_i18n_namespaceObject.__)('A tip for using the block editor')), (0,external_wp_element_namespaceObject.createElement)(tips, null))), [destinationRootClientId, onInsert, onHover, filterValue, showMostUsedBlocks, showInserterHelpPanel]);
  const patternsTab = (0,external_wp_element_namespaceObject.useMemo)(() => (0,external_wp_element_namespaceObject.createElement)(block_patterns_tab, {
    rootClientId: destinationRootClientId,
    onInsert: onInsertPattern,
    onClickCategory: onClickPatternCategory,
    selectedCategory: selectedPatternCategory
  }), [destinationRootClientId, onInsertPattern, onClickPatternCategory, selectedPatternCategory]);
  const reusableBlocksTab = (0,external_wp_element_namespaceObject.useMemo)(() => (0,external_wp_element_namespaceObject.createElement)(reusable_blocks_tab, {
    rootClientId: destinationRootClientId,
    onInsert: onInsert,
    onHover: onHover
  }), [destinationRootClientId, onInsert, onHover]);
  const getCurrentTab = (0,external_wp_element_namespaceObject.useCallback)(tab => {
    if (tab.name === 'blocks') {
      return blocksTab;
    } else if (tab.name === 'patterns') {
      return patternsTab;
    }

    return reusableBlocksTab;
  }, [blocksTab, patternsTab, reusableBlocksTab]);
  const searchRef = (0,external_wp_element_namespaceObject.useRef)();
  (0,external_wp_element_namespaceObject.useImperativeHandle)(ref, () => ({
    focusSearch: () => {
      searchRef.current.focus();
    }
  }));
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-inserter__menu"
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-inserter__main-area"
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-inserter__content"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.SearchControl, {
    className: "block-editor-inserter__search",
    onChange: value => {
      if (hoveredItem) setHoveredItem(null);
      setFilterValue(value);
    },
    value: filterValue,
    label: (0,external_wp_i18n_namespaceObject.__)('Search for blocks and patterns'),
    placeholder: (0,external_wp_i18n_namespaceObject.__)('Search'),
    ref: searchRef
  }), !!filterValue && (0,external_wp_element_namespaceObject.createElement)(search_results, {
    filterValue: filterValue,
    onSelect: onSelect,
    onHover: onHover,
    rootClientId: rootClientId,
    clientId: clientId,
    isAppender: isAppender,
    __experimentalInsertionIndex: __experimentalInsertionIndex,
    showBlockDirectory: true,
    shouldFocusBlock: shouldFocusBlock
  }), !filterValue && (showPatterns || hasReusableBlocks) && (0,external_wp_element_namespaceObject.createElement)(tabs, {
    showPatterns: showPatterns,
    showReusableBlocks: hasReusableBlocks
  }, getCurrentTab), !filterValue && !showPatterns && !hasReusableBlocks && blocksTab)), showInserterHelpPanel && hoveredItem && (0,external_wp_element_namespaceObject.createElement)(preview_panel, {
    item: hoveredItem
  }));
}

/* harmony default export */ var menu = ((0,external_wp_element_namespaceObject.forwardRef)(InserterMenu));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/quick-inserter.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */






const SEARCH_THRESHOLD = 6;
const SHOWN_BLOCK_TYPES = 6;
const SHOWN_BLOCK_PATTERNS = 2;
const SHOWN_BLOCK_PATTERNS_WITH_PRIORITIZATION = 4;
function QuickInserter(_ref) {
  let {
    onSelect,
    rootClientId,
    clientId,
    isAppender,
    prioritizePatterns
  } = _ref;
  const [filterValue, setFilterValue] = (0,external_wp_element_namespaceObject.useState)('');
  const [destinationRootClientId, onInsertBlocks] = use_insertion_point({
    onSelect,
    rootClientId,
    clientId,
    isAppender
  });
  const [blockTypes] = use_block_types_state(destinationRootClientId, onInsertBlocks);
  const [patterns] = use_patterns_state(onInsertBlocks, destinationRootClientId);
  const {
    setInserterIsOpened,
    insertionIndex
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getSettings,
      getBlockIndex,
      getBlockCount
    } = select(store);
    const settings = getSettings();
    const index = getBlockIndex(clientId);
    const blockCount = getBlockCount();
    return {
      setInserterIsOpened: settings.__experimentalSetIsInserterOpened,
      insertionIndex: index === -1 ? blockCount : index
    };
  }, [clientId]);
  const showPatterns = patterns.length && (!!filterValue || prioritizePatterns);
  const showSearch = showPatterns && patterns.length > SEARCH_THRESHOLD || blockTypes.length > SEARCH_THRESHOLD;
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    if (setInserterIsOpened) {
      setInserterIsOpened(false);
    }
  }, [setInserterIsOpened]); // When clicking Browse All select the appropriate block so as
  // the insertion point can work as expected.

  const onBrowseAll = () => {
    setInserterIsOpened({
      rootClientId,
      insertionIndex,
      filterValue
    });
  };

  let maxBlockPatterns = 0;

  if (showPatterns) {
    maxBlockPatterns = prioritizePatterns ? SHOWN_BLOCK_PATTERNS_WITH_PRIORITIZATION : SHOWN_BLOCK_PATTERNS;
  }

  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: classnames_default()('block-editor-inserter__quick-inserter', {
      'has-search': showSearch,
      'has-expand': setInserterIsOpened
    })
  }, showSearch && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.SearchControl, {
    className: "block-editor-inserter__search",
    value: filterValue,
    onChange: value => {
      setFilterValue(value);
    },
    label: (0,external_wp_i18n_namespaceObject.__)('Search for blocks and patterns'),
    placeholder: (0,external_wp_i18n_namespaceObject.__)('Search')
  }), (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-inserter__quick-inserter-results"
  }, (0,external_wp_element_namespaceObject.createElement)(search_results, {
    filterValue: filterValue,
    onSelect: onSelect,
    rootClientId: rootClientId,
    clientId: clientId,
    isAppender: isAppender,
    maxBlockPatterns: maxBlockPatterns,
    maxBlockTypes: SHOWN_BLOCK_TYPES,
    isDraggable: false,
    prioritizePatterns: prioritizePatterns
  })), setInserterIsOpened && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    className: "block-editor-inserter__quick-inserter-expand",
    onClick: onBrowseAll,
    "aria-label": (0,external_wp_i18n_namespaceObject.__)('Browse all. This will open the main inserter panel in the editor toolbar.')
  }, (0,external_wp_i18n_namespaceObject.__)('Browse all')));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/index.js



/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */









/**
 * Internal dependencies
 */





const defaultRenderToggle = _ref => {
  let {
    onToggle,
    disabled,
    isOpen,
    blockTitle,
    hasSingleBlockType,
    toggleProps = {},
    prioritizePatterns
  } = _ref;
  let label;

  if (hasSingleBlockType) {
    label = (0,external_wp_i18n_namespaceObject.sprintf)( // translators: %s: the name of the block when there is only one
    (0,external_wp_i18n_namespaceObject._x)('Add %s', 'directly add the only allowed block'), blockTitle);
  } else if (prioritizePatterns) {
    label = (0,external_wp_i18n_namespaceObject.__)('Add pattern');
  } else {
    label = (0,external_wp_i18n_namespaceObject._x)('Add block', 'Generic label for block inserter button');
  }

  const {
    onClick,
    ...rest
  } = toggleProps; // Handle both onClick functions from the toggle and the parent component.

  function handleClick(event) {
    if (onToggle) {
      onToggle(event);
    }

    if (onClick) {
      onClick(event);
    }
  }

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, _extends({
    icon: library_plus,
    label: label,
    tooltipPosition: "bottom",
    onClick: handleClick,
    className: "block-editor-inserter__toggle",
    "aria-haspopup": !hasSingleBlockType ? 'true' : false,
    "aria-expanded": !hasSingleBlockType ? isOpen : false,
    disabled: disabled
  }, rest));
};

class Inserter extends external_wp_element_namespaceObject.Component {
  constructor() {
    super(...arguments);
    this.onToggle = this.onToggle.bind(this);
    this.renderToggle = this.renderToggle.bind(this);
    this.renderContent = this.renderContent.bind(this);
  }

  onToggle(isOpen) {
    const {
      onToggle
    } = this.props; // Surface toggle callback to parent component.

    if (onToggle) {
      onToggle(isOpen);
    }
  }
  /**
   * Render callback to display Dropdown toggle element.
   *
   * @param {Object}   options
   * @param {Function} options.onToggle Callback to invoke when toggle is
   *                                    pressed.
   * @param {boolean}  options.isOpen   Whether dropdown is currently open.
   *
   * @return {WPElement} Dropdown toggle element.
   */


  renderToggle(_ref2) {
    let {
      onToggle,
      isOpen
    } = _ref2;
    const {
      disabled,
      blockTitle,
      hasSingleBlockType,
      directInsertBlock,
      toggleProps,
      hasItems,
      renderToggle = defaultRenderToggle,
      prioritizePatterns
    } = this.props;
    return renderToggle({
      onToggle,
      isOpen,
      disabled: disabled || !hasItems,
      blockTitle,
      hasSingleBlockType,
      directInsertBlock,
      toggleProps,
      prioritizePatterns
    });
  }
  /**
   * Render callback to display Dropdown content element.
   *
   * @param {Object}   options
   * @param {Function} options.onClose Callback to invoke when dropdown is
   *                                   closed.
   *
   * @return {WPElement} Dropdown content element.
   */


  renderContent(_ref3) {
    let {
      onClose
    } = _ref3;
    const {
      rootClientId,
      clientId,
      isAppender,
      showInserterHelpPanel,
      // This prop is experimental to give some time for the quick inserter to mature
      // Feel free to make them stable after a few releases.
      __experimentalIsQuick: isQuick,
      prioritizePatterns
    } = this.props;

    if (isQuick) {
      return (0,external_wp_element_namespaceObject.createElement)(QuickInserter, {
        onSelect: () => {
          onClose();
        },
        rootClientId: rootClientId,
        clientId: clientId,
        isAppender: isAppender,
        prioritizePatterns: prioritizePatterns
      });
    }

    return (0,external_wp_element_namespaceObject.createElement)(menu, {
      onSelect: () => {
        onClose();
      },
      rootClientId: rootClientId,
      clientId: clientId,
      isAppender: isAppender,
      showInserterHelpPanel: showInserterHelpPanel
    });
  }

  render() {
    const {
      position,
      hasSingleBlockType,
      directInsertBlock,
      insertOnlyAllowedBlock,
      __experimentalIsQuick: isQuick,
      onSelectOrClose
    } = this.props;

    if (hasSingleBlockType || directInsertBlock) {
      return this.renderToggle({
        onToggle: insertOnlyAllowedBlock
      });
    }

    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Dropdown, {
      className: "block-editor-inserter",
      contentClassName: classnames_default()('block-editor-inserter__popover', {
        'is-quick': isQuick
      }),
      position: position,
      onToggle: this.onToggle,
      expandOnMobile: true,
      headerTitle: (0,external_wp_i18n_namespaceObject.__)('Add a block'),
      renderToggle: this.renderToggle,
      renderContent: this.renderContent,
      onClose: onSelectOrClose
    });
  }

}

/* harmony default export */ var inserter = ((0,external_wp_compose_namespaceObject.compose)([(0,external_wp_data_namespaceObject.withSelect)((select, _ref4) => {
  let {
    clientId,
    rootClientId
  } = _ref4;
  const {
    getBlockRootClientId,
    hasInserterItems,
    __experimentalGetAllowedBlocks,
    __experimentalGetDirectInsertBlock,
    getBlockIndex,
    getBlockCount,
    getSettings
  } = select(store);
  const {
    getBlockVariations
  } = select(external_wp_blocks_namespaceObject.store);
  rootClientId = rootClientId || getBlockRootClientId(clientId) || undefined;

  const allowedBlocks = __experimentalGetAllowedBlocks(rootClientId);

  const directInsertBlock = __experimentalGetDirectInsertBlock(rootClientId);

  const index = getBlockIndex(clientId);
  const blockCount = getBlockCount();
  const settings = getSettings();
  const hasSingleBlockType = (0,external_lodash_namespaceObject.size)(allowedBlocks) === 1 && (0,external_lodash_namespaceObject.size)(getBlockVariations(allowedBlocks[0].name, 'inserter')) === 0;
  let allowedBlockType = false;

  if (hasSingleBlockType) {
    allowedBlockType = allowedBlocks[0];
  }

  return {
    hasItems: hasInserterItems(rootClientId),
    hasSingleBlockType,
    blockTitle: allowedBlockType ? allowedBlockType.title : '',
    allowedBlockType,
    directInsertBlock,
    rootClientId,
    prioritizePatterns: settings.__experimentalPreferPatternsOnRoot && !rootClientId && index > 0 && (index < blockCount || blockCount === 0)
  };
}), (0,external_wp_data_namespaceObject.withDispatch)((dispatch, ownProps, _ref5) => {
  let {
    select
  } = _ref5;
  return {
    insertOnlyAllowedBlock() {
      const {
        rootClientId,
        clientId,
        isAppender,
        hasSingleBlockType,
        allowedBlockType,
        directInsertBlock,
        onSelectOrClose
      } = ownProps;

      if (!hasSingleBlockType && !directInsertBlock) {
        return;
      }

      function getAdjacentBlockAttributes(attributesToCopy) {
        const {
          getBlock,
          getPreviousBlockClientId
        } = select(store);

        if (!attributesToCopy || !clientId && !rootClientId) {
          return {};
        }

        const result = {};
        let adjacentAttributes = {}; // If there is no clientId, then attempt to get attributes
        // from the last block within innerBlocks of the root block.

        if (!clientId) {
          var _parentBlock$innerBlo;

          const parentBlock = getBlock(rootClientId);

          if (parentBlock !== null && parentBlock !== void 0 && (_parentBlock$innerBlo = parentBlock.innerBlocks) !== null && _parentBlock$innerBlo !== void 0 && _parentBlock$innerBlo.length) {
            const lastInnerBlock = parentBlock.innerBlocks[parentBlock.innerBlocks.length - 1];

            if (directInsertBlock && (directInsertBlock === null || directInsertBlock === void 0 ? void 0 : directInsertBlock.name) === lastInnerBlock.name) {
              adjacentAttributes = lastInnerBlock.attributes;
            }
          }
        } else {
          // Otherwise, attempt to get attributes from the
          // previous block relative to the current clientId.
          const currentBlock = getBlock(clientId);
          const previousBlock = getBlock(getPreviousBlockClientId(clientId));

          if ((currentBlock === null || currentBlock === void 0 ? void 0 : currentBlock.name) === (previousBlock === null || previousBlock === void 0 ? void 0 : previousBlock.name)) {
            adjacentAttributes = (previousBlock === null || previousBlock === void 0 ? void 0 : previousBlock.attributes) || {};
          }
        } // Copy over only those attributes flagged to be copied.


        attributesToCopy.forEach(attribute => {
          if (adjacentAttributes.hasOwnProperty(attribute)) {
            result[attribute] = adjacentAttributes[attribute];
          }
        });
        return result;
      }

      function getInsertionIndex() {
        const {
          getBlockIndex,
          getBlockSelectionEnd,
          getBlockOrder,
          getBlockRootClientId
        } = select(store); // If the clientId is defined, we insert at the position of the block.

        if (clientId) {
          return getBlockIndex(clientId);
        } // If there a selected block, we insert after the selected block.


        const end = getBlockSelectionEnd();

        if (!isAppender && end && getBlockRootClientId(end) === rootClientId) {
          return getBlockIndex(end) + 1;
        } // Otherwise, we insert at the end of the current rootClientId.


        return getBlockOrder(rootClientId).length;
      }

      const {
        insertBlock
      } = dispatch(store);
      let blockToInsert; // Attempt to augment the directInsertBlock with attributes from an adjacent block.
      // This ensures styling from nearby blocks is preserved in the newly inserted block.
      // See: https://github.com/WordPress/gutenberg/issues/37904

      if (directInsertBlock) {
        const newAttributes = getAdjacentBlockAttributes(directInsertBlock.attributesToCopy);
        blockToInsert = (0,external_wp_blocks_namespaceObject.createBlock)(directInsertBlock.name, { ...(directInsertBlock.attributes || {}),
          ...newAttributes
        });
      } else {
        blockToInsert = (0,external_wp_blocks_namespaceObject.createBlock)(allowedBlockType.name);
      }

      insertBlock(blockToInsert, getInsertionIndex(), rootClientId);

      if (onSelectOrClose) {
        onSelectOrClose();
      }

      const message = (0,external_wp_i18n_namespaceObject.sprintf)( // translators: %s: the name of the block that has been added
      (0,external_wp_i18n_namespaceObject.__)('%s block added'), allowedBlockType.title);
      (0,external_wp_a11y_namespaceObject.speak)(message);
    }

  };
}), // The global inserter should always be visible, we are using ( ! isAppender && ! rootClientId && ! clientId ) as
// a way to detect the global Inserter.
(0,external_wp_compose_namespaceObject.ifCondition)(_ref6 => {
  let {
    hasItems,
    isAppender,
    rootClientId,
    clientId
  } = _ref6;
  return hasItems || !isAppender && !rootClientId && !clientId;
})])(Inserter));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/default-block-appender/index.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */



/**
 * Zero width non-breaking space, used as padding for the paragraph when it is
 * empty.
 */

const ZWNBSP = '\ufeff';
function DefaultBlockAppender(_ref) {
  let {
    isLocked,
    onAppend,
    showPrompt,
    placeholder,
    rootClientId
  } = _ref;

  if (isLocked) {
    return null;
  }

  const value = (0,external_wp_htmlEntities_namespaceObject.decodeEntities)(placeholder) || (0,external_wp_i18n_namespaceObject.__)('Type / to choose a block');

  return (0,external_wp_element_namespaceObject.createElement)("div", {
    "data-root-client-id": rootClientId || '',
    className: classnames_default()('block-editor-default-block-appender', {
      'has-visible-prompt': showPrompt
    })
  }, (0,external_wp_element_namespaceObject.createElement)("p", {
    tabIndex: "0" // We want this element to be styled as a paragraph by themes.
    // eslint-disable-next-line jsx-a11y/no-noninteractive-element-to-interactive-role
    ,
    role: "button",
    "aria-label": (0,external_wp_i18n_namespaceObject.__)('Add default block') // A wrapping container for this one already has the wp-block className.
    ,
    className: "block-editor-default-block-appender__content",
    onKeyDown: event => {
      if (external_wp_keycodes_namespaceObject.ENTER === event.keyCode || external_wp_keycodes_namespaceObject.SPACE === event.keyCode) {
        onAppend();
      }
    },
    onClick: () => onAppend(),
    onFocus: () => {
      if (showPrompt) {
        onAppend();
      }
    }
  }, showPrompt ? value : ZWNBSP), (0,external_wp_element_namespaceObject.createElement)(inserter, {
    rootClientId: rootClientId,
    position: "bottom right",
    isAppender: true,
    __experimentalIsQuick: true
  }));
}
/* harmony default export */ var default_block_appender = ((0,external_wp_compose_namespaceObject.compose)((0,external_wp_data_namespaceObject.withSelect)((select, ownProps) => {
  const {
    getBlockCount,
    getSettings,
    getTemplateLock
  } = select(store);
  const isEmpty = !getBlockCount(ownProps.rootClientId);
  const {
    bodyPlaceholder
  } = getSettings();
  return {
    showPrompt: isEmpty,
    isLocked: !!getTemplateLock(ownProps.rootClientId),
    placeholder: bodyPlaceholder
  };
}), (0,external_wp_data_namespaceObject.withDispatch)((dispatch, ownProps) => {
  const {
    insertDefaultBlock,
    startTyping
  } = dispatch(store);
  return {
    onAppend() {
      const {
        rootClientId
      } = ownProps;
      insertDefaultBlock(undefined, rootClientId);
      startTyping();
    }

  };
}))(DefaultBlockAppender));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/button-block-appender/index.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */



function ButtonBlockAppender(_ref, ref) {
  let {
    rootClientId,
    className,
    onFocus,
    tabIndex
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)(inserter, {
    position: "bottom center",
    rootClientId: rootClientId,
    __experimentalIsQuick: true,
    renderToggle: _ref2 => {
      let {
        onToggle,
        disabled,
        isOpen,
        blockTitle,
        hasSingleBlockType
      } = _ref2;
      let label;

      if (hasSingleBlockType) {
        label = (0,external_wp_i18n_namespaceObject.sprintf)( // translators: %s: the name of the block when there is only one
        (0,external_wp_i18n_namespaceObject._x)('Add %s', 'directly add the only allowed block'), blockTitle);
      } else {
        label = (0,external_wp_i18n_namespaceObject._x)('Add block', 'Generic label for block inserter button');
      }

      const isToggleButton = !hasSingleBlockType;
      let inserterButton = (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
        ref: ref,
        onFocus: onFocus,
        tabIndex: tabIndex,
        className: classnames_default()(className, 'block-editor-button-block-appender'),
        onClick: onToggle,
        "aria-haspopup": isToggleButton ? 'true' : undefined,
        "aria-expanded": isToggleButton ? isOpen : undefined,
        disabled: disabled,
        label: label
      }, !hasSingleBlockType && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.VisuallyHidden, {
        as: "span"
      }, label), (0,external_wp_element_namespaceObject.createElement)(build_module_icon, {
        icon: library_plus
      }));

      if (isToggleButton || hasSingleBlockType) {
        inserterButton = (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Tooltip, {
          text: label
        }, inserterButton);
      }

      return inserterButton;
    },
    isAppender: true
  });
}
/**
 * Use `ButtonBlockAppender` instead.
 *
 * @deprecated
 */


const ButtonBlockerAppender = (0,external_wp_element_namespaceObject.forwardRef)((props, ref) => {
  external_wp_deprecated_default()(`wp.blockEditor.ButtonBlockerAppender`, {
    alternative: 'wp.blockEditor.ButtonBlockAppender',
    since: '5.9'
  });
  return ButtonBlockAppender(props, ref);
});
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/button-block-appender/README.md
 */

/* harmony default export */ var button_block_appender = ((0,external_wp_element_namespaceObject.forwardRef)(ButtonBlockAppender));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list-appender/index.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */





function BlockListAppender(_ref) {
  let {
    rootClientId,
    canInsertDefaultBlock,
    isLocked,
    renderAppender: CustomAppender,
    className,
    selectedBlockClientId,
    tagName: TagName = 'div'
  } = _ref;

  if (isLocked || CustomAppender === false) {
    return null;
  }

  let appender;

  if (CustomAppender) {
    // Prefer custom render prop if provided.
    appender = (0,external_wp_element_namespaceObject.createElement)(CustomAppender, null);
  } else {
    const isParentSelected = selectedBlockClientId === rootClientId || !rootClientId && !selectedBlockClientId;

    if (!isParentSelected) {
      return null;
    }

    if (canInsertDefaultBlock) {
      // Render the default block appender when renderAppender has not been
      // provided and the context supports use of the default appender.
      appender = (0,external_wp_element_namespaceObject.createElement)(default_block_appender, {
        rootClientId: rootClientId
      });
    } else {
      // Fallback in the case no renderAppender has been provided and the
      // default block can't be inserted.
      appender = (0,external_wp_element_namespaceObject.createElement)(button_block_appender, {
        rootClientId: rootClientId,
        className: "block-list-appender__toggle"
      });
    }
  }

  return (0,external_wp_element_namespaceObject.createElement)(TagName // A `tabIndex` is used on the wrapping `div` element in order to
  // force a focus event to occur when an appender `button` element
  // is clicked. In some browsers (Firefox, Safari), button clicks do
  // not emit a focus event, which could cause this event to propagate
  // unexpectedly. The `tabIndex` ensures that the interaction is
  // captured as a focus, without also adding an extra tab stop.
  //
  // See: https://developer.mozilla.org/en-US/docs/Web/HTML/Element/button#Clicking_and_focus
  , {
    tabIndex: -1,
    className: classnames_default()('block-list-appender wp-block', className) // Needed in case the whole editor is content editable (for multi
    // selection). It fixes an edge case where ArrowDown and ArrowRight
    // should collapse the selection to the end of that selection and
    // not into the appender.
    ,
    contentEditable: false // The appender exists to let you add the first Paragraph before
    // any is inserted. To that end, this appender should visually be
    // presented as a block. That means theme CSS should style it as if
    // it were an empty paragraph block. That means a `wp-block` class to
    // ensure the width is correct, and a [data-block] attribute to ensure
    // the correct margin is applied, especially for classic themes which
    // have commonly targeted that attribute for margins.
    ,
    "data-block": true
  }, appender);
}

/* harmony default export */ var block_list_appender = ((0,external_wp_data_namespaceObject.withSelect)((select, _ref2) => {
  let {
    rootClientId
  } = _ref2;
  const {
    canInsertBlockType,
    getTemplateLock,
    getSelectedBlockClientId
  } = select(store);
  return {
    isLocked: !!getTemplateLock(rootClientId),
    canInsertDefaultBlock: canInsertBlockType((0,external_wp_blocks_namespaceObject.getDefaultBlockName)(), rootClientId),
    selectedBlockClientId: getSelectedBlockClientId()
  };
})(BlockListAppender));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-tools/use-popover-scroll.js
/**
 * WordPress dependencies
 */

/**
 * Allow scrolling "through" popovers over the canvas. This is only called for
 * as long as the pointer is over a popover. Do not use React events because it
 * will bubble through portals.
 *
 * @param {Object} scrollableRef
 */

function usePopoverScroll(scrollableRef) {
  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    if (!scrollableRef) {
      return;
    }

    function onWheel(event) {
      const {
        deltaX,
        deltaY
      } = event;
      scrollableRef.current.scrollBy(deltaX, deltaY);
    } // Tell the browser that we do not call event.preventDefault
    // See https://developer.mozilla.org/en-US/docs/Web/API/EventTarget/addEventListener#improving_scrolling_performance_with_passive_listeners


    const options = {
      passive: true
    };
    node.addEventListener('wheel', onWheel, options);
    return () => {
      node.removeEventListener('wheel', onWheel, options);
    };
  }, [scrollableRef]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-tools/insertion-point.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */





const InsertionPointOpenRef = (0,external_wp_element_namespaceObject.createContext)();

function InsertionPointPopover(_ref) {
  let {
    __unstablePopoverSlot,
    __unstableContentRef
  } = _ref;
  const {
    selectBlock,
    hideInsertionPoint
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const openRef = (0,external_wp_element_namespaceObject.useContext)(InsertionPointOpenRef);
  const ref = (0,external_wp_element_namespaceObject.useRef)();
  const {
    orientation,
    previousClientId,
    nextClientId,
    rootClientId,
    isInserterShown
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    var _getBlockListSettings;

    const {
      getBlockOrder,
      getBlockListSettings,
      getBlockInsertionPoint,
      isBlockBeingDragged,
      getPreviousBlockClientId,
      getNextBlockClientId
    } = select(store);
    const insertionPoint = getBlockInsertionPoint();
    const order = getBlockOrder(insertionPoint.rootClientId);

    if (!order.length) {
      return {};
    }

    let _previousClientId = order[insertionPoint.index - 1];
    let _nextClientId = order[insertionPoint.index];

    while (isBlockBeingDragged(_previousClientId)) {
      _previousClientId = getPreviousBlockClientId(_previousClientId);
    }

    while (isBlockBeingDragged(_nextClientId)) {
      _nextClientId = getNextBlockClientId(_nextClientId);
    }

    return {
      previousClientId: _previousClientId,
      nextClientId: _nextClientId,
      orientation: ((_getBlockListSettings = getBlockListSettings(insertionPoint.rootClientId)) === null || _getBlockListSettings === void 0 ? void 0 : _getBlockListSettings.orientation) || 'vertical',
      rootClientId: insertionPoint.rootClientId,
      isInserterShown: insertionPoint === null || insertionPoint === void 0 ? void 0 : insertionPoint.__unstableWithInserter
    };
  }, []);
  const previousElement = useBlockElement(previousClientId);
  const nextElement = useBlockElement(nextClientId);
  const isVertical = orientation === 'vertical';
  const style = (0,external_wp_element_namespaceObject.useMemo)(() => {
    if (!previousElement && !nextElement) {
      return {};
    }

    const previousRect = previousElement ? previousElement.getBoundingClientRect() : null;
    const nextRect = nextElement ? nextElement.getBoundingClientRect() : null;

    if (isVertical) {
      return {
        width: previousElement ? previousElement.offsetWidth : nextElement.offsetWidth,
        height: nextRect && previousRect ? nextRect.top - previousRect.bottom : 0
      };
    }

    let width = 0;

    if (previousRect && nextRect) {
      width = (0,external_wp_i18n_namespaceObject.isRTL)() ? previousRect.left - nextRect.right : nextRect.left - previousRect.right;
    }

    return {
      width,
      height: previousElement ? previousElement.offsetHeight : nextElement.offsetHeight
    };
  }, [previousElement, nextElement]);
  const getAnchorRect = (0,external_wp_element_namespaceObject.useCallback)(() => {
    if (!previousElement && !nextElement) {
      return {};
    }

    const {
      ownerDocument
    } = previousElement || nextElement;
    const previousRect = previousElement ? previousElement.getBoundingClientRect() : null;
    const nextRect = nextElement ? nextElement.getBoundingClientRect() : null;

    if (isVertical) {
      if ((0,external_wp_i18n_namespaceObject.isRTL)()) {
        return {
          top: previousRect ? previousRect.bottom : nextRect.top,
          left: previousRect ? previousRect.right : nextRect.right,
          right: previousRect ? previousRect.left : nextRect.left,
          bottom: nextRect ? nextRect.top : previousRect.bottom,
          ownerDocument
        };
      }

      return {
        top: previousRect ? previousRect.bottom : nextRect.top,
        left: previousRect ? previousRect.left : nextRect.left,
        right: previousRect ? previousRect.right : nextRect.right,
        bottom: nextRect ? nextRect.top : previousRect.bottom,
        ownerDocument
      };
    }

    if ((0,external_wp_i18n_namespaceObject.isRTL)()) {
      return {
        top: previousRect ? previousRect.top : nextRect.top,
        left: previousRect ? previousRect.left : nextRect.right,
        right: nextRect ? nextRect.right : previousRect.left,
        bottom: previousRect ? previousRect.bottom : nextRect.bottom,
        ownerDocument
      };
    }

    return {
      top: previousRect ? previousRect.top : nextRect.top,
      left: previousRect ? previousRect.right : nextRect.left,
      right: nextRect ? nextRect.left : previousRect.right,
      bottom: previousRect ? previousRect.bottom : nextRect.bottom,
      ownerDocument
    };
  }, [previousElement, nextElement]);
  const popoverScrollRef = usePopoverScroll(__unstableContentRef);
  const disableMotion = (0,external_wp_compose_namespaceObject.useReducedMotion)();
  const className = classnames_default()('block-editor-block-list__insertion-point', 'is-' + orientation);

  function onClick(event) {
    if (event.target === ref.current && nextClientId) {
      selectBlock(nextClientId, -1);
    }
  }

  function onFocus(event) {
    // Only handle click on the wrapper specifically, and not an event
    // bubbled from the inserter itself.
    if (event.target !== ref.current) {
      openRef.current = true;
    }
  }

  function maybeHideInserterPoint(event) {
    // Only hide the inserter if it's triggered on the wrapper,
    // and the inserter is not open.
    if (event.target === ref.current && !openRef.current) {
      hideInsertionPoint();
    }
  } // Only show the in-between inserter between blocks, so when there's a
  // previous and a next element.


  const showInsertionPointInserter = previousElement && nextElement && isInserterShown; // Define animation variants for the line element.

  const horizontalLine = {
    start: {
      width: 0,
      top: '50%',
      bottom: '50%',
      x: 0
    },
    rest: {
      width: 4,
      top: 0,
      bottom: 0,
      x: -2
    },
    hover: {
      width: 4,
      top: 0,
      bottom: 0,
      x: -2
    }
  };
  const verticalLine = {
    start: {
      height: 0,
      left: '50%',
      right: '50%',
      y: 0
    },
    rest: {
      height: 4,
      left: 0,
      right: 0,
      y: -2
    },
    hover: {
      height: 4,
      left: 0,
      right: 0,
      y: -2
    }
  };
  const lineVariants = {
    // Initial position starts from the center and invisible.
    start: { ...(!isVertical ? horizontalLine.start : verticalLine.start),
      opacity: 0
    },
    // The line expands to fill the container. If the inserter is visible it
    // is delayed so it appears orchestrated.
    rest: { ...(!isVertical ? horizontalLine.rest : verticalLine.rest),
      opacity: 1,
      borderRadius: '2px',
      transition: {
        delay: showInsertionPointInserter ? 0.4 : 0
      }
    },
    hover: { ...(!isVertical ? horizontalLine.hover : verticalLine.hover),
      opacity: 1,
      borderRadius: '2px',
      transition: {
        delay: 0.4
      }
    }
  };
  const inserterVariants = {
    start: {
      scale: disableMotion ? 1 : 0
    },
    rest: {
      scale: 1,
      transition: {
        delay: 0.2
      }
    }
  };
  /* eslint-disable jsx-a11y/no-static-element-interactions, jsx-a11y/click-events-have-key-events */
  // While ideally it would be enough to capture the
  // bubbling focus event from the Inserter, due to the
  // characteristics of click focusing of `button`s in
  // Firefox and Safari, it is not reliable.
  //
  // See: https://developer.mozilla.org/en-US/docs/Web/HTML/Element/button#Clicking_and_focus

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Popover, {
    ref: popoverScrollRef,
    noArrow: true,
    animate: false,
    getAnchorRect: getAnchorRect,
    focusOnMount: false,
    className: "block-editor-block-list__insertion-point-popover" // Render in the old slot if needed for backward compatibility,
    // otherwise render in place (not in the the default popover slot).
    ,
    __unstableSlotName: __unstablePopoverSlot || null // Forces a remount of the popover when its position changes
    // This makes sure the popover doesn't animate from its previous position.
    ,
    key: nextClientId + '--' + rootClientId
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__unstableMotion.div, {
    layout: !disableMotion,
    initial: disableMotion ? 'rest' : 'start',
    animate: "rest",
    whileHover: "hover",
    whileTap: "pressed",
    exit: "start",
    ref: ref,
    tabIndex: -1,
    onClick: onClick,
    onFocus: onFocus,
    className: classnames_default()(className, {
      'is-with-inserter': showInsertionPointInserter
    }),
    onHoverEnd: maybeHideInserterPoint,
    style: style
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__unstableMotion.div, {
    variants: lineVariants,
    className: "block-editor-block-list__insertion-point-indicator"
  }), showInsertionPointInserter && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__unstableMotion.div, {
    variants: inserterVariants,
    className: classnames_default()('block-editor-block-list__insertion-point-inserter')
  }, (0,external_wp_element_namespaceObject.createElement)(inserter, {
    position: "bottom center",
    clientId: nextClientId,
    rootClientId: rootClientId,
    __experimentalIsQuick: true,
    onToggle: isOpen => {
      openRef.current = isOpen;
    },
    onSelectOrClose: () => {
      openRef.current = false;
    }
  }))));
  /* eslint-enable jsx-a11y/no-static-element-interactions, jsx-a11y/click-events-have-key-events */
}

function InsertionPoint(_ref2) {
  let {
    children,
    __unstablePopoverSlot,
    __unstableContentRef
  } = _ref2;
  const isVisible = (0,external_wp_data_namespaceObject.useSelect)(select => {
    return select(store).isBlockInsertionPointVisible();
  }, []);
  return (0,external_wp_element_namespaceObject.createElement)(InsertionPointOpenRef.Provider, {
    value: (0,external_wp_element_namespaceObject.useRef)(false)
  }, isVisible && (0,external_wp_element_namespaceObject.createElement)(InsertionPointPopover, {
    __unstablePopoverSlot: __unstablePopoverSlot,
    __unstableContentRef: __unstableContentRef
  }), children);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/use-in-between-inserter.js
/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */



function useInBetweenInserter() {
  const openRef = (0,external_wp_element_namespaceObject.useContext)(InsertionPointOpenRef);
  const hasReducedUI = (0,external_wp_data_namespaceObject.useSelect)(select => select(store).getSettings().hasReducedUI, []);
  const {
    getBlockListSettings,
    getBlockRootClientId,
    getBlockIndex,
    isBlockInsertionPointVisible,
    isMultiSelecting,
    getSelectedBlockClientIds,
    getTemplateLock
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const {
    showInsertionPoint,
    hideInsertionPoint
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    if (hasReducedUI) {
      return;
    }

    function onMouseMove(event) {
      var _getBlockListSettings, _element$parentElemen;

      if (openRef.current) {
        return;
      }

      if (isMultiSelecting()) {
        return;
      }

      if (!event.target.classList.contains('block-editor-block-list__layout')) {
        if (isBlockInsertionPointVisible()) {
          hideInsertionPoint();
        }

        return;
      }

      let rootClientId;

      if (!event.target.classList.contains('is-root-container')) {
        const blockElement = !!event.target.getAttribute('data-block') ? event.target : event.target.closest('[data-block]');
        rootClientId = blockElement.getAttribute('data-block');
      } // Don't set the insertion point if the template is locked.


      if (getTemplateLock(rootClientId)) {
        return;
      }

      const orientation = ((_getBlockListSettings = getBlockListSettings(rootClientId)) === null || _getBlockListSettings === void 0 ? void 0 : _getBlockListSettings.orientation) || 'vertical';
      const rect = event.target.getBoundingClientRect();
      const offsetTop = event.clientY - rect.top;
      const offsetLeft = event.clientX - rect.left;
      const children = Array.from(event.target.children);
      let element = children.find(blockEl => {
        return blockEl.classList.contains('wp-block') && orientation === 'vertical' && blockEl.offsetTop > offsetTop || blockEl.classList.contains('wp-block') && orientation === 'horizontal' && blockEl.offsetLeft > offsetLeft;
      });

      if (!element) {
        return;
      } // The block may be in an alignment wrapper, so check the first direct
      // child if the element has no ID.


      if (!element.id) {
        element = element.firstElementChild;

        if (!element) {
          return;
        }
      } // Don't show the insertion point if a parent block has an "overlay"
      // See https://github.com/WordPress/gutenberg/pull/34012#pullrequestreview-727762337


      const parentOverlay = (_element$parentElemen = element.parentElement) === null || _element$parentElemen === void 0 ? void 0 : _element$parentElemen.closest('.block-editor-block-content-overlay.overlay-active');

      if (parentOverlay) {
        return;
      }

      const clientId = element.id.slice('block-'.length);

      if (!clientId) {
        return;
      } // Don't show the inserter when hovering above (conflicts with
      // block toolbar) or inside selected block(s).


      if (getSelectedBlockClientIds().includes(clientId)) {
        return;
      }

      const elementRect = element.getBoundingClientRect();

      if (orientation === 'horizontal' && (event.clientY > elementRect.bottom || event.clientY < elementRect.top) || orientation === 'vertical' && (event.clientX > elementRect.right || event.clientX < elementRect.left)) {
        if (isBlockInsertionPointVisible()) {
          hideInsertionPoint();
        }

        return;
      }

      const index = getBlockIndex(clientId); // Don't show the in-between inserter before the first block in
      // the list (preserves the original behaviour).

      if (index === 0) {
        if (isBlockInsertionPointVisible()) {
          hideInsertionPoint();
        }

        return;
      }

      showInsertionPoint(rootClientId, index, {
        __unstableWithInserter: true
      });
    }

    node.addEventListener('mousemove', onMouseMove);
    return () => {
      node.removeEventListener('mousemove', onMouseMove);
    };
  }, [openRef, getBlockListSettings, getBlockRootClientId, getBlockIndex, isBlockInsertionPointVisible, isMultiSelecting, showInsertionPoint, hideInsertionPoint, getSelectedBlockClientIds]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/utils/pre-parse-patterns.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */



const requestIdleCallback = (() => {
  if (typeof window === 'undefined') {
    return callback => {
      setTimeout(() => callback(Date.now()), 0);
    };
  }

  return window.requestIdleCallback || window.requestAnimationFrame;
})();

const cancelIdleCallback = (() => {
  if (typeof window === 'undefined') {
    return clearTimeout;
  }

  return window.cancelIdleCallback || window.cancelAnimationFrame;
})();

function usePreParsePatterns() {
  const patterns = (0,external_wp_data_namespaceObject.useSelect)(_select => _select(store).getSettings().__experimentalBlockPatterns, []);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    if (!(patterns !== null && patterns !== void 0 && patterns.length)) {
      return;
    }

    let handle;
    let index = -1;

    const callback = () => {
      index++;

      if (index >= patterns.length) {
        return;
      }

      (0,external_wp_data_namespaceObject.select)(store).__experimentalGetParsedPattern(patterns[index].name);

      handle = requestIdleCallback(callback);
    };

    handle = requestIdleCallback(callback);
    return () => cancelIdleCallback(handle);
  }, [patterns]);
  return null;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/use-block-display-information/index.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


/** @typedef {import('@wordpress/blocks').WPIcon} WPIcon */

/**
 * Contains basic block's information for display reasons.
 *
 * @typedef {Object} WPBlockDisplayInformation
 *
 * @property {string} title       Human-readable block type label.
 * @property {WPIcon} icon        Block type icon.
 * @property {string} description A detailed block type description.
 */

/**
 * Hook used to try to find a matching block variation and return
 * the appropriate information for display reasons. In order to
 * to try to find a match we need to things:
 * 1. Block's client id to extract it's current attributes.
 * 2. A block variation should have set `isActive` prop to a proper function.
 *
 * If for any reason a block variaton match cannot be found,
 * the returned information come from the Block Type.
 * If no blockType is found with the provided clientId, returns null.
 *
 * @param {string} clientId Block's client id.
 * @return {?WPBlockDisplayInformation} Block's display information, or `null` when the block or its type not found.
 */

function useBlockDisplayInformation(clientId) {
  return (0,external_wp_data_namespaceObject.useSelect)(select => {
    if (!clientId) return null;
    const {
      getBlockName,
      getBlockAttributes
    } = select(store);
    const {
      getBlockType,
      getActiveBlockVariation
    } = select(external_wp_blocks_namespaceObject.store);
    const blockName = getBlockName(clientId);
    const blockType = getBlockType(blockName);
    if (!blockType) return null;
    const attributes = getBlockAttributes(clientId);
    const match = getActiveBlockVariation(blockName, attributes);
    const blockTypeInfo = {
      title: blockType.title,
      icon: blockType.icon,
      description: blockType.description,
      anchor: attributes === null || attributes === void 0 ? void 0 : attributes.anchor
    };
    if (!match) return blockTypeInfo;
    return {
      title: match.title || blockType.title,
      icon: match.icon || blockType.icon,
      description: match.description || blockType.description
    };
  }, [clientId]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-title/use-block-display-title.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */



/**
 * Returns the block's configured title as a string, or empty if the title
 * cannot be determined.
 *
 * @example
 *
 * ```js
 * useBlockDisplayTitle( 'afd1cb17-2c08-4e7a-91be-007ba7ddc3a1', 17 );
 * ```
 *
 * @param {string}           clientId      Client ID of block.
 * @param {number|undefined} maximumLength The maximum length that the block title string may be before truncated.
 * @return {?string} Block title.
 */

function useBlockDisplayTitle(clientId, maximumLength) {
  const {
    attributes,
    name,
    reusableBlockTitle
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    if (!clientId) {
      return {};
    }

    const {
      getBlockName,
      getBlockAttributes,
      __experimentalGetReusableBlockTitle
    } = select(store);
    const blockName = getBlockName(clientId);

    if (!blockName) {
      return {};
    }

    const isReusable = (0,external_wp_blocks_namespaceObject.isReusableBlock)((0,external_wp_blocks_namespaceObject.getBlockType)(blockName));
    return {
      attributes: getBlockAttributes(clientId),
      name: blockName,
      reusableBlockTitle: isReusable && __experimentalGetReusableBlockTitle(getBlockAttributes(clientId).ref)
    };
  }, [clientId]);
  const blockInformation = useBlockDisplayInformation(clientId);

  if (!name || !blockInformation) {
    return null;
  }

  const blockType = (0,external_wp_blocks_namespaceObject.getBlockType)(name);
  const blockLabel = blockType ? (0,external_wp_blocks_namespaceObject.__experimentalGetBlockLabel)(blockType, attributes) : null;
  const label = reusableBlockTitle || blockLabel; // Label will fallback to the title if no label is defined for the current
  // label context. If the label is defined we prioritize it over a
  // possible block variation title match.

  const blockTitle = label && label !== blockType.title ? label : blockInformation.title;

  if (maximumLength && maximumLength > 0) {
    return (0,external_lodash_namespaceObject.truncate)(blockTitle, {
      length: maximumLength
    });
  }

  return blockTitle;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-title/index.js
/**
 * Internal dependencies
 */

/**
 * Renders the block's configured title as a string, or empty if the title
 * cannot be determined.
 *
 * @example
 *
 * ```jsx
 * <BlockTitle clientId="afd1cb17-2c08-4e7a-91be-007ba7ddc3a1" maximumLength={ 17 }/>
 * ```
 *
 * @param {Object}           props
 * @param {string}           props.clientId      Client ID of block.
 * @param {number|undefined} props.maximumLength The maximum length that the block title string may be before truncated.
 *
 * @return {JSX.Element} Block title.
 */

function BlockTitle(_ref) {
  let {
    clientId,
    maximumLength
  } = _ref;
  return useBlockDisplayTitle(clientId, maximumLength);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-draggable/use-scroll-when-dragging.js
/**
 * WordPress dependencies
 */


const SCROLL_INACTIVE_DISTANCE_PX = 50;
const SCROLL_INTERVAL_MS = 25;
const PIXELS_PER_SECOND_PER_PERCENTAGE = 1000;
const VELOCITY_MULTIPLIER = PIXELS_PER_SECOND_PER_PERCENTAGE * (SCROLL_INTERVAL_MS / 1000);
/**
 * React hook that scrolls the scroll container when a block is being dragged.
 *
 * @return {Function[]} `startScrolling`, `scrollOnDragOver`, `stopScrolling`
 *                      functions to be called in `onDragStart`, `onDragOver`
 *                      and `onDragEnd` events respectively.
 */

function useScrollWhenDragging() {
  const dragStartY = (0,external_wp_element_namespaceObject.useRef)(null);
  const velocityY = (0,external_wp_element_namespaceObject.useRef)(null);
  const scrollParentY = (0,external_wp_element_namespaceObject.useRef)(null);
  const scrollEditorInterval = (0,external_wp_element_namespaceObject.useRef)(null); // Clear interval when unmounting.

  (0,external_wp_element_namespaceObject.useEffect)(() => () => {
    if (scrollEditorInterval.current) {
      clearInterval(scrollEditorInterval.current);
      scrollEditorInterval.current = null;
    }
  }, []);
  const startScrolling = (0,external_wp_element_namespaceObject.useCallback)(event => {
    dragStartY.current = event.clientY; // Find nearest parent(s) to scroll.

    scrollParentY.current = (0,external_wp_dom_namespaceObject.getScrollContainer)(event.target);
    scrollEditorInterval.current = setInterval(() => {
      if (scrollParentY.current && velocityY.current) {
        const newTop = scrollParentY.current.scrollTop + velocityY.current; // Setting `behavior: 'smooth'` as a scroll property seems to hurt performance.
        // Better to use a small scroll interval.

        scrollParentY.current.scroll({
          top: newTop
        });
      }
    }, SCROLL_INTERVAL_MS);
  }, []);
  const scrollOnDragOver = (0,external_wp_element_namespaceObject.useCallback)(event => {
    if (!scrollParentY.current) {
      return;
    }

    const scrollParentHeight = scrollParentY.current.offsetHeight;
    const offsetDragStartPosition = dragStartY.current - scrollParentY.current.offsetTop;
    const offsetDragPosition = event.clientY - scrollParentY.current.offsetTop;

    if (event.clientY > offsetDragStartPosition) {
      // User is dragging downwards.
      const moveableDistance = Math.max(scrollParentHeight - offsetDragStartPosition - SCROLL_INACTIVE_DISTANCE_PX, 0);
      const dragDistance = Math.max(offsetDragPosition - offsetDragStartPosition - SCROLL_INACTIVE_DISTANCE_PX, 0);
      const distancePercentage = dragDistance / moveableDistance;
      velocityY.current = VELOCITY_MULTIPLIER * distancePercentage;
    } else if (event.clientY < offsetDragStartPosition) {
      // User is dragging upwards.
      const moveableDistance = Math.max(offsetDragStartPosition - SCROLL_INACTIVE_DISTANCE_PX, 0);
      const dragDistance = Math.max(offsetDragStartPosition - offsetDragPosition - SCROLL_INACTIVE_DISTANCE_PX, 0);
      const distancePercentage = dragDistance / moveableDistance;
      velocityY.current = -VELOCITY_MULTIPLIER * distancePercentage;
    } else {
      velocityY.current = 0;
    }
  }, []);

  const stopScrolling = () => {
    dragStartY.current = null;
    scrollParentY.current = null;

    if (scrollEditorInterval.current) {
      clearInterval(scrollEditorInterval.current);
      scrollEditorInterval.current = null;
    }
  };

  return [startScrolling, scrollOnDragOver, stopScrolling];
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-draggable/index.js


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */





const BlockDraggable = _ref => {
  let {
    children,
    clientIds,
    cloneClassname,
    onDragStart,
    onDragEnd
  } = _ref;
  const {
    srcRootClientId,
    isDraggable,
    icon
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    var _getBlockType;

    const {
      canMoveBlocks,
      getBlockRootClientId,
      getBlockName
    } = select(store);
    const rootClientId = getBlockRootClientId(clientIds[0]);
    const blockName = getBlockName(clientIds[0]);
    return {
      srcRootClientId: rootClientId,
      isDraggable: canMoveBlocks(clientIds, rootClientId),
      icon: (_getBlockType = (0,external_wp_blocks_namespaceObject.getBlockType)(blockName)) === null || _getBlockType === void 0 ? void 0 : _getBlockType.icon
    };
  }, [clientIds]);
  const isDragging = (0,external_wp_element_namespaceObject.useRef)(false);
  const [startScrolling, scrollOnDragOver, stopScrolling] = useScrollWhenDragging();
  const {
    startDraggingBlocks,
    stopDraggingBlocks
  } = (0,external_wp_data_namespaceObject.useDispatch)(store); // Stop dragging blocks if the block draggable is unmounted.

  (0,external_wp_element_namespaceObject.useEffect)(() => {
    return () => {
      if (isDragging.current) {
        stopDraggingBlocks();
      }
    };
  }, []);

  if (!isDraggable) {
    return children({
      isDraggable: false
    });
  }

  const transferData = {
    type: 'block',
    srcClientIds: clientIds,
    srcRootClientId
  };
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Draggable, {
    cloneClassname: cloneClassname,
    __experimentalTransferDataType: "wp-blocks",
    transferData: transferData,
    onDragStart: event => {
      startDraggingBlocks(clientIds);
      isDragging.current = true;
      startScrolling(event);

      if (onDragStart) {
        onDragStart();
      }
    },
    onDragOver: scrollOnDragOver,
    onDragEnd: () => {
      stopDraggingBlocks();
      isDragging.current = false;
      stopScrolling();

      if (onDragEnd) {
        onDragEnd();
      }
    },
    __experimentalDragComponent: (0,external_wp_element_namespaceObject.createElement)(BlockDraggableChip, {
      count: clientIds.length,
      icon: icon
    })
  }, _ref2 => {
    let {
      onDraggableStart,
      onDraggableEnd
    } = _ref2;
    return children({
      draggable: true,
      onDragStart: onDraggableStart,
      onDragEnd: onDraggableEnd
    });
  });
};

/* harmony default export */ var block_draggable = (BlockDraggable);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-tools/block-selection-button.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */










/**
 * Internal dependencies
 */






/**
 * Block selection button component, displaying the label of the block. If the block
 * descends from a root block, a button is displayed enabling the user to select
 * the root block.
 *
 * @param {string} props          Component props.
 * @param {string} props.clientId Client ID of block.
 *
 * @return {WPComponent} The component to be rendered.
 */

function BlockSelectionButton(_ref) {
  let {
    clientId,
    rootClientId,
    blockElement
  } = _ref;
  const blockInformation = useBlockDisplayInformation(clientId);
  const selected = (0,external_wp_data_namespaceObject.useSelect)(select => {
    var _getBlockListSettings;

    const {
      getBlock,
      getBlockIndex,
      hasBlockMovingClientId,
      getBlockListSettings
    } = select(store);
    const index = getBlockIndex(clientId);
    const {
      name,
      attributes
    } = getBlock(clientId);
    const blockMovingMode = hasBlockMovingClientId();
    return {
      index,
      name,
      attributes,
      blockMovingMode,
      orientation: (_getBlockListSettings = getBlockListSettings(rootClientId)) === null || _getBlockListSettings === void 0 ? void 0 : _getBlockListSettings.orientation
    };
  }, [clientId, rootClientId]);
  const {
    index,
    name,
    attributes,
    blockMovingMode,
    orientation
  } = selected;
  const {
    setNavigationMode,
    removeBlock
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const ref = (0,external_wp_element_namespaceObject.useRef)();
  const blockType = (0,external_wp_blocks_namespaceObject.getBlockType)(name);
  const label = (0,external_wp_blocks_namespaceObject.__experimentalGetAccessibleBlockLabel)(blockType, attributes, index + 1, orientation); // Focus the breadcrumb in navigation mode.

  (0,external_wp_element_namespaceObject.useEffect)(() => {
    ref.current.focus();
    (0,external_wp_a11y_namespaceObject.speak)(label);
  }, [label]);
  const {
    hasBlockMovingClientId,
    getBlockIndex,
    getBlockRootClientId,
    getClientIdsOfDescendants,
    getSelectedBlockClientId,
    getMultiSelectedBlocksEndClientId,
    getPreviousBlockClientId,
    getNextBlockClientId,
    isNavigationMode
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const {
    selectBlock,
    clearSelectedBlock,
    setBlockMovingClientId,
    moveBlockToPosition
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);

  function onKeyDown(event) {
    const {
      keyCode
    } = event;
    const isUp = keyCode === external_wp_keycodes_namespaceObject.UP;
    const isDown = keyCode === external_wp_keycodes_namespaceObject.DOWN;
    const isLeft = keyCode === external_wp_keycodes_namespaceObject.LEFT;
    const isRight = keyCode === external_wp_keycodes_namespaceObject.RIGHT;
    const isTab = keyCode === external_wp_keycodes_namespaceObject.TAB;
    const isEscape = keyCode === external_wp_keycodes_namespaceObject.ESCAPE;
    const isEnter = keyCode === external_wp_keycodes_namespaceObject.ENTER;
    const isSpace = keyCode === external_wp_keycodes_namespaceObject.SPACE;
    const isShift = event.shiftKey;

    if (keyCode === external_wp_keycodes_namespaceObject.BACKSPACE || keyCode === external_wp_keycodes_namespaceObject.DELETE) {
      removeBlock(clientId);
      event.preventDefault();
      return;
    }

    const selectedBlockClientId = getSelectedBlockClientId();
    const selectionEndClientId = getMultiSelectedBlocksEndClientId();
    const selectionBeforeEndClientId = getPreviousBlockClientId(selectionEndClientId || selectedBlockClientId);
    const selectionAfterEndClientId = getNextBlockClientId(selectionEndClientId || selectedBlockClientId);
    const navigateUp = isTab && isShift || isUp;
    const navigateDown = isTab && !isShift || isDown; // Move out of current nesting level (no effect if at root level).

    const navigateOut = isLeft; // Move into next nesting level (no effect if the current block has no innerBlocks).

    const navigateIn = isRight;
    let focusedBlockUid;

    if (navigateUp) {
      focusedBlockUid = selectionBeforeEndClientId;
    } else if (navigateDown) {
      focusedBlockUid = selectionAfterEndClientId;
    } else if (navigateOut) {
      var _getBlockRootClientId;

      focusedBlockUid = (_getBlockRootClientId = getBlockRootClientId(selectedBlockClientId)) !== null && _getBlockRootClientId !== void 0 ? _getBlockRootClientId : selectedBlockClientId;
    } else if (navigateIn) {
      var _getClientIdsOfDescen;

      focusedBlockUid = (_getClientIdsOfDescen = getClientIdsOfDescendants([selectedBlockClientId])[0]) !== null && _getClientIdsOfDescen !== void 0 ? _getClientIdsOfDescen : selectedBlockClientId;
    }

    const startingBlockClientId = hasBlockMovingClientId();

    if (isEscape && isNavigationMode()) {
      clearSelectedBlock();
      event.preventDefault();
    }

    if (isEscape && startingBlockClientId && !event.defaultPrevented) {
      setBlockMovingClientId(null);
      event.preventDefault();
    }

    if ((isEnter || isSpace) && startingBlockClientId) {
      const sourceRoot = getBlockRootClientId(startingBlockClientId);
      const destRoot = getBlockRootClientId(selectedBlockClientId);
      const sourceBlockIndex = getBlockIndex(startingBlockClientId);
      let destinationBlockIndex = getBlockIndex(selectedBlockClientId);

      if (sourceBlockIndex < destinationBlockIndex && sourceRoot === destRoot) {
        destinationBlockIndex -= 1;
      }

      moveBlockToPosition(startingBlockClientId, sourceRoot, destRoot, destinationBlockIndex);
      selectBlock(startingBlockClientId);
      setBlockMovingClientId(null);
    }

    if (navigateDown || navigateUp || navigateOut || navigateIn) {
      if (focusedBlockUid) {
        event.preventDefault();
        selectBlock(focusedBlockUid);
      } else if (isTab && selectedBlockClientId) {
        let nextTabbable;

        if (navigateDown) {
          nextTabbable = blockElement;

          do {
            nextTabbable = external_wp_dom_namespaceObject.focus.tabbable.findNext(nextTabbable);
          } while (nextTabbable && blockElement.contains(nextTabbable));

          if (!nextTabbable) {
            nextTabbable = blockElement.ownerDocument.defaultView.frameElement;
            nextTabbable = external_wp_dom_namespaceObject.focus.tabbable.findNext(nextTabbable);
          }
        } else {
          nextTabbable = external_wp_dom_namespaceObject.focus.tabbable.findPrevious(blockElement);
        }

        if (nextTabbable) {
          event.preventDefault();
          nextTabbable.focus();
          clearSelectedBlock();
        }
      }
    }
  }

  const classNames = classnames_default()('block-editor-block-list__block-selection-button', {
    'is-block-moving-mode': !!blockMovingMode
  });

  const dragHandleLabel = (0,external_wp_i18n_namespaceObject.__)('Drag');

  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: classNames
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Flex, {
    justify: "center",
    className: "block-editor-block-list__block-selection-button__content"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.FlexItem, null, (0,external_wp_element_namespaceObject.createElement)(block_icon, {
    icon: blockInformation === null || blockInformation === void 0 ? void 0 : blockInformation.icon,
    showColors: true
  })), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.FlexItem, null, (0,external_wp_element_namespaceObject.createElement)(block_draggable, {
    clientIds: [clientId]
  }, draggableProps => (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, _extends({
    icon: drag_handle,
    className: "block-selection-button_drag-handle",
    "aria-hidden": "true",
    label: dragHandleLabel // Should not be able to tab to drag handle as this
    // button can only be used with a pointer device.
    ,
    tabIndex: "-1"
  }, draggableProps)))), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.FlexItem, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    ref: ref,
    onClick: () => setNavigationMode(false),
    onKeyDown: onKeyDown,
    label: label,
    className: "block-selection-button_select-button"
  }, (0,external_wp_element_namespaceObject.createElement)(BlockTitle, {
    clientId: clientId,
    maximumLength: 35
  })))));
}

/* harmony default export */ var block_selection_button = (BlockSelectionButton);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/navigable-toolbar/index.js



/**
 * WordPress dependencies
 */






function hasOnlyToolbarItem(elements) {
  const dataProp = 'toolbarItem';
  return !elements.some(element => !(dataProp in element.dataset));
}

function getAllToolbarItemsIn(container) {
  return Array.from(container.querySelectorAll('[data-toolbar-item]'));
}

function hasFocusWithin(container) {
  return container.contains(container.ownerDocument.activeElement);
}

function focusFirstTabbableIn(container) {
  const [firstTabbable] = external_wp_dom_namespaceObject.focus.tabbable.find(container);

  if (firstTabbable) {
    firstTabbable.focus();
  }
}

function useIsAccessibleToolbar(ref) {
  /*
   * By default, we'll assume the starting accessible state of the Toolbar
   * is true, as it seems to be the most common case.
   *
   * Transitioning from an (initial) false to true state causes the
   * <Toolbar /> component to mount twice, which is causing undesired
   * side-effects. These side-effects appear to only affect certain
   * E2E tests.
   *
   * This was initial discovered in this pull-request:
   * https://github.com/WordPress/gutenberg/pull/23425
   */
  const initialAccessibleToolbarState = true; // By default, it's gonna render NavigableMenu. If all the tabbable elements
  // inside the toolbar are ToolbarItem components (or derived components like
  // ToolbarButton), then we can wrap them with the accessible Toolbar
  // component.

  const [isAccessibleToolbar, setIsAccessibleToolbar] = (0,external_wp_element_namespaceObject.useState)(initialAccessibleToolbarState);
  const determineIsAccessibleToolbar = (0,external_wp_element_namespaceObject.useCallback)(() => {
    const tabbables = external_wp_dom_namespaceObject.focus.tabbable.find(ref.current);
    const onlyToolbarItem = hasOnlyToolbarItem(tabbables);

    if (!onlyToolbarItem) {
      external_wp_deprecated_default()('Using custom components as toolbar controls', {
        since: '5.6',
        alternative: 'ToolbarItem, ToolbarButton or ToolbarDropdownMenu components',
        link: 'https://developer.wordpress.org/block-editor/components/toolbar-button/#inside-blockcontrols'
      });
    }

    setIsAccessibleToolbar(onlyToolbarItem);
  }, []);
  (0,external_wp_element_namespaceObject.useLayoutEffect)(() => {
    // Toolbar buttons may be rendered asynchronously, so we use
    // MutationObserver to check if the toolbar subtree has been modified.
    const observer = new window.MutationObserver(determineIsAccessibleToolbar);
    observer.observe(ref.current, {
      childList: true,
      subtree: true
    });
    return () => observer.disconnect();
  }, [isAccessibleToolbar]);
  return isAccessibleToolbar;
}

function useToolbarFocus(ref, focusOnMount, isAccessibleToolbar, defaultIndex, onIndexChange) {
  // Make sure we don't use modified versions of this prop.
  const [initialFocusOnMount] = (0,external_wp_element_namespaceObject.useState)(focusOnMount);
  const [initialIndex] = (0,external_wp_element_namespaceObject.useState)(defaultIndex);
  const focusToolbar = (0,external_wp_element_namespaceObject.useCallback)(() => {
    focusFirstTabbableIn(ref.current);
  }, []); // Focus on toolbar when pressing alt+F10 when the toolbar is visible.

  (0,external_wp_keyboardShortcuts_namespaceObject.useShortcut)('core/block-editor/focus-toolbar', focusToolbar);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    if (initialFocusOnMount) {
      focusToolbar();
    }
  }, [isAccessibleToolbar, initialFocusOnMount, focusToolbar]);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    // If initialIndex is passed, we focus on that toolbar item when the
    // toolbar gets mounted and initial focus is not forced.
    // We have to wait for the next browser paint because block controls aren't
    // rendered right away when the toolbar gets mounted.
    let raf = 0;

    if (initialIndex && !initialFocusOnMount) {
      raf = window.requestAnimationFrame(() => {
        const items = getAllToolbarItemsIn(ref.current);
        const index = initialIndex || 0;

        if (items[index] && hasFocusWithin(ref.current)) {
          items[index].focus();
        }
      });
    }

    return () => {
      window.cancelAnimationFrame(raf);
      if (!onIndexChange || !ref.current) return; // When the toolbar element is unmounted and onIndexChange is passed, we
      // pass the focused toolbar item index so it can be hydrated later.

      const items = getAllToolbarItemsIn(ref.current);
      const index = items.findIndex(item => item.tabIndex === 0);
      onIndexChange(index);
    };
  }, [initialIndex, initialFocusOnMount]);
}

function NavigableToolbar(_ref) {
  let {
    children,
    focusOnMount,
    __experimentalInitialIndex: initialIndex,
    __experimentalOnIndexChange: onIndexChange,
    ...props
  } = _ref;
  const ref = (0,external_wp_element_namespaceObject.useRef)();
  const isAccessibleToolbar = useIsAccessibleToolbar(ref);
  useToolbarFocus(ref, focusOnMount, isAccessibleToolbar, initialIndex, onIndexChange);

  if (isAccessibleToolbar) {
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Toolbar, _extends({
      label: props['aria-label'],
      ref: ref
    }, props), children);
  }

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.NavigableMenu, _extends({
    orientation: "horizontal",
    role: "toolbar",
    ref: ref
  }, props), children);
}

/* harmony default export */ var navigable_toolbar = (NavigableToolbar);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/chevron-right.js


/**
 * WordPress dependencies
 */

const chevronRight = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M10.6 6L9.4 7l4.6 5-4.6 5 1.2 1 5.4-6z"
}));
/* harmony default export */ var chevron_right = (chevronRight);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/chevron-left.js


/**
 * WordPress dependencies
 */

const chevronLeft = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M14.6 7l-1.2-1L8 12l5.4 6 1.2-1-4.6-5z"
}));
/* harmony default export */ var chevron_left = (chevronLeft);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/chevron-up.js


/**
 * WordPress dependencies
 */

const chevronUp = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  viewBox: "0 0 24 24",
  xmlns: "http://www.w3.org/2000/svg"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M6.5 12.4L12 8l5.5 4.4-.9 1.2L12 10l-4.5 3.6-1-1.2z"
}));
/* harmony default export */ var chevron_up = (chevronUp);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/chevron-down.js


/**
 * WordPress dependencies
 */

const chevronDown = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  viewBox: "0 0 24 24",
  xmlns: "http://www.w3.org/2000/svg"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M17.5 11.6L12 16l-5.5-4.4.9-1.2L12 14l4.5-3.6 1 1.2z"
}));
/* harmony default export */ var chevron_down = (chevronDown);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-mover/mover-description.js
/**
 * WordPress dependencies
 */

/**
 * Return a label for the block movement controls depending on block position.
 *
 * @param {number}  selectedCount Number of blocks selected.
 * @param {string}  type          Block type - in the case of a single block, should
 *                                define its 'type'. I.e. 'Text', 'Heading', 'Image' etc.
 * @param {number}  firstIndex    The index (position - 1) of the first block selected.
 * @param {boolean} isFirst       This is the first block.
 * @param {boolean} isLast        This is the last block.
 * @param {number}  dir           Direction of movement (> 0 is considered to be going
 *                                down, < 0 is up).
 * @param {string}  orientation   The orientation of the block movers, vertical or
 *                                horizontal.
 *
 * @return {string} Label for the block movement controls.
 */

function getBlockMoverDescription(selectedCount, type, firstIndex, isFirst, isLast, dir, orientation) {
  const position = firstIndex + 1;

  const getMovementDirection = moveDirection => {
    if (moveDirection === 'up') {
      if (orientation === 'horizontal') {
        return (0,external_wp_i18n_namespaceObject.isRTL)() ? 'right' : 'left';
      }

      return 'up';
    } else if (moveDirection === 'down') {
      if (orientation === 'horizontal') {
        return (0,external_wp_i18n_namespaceObject.isRTL)() ? 'left' : 'right';
      }

      return 'down';
    }

    return null;
  };

  if (selectedCount > 1) {
    return getMultiBlockMoverDescription(selectedCount, firstIndex, isFirst, isLast, dir);
  }

  if (isFirst && isLast) {
    return (0,external_wp_i18n_namespaceObject.sprintf)( // translators: %s: Type of block (i.e. Text, Image etc)
    (0,external_wp_i18n_namespaceObject.__)('Block %s is the only block, and cannot be moved'), type);
  }

  if (dir > 0 && !isLast) {
    // Moving down.
    const movementDirection = getMovementDirection('down');

    if (movementDirection === 'down') {
      return (0,external_wp_i18n_namespaceObject.sprintf)( // translators: 1: Type of block (i.e. Text, Image etc), 2: Position of selected block, 3: New position
      (0,external_wp_i18n_namespaceObject.__)('Move %1$s block from position %2$d down to position %3$d'), type, position, position + 1);
    }

    if (movementDirection === 'left') {
      return (0,external_wp_i18n_namespaceObject.sprintf)( // translators: 1: Type of block (i.e. Text, Image etc), 2: Position of selected block, 3: New position
      (0,external_wp_i18n_namespaceObject.__)('Move %1$s block from position %2$d left to position %3$d'), type, position, position + 1);
    }

    if (movementDirection === 'right') {
      return (0,external_wp_i18n_namespaceObject.sprintf)( // translators: 1: Type of block (i.e. Text, Image etc), 2: Position of selected block, 3: New position
      (0,external_wp_i18n_namespaceObject.__)('Move %1$s block from position %2$d right to position %3$d'), type, position, position + 1);
    }
  }

  if (dir > 0 && isLast) {
    // Moving down, and is the last item.
    const movementDirection = getMovementDirection('down');

    if (movementDirection === 'down') {
      return (0,external_wp_i18n_namespaceObject.sprintf)( // translators: 1: Type of block (i.e. Text, Image etc)
      (0,external_wp_i18n_namespaceObject.__)('Block %1$s is at the end of the content and can’t be moved down'), type);
    }

    if (movementDirection === 'left') {
      return (0,external_wp_i18n_namespaceObject.sprintf)( // translators: 1: Type of block (i.e. Text, Image etc)
      (0,external_wp_i18n_namespaceObject.__)('Block %1$s is at the end of the content and can’t be moved left'), type);
    }

    if (movementDirection === 'right') {
      return (0,external_wp_i18n_namespaceObject.sprintf)( // translators: 1: Type of block (i.e. Text, Image etc)
      (0,external_wp_i18n_namespaceObject.__)('Block %1$s is at the end of the content and can’t be moved right'), type);
    }
  }

  if (dir < 0 && !isFirst) {
    // Moving up.
    const movementDirection = getMovementDirection('up');

    if (movementDirection === 'up') {
      return (0,external_wp_i18n_namespaceObject.sprintf)( // translators: 1: Type of block (i.e. Text, Image etc), 2: Position of selected block, 3: New position
      (0,external_wp_i18n_namespaceObject.__)('Move %1$s block from position %2$d up to position %3$d'), type, position, position - 1);
    }

    if (movementDirection === 'left') {
      return (0,external_wp_i18n_namespaceObject.sprintf)( // translators: 1: Type of block (i.e. Text, Image etc), 2: Position of selected block, 3: New position
      (0,external_wp_i18n_namespaceObject.__)('Move %1$s block from position %2$d left to position %3$d'), type, position, position - 1);
    }

    if (movementDirection === 'right') {
      return (0,external_wp_i18n_namespaceObject.sprintf)( // translators: 1: Type of block (i.e. Text, Image etc), 2: Position of selected block, 3: New position
      (0,external_wp_i18n_namespaceObject.__)('Move %1$s block from position %2$d right to position %3$d'), type, position, position - 1);
    }
  }

  if (dir < 0 && isFirst) {
    // Moving up, and is the first item.
    const movementDirection = getMovementDirection('up');

    if (movementDirection === 'up') {
      return (0,external_wp_i18n_namespaceObject.sprintf)( // translators: 1: Type of block (i.e. Text, Image etc)
      (0,external_wp_i18n_namespaceObject.__)('Block %1$s is at the beginning of the content and can’t be moved up'), type);
    }

    if (movementDirection === 'left') {
      return (0,external_wp_i18n_namespaceObject.sprintf)( // translators: 1: Type of block (i.e. Text, Image etc)
      (0,external_wp_i18n_namespaceObject.__)('Block %1$s is at the beginning of the content and can’t be moved left'), type);
    }

    if (movementDirection === 'right') {
      return (0,external_wp_i18n_namespaceObject.sprintf)( // translators: 1: Type of block (i.e. Text, Image etc)
      (0,external_wp_i18n_namespaceObject.__)('Block %1$s is at the beginning of the content and can’t be moved right'), type);
    }
  }
}
/**
 * Return a label for the block movement controls depending on block position.
 *
 * @param {number}  selectedCount Number of blocks selected.
 * @param {number}  firstIndex    The index (position - 1) of the first block selected.
 * @param {boolean} isFirst       This is the first block.
 * @param {boolean} isLast        This is the last block.
 * @param {number}  dir           Direction of movement (> 0 is considered to be going
 *                                down, < 0 is up).
 *
 * @return {string} Label for the block movement controls.
 */

function getMultiBlockMoverDescription(selectedCount, firstIndex, isFirst, isLast, dir) {
  const position = firstIndex + 1;

  if (dir < 0 && isFirst) {
    return (0,external_wp_i18n_namespaceObject.__)('Blocks cannot be moved up as they are already at the top');
  }

  if (dir > 0 && isLast) {
    return (0,external_wp_i18n_namespaceObject.__)('Blocks cannot be moved down as they are already at the bottom');
  }

  if (dir < 0 && !isFirst) {
    return (0,external_wp_i18n_namespaceObject.sprintf)( // translators: 1: Number of selected blocks, 2: Position of selected blocks
    (0,external_wp_i18n_namespaceObject._n)('Move %1$d block from position %2$d up by one place', 'Move %1$d blocks from position %2$d up by one place', selectedCount), selectedCount, position);
  }

  if (dir > 0 && !isLast) {
    return (0,external_wp_i18n_namespaceObject.sprintf)( // translators: 1: Number of selected blocks, 2: Position of selected blocks
    (0,external_wp_i18n_namespaceObject._n)('Move %1$d block from position %2$d down by one place', 'Move %1$d blocks from position %2$d down by one place', selectedCount), selectedCount, position);
  }
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-mover/button.js



/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */







/**
 * Internal dependencies
 */





const getArrowIcon = (direction, orientation) => {
  if (direction === 'up') {
    if (orientation === 'horizontal') {
      return (0,external_wp_i18n_namespaceObject.isRTL)() ? chevron_right : chevron_left;
    }

    return chevron_up;
  } else if (direction === 'down') {
    if (orientation === 'horizontal') {
      return (0,external_wp_i18n_namespaceObject.isRTL)() ? chevron_left : chevron_right;
    }

    return chevron_down;
  }

  return null;
};

const getMovementDirectionLabel = (moveDirection, orientation) => {
  if (moveDirection === 'up') {
    if (orientation === 'horizontal') {
      return (0,external_wp_i18n_namespaceObject.isRTL)() ? (0,external_wp_i18n_namespaceObject.__)('Move right') : (0,external_wp_i18n_namespaceObject.__)('Move left');
    }

    return (0,external_wp_i18n_namespaceObject.__)('Move up');
  } else if (moveDirection === 'down') {
    if (orientation === 'horizontal') {
      return (0,external_wp_i18n_namespaceObject.isRTL)() ? (0,external_wp_i18n_namespaceObject.__)('Move left') : (0,external_wp_i18n_namespaceObject.__)('Move right');
    }

    return (0,external_wp_i18n_namespaceObject.__)('Move down');
  }

  return null;
};

const BlockMoverButton = (0,external_wp_element_namespaceObject.forwardRef)((_ref, ref) => {
  let {
    clientIds,
    direction,
    orientation: moverOrientation,
    ...props
  } = _ref;
  const instanceId = (0,external_wp_compose_namespaceObject.useInstanceId)(BlockMoverButton);
  const blocksCount = (0,external_lodash_namespaceObject.castArray)(clientIds).length;
  const {
    blockType,
    isDisabled,
    rootClientId,
    isFirst,
    isLast,
    firstIndex,
    orientation = 'vertical'
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getBlockIndex,
      getBlockRootClientId,
      getBlockOrder,
      getBlock,
      getBlockListSettings
    } = select(store);
    const normalizedClientIds = (0,external_lodash_namespaceObject.castArray)(clientIds);
    const firstClientId = (0,external_lodash_namespaceObject.first)(normalizedClientIds);
    const blockRootClientId = getBlockRootClientId(firstClientId);
    const firstBlockIndex = getBlockIndex(firstClientId);
    const lastBlockIndex = getBlockIndex((0,external_lodash_namespaceObject.last)(normalizedClientIds));
    const blockOrder = getBlockOrder(blockRootClientId);
    const block = getBlock(firstClientId);
    const isFirstBlock = firstBlockIndex === 0;
    const isLastBlock = lastBlockIndex === blockOrder.length - 1;
    const {
      orientation: blockListOrientation
    } = getBlockListSettings(blockRootClientId) || {};
    return {
      blockType: block ? (0,external_wp_blocks_namespaceObject.getBlockType)(block.name) : null,
      isDisabled: direction === 'up' ? isFirstBlock : isLastBlock,
      rootClientId: blockRootClientId,
      firstIndex: firstBlockIndex,
      isFirst: isFirstBlock,
      isLast: isLastBlock,
      orientation: moverOrientation || blockListOrientation
    };
  }, [clientIds, direction]);
  const {
    moveBlocksDown,
    moveBlocksUp
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const moverFunction = direction === 'up' ? moveBlocksUp : moveBlocksDown;

  const onClick = event => {
    moverFunction(clientIds, rootClientId);

    if (props.onClick) {
      props.onClick(event);
    }
  };

  const descriptionId = `block-editor-block-mover-button__description-${instanceId}`;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, _extends({
    ref: ref,
    className: classnames_default()('block-editor-block-mover-button', `is-${direction}-button`),
    icon: getArrowIcon(direction, orientation),
    label: getMovementDirectionLabel(direction, orientation),
    "aria-describedby": descriptionId
  }, props, {
    onClick: isDisabled ? null : onClick,
    "aria-disabled": isDisabled
  })), (0,external_wp_element_namespaceObject.createElement)("span", {
    id: descriptionId,
    className: "block-editor-block-mover-button__description"
  }, getBlockMoverDescription(blocksCount, blockType && blockType.title, firstIndex, isFirst, isLast, direction === 'up' ? -1 : 1, orientation)));
});
const BlockMoverUpButton = (0,external_wp_element_namespaceObject.forwardRef)((props, ref) => {
  return (0,external_wp_element_namespaceObject.createElement)(BlockMoverButton, _extends({
    direction: "up",
    ref: ref
  }, props));
});
const BlockMoverDownButton = (0,external_wp_element_namespaceObject.forwardRef)((props, ref) => {
  return (0,external_wp_element_namespaceObject.createElement)(BlockMoverButton, _extends({
    direction: "down",
    ref: ref
  }, props));
});

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-mover/index.js



/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */







/**
 * Internal dependencies
 */





function BlockMover(_ref) {
  let {
    isFirst,
    isLast,
    clientIds,
    canMove,
    isHidden,
    rootClientId,
    orientation,
    hideDragHandle
  } = _ref;
  const [isFocused, setIsFocused] = (0,external_wp_element_namespaceObject.useState)(false);

  const onFocus = () => setIsFocused(true);

  const onBlur = () => setIsFocused(false);

  if (!canMove || isFirst && isLast && !rootClientId) {
    return null;
  }

  const dragHandleLabel = (0,external_wp_i18n_namespaceObject.__)('Drag'); // We emulate a disabled state because forcefully applying the `disabled`
  // attribute on the buttons while it has focus causes the screen to change
  // to an unfocused state (body as active element) without firing blur on,
  // the rendering parent, leaving it unable to react to focus out.


  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: classnames_default()('block-editor-block-mover', {
      'is-visible': isFocused || !isHidden,
      'is-horizontal': orientation === 'horizontal'
    })
  }, !hideDragHandle && (0,external_wp_element_namespaceObject.createElement)(block_draggable, {
    clientIds: clientIds,
    cloneClassname: "block-editor-block-mover__drag-clone"
  }, draggableProps => (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, _extends({
    icon: drag_handle,
    className: "block-editor-block-mover__drag-handle",
    "aria-hidden": "true",
    label: dragHandleLabel // Should not be able to tab to drag handle as this
    // button can only be used with a pointer device.
    ,
    tabIndex: "-1"
  }, draggableProps))), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarGroup, {
    className: "block-editor-block-mover__move-button-container"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarItem, {
    onFocus: onFocus,
    onBlur: onBlur
  }, itemProps => (0,external_wp_element_namespaceObject.createElement)(BlockMoverUpButton, _extends({
    clientIds: clientIds
  }, itemProps))), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarItem, {
    onFocus: onFocus,
    onBlur: onBlur
  }, itemProps => (0,external_wp_element_namespaceObject.createElement)(BlockMoverDownButton, _extends({
    clientIds: clientIds
  }, itemProps)))));
}
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/block-mover/README.md
 */


/* harmony default export */ var block_mover = ((0,external_wp_data_namespaceObject.withSelect)((select, _ref2) => {
  var _getBlockListSettings;

  let {
    clientIds
  } = _ref2;
  const {
    getBlock,
    getBlockIndex,
    getBlockListSettings,
    canMoveBlocks,
    getBlockOrder,
    getBlockRootClientId
  } = select(store);
  const normalizedClientIds = (0,external_lodash_namespaceObject.castArray)(clientIds);
  const firstClientId = (0,external_lodash_namespaceObject.first)(normalizedClientIds);
  const block = getBlock(firstClientId);
  const rootClientId = getBlockRootClientId((0,external_lodash_namespaceObject.first)(normalizedClientIds));
  const firstIndex = getBlockIndex(firstClientId);
  const lastIndex = getBlockIndex((0,external_lodash_namespaceObject.last)(normalizedClientIds));
  const blockOrder = getBlockOrder(rootClientId);
  const isFirst = firstIndex === 0;
  const isLast = lastIndex === blockOrder.length - 1;
  return {
    blockType: block ? (0,external_wp_blocks_namespaceObject.getBlockType)(block.name) : null,
    canMove: canMoveBlocks(clientIds, rootClientId),
    rootClientId,
    firstIndex,
    isFirst,
    isLast,
    orientation: (_getBlockListSettings = getBlockListSettings(rootClientId)) === null || _getBlockListSettings === void 0 ? void 0 : _getBlockListSettings.orientation
  };
})(BlockMover));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-toolbar/utils.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */


const {
  clearTimeout: utils_clearTimeout,
  setTimeout: utils_setTimeout
} = window;
const DEBOUNCE_TIMEOUT = 200;
/**
 * Hook that creates a showMover state, as well as debounced show/hide callbacks.
 *
 * @param {Object}   props                       Component props.
 * @param {Object}   props.ref                   Element reference.
 * @param {boolean}  props.isFocused             Whether the component has current focus.
 * @param {number}   [props.debounceTimeout=250] Debounce timeout in milliseconds.
 * @param {Function} [props.onChange=noop]       Callback function.
 */

function useDebouncedShowMovers(_ref) {
  let {
    ref,
    isFocused,
    debounceTimeout = DEBOUNCE_TIMEOUT,
    onChange = external_lodash_namespaceObject.noop
  } = _ref;
  const [showMovers, setShowMovers] = (0,external_wp_element_namespaceObject.useState)(false);
  const timeoutRef = (0,external_wp_element_namespaceObject.useRef)();

  const handleOnChange = nextIsFocused => {
    if (ref !== null && ref !== void 0 && ref.current) {
      setShowMovers(nextIsFocused);
    }

    onChange(nextIsFocused);
  };

  const getIsHovered = () => {
    return (ref === null || ref === void 0 ? void 0 : ref.current) && ref.current.matches(':hover');
  };

  const shouldHideMovers = () => {
    const isHovered = getIsHovered();
    return !isFocused && !isHovered;
  };

  const clearTimeoutRef = () => {
    const timeout = timeoutRef.current;

    if (timeout && utils_clearTimeout) {
      utils_clearTimeout(timeout);
    }
  };

  const debouncedShowMovers = event => {
    if (event) {
      event.stopPropagation();
    }

    clearTimeoutRef();

    if (!showMovers) {
      handleOnChange(true);
    }
  };

  const debouncedHideMovers = event => {
    if (event) {
      event.stopPropagation();
    }

    clearTimeoutRef();
    timeoutRef.current = utils_setTimeout(() => {
      if (shouldHideMovers()) {
        handleOnChange(false);
      }
    }, debounceTimeout);
  };

  (0,external_wp_element_namespaceObject.useEffect)(() => () => {
    /**
     * We need to call the change handler with `isFocused`
     * set to false on unmount because we also clear the
     * timeout that would handle that.
     */
    handleOnChange(false);
    clearTimeoutRef();
  }, []);
  return {
    showMovers,
    debouncedShowMovers,
    debouncedHideMovers
  };
}
/**
 * Hook that provides a showMovers state and gesture events for DOM elements
 * that interact with the showMovers state.
 *
 * @param {Object}   props                       Component props.
 * @param {Object}   props.ref                   Element reference.
 * @param {number}   [props.debounceTimeout=250] Debounce timeout in milliseconds.
 * @param {Function} [props.onChange=noop]       Callback function.
 */

function useShowMoversGestures(_ref2) {
  let {
    ref,
    debounceTimeout = DEBOUNCE_TIMEOUT,
    onChange = external_lodash_namespaceObject.noop
  } = _ref2;
  const [isFocused, setIsFocused] = (0,external_wp_element_namespaceObject.useState)(false);
  const {
    showMovers,
    debouncedShowMovers,
    debouncedHideMovers
  } = useDebouncedShowMovers({
    ref,
    debounceTimeout,
    isFocused,
    onChange
  });
  const registerRef = (0,external_wp_element_namespaceObject.useRef)(false);

  const isFocusedWithin = () => {
    return (ref === null || ref === void 0 ? void 0 : ref.current) && ref.current.contains(ref.current.ownerDocument.activeElement);
  };

  (0,external_wp_element_namespaceObject.useEffect)(() => {
    const node = ref.current;

    const handleOnFocus = () => {
      if (isFocusedWithin()) {
        setIsFocused(true);
        debouncedShowMovers();
      }
    };

    const handleOnBlur = () => {
      if (!isFocusedWithin()) {
        setIsFocused(false);
        debouncedHideMovers();
      }
    };
    /**
     * Events are added via DOM events (vs. React synthetic events),
     * as the child React components swallow mouse events.
     */


    if (node && !registerRef.current) {
      node.addEventListener('focus', handleOnFocus, true);
      node.addEventListener('blur', handleOnBlur, true);
      registerRef.current = true;
    }

    return () => {
      if (node) {
        node.removeEventListener('focus', handleOnFocus);
        node.removeEventListener('blur', handleOnBlur);
      }
    };
  }, [ref, registerRef, setIsFocused, debouncedShowMovers, debouncedHideMovers]);
  return {
    showMovers,
    gestures: {
      onMouseMove: debouncedShowMovers,
      onMouseLeave: debouncedHideMovers
    }
  };
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-parent-selector/index.js



/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */





/**
 * Block parent selector component, displaying the hierarchy of the
 * current block selection as a single icon to "go up" a level.
 *
 * @return {WPComponent} Parent block selector.
 */

function BlockParentSelector() {
  const {
    selectBlock,
    toggleBlockHighlight
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const {
    firstParentClientId,
    shouldHide,
    hasReducedUI
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getBlockName,
      getBlockParents,
      getSelectedBlockClientId,
      getSettings
    } = select(store);
    const {
      hasBlockSupport
    } = select(external_wp_blocks_namespaceObject.store);
    const selectedBlockClientId = getSelectedBlockClientId();
    const parents = getBlockParents(selectedBlockClientId);
    const _firstParentClientId = parents[parents.length - 1];
    const parentBlockName = getBlockName(_firstParentClientId);

    const _parentBlockType = (0,external_wp_blocks_namespaceObject.getBlockType)(parentBlockName);

    const settings = getSettings();
    return {
      firstParentClientId: _firstParentClientId,
      shouldHide: !hasBlockSupport(_parentBlockType, '__experimentalParentSelector', true),
      hasReducedUI: settings.hasReducedUI
    };
  }, []);
  const blockInformation = useBlockDisplayInformation(firstParentClientId); // Allows highlighting the parent block outline when focusing or hovering
  // the parent block selector within the child.

  const nodeRef = (0,external_wp_element_namespaceObject.useRef)();
  const {
    gestures: showMoversGestures
  } = useShowMoversGestures({
    ref: nodeRef,

    onChange(isFocused) {
      if (isFocused && hasReducedUI) {
        return;
      }

      toggleBlockHighlight(firstParentClientId, isFocused);
    }

  });

  if (shouldHide || firstParentClientId === undefined) {
    return null;
  }

  return (0,external_wp_element_namespaceObject.createElement)("div", _extends({
    className: "block-editor-block-parent-selector",
    key: firstParentClientId,
    ref: nodeRef
  }, showMoversGestures), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarButton, {
    className: "block-editor-block-parent-selector__button",
    onClick: () => selectBlock(firstParentClientId),
    label: (0,external_wp_i18n_namespaceObject.sprintf)(
    /* translators: %s: Name of the block's parent. */
    (0,external_wp_i18n_namespaceObject.__)('Select %s'), blockInformation.title),
    showTooltip: true,
    icon: (0,external_wp_element_namespaceObject.createElement)(block_icon, {
      icon: blockInformation.icon
    })
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/copy.js


/**
 * WordPress dependencies
 */

const copy = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M20.2 8v11c0 .7-.6 1.2-1.2 1.2H6v1.5h13c1.5 0 2.7-1.2 2.7-2.8V8zM18 16.4V4.6c0-.9-.7-1.6-1.6-1.6H4.6C3.7 3 3 3.7 3 4.6v11.8c0 .9.7 1.6 1.6 1.6h11.8c.9 0 1.6-.7 1.6-1.6zm-13.5 0V4.6c0-.1.1-.1.1-.1h11.8c.1 0 .1.1.1.1v11.8c0 .1-.1.1-.1.1H4.6l-.1-.1z"
}));
/* harmony default export */ var library_copy = (copy);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-switcher/preview-block-popover.js


/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


function PreviewBlockPopover(_ref) {
  let {
    blocks
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-switcher__popover__preview__parent"
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-switcher__popover__preview__container"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Popover, {
    className: "block-editor-block-switcher__preview__popover",
    position: "bottom right",
    focusOnMount: false
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-switcher__preview"
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-switcher__preview-title"
  }, (0,external_wp_i18n_namespaceObject.__)('Preview')), (0,external_wp_element_namespaceObject.createElement)(block_preview, {
    viewportWidth: 500,
    blocks: blocks
  })))));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-switcher/block-transformations-menu.js


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */




const BlockTransformationsMenu = _ref => {
  let {
    className,
    possibleBlockTransformations,
    onSelect,
    blocks
  } = _ref;
  const [hoveredTransformItemName, setHoveredTransformItemName] = (0,external_wp_element_namespaceObject.useState)();
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuGroup, {
    label: (0,external_wp_i18n_namespaceObject.__)('Transform to'),
    className: className
  }, hoveredTransformItemName && (0,external_wp_element_namespaceObject.createElement)(PreviewBlockPopover, {
    blocks: (0,external_wp_blocks_namespaceObject.switchToBlockType)(blocks, hoveredTransformItemName)
  }), possibleBlockTransformations.map(item => {
    const {
      name,
      icon,
      title,
      isDisabled
    } = item;
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
      key: name,
      className: (0,external_wp_blocks_namespaceObject.getBlockMenuDefaultClassName)(name),
      onClick: event => {
        event.preventDefault();
        onSelect(name);
      },
      disabled: isDisabled,
      onMouseLeave: () => setHoveredTransformItemName(null),
      onMouseEnter: () => setHoveredTransformItemName(name)
    }, (0,external_wp_element_namespaceObject.createElement)(block_icon, {
      icon: icon,
      showColors: true
    }), title);
  }));
};

/* harmony default export */ var block_transformations_menu = (BlockTransformationsMenu);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/check.js


/**
 * WordPress dependencies
 */

const check = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M16.7 7.1l-6.3 8.5-3.3-2.5-.9 1.2 4.5 3.4L17.9 8z"
}));
/* harmony default export */ var library_check = (check);

;// CONCATENATED MODULE: external ["wp","tokenList"]
var external_wp_tokenList_namespaceObject = window["wp"]["tokenList"];
var external_wp_tokenList_default = /*#__PURE__*/__webpack_require__.n(external_wp_tokenList_namespaceObject);
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-styles/utils.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Returns the active style from the given className.
 *
 * @param {Array}  styles    Block style variations.
 * @param {string} className Class name
 *
 * @return {Object?} The active style.
 */

function getActiveStyle(styles, className) {
  for (const style of new (external_wp_tokenList_default())(className).values()) {
    if (style.indexOf('is-style-') === -1) {
      continue;
    }

    const potentialStyleName = style.substring(9);
    const activeStyle = (0,external_lodash_namespaceObject.find)(styles, {
      name: potentialStyleName
    });

    if (activeStyle) {
      return activeStyle;
    }
  }

  return (0,external_lodash_namespaceObject.find)(styles, 'isDefault');
}
/**
 * Replaces the active style in the block's className.
 *
 * @param {string}  className   Class name.
 * @param {Object?} activeStyle The replaced style.
 * @param {Object}  newStyle    The replacing style.
 *
 * @return {string} The updated className.
 */

function replaceActiveStyle(className, activeStyle, newStyle) {
  const list = new (external_wp_tokenList_default())(className);

  if (activeStyle) {
    list.remove('is-style-' + activeStyle.name);
  }

  list.add('is-style-' + newStyle.name);
  return list.value;
}
/**
 * Returns a collection of styles that can be represented on the frontend.
 * The function checks a style collection for a default style. If none is found, it adds one to
 * act as a fallback for when there is no active style applied to a block. The default item also serves
 * as a switch on the frontend to deactivate non-default styles.
 *
 * @param {Array} styles Block style variations.
 *
 * @return {Array<Object?>}        The style collection.
 */

function getRenderedStyles(styles) {
  if (!styles || styles.length === 0) {
    return [];
  }

  return getDefaultStyle(styles) ? styles : [{
    name: 'default',
    label: (0,external_wp_i18n_namespaceObject._x)('Default', 'block style'),
    isDefault: true
  }, ...styles];
}
/**
 * Returns a style object from a collection of styles where that style object is the default block style.
 *
 * @param {Array} styles Block style variations.
 *
 * @return {Object?}        The default style object, if found.
 */

function getDefaultStyle(styles) {
  return (0,external_lodash_namespaceObject.find)(styles, 'isDefault');
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-styles/use-styles-for-block.js
/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */



/**
 *
 * @param {WPBlock}     block Block object.
 * @param {WPBlockType} type  Block type settings.
 * @return {WPBlock}          A generic block ready for styles preview.
 */

function useGenericPreviewBlock(block, type) {
  return (0,external_wp_element_namespaceObject.useMemo)(() => {
    const example = type === null || type === void 0 ? void 0 : type.example;
    const blockName = type === null || type === void 0 ? void 0 : type.name;

    if (example && blockName) {
      return (0,external_wp_blocks_namespaceObject.getBlockFromExample)(blockName, {
        attributes: example.attributes,
        innerBlocks: example.innerBlocks
      });
    }

    if (block) {
      return (0,external_wp_blocks_namespaceObject.cloneBlock)(block);
    }
  }, [type !== null && type !== void 0 && type.example ? block === null || block === void 0 ? void 0 : block.name : block, type]);
}
/**
 * @typedef useStylesForBlocksArguments
 * @property {string}     clientId Block client ID.
 * @property {() => void} onSwitch Block style switch callback function.
 */

/**
 *
 * @param {useStylesForBlocksArguments} useStylesForBlocks arguments.
 * @return {Object}                                         Results of the select methods.
 */


function useStylesForBlocks(_ref) {
  let {
    clientId,
    onSwitch
  } = _ref;

  const selector = select => {
    const {
      getBlock
    } = select(store);
    const block = getBlock(clientId);

    if (!block) {
      return {};
    }

    const blockType = (0,external_wp_blocks_namespaceObject.getBlockType)(block.name);
    const {
      getBlockStyles
    } = select(external_wp_blocks_namespaceObject.store);
    return {
      block,
      blockType,
      styles: getBlockStyles(block.name),
      className: block.attributes.className || ''
    };
  };

  const {
    styles,
    block,
    blockType,
    className
  } = (0,external_wp_data_namespaceObject.useSelect)(selector, [clientId]);
  const {
    updateBlockAttributes
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const stylesToRender = getRenderedStyles(styles);
  const activeStyle = getActiveStyle(stylesToRender, className);
  const genericPreviewBlock = useGenericPreviewBlock(block, blockType);

  const onSelect = style => {
    const styleClassName = replaceActiveStyle(className, activeStyle, style);
    updateBlockAttributes(clientId, {
      className: styleClassName
    });
    onSwitch();
  };

  return {
    onSelect,
    stylesToRender,
    activeStyle,
    genericPreviewBlock,
    className
  };
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-styles/menu-items.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */


function BlockStylesMenuItems(_ref) {
  let {
    clientId,
    onSwitch = external_lodash_namespaceObject.noop
  } = _ref;
  const {
    onSelect,
    stylesToRender,
    activeStyle
  } = useStylesForBlocks({
    clientId,
    onSwitch
  });

  if (!stylesToRender || stylesToRender.length === 0) {
    return null;
  }

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, stylesToRender.map(style => {
    const menuItemText = style.label || style.name;
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
      key: style.name,
      icon: activeStyle.name === style.name ? library_check : null,
      onClick: () => onSelect(style)
    }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalText, {
      as: "span",
      limit: 18,
      ellipsizeMode: "tail",
      truncate: true
    }, menuItemText));
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-switcher/block-styles-menu.js


/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


function BlockStylesMenu(_ref) {
  let {
    hoveredBlock,
    onSwitch
  } = _ref;
  const {
    clientId
  } = hoveredBlock;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuGroup, {
    label: (0,external_wp_i18n_namespaceObject.__)('Styles'),
    className: "block-editor-block-switcher__styles__menugroup"
  }, (0,external_wp_element_namespaceObject.createElement)(BlockStylesMenuItems, {
    clientId: clientId,
    onSwitch: onSwitch
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-switcher/utils.js
/**
 * WordPress dependencies
 */

/**
 * Try to find a matching block by a block's name in a provided
 * block. We recurse through InnerBlocks and return the reference
 * of the matched block (it could be an InnerBlock).
 * If no match is found return nothing.
 *
 * @param {WPBlock} block             The block to try to find a match.
 * @param {string}  selectedBlockName The block's name to use for matching condition.
 * @param {Set}     consumedBlocks    A set holding the previously matched/consumed blocks.
 *
 * @return {WPBlock?} The matched block if found or nothing(`undefined`).
 */

const getMatchingBlockByName = function (block, selectedBlockName) {
  let consumedBlocks = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : new Set();
  const {
    clientId,
    name,
    innerBlocks = []
  } = block; // Check if block has been consumed already.

  if (consumedBlocks.has(clientId)) return;
  if (name === selectedBlockName) return block; // Try to find a matching block from InnerBlocks recursively.

  for (const innerBlock of innerBlocks) {
    const match = getMatchingBlockByName(innerBlock, selectedBlockName, consumedBlocks);
    if (match) return match;
  }
};
/**
 * Find and return the block attributes to retain through
 * the transformation, based on Block Type's `role:content`
 * attributes. If no `role:content` attributes exist,
 * return selected block's attributes.
 *
 * @param {string} name       Block type's namespaced name.
 * @param {Object} attributes Selected block's attributes.
 * @return {Object} The block's attributes to retain.
 */

const getRetainedBlockAttributes = (name, attributes) => {
  const contentAttributes = (0,external_wp_blocks_namespaceObject.__experimentalGetBlockAttributesNamesByRole)(name, 'content');
  if (!(contentAttributes !== null && contentAttributes !== void 0 && contentAttributes.length)) return attributes;
  return contentAttributes.reduce((_accumulator, attribute) => {
    if (attributes[attribute]) _accumulator[attribute] = attributes[attribute];
    return _accumulator;
  }, {});
};

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-switcher/use-transformed-patterns.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


/**
 * Mutate the matched block's attributes by getting
 * which block type's attributes to retain and prioritize
 * them in the merging of the attributes.
 *
 * @param {WPBlock} match         The matched block.
 * @param {WPBlock} selectedBlock The selected block.
 * @return {void}
 */

const transformMatchingBlock = (match, selectedBlock) => {
  // Get the block attributes to retain through the transformation.
  const retainedBlockAttributes = getRetainedBlockAttributes(selectedBlock.name, selectedBlock.attributes);
  match.attributes = { ...match.attributes,
    ...retainedBlockAttributes
  };
};
/**
 * By providing the selected blocks and pattern's blocks
 * find the matching blocks, transform them and return them.
 * If not all selected blocks are matched, return nothing.
 *
 * @param {WPBlock[]} selectedBlocks The selected blocks.
 * @param {WPBlock[]} patternBlocks  The pattern's blocks.
 * @return {WPBlock[]|void} The transformed pattern's blocks or undefined if not all selected blocks have been matched.
 */

const getPatternTransformedBlocks = (selectedBlocks, patternBlocks) => {
  // Clone Pattern's blocks to produce new clientIds and be able to mutate the matches.
  const _patternBlocks = patternBlocks.map(block => (0,external_wp_blocks_namespaceObject.cloneBlock)(block));
  /**
   * Keep track of the consumed pattern blocks.
   * This is needed because we loop the selected blocks
   * and for example we may have selected two paragraphs and
   * the pattern's blocks could have more `paragraphs`.
   */


  const consumedBlocks = new Set();

  for (const selectedBlock of selectedBlocks) {
    let isMatch = false;

    for (const patternBlock of _patternBlocks) {
      const match = getMatchingBlockByName(patternBlock, selectedBlock.name, consumedBlocks);
      if (!match) continue;
      isMatch = true;
      consumedBlocks.add(match.clientId); // We update (mutate) the matching pattern block.

      transformMatchingBlock(match, selectedBlock); // No need to loop through other pattern's blocks.

      break;
    } // Bail eary if a selected block has not been matched.


    if (!isMatch) return;
  }

  return _patternBlocks;
};
/**
 * @typedef {WPBlockPattern & {transformedBlocks: WPBlock[]}} TransformedBlockPattern
 */

/**
 * Custom hook that accepts patterns from state and the selected
 * blocks and tries to match these with the pattern's blocks.
 * If all selected blocks are matched with a Pattern's block,
 * we transform them by retaining block's attributes with `role:content`.
 * The transformed pattern's blocks are set to a new pattern
 * property `transformedBlocks`.
 *
 * @param {WPBlockPattern[]} patterns       Patterns from state.
 * @param {WPBlock[]}        selectedBlocks The currently selected blocks.
 * @return {TransformedBlockPattern[]} Returns the eligible matched patterns with all the selected blocks.
 */

const useTransformedPatterns = (patterns, selectedBlocks) => {
  return (0,external_wp_element_namespaceObject.useMemo)(() => patterns.reduce((accumulator, _pattern) => {
    const transformedBlocks = getPatternTransformedBlocks(selectedBlocks, _pattern.blocks);

    if (transformedBlocks) {
      accumulator.push({ ..._pattern,
        transformedBlocks
      });
    }

    return accumulator;
  }, []), [patterns, selectedBlocks]);
};

/* harmony default export */ var use_transformed_patterns = (useTransformedPatterns);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-switcher/pattern-transformations-menu.js



/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */




function PatternTransformationsMenu(_ref) {
  let {
    blocks,
    patterns: statePatterns,
    onSelect
  } = _ref;
  const [showTransforms, setShowTransforms] = (0,external_wp_element_namespaceObject.useState)(false);
  const patterns = use_transformed_patterns(statePatterns, blocks);
  if (!patterns.length) return null;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuGroup, {
    className: "block-editor-block-switcher__pattern__transforms__menugroup"
  }, showTransforms && (0,external_wp_element_namespaceObject.createElement)(PreviewPatternsPopover, {
    patterns: patterns,
    onSelect: onSelect
  }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
    onClick: event => {
      event.preventDefault();
      setShowTransforms(!showTransforms);
    },
    icon: chevron_right
  }, (0,external_wp_i18n_namespaceObject.__)('Patterns')));
}

function PreviewPatternsPopover(_ref2) {
  let {
    patterns,
    onSelect
  } = _ref2;
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-switcher__popover__preview__parent"
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-switcher__popover__preview__container"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Popover, {
    className: "block-editor-block-switcher__preview__popover",
    position: "bottom right"
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-switcher__preview"
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-switcher__preview-title"
  }, (0,external_wp_i18n_namespaceObject.__)('Preview')), (0,external_wp_element_namespaceObject.createElement)(BlockPatternsList, {
    patterns: patterns,
    onSelect: onSelect
  })))));
}

function BlockPatternsList(_ref3) {
  let {
    patterns,
    onSelect
  } = _ref3;
  const composite = (0,external_wp_components_namespaceObject.__unstableUseCompositeState)();
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__unstableComposite, _extends({}, composite, {
    role: "listbox",
    className: "block-editor-block-switcher__preview-patterns-container",
    "aria-label": (0,external_wp_i18n_namespaceObject.__)('Patterns list')
  }), patterns.map(pattern => (0,external_wp_element_namespaceObject.createElement)(pattern_transformations_menu_BlockPattern, {
    key: pattern.name,
    pattern: pattern,
    onSelect: onSelect,
    composite: composite
  })));
}

function pattern_transformations_menu_BlockPattern(_ref4) {
  let {
    pattern,
    onSelect,
    composite
  } = _ref4;
  // TODO check pattern/preview width...
  const baseClassName = 'block-editor-block-switcher__preview-patterns-container';
  const descriptionId = (0,external_wp_compose_namespaceObject.useInstanceId)(pattern_transformations_menu_BlockPattern, `${baseClassName}-list__item-description`);
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: `${baseClassName}-list__list-item`,
    "aria-label": pattern.title,
    "aria-describedby": pattern.description ? descriptionId : undefined
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__unstableCompositeItem, _extends({
    role: "option",
    as: "div"
  }, composite, {
    className: `${baseClassName}-list__item`,
    onClick: () => onSelect(pattern.transformedBlocks)
  }), (0,external_wp_element_namespaceObject.createElement)(block_preview, {
    blocks: pattern.transformedBlocks,
    viewportWidth: pattern.viewportWidth || 500
  }), (0,external_wp_element_namespaceObject.createElement)("div", {
    className: `${baseClassName}-list__item-title`
  }, pattern.title)), !!pattern.description && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.VisuallyHidden, {
    id: descriptionId
  }, pattern.description));
}

/* harmony default export */ var pattern_transformations_menu = (PatternTransformationsMenu);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-switcher/index.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */








const BlockSwitcherDropdownMenu = _ref => {
  let {
    clientIds,
    blocks
  } = _ref;
  const {
    replaceBlocks
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const blockInformation = useBlockDisplayInformation(blocks[0].clientId);
  const {
    possibleBlockTransformations,
    canRemove,
    hasBlockStyles,
    icon,
    blockTitle,
    patterns
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    var _getBlockType2;

    const {
      getBlockRootClientId,
      getBlockTransformItems,
      __experimentalGetPatternTransformItems
    } = select(store);
    const {
      getBlockStyles,
      getBlockType
    } = select(external_wp_blocks_namespaceObject.store);
    const {
      canRemoveBlocks
    } = select(store);
    const rootClientId = getBlockRootClientId((0,external_lodash_namespaceObject.castArray)(clientIds)[0]);
    const [{
      name: firstBlockName
    }] = blocks;

    const _isSingleBlockSelected = blocks.length === 1;

    const styles = _isSingleBlockSelected && getBlockStyles(firstBlockName);

    let _icon;

    if (_isSingleBlockSelected) {
      _icon = blockInformation === null || blockInformation === void 0 ? void 0 : blockInformation.icon; // Take into account active block variations.
    } else {
      var _getBlockType;

      const isSelectionOfSameType = (0,external_lodash_namespaceObject.uniq)(blocks.map(_ref2 => {
        let {
          name
        } = _ref2;
        return name;
      })).length === 1; // When selection consists of blocks of multiple types, display an
      // appropriate icon to communicate the non-uniformity.

      _icon = isSelectionOfSameType ? (_getBlockType = getBlockType(firstBlockName)) === null || _getBlockType === void 0 ? void 0 : _getBlockType.icon : library_copy;
    }

    return {
      possibleBlockTransformations: getBlockTransformItems(blocks, rootClientId),
      canRemove: canRemoveBlocks(clientIds, rootClientId),
      hasBlockStyles: !!(styles !== null && styles !== void 0 && styles.length),
      icon: _icon,
      blockTitle: (_getBlockType2 = getBlockType(firstBlockName)) === null || _getBlockType2 === void 0 ? void 0 : _getBlockType2.title,
      patterns: __experimentalGetPatternTransformItems(blocks, rootClientId)
    };
  }, [clientIds, blocks, blockInformation === null || blockInformation === void 0 ? void 0 : blockInformation.icon]);
  const isReusable = blocks.length === 1 && (0,external_wp_blocks_namespaceObject.isReusableBlock)(blocks[0]);
  const isTemplate = blocks.length === 1 && (0,external_wp_blocks_namespaceObject.isTemplatePart)(blocks[0]); // Simple block tranformation based on the `Block Transforms` API.

  const onBlockTransform = name => replaceBlocks(clientIds, (0,external_wp_blocks_namespaceObject.switchToBlockType)(blocks, name)); // Pattern transformation through the `Patterns` API.


  const onPatternTransform = transformedBlocks => replaceBlocks(clientIds, transformedBlocks);

  const hasPossibleBlockTransformations = !!possibleBlockTransformations.length && canRemove;
  const hasPatternTransformation = !!(patterns !== null && patterns !== void 0 && patterns.length) && canRemove;

  if (!hasBlockStyles && !hasPossibleBlockTransformations) {
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarGroup, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarButton, {
      disabled: true,
      className: "block-editor-block-switcher__no-switcher-icon",
      title: blockTitle,
      icon: (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(block_icon, {
        icon: icon,
        showColors: true
      }), (isReusable || isTemplate) && (0,external_wp_element_namespaceObject.createElement)("span", {
        className: "block-editor-block-switcher__toggle-text"
      }, (0,external_wp_element_namespaceObject.createElement)(BlockTitle, {
        clientId: clientIds,
        maximumLength: 35
      })))
    }));
  }

  const blockSwitcherLabel = blockTitle;
  const blockSwitcherDescription = 1 === blocks.length ? (0,external_wp_i18n_namespaceObject.sprintf)(
  /* translators: %s: block title. */
  (0,external_wp_i18n_namespaceObject.__)('%s: Change block type or style'), blockTitle) : (0,external_wp_i18n_namespaceObject.sprintf)(
  /* translators: %d: number of blocks. */
  (0,external_wp_i18n_namespaceObject._n)('Change type of %d block', 'Change type of %d blocks', blocks.length), blocks.length);
  const showDropDown = hasBlockStyles || hasPossibleBlockTransformations || hasPatternTransformation;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarGroup, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarItem, null, toggleProps => (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.DropdownMenu, {
    className: "block-editor-block-switcher",
    label: blockSwitcherLabel,
    popoverProps: {
      position: 'bottom right',
      isAlternate: true,
      className: 'block-editor-block-switcher__popover'
    },
    icon: (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(block_icon, {
      icon: icon,
      className: "block-editor-block-switcher__toggle",
      showColors: true
    }), (isReusable || isTemplate) && (0,external_wp_element_namespaceObject.createElement)("span", {
      className: "block-editor-block-switcher__toggle-text"
    }, (0,external_wp_element_namespaceObject.createElement)(BlockTitle, {
      clientId: clientIds,
      maximumLength: 35
    }))),
    toggleProps: {
      describedBy: blockSwitcherDescription,
      ...toggleProps
    },
    menuProps: {
      orientation: 'both'
    }
  }, _ref3 => {
    let {
      onClose
    } = _ref3;
    return showDropDown && (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "block-editor-block-switcher__container"
    }, hasPatternTransformation && (0,external_wp_element_namespaceObject.createElement)(pattern_transformations_menu, {
      blocks: blocks,
      patterns: patterns,
      onSelect: transformedBlocks => {
        onPatternTransform(transformedBlocks);
        onClose();
      }
    }), hasPossibleBlockTransformations && (0,external_wp_element_namespaceObject.createElement)(block_transformations_menu, {
      className: "block-editor-block-switcher__transforms__menugroup",
      possibleBlockTransformations: possibleBlockTransformations,
      blocks: blocks,
      onSelect: name => {
        onBlockTransform(name);
        onClose();
      }
    }), hasBlockStyles && (0,external_wp_element_namespaceObject.createElement)(BlockStylesMenu, {
      hoveredBlock: blocks[0],
      onSwitch: onClose
    }));
  })));
};
const BlockSwitcher = _ref4 => {
  let {
    clientIds
  } = _ref4;
  const blocks = (0,external_wp_data_namespaceObject.useSelect)(select => select(store).getBlocksByClientId(clientIds), [clientIds]);

  if (!blocks.length || blocks.some(block => !block)) {
    return null;
  }

  return (0,external_wp_element_namespaceObject.createElement)(BlockSwitcherDropdownMenu, {
    clientIds: clientIds,
    blocks: blocks
  });
};
/* harmony default export */ var block_switcher = (BlockSwitcher);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-toolbar/block-toolbar-last-item.js
/**
 * WordPress dependencies
 */

const {
  Fill: __unstableBlockToolbarLastItem,
  Slot: block_toolbar_last_item_Slot
} = (0,external_wp_components_namespaceObject.createSlotFill)('__unstableBlockToolbarLastItem');
__unstableBlockToolbarLastItem.Slot = block_toolbar_last_item_Slot;
/* harmony default export */ var block_toolbar_last_item = (__unstableBlockToolbarLastItem);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/more-vertical.js


/**
 * WordPress dependencies
 */

const moreVertical = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M13 19h-2v-2h2v2zm0-6h-2v-2h2v2zm0-6h-2V5h2v2z"
}));
/* harmony default export */ var more_vertical = (moreVertical);

;// CONCATENATED MODULE: external ["wp","blob"]
var external_wp_blob_namespaceObject = window["wp"]["blob"];
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/utils/pasting.js
/**
 * WordPress dependencies
 */


function getPasteEventData(_ref) {
  let {
    clipboardData
  } = _ref;
  let plainText = '';
  let html = ''; // IE11 only supports `Text` as an argument for `getData` and will
  // otherwise throw an invalid argument error, so we try the standard
  // arguments first, then fallback to `Text` if they fail.

  try {
    plainText = clipboardData.getData('text/plain');
    html = clipboardData.getData('text/html');
  } catch (error1) {
    try {
      html = clipboardData.getData('Text');
    } catch (error2) {
      // Some browsers like UC Browser paste plain text by default and
      // don't support clipboardData at all, so allow default
      // behaviour.
      return;
    }
  }

  const files = (0,external_wp_dom_namespaceObject.getFilesFromDataTransfer)(clipboardData).filter(_ref2 => {
    let {
      type
    } = _ref2;
    return /^image\/(?:jpe?g|png|gif|webp)$/.test(type);
  });

  if (files.length && !shouldDismissPastedFiles(files, html, plainText)) {
    html = files.map(file => `<img src="${(0,external_wp_blob_namespaceObject.createBlobURL)(file)}">`).join('');
    plainText = '';
  }

  return {
    html,
    plainText
  };
}
/**
 * Given a collection of DataTransfer files and HTML and plain text strings,
 * determine whether the files are to be dismissed in favor of the HTML.
 *
 * Certain office-type programs, like Microsoft Word or Apple Numbers,
 * will, upon copy, generate a screenshot of the content being copied and
 * attach it to the clipboard alongside the actual rich text that the user
 * sought to copy. In those cases, we should let Gutenberg handle the rich text
 * content and not the screenshot, since this allows Gutenberg to insert
 * meaningful blocks, like paragraphs, lists or even tables.
 *
 * @param {File[]} files File objects obtained from a paste event
 * @param {string} html  HTML content obtained from a paste event
 * @return {boolean}     True if the files should be dismissed
 */

function shouldDismissPastedFiles(files, html
/*, plainText */
) {
  // The question is only relevant when there is actual HTML content and when
  // there is exactly one image file.
  if (html && (files === null || files === void 0 ? void 0 : files.length) === 1 && files[0].type.indexOf('image/') === 0) {
    var _html$match;

    // A single <img> tag found in the HTML source suggests that the
    // content being pasted revolves around an image. Sometimes there are
    // other elements found, like <figure>, but we assume that the user's
    // intention is to paste the actual image file.
    const IMAGE_TAG = /<\s*img\b/gi;
    return ((_html$match = html.match(IMAGE_TAG)) === null || _html$match === void 0 ? void 0 : _html$match.length) !== 1;
  }

  return false;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/copy-handler/index.js


/**
 * WordPress dependencies
 */







/**
 * Internal dependencies
 */



function useNotifyCopy() {
  const {
    getBlockName
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const {
    getBlockType
  } = (0,external_wp_data_namespaceObject.useSelect)(external_wp_blocks_namespaceObject.store);
  const {
    createSuccessNotice
  } = (0,external_wp_data_namespaceObject.useDispatch)(external_wp_notices_namespaceObject.store);
  return (0,external_wp_element_namespaceObject.useCallback)((eventType, selectedBlockClientIds) => {
    let notice = '';

    if (selectedBlockClientIds.length === 1) {
      var _getBlockType;

      const clientId = selectedBlockClientIds[0];
      const title = (_getBlockType = getBlockType(getBlockName(clientId))) === null || _getBlockType === void 0 ? void 0 : _getBlockType.title;
      notice = eventType === 'copy' ? (0,external_wp_i18n_namespaceObject.sprintf)( // Translators: Name of the block being copied, e.g. "Paragraph".
      (0,external_wp_i18n_namespaceObject.__)('Copied "%s" to clipboard.'), title) : (0,external_wp_i18n_namespaceObject.sprintf)( // Translators: Name of the block being cut, e.g. "Paragraph".
      (0,external_wp_i18n_namespaceObject.__)('Moved "%s" to clipboard.'), title);
    } else {
      notice = eventType === 'copy' ? (0,external_wp_i18n_namespaceObject.sprintf)( // Translators: %d: Number of blocks being copied.
      (0,external_wp_i18n_namespaceObject._n)('Copied %d block to clipboard.', 'Copied %d blocks to clipboard.', selectedBlockClientIds.length), selectedBlockClientIds.length) : (0,external_wp_i18n_namespaceObject.sprintf)( // Translators: %d: Number of blocks being cut.
      (0,external_wp_i18n_namespaceObject._n)('Moved %d block to clipboard.', 'Moved %d blocks to clipboard.', selectedBlockClientIds.length), selectedBlockClientIds.length);
    }

    createSuccessNotice(notice, {
      type: 'snackbar'
    });
  }, []);
}
function useClipboardHandler() {
  const {
    getBlocksByClientId,
    getSelectedBlockClientIds,
    hasMultiSelection,
    getSettings,
    __unstableIsFullySelected,
    __unstableIsSelectionCollapsed,
    __unstableIsSelectionMergeable,
    __unstableGetSelectedBlocksWithPartialSelection
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const {
    flashBlock,
    removeBlocks,
    replaceBlocks,
    __unstableDeleteSelection,
    __unstableExpandSelection
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const notifyCopy = useNotifyCopy();
  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    function handler(event) {
      const selectedBlockClientIds = getSelectedBlockClientIds();

      if (selectedBlockClientIds.length === 0) {
        return;
      } // Always handle multiple selected blocks.


      if (!hasMultiSelection()) {
        const {
          target
        } = event;
        const {
          ownerDocument
        } = target; // If copying, only consider actual text selection as selection.
        // Otherwise, any focus on an input field is considered.

        const hasSelection = event.type === 'copy' || event.type === 'cut' ? (0,external_wp_dom_namespaceObject.documentHasUncollapsedSelection)(ownerDocument) : (0,external_wp_dom_namespaceObject.documentHasSelection)(ownerDocument); // Let native copy behaviour take over in input fields.

        if (hasSelection) {
          return;
        }
      }

      if (!node.contains(event.target.ownerDocument.activeElement)) {
        return;
      }

      const eventDefaultPrevented = event.defaultPrevented;
      event.preventDefault();

      const isSelectionMergeable = __unstableIsSelectionMergeable();

      const shouldHandleWholeBlocks = __unstableIsSelectionCollapsed() || __unstableIsFullySelected();

      const expandSelectionIsNeeded = !shouldHandleWholeBlocks && !isSelectionMergeable;

      if (event.type === 'copy' || event.type === 'cut') {
        if (selectedBlockClientIds.length === 1) {
          flashBlock(selectedBlockClientIds[0]);
        } // If we have a partial selection that is not mergeable, just
        // expand the selection to the whole blocks.


        if (expandSelectionIsNeeded) {
          __unstableExpandSelection();
        } else {
          notifyCopy(event.type, selectedBlockClientIds);
          let blocks; // Check if we have partial selection.

          if (shouldHandleWholeBlocks) {
            blocks = getBlocksByClientId(selectedBlockClientIds);
          } else {
            const [head, tail] = __unstableGetSelectedBlocksWithPartialSelection();

            const inBetweenBlocks = getBlocksByClientId(selectedBlockClientIds.slice(1, selectedBlockClientIds.length - 1));
            blocks = [head, ...inBetweenBlocks, tail];
          }

          const serialized = (0,external_wp_blocks_namespaceObject.serialize)(blocks);
          event.clipboardData.setData('text/plain', serialized);
          event.clipboardData.setData('text/html', serialized);
        }
      }

      if (event.type === 'cut') {
        // We need to also check if at the start we needed to
        // expand the selection, as in this point we might have
        // programmatically fully selected the blocks above.
        if (shouldHandleWholeBlocks && !expandSelectionIsNeeded) {
          removeBlocks(selectedBlockClientIds);
        } else {
          __unstableDeleteSelection();
        }
      } else if (event.type === 'paste') {
        if (eventDefaultPrevented) {
          // This was likely already handled in rich-text/use-paste-handler.js.
          return;
        }

        const {
          __experimentalCanUserUseUnfilteredHTML: canUserUseUnfilteredHTML
        } = getSettings();
        const {
          plainText,
          html
        } = getPasteEventData(event);
        const blocks = (0,external_wp_blocks_namespaceObject.pasteHandler)({
          HTML: html,
          plainText,
          mode: 'BLOCKS',
          canUserUseUnfilteredHTML
        });
        replaceBlocks(selectedBlockClientIds, blocks, blocks.length - 1, -1);
      }
    }

    node.ownerDocument.addEventListener('copy', handler);
    node.ownerDocument.addEventListener('cut', handler);
    node.ownerDocument.addEventListener('paste', handler);
    return () => {
      node.ownerDocument.removeEventListener('copy', handler);
      node.ownerDocument.removeEventListener('cut', handler);
      node.ownerDocument.removeEventListener('paste', handler);
    };
  }, []);
}

function CopyHandler(_ref) {
  let {
    children
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    ref: useClipboardHandler()
  }, children);
}
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/copy-handler/README.md
 */


/* harmony default export */ var copy_handler = (CopyHandler);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-actions/index.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */



function BlockActions(_ref) {
  let {
    clientIds,
    children,
    __experimentalUpdateSelection: updateSelection
  } = _ref;
  const {
    canInsertBlockType,
    getBlockRootClientId,
    getBlocksByClientId,
    canMoveBlocks,
    canRemoveBlocks
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const {
    getDefaultBlockName,
    getGroupingBlockName
  } = (0,external_wp_data_namespaceObject.useSelect)(external_wp_blocks_namespaceObject.store);
  const blocks = getBlocksByClientId(clientIds);
  const rootClientId = getBlockRootClientId(clientIds[0]);
  const canDuplicate = (0,external_lodash_namespaceObject.every)(blocks, block => {
    return !!block && (0,external_wp_blocks_namespaceObject.hasBlockSupport)(block.name, 'multiple', true) && canInsertBlockType(block.name, rootClientId);
  });
  const canInsertDefaultBlock = canInsertBlockType(getDefaultBlockName(), rootClientId);
  const canMove = canMoveBlocks(clientIds, rootClientId);
  const canRemove = canRemoveBlocks(clientIds, rootClientId);
  const {
    removeBlocks,
    replaceBlocks,
    duplicateBlocks,
    insertAfterBlock,
    insertBeforeBlock,
    flashBlock,
    setBlockMovingClientId,
    setNavigationMode,
    selectBlock
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const notifyCopy = useNotifyCopy();
  return children({
    canDuplicate,
    canInsertDefaultBlock,
    canMove,
    canRemove,
    rootClientId,
    blocks,

    onDuplicate() {
      return duplicateBlocks(clientIds, updateSelection);
    },

    onRemove() {
      return removeBlocks(clientIds, updateSelection);
    },

    onInsertBefore() {
      insertBeforeBlock((0,external_lodash_namespaceObject.first)((0,external_lodash_namespaceObject.castArray)(clientIds)));
    },

    onInsertAfter() {
      insertAfterBlock((0,external_lodash_namespaceObject.last)((0,external_lodash_namespaceObject.castArray)(clientIds)));
    },

    onMoveTo() {
      setNavigationMode(true);
      selectBlock(clientIds[0]);
      setBlockMovingClientId(clientIds[0]);
    },

    onGroup() {
      if (!blocks.length) {
        return;
      }

      const groupingBlockName = getGroupingBlockName(); // Activate the `transform` on `core/group` which does the conversion.

      const newBlocks = (0,external_wp_blocks_namespaceObject.switchToBlockType)(blocks, groupingBlockName);

      if (!newBlocks) {
        return;
      }

      replaceBlocks(clientIds, newBlocks);
    },

    onUngroup() {
      if (!blocks.length) {
        return;
      }

      const innerBlocks = blocks[0].innerBlocks;

      if (!innerBlocks.length) {
        return;
      }

      replaceBlocks(clientIds, innerBlocks);
    },

    onCopy() {
      const selectedBlockClientIds = blocks.map(_ref2 => {
        let {
          clientId
        } = _ref2;
        return clientId;
      });

      if (blocks.length === 1) {
        flashBlock(selectedBlockClientIds[0]);
      }

      notifyCopy('copy', selectedBlockClientIds);
    }

  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-settings-menu/block-mode-toggle.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */


function BlockModeToggle(_ref) {
  let {
    blockType,
    mode,
    onToggleMode,
    small = false,
    isCodeEditingEnabled = true
  } = _ref;

  if (!(0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockType, 'html', true) || !isCodeEditingEnabled) {
    return null;
  }

  const label = mode === 'visual' ? (0,external_wp_i18n_namespaceObject.__)('Edit as HTML') : (0,external_wp_i18n_namespaceObject.__)('Edit visually');
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
    onClick: onToggleMode
  }, !small && label);
}
/* harmony default export */ var block_mode_toggle = ((0,external_wp_compose_namespaceObject.compose)([(0,external_wp_data_namespaceObject.withSelect)((select, _ref2) => {
  let {
    clientId
  } = _ref2;
  const {
    getBlock,
    getBlockMode,
    getSettings
  } = select(store);
  const block = getBlock(clientId);
  const isCodeEditingEnabled = getSettings().codeEditingEnabled;
  return {
    mode: getBlockMode(clientId),
    blockType: block ? (0,external_wp_blocks_namespaceObject.getBlockType)(block.name) : null,
    isCodeEditingEnabled
  };
}), (0,external_wp_data_namespaceObject.withDispatch)((dispatch, _ref3) => {
  let {
    onToggle = external_lodash_namespaceObject.noop,
    clientId
  } = _ref3;
  return {
    onToggleMode() {
      dispatch(store).toggleBlockMode(clientId);
      onToggle();
    }

  };
})])(BlockModeToggle));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-settings-menu/block-convert-button.js


/**
 * WordPress dependencies
 */


function BlockConvertButton(_ref) {
  let {
    shouldRender,
    onClick,
    small
  } = _ref;

  if (!shouldRender) {
    return null;
  }

  const label = (0,external_wp_i18n_namespaceObject.__)('Convert to Blocks');

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
    onClick: onClick
  }, !small && label);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-settings-menu/block-html-convert-button.js
/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */



/* harmony default export */ var block_html_convert_button = ((0,external_wp_compose_namespaceObject.compose)((0,external_wp_data_namespaceObject.withSelect)((select, _ref) => {
  let {
    clientId
  } = _ref;
  const block = select(store).getBlock(clientId);
  return {
    block,
    shouldRender: block && block.name === 'core/html'
  };
}), (0,external_wp_data_namespaceObject.withDispatch)((dispatch, _ref2) => {
  let {
    block
  } = _ref2;
  return {
    onClick: () => dispatch(store).replaceBlocks(block.clientId, (0,external_wp_blocks_namespaceObject.rawHandler)({
      HTML: (0,external_wp_blocks_namespaceObject.getBlockContent)(block)
    }))
  };
}))(BlockConvertButton));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-settings-menu/block-settings-menu-first-item.js
/**
 * WordPress dependencies
 */

const {
  Fill: __unstableBlockSettingsMenuFirstItem,
  Slot: block_settings_menu_first_item_Slot
} = (0,external_wp_components_namespaceObject.createSlotFill)('__unstableBlockSettingsMenuFirstItem');
__unstableBlockSettingsMenuFirstItem.Slot = block_settings_menu_first_item_Slot;
/* harmony default export */ var block_settings_menu_first_item = (__unstableBlockSettingsMenuFirstItem);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/convert-to-group-buttons/index.js


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */





function ConvertToGroupButton(_ref) {
  let {
    clientIds,
    isGroupable,
    isUngroupable,
    blocksSelection,
    groupingBlockName,
    onClose = () => {}
  } = _ref;
  const {
    replaceBlocks
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);

  const onConvertToGroup = () => {
    // Activate the `transform` on the Grouping Block which does the conversion.
    const newBlocks = (0,external_wp_blocks_namespaceObject.switchToBlockType)(blocksSelection, groupingBlockName);

    if (newBlocks) {
      replaceBlocks(clientIds, newBlocks);
    }
  };

  const onConvertFromGroup = () => {
    const innerBlocks = blocksSelection[0].innerBlocks;

    if (!innerBlocks.length) {
      return;
    }

    replaceBlocks(clientIds, innerBlocks);
  };

  if (!isGroupable && !isUngroupable) {
    return null;
  }

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, isGroupable && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
    onClick: () => {
      onConvertToGroup();
      onClose();
    }
  }, (0,external_wp_i18n_namespaceObject._x)('Group', 'verb')), isUngroupable && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
    onClick: () => {
      onConvertFromGroup();
      onClose();
    }
  }, (0,external_wp_i18n_namespaceObject._x)('Ungroup', 'Ungrouping blocks from within a Group block back into individual blocks within the Editor ')));
}



;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/convert-to-group-buttons/use-convert-to-group-button-props.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


/**
 * Contains the properties `ConvertToGroupButton` component needs.
 *
 * @typedef {Object} ConvertToGroupButtonProps
 * @property {string[]}  clientIds         An array of the selected client ids.
 * @property {boolean}   isGroupable       Indicates if the selected blocks can be grouped.
 * @property {boolean}   isUngroupable     Indicates if the selected blocks can be ungrouped.
 * @property {WPBlock[]} blocksSelection   An array of the selected blocks.
 * @property {string}    groupingBlockName The name of block used for handling grouping interactions.
 */

/**
 * Returns the properties `ConvertToGroupButton` component needs to work properly.
 * It is used in `BlockSettingsMenuControls` to know if `ConvertToGroupButton`
 * should be rendered, to avoid ending up with an empty MenuGroup.
 *
 * @return {ConvertToGroupButtonProps} Returns the properties needed by `ConvertToGroupButton`.
 */

function useConvertToGroupButtonProps() {
  const {
    clientIds,
    isGroupable,
    isUngroupable,
    blocksSelection,
    groupingBlockName
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    var _blocksSelection$;

    const {
      getBlockRootClientId,
      getBlocksByClientId,
      canInsertBlockType,
      getSelectedBlockClientIds
    } = select(store);
    const {
      getGroupingBlockName
    } = select(external_wp_blocks_namespaceObject.store);

    const _clientIds = getSelectedBlockClientIds();

    const _groupingBlockName = getGroupingBlockName();

    const rootClientId = !!(_clientIds !== null && _clientIds !== void 0 && _clientIds.length) ? getBlockRootClientId(_clientIds[0]) : undefined;
    const groupingBlockAvailable = canInsertBlockType(_groupingBlockName, rootClientId);

    const _blocksSelection = getBlocksByClientId(_clientIds);

    const isSingleGroupingBlock = _blocksSelection.length === 1 && ((_blocksSelection$ = _blocksSelection[0]) === null || _blocksSelection$ === void 0 ? void 0 : _blocksSelection$.name) === _groupingBlockName; // Do we have
    // 1. Grouping block available to be inserted?
    // 2. One or more blocks selected

    const _isGroupable = groupingBlockAvailable && _blocksSelection.length; // Do we have a single Group Block selected and does that group have inner blocks?


    const _isUngroupable = isSingleGroupingBlock && !!_blocksSelection[0].innerBlocks.length;

    return {
      clientIds: _clientIds,
      isGroupable: _isGroupable,
      isUngroupable: _isUngroupable,
      blocksSelection: _blocksSelection,
      groupingBlockName: _groupingBlockName
    };
  }, []);
  return {
    clientIds,
    isGroupable,
    isUngroupable,
    blocksSelection,
    groupingBlockName
  };
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/unlock.js


/**
 * WordPress dependencies
 */

const unlock = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  viewBox: "0 0 24 24",
  xmlns: "http://www.w3.org/2000/svg"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M17 10h-1.2V7c0-2.1-1.7-3.8-3.8-3.8-2.1 0-3.8 1.7-3.8 3.8h1.5c0-1.2 1-2.2 2.2-2.2s2.2 1 2.2 2.2v3H7c-.6 0-1 .4-1 1v8c0 .6.4 1 1 1h10c.6 0 1-.4 1-1v-8c0-.6-.4-1-1-1z"
}));
/* harmony default export */ var library_unlock = (unlock);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/lock.js


/**
 * WordPress dependencies
 */

const lock = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  viewBox: "0 0 24 24",
  xmlns: "http://www.w3.org/2000/svg"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M17 10h-1.2V7c0-2.1-1.7-3.8-3.8-3.8-2.1 0-3.8 1.7-3.8 3.8v3H7c-.6 0-1 .4-1 1v8c0 .6.4 1 1 1h10c.6 0 1-.4 1-1v-8c0-.6-.4-1-1-1zm-2.8 0H9.8V7c0-1.2 1-2.2 2.2-2.2s2.2 1 2.2 2.2v3z"
}));
/* harmony default export */ var library_lock = (lock);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-lock/use-block-lock.js
/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */


/**
 * Return details about the block lock status.
 *
 * @param {string} clientId The block client Id.
 *
 * @return {Object} Block lock status
 */

function useBlockLock(clientId) {
  return (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      canMoveBlock,
      canRemoveBlock,
      canLockBlockType,
      getBlockName,
      getBlockRootClientId
    } = select(store);
    const rootClientId = getBlockRootClientId(clientId);
    const canMove = canMoveBlock(clientId, rootClientId);
    const canRemove = canRemoveBlock(clientId, rootClientId);
    return {
      canMove,
      canRemove,
      canLock: canLockBlockType(getBlockName(clientId)),
      isLocked: !canMove || !canRemove
    };
  }, [clientId]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-lock/modal.js


/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */




function BlockLockModal(_ref) {
  let {
    clientId,
    onClose
  } = _ref;
  const [lock, setLock] = (0,external_wp_element_namespaceObject.useState)({
    move: false,
    remove: false
  });
  const {
    canMove,
    canRemove
  } = useBlockLock(clientId);
  const {
    updateBlockAttributes
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const blockInformation = useBlockDisplayInformation(clientId);
  const instanceId = (0,external_wp_compose_namespaceObject.useInstanceId)(BlockLockModal, 'block-editor-block-lock-modal__options-title');
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    setLock({
      move: !canMove,
      remove: !canRemove
    });
  }, [canMove, canRemove]);
  const isAllChecked = Object.values(lock).every(Boolean);
  const isMixed = Object.values(lock).some(Boolean) && !isAllChecked;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Modal, {
    title: (0,external_wp_i18n_namespaceObject.sprintf)(
    /* translators: %s: Name of the block. */
    (0,external_wp_i18n_namespaceObject.__)('Lock %s'), blockInformation.title),
    overlayClassName: "block-editor-block-lock-modal",
    closeLabel: (0,external_wp_i18n_namespaceObject.__)('Close'),
    onRequestClose: onClose
  }, (0,external_wp_element_namespaceObject.createElement)("form", {
    onSubmit: event => {
      event.preventDefault();
      updateBlockAttributes([clientId], {
        lock
      });
      onClose();
    }
  }, (0,external_wp_element_namespaceObject.createElement)("p", null, (0,external_wp_i18n_namespaceObject.__)('Choose specific attributes to restrict or lock all available options.')), (0,external_wp_element_namespaceObject.createElement)("div", {
    role: "group",
    "aria-labelledby": instanceId,
    className: "block-editor-block-lock-modal__options"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.CheckboxControl, {
    className: "block-editor-block-lock-modal__options-title",
    label: (0,external_wp_element_namespaceObject.createElement)("span", {
      id: instanceId
    }, (0,external_wp_i18n_namespaceObject.__)('Lock all')),
    checked: isAllChecked,
    indeterminate: isMixed,
    onChange: newValue => setLock({
      move: newValue,
      remove: newValue
    })
  }), (0,external_wp_element_namespaceObject.createElement)("ul", {
    className: "block-editor-block-lock-modal__checklist"
  }, (0,external_wp_element_namespaceObject.createElement)("li", {
    className: "block-editor-block-lock-modal__checklist-item"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.CheckboxControl, {
    label: (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_i18n_namespaceObject.__)('Disable movement'), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Icon, {
      icon: lock.move ? library_lock : library_unlock
    })),
    checked: lock.move,
    onChange: move => setLock(prevLock => ({ ...prevLock,
      move
    }))
  })), (0,external_wp_element_namespaceObject.createElement)("li", {
    className: "block-editor-block-lock-modal__checklist-item"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.CheckboxControl, {
    label: (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_i18n_namespaceObject.__)('Prevent removal'), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Icon, {
      icon: lock.remove ? library_lock : library_unlock
    })),
    checked: lock.remove,
    onChange: remove => setLock(prevLock => ({ ...prevLock,
      remove
    }))
  })))), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Flex, {
    className: "block-editor-block-lock-modal__actions",
    justify: "flex-end",
    expanded: false
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.FlexItem, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    variant: "tertiary",
    onClick: onClose
  }, (0,external_wp_i18n_namespaceObject.__)('Cancel'))), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.FlexItem, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    variant: "primary",
    type: "submit"
  }, (0,external_wp_i18n_namespaceObject.__)('Apply'))))));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-lock/menu-item.js


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */



function BlockLockMenuItem(_ref) {
  let {
    clientId
  } = _ref;
  const {
    canLock,
    isLocked
  } = useBlockLock(clientId);
  const [isModalOpen, toggleModal] = (0,external_wp_element_namespaceObject.useReducer)(isActive => !isActive, false);

  if (!canLock) {
    return null;
  }

  const label = isLocked ? (0,external_wp_i18n_namespaceObject.__)('Unlock') : (0,external_wp_i18n_namespaceObject.__)('Lock');
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
    icon: isLocked ? library_unlock : library_lock,
    onClick: toggleModal
  }, label), isModalOpen && (0,external_wp_element_namespaceObject.createElement)(BlockLockModal, {
    clientId: clientId,
    onClose: toggleModal
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-settings-menu-controls/index.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */




const {
  Fill,
  Slot: block_settings_menu_controls_Slot
} = (0,external_wp_components_namespaceObject.createSlotFill)('BlockSettingsMenuControls');

const BlockSettingsMenuControlsSlot = _ref => {
  let {
    fillProps,
    clientIds = null
  } = _ref;
  const {
    selectedBlocks,
    selectedClientIds,
    canRemove
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getBlocksByClientId,
      getSelectedBlockClientIds,
      canRemoveBlocks
    } = select(store);
    const ids = clientIds !== null ? clientIds : getSelectedBlockClientIds();
    return {
      selectedBlocks: (0,external_lodash_namespaceObject.map)((0,external_lodash_namespaceObject.compact)(getBlocksByClientId(ids)), block => block.name),
      selectedClientIds: ids,
      canRemove: canRemoveBlocks(ids)
    };
  }, [clientIds]);
  const showLockButton = selectedClientIds.length === 1; // Check if current selection of blocks is Groupable or Ungroupable
  // and pass this props down to ConvertToGroupButton.

  const convertToGroupButtonProps = useConvertToGroupButtonProps();
  const {
    isGroupable,
    isUngroupable
  } = convertToGroupButtonProps;
  const showConvertToGroupButton = (isGroupable || isUngroupable) && canRemove;
  return (0,external_wp_element_namespaceObject.createElement)(block_settings_menu_controls_Slot, {
    fillProps: { ...fillProps,
      selectedBlocks,
      selectedClientIds
    }
  }, fills => {
    if (!(fills !== null && fills !== void 0 && fills.length) > 0 && !showConvertToGroupButton && !showLockButton) {
      return null;
    }

    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuGroup, null, showLockButton && (0,external_wp_element_namespaceObject.createElement)(BlockLockMenuItem, {
      clientId: selectedClientIds[0]
    }), fills, showConvertToGroupButton && (0,external_wp_element_namespaceObject.createElement)(ConvertToGroupButton, _extends({}, convertToGroupButtonProps, {
      onClose: fillProps === null || fillProps === void 0 ? void 0 : fillProps.onClose
    })));
  });
};
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/block-settings-menu-controls/README.md
 *
 * @param {Object} props Fill props.
 * @return {WPElement} Element.
 */


function BlockSettingsMenuControls(_ref2) {
  let { ...props
  } = _ref2;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalStyleProvider, {
    document: document
  }, (0,external_wp_element_namespaceObject.createElement)(Fill, props));
}

BlockSettingsMenuControls.Slot = BlockSettingsMenuControlsSlot;
/* harmony default export */ var block_settings_menu_controls = (BlockSettingsMenuControls);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-settings-menu/block-settings-dropdown.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */









/**
 * Internal dependencies
 */










const block_settings_dropdown_POPOVER_PROPS = {
  className: 'block-editor-block-settings-menu__popover',
  position: 'bottom right',
  isAlternate: true
};

function CopyMenuItem(_ref) {
  let {
    blocks,
    onCopy
  } = _ref;
  const ref = (0,external_wp_compose_namespaceObject.useCopyToClipboard)(() => (0,external_wp_blocks_namespaceObject.serialize)(blocks), onCopy);
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
    ref: ref
  }, (0,external_wp_i18n_namespaceObject.__)('Copy'));
}

function BlockSettingsDropdown(_ref2) {
  let {
    clientIds,
    __experimentalSelectBlock,
    children,
    ...props
  } = _ref2;
  const blockClientIds = (0,external_lodash_namespaceObject.castArray)(clientIds);
  const count = blockClientIds.length;
  const firstBlockClientId = blockClientIds[0];
  const {
    firstParentClientId,
    hasReducedUI,
    onlyBlock,
    parentBlockType,
    previousBlockClientId,
    nextBlockClientId,
    selectedBlockClientIds
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getBlockCount,
      getBlockName,
      getBlockParents,
      getPreviousBlockClientId,
      getNextBlockClientId,
      getSelectedBlockClientIds,
      getSettings
    } = select(store);
    const parents = getBlockParents(firstBlockClientId);
    const _firstParentClientId = parents[parents.length - 1];
    const parentBlockName = getBlockName(_firstParentClientId);
    return {
      firstParentClientId: _firstParentClientId,
      hasReducedUI: getSettings().hasReducedUI,
      onlyBlock: 1 === getBlockCount(),
      parentBlockType: (0,external_wp_blocks_namespaceObject.getBlockType)(parentBlockName),
      previousBlockClientId: getPreviousBlockClientId(firstBlockClientId),
      nextBlockClientId: getNextBlockClientId(firstBlockClientId),
      selectedBlockClientIds: getSelectedBlockClientIds()
    };
  }, [firstBlockClientId]);
  const shortcuts = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getShortcutRepresentation
    } = select(external_wp_keyboardShortcuts_namespaceObject.store);
    return {
      duplicate: getShortcutRepresentation('core/block-editor/duplicate'),
      remove: getShortcutRepresentation('core/block-editor/remove'),
      insertAfter: getShortcutRepresentation('core/block-editor/insert-after'),
      insertBefore: getShortcutRepresentation('core/block-editor/insert-before')
    };
  }, []);
  const {
    selectBlock,
    toggleBlockHighlight
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const updateSelectionAfterDuplicate = (0,external_wp_element_namespaceObject.useCallback)(__experimentalSelectBlock ? async clientIdsPromise => {
    const ids = await clientIdsPromise;

    if (ids && ids[0]) {
      __experimentalSelectBlock(ids[0]);
    }
  } : external_lodash_namespaceObject.noop, [__experimentalSelectBlock]);
  const blockTitle = useBlockDisplayTitle(firstBlockClientId, 25);
  const updateSelectionAfterRemove = (0,external_wp_element_namespaceObject.useCallback)(__experimentalSelectBlock ? () => {
    const blockToSelect = previousBlockClientId || nextBlockClientId;

    if (blockToSelect && // From the block options dropdown, it's possible to remove a block that is not selected,
    // in this case, it's not necessary to update the selection since the selected block wasn't removed.
    selectedBlockClientIds.includes(firstBlockClientId) && // Don't update selection when next/prev block also is in the selection ( and gets removed ),
    // In case someone selects all blocks and removes them at once.
    !selectedBlockClientIds.includes(blockToSelect)) {
      __experimentalSelectBlock(blockToSelect);
    }
  } : external_lodash_namespaceObject.noop, [__experimentalSelectBlock, previousBlockClientId, nextBlockClientId, selectedBlockClientIds]);
  const label = (0,external_wp_i18n_namespaceObject.sprintf)(
  /* translators: %s: block name */
  (0,external_wp_i18n_namespaceObject.__)('Remove %s'), blockTitle);
  const removeBlockLabel = count === 1 ? label : (0,external_wp_i18n_namespaceObject.__)('Remove blocks'); // Allows highlighting the parent block outline when focusing or hovering
  // the parent block selector within the child.

  const selectParentButtonRef = (0,external_wp_element_namespaceObject.useRef)();
  const {
    gestures: showParentOutlineGestures
  } = useShowMoversGestures({
    ref: selectParentButtonRef,

    onChange(isFocused) {
      if (isFocused && hasReducedUI) {
        return;
      }

      toggleBlockHighlight(firstParentClientId, isFocused);
    }

  });
  return (0,external_wp_element_namespaceObject.createElement)(BlockActions, {
    clientIds: clientIds,
    __experimentalUpdateSelection: !__experimentalSelectBlock
  }, _ref3 => {
    let {
      canDuplicate,
      canInsertDefaultBlock,
      canMove,
      canRemove,
      onDuplicate,
      onInsertAfter,
      onInsertBefore,
      onRemove,
      onCopy,
      onMoveTo,
      blocks
    } = _ref3;
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.DropdownMenu, _extends({
      icon: more_vertical,
      label: (0,external_wp_i18n_namespaceObject.__)('Options'),
      className: "block-editor-block-settings-menu",
      popoverProps: block_settings_dropdown_POPOVER_PROPS,
      noIcons: true
    }, props), _ref4 => {
      let {
        onClose
      } = _ref4;
      return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuGroup, null, (0,external_wp_element_namespaceObject.createElement)(block_settings_menu_first_item.Slot, {
        fillProps: {
          onClose
        }
      }), firstParentClientId !== undefined && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, _extends({}, showParentOutlineGestures, {
        ref: selectParentButtonRef,
        icon: (0,external_wp_element_namespaceObject.createElement)(block_icon, {
          icon: parentBlockType.icon
        }),
        onClick: () => selectBlock(firstParentClientId)
      }), (0,external_wp_i18n_namespaceObject.sprintf)(
      /* translators: %s: Name of the block's parent. */
      (0,external_wp_i18n_namespaceObject.__)('Select parent block (%s)'), parentBlockType.title)), count === 1 && (0,external_wp_element_namespaceObject.createElement)(block_html_convert_button, {
        clientId: firstBlockClientId
      }), (0,external_wp_element_namespaceObject.createElement)(CopyMenuItem, {
        blocks: blocks,
        onCopy: onCopy
      }), canDuplicate && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
        onClick: (0,external_lodash_namespaceObject.flow)(onClose, onDuplicate, updateSelectionAfterDuplicate),
        shortcut: shortcuts.duplicate
      }, (0,external_wp_i18n_namespaceObject.__)('Duplicate')), canInsertDefaultBlock && (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
        onClick: (0,external_lodash_namespaceObject.flow)(onClose, onInsertBefore),
        shortcut: shortcuts.insertBefore
      }, (0,external_wp_i18n_namespaceObject.__)('Insert before')), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
        onClick: (0,external_lodash_namespaceObject.flow)(onClose, onInsertAfter),
        shortcut: shortcuts.insertAfter
      }, (0,external_wp_i18n_namespaceObject.__)('Insert after'))), canMove && !onlyBlock && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
        onClick: (0,external_lodash_namespaceObject.flow)(onClose, onMoveTo)
      }, (0,external_wp_i18n_namespaceObject.__)('Move to')), count === 1 && (0,external_wp_element_namespaceObject.createElement)(block_mode_toggle, {
        clientId: firstBlockClientId,
        onToggle: onClose
      })), (0,external_wp_element_namespaceObject.createElement)(block_settings_menu_controls.Slot, {
        fillProps: {
          onClose
        },
        clientIds: clientIds
      }), typeof children === 'function' ? children({
        onClose
      }) : external_wp_element_namespaceObject.Children.map(child => (0,external_wp_element_namespaceObject.cloneElement)(child, {
        onClose
      })), canRemove && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuGroup, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
        onClick: (0,external_lodash_namespaceObject.flow)(onClose, onRemove, updateSelectionAfterRemove),
        shortcut: shortcuts.remove
      }, removeBlockLabel)));
    });
  });
}
/* harmony default export */ var block_settings_dropdown = (BlockSettingsDropdown);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-settings-menu/index.js



/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */


function BlockSettingsMenu(_ref) {
  let {
    clientIds,
    ...props
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarGroup, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarItem, null, toggleProps => (0,external_wp_element_namespaceObject.createElement)(block_settings_dropdown, _extends({
    clientIds: clientIds,
    toggleProps: toggleProps
  }, props))));
}
/* harmony default export */ var block_settings_menu = (BlockSettingsMenu);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-lock/toolbar.js


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */




function BlockLockToolbar(_ref) {
  let {
    clientId
  } = _ref;
  const blockInformation = useBlockDisplayInformation(clientId);
  const {
    canMove,
    canRemove,
    canLock
  } = useBlockLock(clientId);
  const [isModalOpen, toggleModal] = (0,external_wp_element_namespaceObject.useReducer)(isActive => !isActive, false);

  if (!canLock) {
    return null;
  }

  if (canMove && canRemove) {
    return null;
  }

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarGroup, {
    className: "block-editor-block-lock-toolbar"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarButton, {
    icon: library_lock,
    label: (0,external_wp_i18n_namespaceObject.sprintf)(
    /* translators: %s: block name */
    (0,external_wp_i18n_namespaceObject.__)('Unlock %s'), blockInformation.title),
    onClick: toggleModal
  })), isModalOpen && (0,external_wp_element_namespaceObject.createElement)(BlockLockModal, {
    clientId: clientId,
    onClose: toggleModal
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/group.js


/**
 * WordPress dependencies
 */

const group_group = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  viewBox: "0 0 24 24",
  xmlns: "http://www.w3.org/2000/svg"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M18 4h-7c-1.1 0-2 .9-2 2v3H6c-1.1 0-2 .9-2 2v7c0 1.1.9 2 2 2h7c1.1 0 2-.9 2-2v-3h3c1.1 0 2-.9 2-2V6c0-1.1-.9-2-2-2zm-4.5 14c0 .3-.2.5-.5.5H6c-.3 0-.5-.2-.5-.5v-7c0-.3.2-.5.5-.5h3V13c0 1.1.9 2 2 2h2.5v3zm0-4.5H11c-.3 0-.5-.2-.5-.5v-2.5H13c.3 0 .5.2.5.5v2.5zm5-.5c0 .3-.2.5-.5.5h-3V11c0-1.1-.9-2-2-2h-2.5V6c0-.3.2-.5.5-.5h7c.3 0 .5.2.5.5v7z"
}));
/* harmony default export */ var library_group = (group_group);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/row.js


/**
 * WordPress dependencies
 */

const row = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M9.2 6.5H4V8h5.2c.3 0 .5.2.5.5v7c0 .3-.2.5-.5.5H4v1.5h5.2c1.1 0 2-.9 2-2v-7c0-1.1-.8-2-2-2zM14.8 8H20V6.5h-5.2c-1.1 0-2 .9-2 2v7c0 1.1.9 2 2 2H20V16h-5.2c-.3 0-.5-.2-.5-.5v-7c-.1-.3.2-.5.5-.5z"
}));
/* harmony default export */ var library_row = (row);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/stack.js


/**
 * WordPress dependencies
 */

const stack = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M16 4v5.2c0 .3-.2.5-.5.5h-7c-.3.1-.5-.2-.5-.5V4H6.5v5.2c0 1.1.9 2 2 2h7c1.1 0 2-.9 2-2V4H16zm-.5 8.8h-7c-1.1 0-2 .9-2 2V20H8v-5.2c0-.3.2-.5.5-.5h7c.3 0 .5.2.5.5V20h1.5v-5.2c0-1.2-.9-2-2-2z"
}));
/* harmony default export */ var library_stack = (stack);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/convert-to-group-buttons/toolbar.js


/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */



const layouts = {
  group: undefined,
  row: {
    type: 'flex',
    flexWrap: 'nowrap'
  },
  stack: {
    type: 'flex',
    orientation: 'vertical'
  }
};

function BlockGroupToolbar() {
  const {
    blocksSelection,
    clientIds,
    groupingBlockName,
    isGroupable
  } = useConvertToGroupButtonProps();
  const {
    replaceBlocks
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const {
    canRemove
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      canRemoveBlocks
    } = select(store);
    return {
      canRemove: canRemoveBlocks(clientIds)
    };
  }, [clientIds]);

  const onConvertToGroup = function () {
    let layout = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 'group';
    const newBlocks = (0,external_wp_blocks_namespaceObject.switchToBlockType)(blocksSelection, groupingBlockName);

    if (newBlocks && newBlocks.length > 0) {
      // Because the block is not in the store yet we can't use
      // updateBlockAttributes so need to manually update attributes.
      newBlocks[0].attributes.layout = layouts[layout];
      replaceBlocks(clientIds, newBlocks);
    }
  };

  const onConvertToRow = () => onConvertToGroup('row');

  const onConvertToStack = () => onConvertToGroup('stack'); // Don't render the button if the current selection cannot be grouped.
  // A good example is selecting multiple button blocks within a Buttons block:
  // The group block is not a valid child of Buttons, so we should not show the button.
  // Any blocks that are locked against removal also cannot be grouped.


  if (!isGroupable || !canRemove) {
    return null;
  }

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarGroup, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarButton, {
    icon: library_group,
    label: (0,external_wp_i18n_namespaceObject._x)('Group', 'verb'),
    onClick: onConvertToGroup
  }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarButton, {
    icon: library_row,
    label: (0,external_wp_i18n_namespaceObject._x)('Row', 'single horizontal line'),
    onClick: onConvertToRow
  }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarButton, {
    icon: library_stack,
    label: (0,external_wp_i18n_namespaceObject._x)('Stack', 'verb'),
    onClick: onConvertToStack
  }));
}

/* harmony default export */ var toolbar = (BlockGroupToolbar);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-toolbar/block-name-context.js
/**
 * WordPress dependencies
 */


const __unstableBlockNameContext = (0,external_wp_element_namespaceObject.createContext)('');

/* harmony default export */ var block_name_context = (__unstableBlockNameContext);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-toolbar/index.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */













const BlockToolbar = _ref => {
  let {
    hideDragHandle
  } = _ref;
  const {
    blockClientIds,
    blockClientId,
    blockType,
    hasFixedToolbar,
    hasReducedUI,
    isValid,
    isVisual
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getBlockName,
      getBlockMode,
      getSelectedBlockClientIds,
      isBlockValid,
      getBlockRootClientId,
      getSettings
    } = select(store);
    const selectedBlockClientIds = getSelectedBlockClientIds();
    const selectedBlockClientId = selectedBlockClientIds[0];
    const blockRootClientId = getBlockRootClientId(selectedBlockClientId);
    const settings = getSettings();
    return {
      blockClientIds: selectedBlockClientIds,
      blockClientId: selectedBlockClientId,
      blockType: selectedBlockClientId && (0,external_wp_blocks_namespaceObject.getBlockType)(getBlockName(selectedBlockClientId)),
      hasFixedToolbar: settings.hasFixedToolbar,
      hasReducedUI: settings.hasReducedUI,
      rootClientId: blockRootClientId,
      isValid: selectedBlockClientIds.every(id => isBlockValid(id)),
      isVisual: selectedBlockClientIds.every(id => getBlockMode(id) === 'visual')
    };
  }, []); // Handles highlighting the current block outline on hover or focus of the
  // block type toolbar area.

  const {
    toggleBlockHighlight
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const nodeRef = (0,external_wp_element_namespaceObject.useRef)();
  const {
    showMovers,
    gestures: showMoversGestures
  } = useShowMoversGestures({
    ref: nodeRef,

    onChange(isFocused) {
      if (isFocused && hasReducedUI) {
        return;
      }

      toggleBlockHighlight(blockClientId, isFocused);
    }

  }); // Account for the cases where the block toolbar is rendered within the
  // header area and not contextually to the block.

  const displayHeaderToolbar = (0,external_wp_compose_namespaceObject.useViewportMatch)('medium', '<') || hasFixedToolbar;

  if (blockType) {
    if (!(0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockType, '__experimentalToolbar', true)) {
      return null;
    }
  }

  const shouldShowMovers = displayHeaderToolbar || showMovers;

  if (blockClientIds.length === 0) {
    return null;
  }

  const shouldShowVisualToolbar = isValid && isVisual;
  const isMultiToolbar = blockClientIds.length > 1;
  const classes = classnames_default()('block-editor-block-toolbar', shouldShowMovers && 'is-showing-movers');
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: classes
  }, !isMultiToolbar && !displayHeaderToolbar && (0,external_wp_element_namespaceObject.createElement)(BlockParentSelector, {
    clientIds: blockClientIds
  }), (0,external_wp_element_namespaceObject.createElement)("div", _extends({
    ref: nodeRef
  }, showMoversGestures), (shouldShowVisualToolbar || isMultiToolbar) && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarGroup, {
    className: "block-editor-block-toolbar__block-controls"
  }, (0,external_wp_element_namespaceObject.createElement)(block_switcher, {
    clientIds: blockClientIds
  }), !isMultiToolbar && (0,external_wp_element_namespaceObject.createElement)(BlockLockToolbar, {
    clientId: blockClientIds[0]
  }), (0,external_wp_element_namespaceObject.createElement)(block_mover, {
    clientIds: blockClientIds,
    hideDragHandle: hideDragHandle || hasReducedUI
  }))), shouldShowVisualToolbar && isMultiToolbar && (0,external_wp_element_namespaceObject.createElement)(toolbar, null), shouldShowVisualToolbar && (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(block_controls.Slot, {
    group: "parent",
    className: "block-editor-block-toolbar__slot"
  }), (0,external_wp_element_namespaceObject.createElement)(block_controls.Slot, {
    group: "block",
    className: "block-editor-block-toolbar__slot"
  }), (0,external_wp_element_namespaceObject.createElement)(block_controls.Slot, {
    className: "block-editor-block-toolbar__slot"
  }), (0,external_wp_element_namespaceObject.createElement)(block_controls.Slot, {
    group: "inline",
    className: "block-editor-block-toolbar__slot"
  }), (0,external_wp_element_namespaceObject.createElement)(block_controls.Slot, {
    group: "other",
    className: "block-editor-block-toolbar__slot"
  }), (0,external_wp_element_namespaceObject.createElement)(block_name_context.Provider, {
    value: blockType === null || blockType === void 0 ? void 0 : blockType.name
  }, (0,external_wp_element_namespaceObject.createElement)(block_toolbar_last_item.Slot, null))), (0,external_wp_element_namespaceObject.createElement)(block_settings_menu, {
    clientIds: blockClientIds
  }));
};
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/block-toolbar/README.md
 */


/* harmony default export */ var block_toolbar = (BlockToolbar);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-tools/block-contextual-toolbar.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */





function BlockContextualToolbar(_ref) {
  let {
    focusOnMount,
    isFixed,
    ...props
  } = _ref;
  const {
    blockType,
    hasParents,
    showParentSelector
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getBlockName,
      getBlockParents,
      getSelectedBlockClientIds
    } = select(store);
    const {
      getBlockType
    } = select(external_wp_blocks_namespaceObject.store);
    const selectedBlockClientIds = getSelectedBlockClientIds();
    const selectedBlockClientId = selectedBlockClientIds[0];
    const parents = getBlockParents(selectedBlockClientId);
    const firstParentClientId = parents[parents.length - 1];
    const parentBlockName = getBlockName(firstParentClientId);
    const parentBlockType = getBlockType(parentBlockName);
    return {
      blockType: selectedBlockClientId && getBlockType(getBlockName(selectedBlockClientId)),
      hasParents: parents.length,
      showParentSelector: (0,external_wp_blocks_namespaceObject.hasBlockSupport)(parentBlockType, '__experimentalParentSelector', true) && selectedBlockClientIds.length <= 1
    };
  }, []);

  if (blockType) {
    if (!(0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockType, '__experimentalToolbar', true)) {
      return null;
    }
  } // Shifts the toolbar to make room for the parent block selector.


  const classes = classnames_default()('block-editor-block-contextual-toolbar', {
    'has-parent': hasParents && showParentSelector,
    'is-fixed': isFixed
  });
  return (0,external_wp_element_namespaceObject.createElement)(navigable_toolbar, _extends({
    focusOnMount: focusOnMount,
    className: classes
    /* translators: accessibility text for the block toolbar */
    ,
    "aria-label": (0,external_wp_i18n_namespaceObject.__)('Block tools')
  }, props), (0,external_wp_element_namespaceObject.createElement)(block_toolbar, {
    hideDragHandle: isFixed
  }));
}

/* harmony default export */ var block_contextual_toolbar = (BlockContextualToolbar);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-tools/block-popover.js


/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */








/**
 * Internal dependencies
 */








function block_popover_selector(select) {
  const {
    isNavigationMode,
    isMultiSelecting,
    hasMultiSelection,
    isTyping,
    isCaretWithinFormattedText,
    getSettings,
    getLastMultiSelectedBlockClientId
  } = select(store);
  return {
    isNavigationMode: isNavigationMode(),
    isMultiSelecting: isMultiSelecting(),
    isTyping: isTyping(),
    isCaretWithinFormattedText: isCaretWithinFormattedText(),
    hasMultiSelection: hasMultiSelection(),
    hasFixedToolbar: getSettings().hasFixedToolbar,
    lastClientId: getLastMultiSelectedBlockClientId()
  };
}

function BlockPopover(_ref) {
  let {
    clientId,
    rootClientId,
    isValid,
    isEmptyDefaultBlock,
    capturingClientId,
    __unstablePopoverSlot,
    __unstableContentRef
  } = _ref;
  const {
    isNavigationMode,
    isMultiSelecting,
    isTyping,
    isCaretWithinFormattedText,
    hasMultiSelection,
    hasFixedToolbar,
    lastClientId
  } = (0,external_wp_data_namespaceObject.useSelect)(block_popover_selector, []);
  const isInsertionPointVisible = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      isBlockInsertionPointVisible,
      getBlockInsertionPoint,
      getBlockOrder
    } = select(store);

    if (!isBlockInsertionPointVisible()) {
      return false;
    }

    const insertionPoint = getBlockInsertionPoint();
    const order = getBlockOrder(insertionPoint.rootClientId);
    return order[insertionPoint.index] === clientId;
  }, [clientId]);
  const isLargeViewport = (0,external_wp_compose_namespaceObject.useViewportMatch)('medium');
  const [isToolbarForced, setIsToolbarForced] = (0,external_wp_element_namespaceObject.useState)(false);
  const [isInserterShown, setIsInserterShown] = (0,external_wp_element_namespaceObject.useState)(false);
  const {
    stopTyping
  } = (0,external_wp_data_namespaceObject.useDispatch)(store); // Controls when the side inserter on empty lines should
  // be shown, including writing and selection modes.

  const showEmptyBlockSideInserter = !isTyping && !isNavigationMode && isEmptyDefaultBlock && isValid;
  const shouldShowBreadcrumb = isNavigationMode;
  const shouldShowContextualToolbar = !isNavigationMode && !hasFixedToolbar && isLargeViewport && !showEmptyBlockSideInserter && !isMultiSelecting && (!isTyping || isCaretWithinFormattedText);
  const canFocusHiddenToolbar = !isNavigationMode && !shouldShowContextualToolbar && !hasFixedToolbar && !isEmptyDefaultBlock;
  (0,external_wp_keyboardShortcuts_namespaceObject.useShortcut)('core/block-editor/focus-toolbar', () => {
    setIsToolbarForced(true);
    stopTyping(true);
  }, {
    isDisabled: !canFocusHiddenToolbar
  });
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    if (!shouldShowContextualToolbar) {
      setIsToolbarForced(false);
    }
  }, [shouldShowContextualToolbar]); // Stores the active toolbar item index so the block toolbar can return focus
  // to it when re-mounting.

  const initialToolbarItemIndexRef = (0,external_wp_element_namespaceObject.useRef)();
  const selectedElement = useBlockElement(clientId);
  const lastSelectedElement = useBlockElement(lastClientId);
  const capturingElement = useBlockElement(capturingClientId);
  const popoverScrollRef = usePopoverScroll(__unstableContentRef);

  if (!shouldShowBreadcrumb && !shouldShowContextualToolbar && !isToolbarForced && !showEmptyBlockSideInserter) {
    return null;
  }

  let node = selectedElement;

  if (!node) {
    return null;
  }

  if (capturingClientId) {
    node = capturingElement;
  }

  let anchorRef = node;

  if (hasMultiSelection) {
    // Wait to render the popover until the bottom reference is available
    // as well.
    if (!lastSelectedElement) {
      return null;
    }

    anchorRef = {
      top: node,
      bottom: lastSelectedElement
    };
  }

  function onFocus() {
    setIsInserterShown(true);
  }

  function onBlur() {
    setIsInserterShown(false);
  } // Position above the anchor, pop out towards the right, and position in the
  // left corner. For the side inserter, pop out towards the left, and
  // position in the right corner.
  // To do: refactor `Popover` to make this prop clearer.


  const popoverPosition = showEmptyBlockSideInserter ? 'top left right' : 'top right left';
  const {
    ownerDocument
  } = node;
  const stickyBoundaryElement = showEmptyBlockSideInserter ? undefined : // The sticky boundary element should be the boundary at which the
  // the block toolbar becomes sticky when the block scolls out of view.
  // In case of an iframe, this should be the iframe boundary, otherwise
  // the scroll container.
  ownerDocument.defaultView.frameElement || (0,external_wp_dom_namespaceObject.getScrollContainer)(node) || ownerDocument.body;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Popover, {
    ref: popoverScrollRef,
    noArrow: true,
    animate: false,
    position: popoverPosition,
    focusOnMount: false,
    anchorRef: anchorRef,
    className: classnames_default()('block-editor-block-list__block-popover', {
      'is-insertion-point-visible': isInsertionPointVisible
    }),
    __unstableStickyBoundaryElement: stickyBoundaryElement // Render in the old slot if needed for backward compatibility,
    // otherwise render in place (not in the the default popover slot).
    ,
    __unstableSlotName: __unstablePopoverSlot || null,
    __unstableBoundaryParent: true // Observe movement for block animations (especially horizontal).
    ,
    __unstableObserveElement: node,
    shouldAnchorIncludePadding: true // Used to safeguard sticky position behavior against cases where it would permanently
    // obscure specific sections of a block.
    ,
    __unstableEditorCanvasWrapper: __unstableContentRef === null || __unstableContentRef === void 0 ? void 0 : __unstableContentRef.current
  }, (shouldShowContextualToolbar || isToolbarForced) && (0,external_wp_element_namespaceObject.createElement)("div", {
    onFocus: onFocus,
    onBlur: onBlur // While ideally it would be enough to capture the
    // bubbling focus event from the Inserter, due to the
    // characteristics of click focusing of `button`s in
    // Firefox and Safari, it is not reliable.
    //
    // See: https://developer.mozilla.org/en-US/docs/Web/HTML/Element/button#Clicking_and_focus
    ,
    tabIndex: -1,
    className: classnames_default()('block-editor-block-list__block-popover-inserter', {
      'is-visible': isInserterShown
    })
  }, (0,external_wp_element_namespaceObject.createElement)(inserter, {
    clientId: clientId,
    rootClientId: rootClientId,
    __experimentalIsQuick: true
  })), (shouldShowContextualToolbar || isToolbarForced) && (0,external_wp_element_namespaceObject.createElement)(block_contextual_toolbar // If the toolbar is being shown because of being forced
  // it should focus the toolbar right after the mount.
  , {
    focusOnMount: isToolbarForced,
    __experimentalInitialIndex: initialToolbarItemIndexRef.current,
    __experimentalOnIndexChange: index => {
      initialToolbarItemIndexRef.current = index;
    } // Resets the index whenever the active block changes so
    // this is not persisted. See https://github.com/WordPress/gutenberg/pull/25760#issuecomment-717906169
    ,
    key: clientId
  }), shouldShowBreadcrumb && (0,external_wp_element_namespaceObject.createElement)(block_selection_button, {
    clientId: clientId,
    rootClientId: rootClientId,
    blockElement: node
  }), showEmptyBlockSideInserter && (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-list__empty-block-inserter"
  }, (0,external_wp_element_namespaceObject.createElement)(inserter, {
    position: "bottom right",
    rootClientId: rootClientId,
    clientId: clientId,
    __experimentalIsQuick: true
  })));
}

function wrapperSelector(select) {
  const {
    getSelectedBlockClientId,
    getFirstMultiSelectedBlockClientId,
    getBlockRootClientId,
    getBlock,
    getBlockParents,
    __experimentalGetBlockListSettingsForBlocks
  } = select(store);
  const clientId = getSelectedBlockClientId() || getFirstMultiSelectedBlockClientId();

  if (!clientId) {
    return;
  }

  const {
    name,
    attributes = {},
    isValid
  } = getBlock(clientId) || {};
  const blockParentsClientIds = getBlockParents(clientId); // Get Block List Settings for all ancestors of the current Block clientId.

  const parentBlockListSettings = __experimentalGetBlockListSettingsForBlocks(blockParentsClientIds); // Get the clientId of the topmost parent with the capture toolbars setting.


  const capturingClientId = (0,external_lodash_namespaceObject.find)(blockParentsClientIds, parentClientId => {
    var _parentBlockListSetti;

    return (_parentBlockListSetti = parentBlockListSettings[parentClientId]) === null || _parentBlockListSetti === void 0 ? void 0 : _parentBlockListSetti.__experimentalCaptureToolbars;
  });
  return {
    clientId,
    rootClientId: getBlockRootClientId(clientId),
    name,
    isValid,
    isEmptyDefaultBlock: name && (0,external_wp_blocks_namespaceObject.isUnmodifiedDefaultBlock)({
      name,
      attributes
    }),
    capturingClientId
  };
}

function WrappedBlockPopover(_ref2) {
  let {
    __unstablePopoverSlot,
    __unstableContentRef
  } = _ref2;
  const selected = (0,external_wp_data_namespaceObject.useSelect)(wrapperSelector, []);

  if (!selected) {
    return null;
  }

  const {
    clientId,
    rootClientId,
    name,
    isValid,
    isEmptyDefaultBlock,
    capturingClientId
  } = selected;

  if (!name) {
    return null;
  }

  return (0,external_wp_element_namespaceObject.createElement)(BlockPopover, {
    clientId: clientId,
    rootClientId: rootClientId,
    isValid: isValid,
    isEmptyDefaultBlock: isEmptyDefaultBlock,
    capturingClientId: capturingClientId,
    __unstablePopoverSlot: __unstablePopoverSlot,
    __unstableContentRef: __unstableContentRef
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-tools/back-compat.js


/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */



function BlockToolsBackCompat(_ref) {
  let {
    children
  } = _ref;
  const openRef = (0,external_wp_element_namespaceObject.useContext)(InsertionPointOpenRef);
  const isDisabled = (0,external_wp_element_namespaceObject.useContext)(external_wp_components_namespaceObject.Disabled.Context); // If context is set, `BlockTools` is a parent component.

  if (openRef || isDisabled) {
    return children;
  }

  external_wp_deprecated_default()('wp.components.Popover.Slot name="block-toolbar"', {
    alternative: 'wp.blockEditor.BlockTools',
    since: '5.8'
  });
  return (0,external_wp_element_namespaceObject.createElement)(InsertionPoint, {
    __unstablePopoverSlot: "block-toolbar"
  }, (0,external_wp_element_namespaceObject.createElement)(WrappedBlockPopover, {
    __unstablePopoverSlot: "block-toolbar"
  }), children);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inner-blocks/with-client-id.js



/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */


const withClientId = (0,external_wp_compose_namespaceObject.createHigherOrderComponent)(WrappedComponent => props => {
  const {
    clientId
  } = useBlockEditContext();
  return (0,external_wp_element_namespaceObject.createElement)(WrappedComponent, _extends({}, props, {
    clientId: clientId
  }));
}, 'withClientId');
/* harmony default export */ var with_client_id = (withClientId);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inner-blocks/button-block-appender.js


/**
 * External dependencies
 */

/**
 * Internal dependencies
 */



const button_block_appender_ButtonBlockAppender = _ref => {
  let {
    clientId,
    showSeparator,
    isFloating,
    onAddBlock,
    isToggle
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)(button_block_appender, {
    className: classnames_default()({
      'block-list-appender__toggle': isToggle
    }),
    rootClientId: clientId,
    showSeparator: showSeparator,
    isFloating: isFloating,
    onAddBlock: onAddBlock
  });
};
/* harmony default export */ var inner_blocks_button_block_appender = (with_client_id(button_block_appender_ButtonBlockAppender));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inner-blocks/default-block-appender.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */




const default_block_appender_DefaultBlockAppender = _ref => {
  let {
    clientId
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)(default_block_appender, {
    rootClientId: clientId
  });
};
/* harmony default export */ var inner_blocks_default_block_appender = ((0,external_wp_compose_namespaceObject.compose)([with_client_id, (0,external_wp_data_namespaceObject.withSelect)((select, _ref2) => {
  let {
    clientId
  } = _ref2;
  const {
    getBlockOrder
  } = select(store);
  const blockClientIds = getBlockOrder(clientId);
  return {
    lastBlockClientId: (0,external_lodash_namespaceObject.last)(blockClientIds)
  };
})])(default_block_appender_DefaultBlockAppender));

;// CONCATENATED MODULE: external ["wp","isShallowEqual"]
var external_wp_isShallowEqual_namespaceObject = window["wp"]["isShallowEqual"];
var external_wp_isShallowEqual_default = /*#__PURE__*/__webpack_require__.n(external_wp_isShallowEqual_namespaceObject);
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inner-blocks/use-nested-settings-update.js
/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */



/** @typedef {import('../../selectors').WPDirectInsertBlock } WPDirectInsertBlock */

/**
 * This hook is a side effect which updates the block-editor store when changes
 * happen to inner block settings. The given props are transformed into a
 * settings object, and if that is different from the current settings object in
 * the block-editor store, then the store is updated with the new settings which
 * came from props.
 *
 * @param {string}               clientId                   The client ID of the block to update.
 * @param {string[]}             allowedBlocks              An array of block names which are permitted
 *                                                          in inner blocks.
 * @param {?WPDirectInsertBlock} __experimentalDefaultBlock The default block to insert: [ blockName, { blockAttributes } ].
 * @param {?Function|boolean}    __experimentalDirectInsert If a default block should be inserted directly by the
 *                                                          appender.
 * @param {string}               [templateLock]             The template lock specified for the inner
 *                                                          blocks component. (e.g. "all")
 * @param {boolean}              captureToolbars            Whether or children toolbars should be shown
 *                                                          in the inner blocks component rather than on
 *                                                          the child block.
 * @param {string}               orientation                The direction in which the block
 *                                                          should face.
 * @param {Object}               layout                     The layout object for the block container.
 */

function useNestedSettingsUpdate(clientId, allowedBlocks, __experimentalDefaultBlock, __experimentalDirectInsert, templateLock, captureToolbars, orientation, layout) {
  const {
    updateBlockListSettings
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const {
    blockListSettings,
    parentLock
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const rootClientId = select(store).getBlockRootClientId(clientId);
    return {
      blockListSettings: select(store).getBlockListSettings(clientId),
      parentLock: select(store).getTemplateLock(rootClientId)
    };
  }, [clientId]); // Memoize as inner blocks implementors often pass a new array on every
  // render.

  const _allowedBlocks = (0,external_wp_element_namespaceObject.useMemo)(() => allowedBlocks, allowedBlocks);

  (0,external_wp_element_namespaceObject.useLayoutEffect)(() => {
    const newSettings = {
      allowedBlocks: _allowedBlocks,
      templateLock: templateLock === undefined ? parentLock : templateLock
    }; // These values are not defined for RN, so only include them if they
    // are defined.

    if (captureToolbars !== undefined) {
      newSettings.__experimentalCaptureToolbars = captureToolbars;
    } // Orientation depends on layout,
    // ideally the separate orientation prop should be deprecated.


    if (orientation !== undefined) {
      newSettings.orientation = orientation;
    } else {
      const layoutType = getLayoutType(layout === null || layout === void 0 ? void 0 : layout.type);
      newSettings.orientation = layoutType.getOrientation(layout);
    }

    if (__experimentalDefaultBlock !== undefined) {
      newSettings.__experimentalDefaultBlock = __experimentalDefaultBlock;
    }

    if (__experimentalDirectInsert !== undefined) {
      newSettings.__experimentalDirectInsert = __experimentalDirectInsert;
    }

    if (!external_wp_isShallowEqual_default()(blockListSettings, newSettings)) {
      updateBlockListSettings(clientId, newSettings);
    }
  }, [clientId, blockListSettings, _allowedBlocks, __experimentalDefaultBlock, __experimentalDirectInsert, templateLock, parentLock, captureToolbars, orientation, updateBlockListSettings, layout]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inner-blocks/use-inner-block-template-sync.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */


/**
 * This hook makes sure that a block's inner blocks stay in sync with the given
 * block "template". The template is a block hierarchy to which inner blocks must
 * conform. If the blocks get "out of sync" with the template and the template
 * is meant to be locked (e.g. templateLock = "all"), then we replace the inner
 * blocks with the correct value after synchronizing it with the template.
 *
 * @param {string}  clientId                       The block client ID.
 * @param {Object}  template                       The template to match.
 * @param {string}  templateLock                   The template lock state for the inner blocks. For
 *                                                 example, if the template lock is set to "all",
 *                                                 then the inner blocks will stay in sync with the
 *                                                 template. If not defined or set to false, then
 *                                                 the inner blocks will not be synchronized with
 *                                                 the given template.
 * @param {boolean} templateInsertUpdatesSelection Whether or not to update the
 *                                                 block-editor selection state when inner blocks
 *                                                 are replaced after template synchronization.
 */

function useInnerBlockTemplateSync(clientId, template, templateLock, templateInsertUpdatesSelection) {
  const {
    getSelectedBlocksInitialCaretPosition
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const {
    replaceInnerBlocks
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const innerBlocks = (0,external_wp_data_namespaceObject.useSelect)(select => select(store).getBlocks(clientId), [clientId]); // Maintain a reference to the previous value so we can do a deep equality check.

  const existingTemplate = (0,external_wp_element_namespaceObject.useRef)(null);
  (0,external_wp_element_namespaceObject.useLayoutEffect)(() => {
    // Only synchronize innerBlocks with template if innerBlocks are empty or
    // a locking all exists directly on the block.
    if (innerBlocks.length === 0 || templateLock === 'all') {
      const hasTemplateChanged = !(0,external_lodash_namespaceObject.isEqual)(template, existingTemplate.current);

      if (hasTemplateChanged) {
        existingTemplate.current = template;
        const nextBlocks = (0,external_wp_blocks_namespaceObject.synchronizeBlocksWithTemplate)(innerBlocks, template);

        if (!(0,external_lodash_namespaceObject.isEqual)(nextBlocks, innerBlocks)) {
          replaceInnerBlocks(clientId, nextBlocks, innerBlocks.length === 0 && templateInsertUpdatesSelection && nextBlocks.length !== 0, // This ensures the "initialPosition" doesn't change when applying the template
          // If we're supposed to focus the block, we'll focus the first inner block
          // otherwise, we won't apply any auto-focus.
          // This ensures for instance that the focus stays in the inserter when inserting the "buttons" block.
          getSelectedBlocksInitialCaretPosition());
        }
      }
    }
  }, [innerBlocks, template, templateLock, clientId]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inner-blocks/get-block-context.js
/**
 * External dependencies
 */

/**
 * Block context cache, implemented as a WeakMap mapping block types to a
 * WeakMap mapping attributes object to context value.
 *
 * @type {WeakMap<string,WeakMap<string,*>>}
 */

const BLOCK_CONTEXT_CACHE = new WeakMap();
/**
 * Returns a cached context object value for a given set of attributes for the
 * block type.
 *
 * @param {Record<string,*>} attributes Block attributes object.
 * @param {WPBlockType}      blockType  Block type settings.
 *
 * @return {Record<string,*>} Context value.
 */

function getBlockContext(attributes, blockType) {
  if (!BLOCK_CONTEXT_CACHE.has(blockType)) {
    BLOCK_CONTEXT_CACHE.set(blockType, new WeakMap());
  }

  const blockTypeCache = BLOCK_CONTEXT_CACHE.get(blockType);

  if (!blockTypeCache.has(attributes)) {
    const context = (0,external_lodash_namespaceObject.mapValues)(blockType.providesContext, attributeName => attributes[attributeName]);
    blockTypeCache.set(attributes, context);
  }

  return blockTypeCache.get(attributes);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/use-on-block-drop/index.js
/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */


/** @typedef {import('@wordpress/element').WPSyntheticEvent} WPSyntheticEvent */

/**
 * Retrieve the data for a block drop event.
 *
 * @param {WPSyntheticEvent} event The drop event.
 *
 * @return {Object} An object with block drag and drop data.
 */

function parseDropEvent(event) {
  let result = {
    srcRootClientId: null,
    srcClientIds: null,
    srcIndex: null,
    type: null,
    blocks: null
  };

  if (!event.dataTransfer) {
    return result;
  }

  try {
    result = Object.assign(result, JSON.parse(event.dataTransfer.getData('wp-blocks')));
  } catch (err) {
    return result;
  }

  return result;
}
/**
 * A function that returns an event handler function for block drop events.
 *
 * @param {string}   targetRootClientId        The root client id where the block(s) will be inserted.
 * @param {number}   targetBlockIndex          The index where the block(s) will be inserted.
 * @param {Function} getBlockIndex             A function that gets the index of a block.
 * @param {Function} getClientIdsOfDescendants A function that gets the client ids of descendant blocks.
 * @param {Function} moveBlocksToPosition      A function that moves blocks.
 * @param {Function} insertBlocks              A function that inserts blocks.
 * @param {Function} clearSelectedBlock        A function that clears block selection.
 * @return {Function} The event handler for a block drop event.
 */

function onBlockDrop(targetRootClientId, targetBlockIndex, getBlockIndex, getClientIdsOfDescendants, moveBlocksToPosition, insertBlocks, clearSelectedBlock) {
  return event => {
    const {
      srcRootClientId: sourceRootClientId,
      srcClientIds: sourceClientIds,
      type: dropType,
      blocks
    } = parseDropEvent(event); // If the user is inserting a block.

    if (dropType === 'inserter') {
      clearSelectedBlock();
      const blocksToInsert = blocks.map(block => (0,external_wp_blocks_namespaceObject.cloneBlock)(block));
      insertBlocks(blocksToInsert, targetBlockIndex, targetRootClientId, true, null);
    } // If the user is moving a block.


    if (dropType === 'block') {
      const sourceBlockIndex = getBlockIndex(sourceClientIds[0]); // If the user is dropping to the same position, return early.

      if (sourceRootClientId === targetRootClientId && sourceBlockIndex === targetBlockIndex) {
        return;
      } // If the user is attempting to drop a block within its own
      // nested blocks, return early as this would create infinite
      // recursion.


      if (sourceClientIds.includes(targetRootClientId) || getClientIdsOfDescendants(sourceClientIds).some(id => id === targetRootClientId)) {
        return;
      }

      const isAtSameLevel = sourceRootClientId === targetRootClientId;
      const draggedBlockCount = sourceClientIds.length; // If the block is kept at the same level and moved downwards,
      // subtract to take into account that the blocks being dragged
      // were removed from the block list above the insertion point.

      const insertIndex = isAtSameLevel && sourceBlockIndex < targetBlockIndex ? targetBlockIndex - draggedBlockCount : targetBlockIndex;
      moveBlocksToPosition(sourceClientIds, sourceRootClientId, targetRootClientId, insertIndex);
    }
  };
}
/**
 * A function that returns an event handler function for block-related file drop events.
 *
 * @param {string}   targetRootClientId    The root client id where the block(s) will be inserted.
 * @param {number}   targetBlockIndex      The index where the block(s) will be inserted.
 * @param {boolean}  hasUploadPermissions  Whether the user has upload permissions.
 * @param {Function} updateBlockAttributes A function that updates a block's attributes.
 * @param {Function} canInsertBlockType    A function that returns checks whether a block type can be inserted.
 * @param {Function} insertBlocks          A function that inserts blocks.
 *
 * @return {Function} The event handler for a block-related file drop event.
 */

function onFilesDrop(targetRootClientId, targetBlockIndex, hasUploadPermissions, updateBlockAttributes, canInsertBlockType, insertBlocks) {
  return files => {
    if (!hasUploadPermissions) {
      return;
    }

    const transformation = (0,external_wp_blocks_namespaceObject.findTransform)((0,external_wp_blocks_namespaceObject.getBlockTransforms)('from'), transform => transform.type === 'files' && canInsertBlockType(transform.blockName, targetRootClientId) && transform.isMatch(files));

    if (transformation) {
      const blocks = transformation.transform(files, updateBlockAttributes);
      insertBlocks(blocks, targetBlockIndex, targetRootClientId);
    }
  };
}
/**
 * A function that returns an event handler function for block-related HTML drop events.
 *
 * @param {string}   targetRootClientId The root client id where the block(s) will be inserted.
 * @param {number}   targetBlockIndex   The index where the block(s) will be inserted.
 * @param {Function} insertBlocks       A function that inserts blocks.
 *
 * @return {Function} The event handler for a block-related HTML drop event.
 */

function onHTMLDrop(targetRootClientId, targetBlockIndex, insertBlocks) {
  return HTML => {
    const blocks = (0,external_wp_blocks_namespaceObject.pasteHandler)({
      HTML,
      mode: 'BLOCKS'
    });

    if (blocks.length) {
      insertBlocks(blocks, targetBlockIndex, targetRootClientId);
    }
  };
}
/**
 * A React hook for handling block drop events.
 *
 * @param {string} targetRootClientId The root client id where the block(s) will be inserted.
 * @param {number} targetBlockIndex   The index where the block(s) will be inserted.
 *
 * @return {Object} An object that contains the event handlers `onDrop`, `onFilesDrop` and `onHTMLDrop`.
 */

function useOnBlockDrop(targetRootClientId, targetBlockIndex) {
  const hasUploadPermissions = (0,external_wp_data_namespaceObject.useSelect)(select => select(store).getSettings().mediaUpload, []);
  const {
    canInsertBlockType,
    getBlockIndex,
    getClientIdsOfDescendants
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const {
    insertBlocks,
    moveBlocksToPosition,
    updateBlockAttributes,
    clearSelectedBlock
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);

  const _onDrop = onBlockDrop(targetRootClientId, targetBlockIndex, getBlockIndex, getClientIdsOfDescendants, moveBlocksToPosition, insertBlocks, clearSelectedBlock);

  const _onFilesDrop = onFilesDrop(targetRootClientId, targetBlockIndex, hasUploadPermissions, updateBlockAttributes, canInsertBlockType, insertBlocks);

  const _onHTMLDrop = onHTMLDrop(targetRootClientId, targetBlockIndex, insertBlocks);

  return event => {
    const files = (0,external_wp_dom_namespaceObject.getFilesFromDataTransfer)(event.dataTransfer);
    const html = event.dataTransfer.getData('text/html');
    /**
     * From Windows Chrome 96, the `event.dataTransfer` returns both file object and HTML.
     * The order of the checks is important to recognise the HTML drop.
     */

    if (html) {
      _onHTMLDrop(html);
    } else if (files.length) {
      _onFilesDrop(files);
    } else {
      _onDrop(event);
    }
  };
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/utils/math.js
/**
 * A string representing the name of an edge.
 *
 * @typedef {'top'|'right'|'bottom'|'left'} WPEdgeName
 */

/**
 * @typedef  {Object} WPPoint
 * @property {number} x The horizontal position.
 * @property {number} y The vertical position.
 */

/**
 * Given a point, a DOMRect and the name of an edge, returns the distance to
 * that edge of the rect.
 *
 * This function works for edges that are horizontal or vertical (e.g. not
 * rotated), the following terms are used so that the function works in both
 * orientations:
 *
 * - Forward, meaning the axis running horizontally when an edge is vertical
 *   and vertically when an edge is horizontal.
 * - Lateral, meaning the axis running vertically when an edge is vertical
 *   and horizontally when an edge is horizontal.
 *
 * @param {WPPoint}    point The point to measure distance from.
 * @param {DOMRect}    rect  A DOM Rect containing edge positions.
 * @param {WPEdgeName} edge  The edge to measure to.
 */
function getDistanceFromPointToEdge(point, rect, edge) {
  const isHorizontal = edge === 'top' || edge === 'bottom';
  const {
    x,
    y
  } = point;
  const pointLateralPosition = isHorizontal ? x : y;
  const pointForwardPosition = isHorizontal ? y : x;
  const edgeStart = isHorizontal ? rect.left : rect.top;
  const edgeEnd = isHorizontal ? rect.right : rect.bottom;
  const edgeForwardPosition = rect[edge]; // Measure the straight line distance to the edge of the rect, when the
  // point is adjacent to the edge.
  // Else, if the point is positioned diagonally to the edge of the rect,
  // measure diagonally to the nearest corner that the edge meets.

  let edgeLateralPosition;

  if (pointLateralPosition >= edgeStart && pointLateralPosition <= edgeEnd) {
    edgeLateralPosition = pointLateralPosition;
  } else if (pointLateralPosition < edgeEnd) {
    edgeLateralPosition = edgeStart;
  } else {
    edgeLateralPosition = edgeEnd;
  }

  return Math.sqrt((pointLateralPosition - edgeLateralPosition) ** 2 + (pointForwardPosition - edgeForwardPosition) ** 2);
}
/**
 * Given a point, a DOMRect and a list of allowed edges returns the name of and
 * distance to the nearest edge.
 *
 * @param {WPPoint}      point        The point to measure distance from.
 * @param {DOMRect}      rect         A DOM Rect containing edge positions.
 * @param {WPEdgeName[]} allowedEdges A list of the edges included in the
 *                                    calculation. Defaults to all edges.
 *
 * @return {[number, string]} An array where the first value is the distance
 *                              and a second is the edge name.
 */

function getDistanceToNearestEdge(point, rect) {
  let allowedEdges = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : ['top', 'bottom', 'left', 'right'];
  let candidateDistance;
  let candidateEdge;
  allowedEdges.forEach(edge => {
    const distance = getDistanceFromPointToEdge(point, rect, edge);

    if (candidateDistance === undefined || distance < candidateDistance) {
      candidateDistance = distance;
      candidateEdge = edge;
    }
  });
  return [candidateDistance, candidateEdge];
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/use-block-drop-zone/index.js
/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */




/** @typedef {import('../../utils/math').WPPoint} WPPoint */

/**
 * The orientation of a block list.
 *
 * @typedef {'horizontal'|'vertical'|undefined} WPBlockListOrientation
 */

/**
 * Given a list of block DOM elements finds the index that a block should be dropped
 * at.
 *
 * @param {Element[]}              elements    Array of DOM elements that represent each block in a block list.
 * @param {WPPoint}                position    The position of the item being dragged.
 * @param {WPBlockListOrientation} orientation The orientation of a block list.
 *
 * @return {number|undefined} The block index that's closest to the drag position.
 */

function getNearestBlockIndex(elements, position, orientation) {
  const allowedEdges = orientation === 'horizontal' ? ['left', 'right'] : ['top', 'bottom'];
  const isRightToLeft = (0,external_wp_i18n_namespaceObject.isRTL)();
  let candidateIndex;
  let candidateDistance;
  elements.forEach((element, index) => {
    const rect = element.getBoundingClientRect();
    const [distance, edge] = getDistanceToNearestEdge(position, rect, allowedEdges);

    if (candidateDistance === undefined || distance < candidateDistance) {
      // If the user is dropping to the trailing edge of the block
      // add 1 to the index to represent dragging after.
      // Take RTL languages into account where the left edge is
      // the trailing edge.
      const isTrailingEdge = edge === 'bottom' || !isRightToLeft && edge === 'right' || isRightToLeft && edge === 'left';
      const offset = isTrailingEdge ? 1 : 0; // Update the currently known best candidate.

      candidateDistance = distance;
      candidateIndex = index + offset;
    }
  });
  return candidateIndex;
}
/**
 * @typedef  {Object} WPBlockDropZoneConfig
 * @property {string} rootClientId The root client id for the block list.
 */

/**
 * A React hook that can be used to make a block list handle drag and drop.
 *
 * @param {WPBlockDropZoneConfig} dropZoneConfig configuration data for the drop zone.
 */

function useBlockDropZone() {
  let {
    // An undefined value represents a top-level block. Default to an empty
    // string for this so that `targetRootClientId` can be easily compared to
    // values returned by the `getRootBlockClientId` selector, which also uses
    // an empty string to represent top-level blocks.
    rootClientId: targetRootClientId = ''
  } = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  const [targetBlockIndex, setTargetBlockIndex] = (0,external_wp_element_namespaceObject.useState)(null);
  const isLockedAll = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getTemplateLock
    } = select(store);
    return getTemplateLock(targetRootClientId) === 'all';
  }, [targetRootClientId]);
  const {
    getBlockListSettings
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const {
    showInsertionPoint,
    hideInsertionPoint
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const onBlockDrop = useOnBlockDrop(targetRootClientId, targetBlockIndex);
  const throttled = (0,external_wp_compose_namespaceObject.useThrottle)((0,external_wp_element_namespaceObject.useCallback)((event, currentTarget) => {
    var _getBlockListSettings;

    const blockElements = Array.from(currentTarget.children).filter( // Ensure the element is a block. It should have the `wp-block` class.
    element => element.classList.contains('wp-block'));
    const targetIndex = getNearestBlockIndex(blockElements, {
      x: event.clientX,
      y: event.clientY
    }, (_getBlockListSettings = getBlockListSettings(targetRootClientId)) === null || _getBlockListSettings === void 0 ? void 0 : _getBlockListSettings.orientation);
    setTargetBlockIndex(targetIndex === undefined ? 0 : targetIndex);

    if (targetIndex !== null) {
      showInsertionPoint(targetRootClientId, targetIndex);
    }
  }, []), 200);
  return (0,external_wp_compose_namespaceObject.__experimentalUseDropZone)({
    isDisabled: isLockedAll,
    onDrop: onBlockDrop,

    onDragOver(event) {
      // `currentTarget` is only available while the event is being
      // handled, so get it now and pass it to the thottled function.
      // https://developer.mozilla.org/en-US/docs/Web/API/Event/currentTarget
      throttled(event, event.currentTarget);
    },

    onDragLeave() {
      throttled.cancel();
      hideInsertionPoint();
      setTargetBlockIndex(null);
    },

    onDragEnd() {
      throttled.cancel();
      hideInsertionPoint();
      setTargetBlockIndex(null);
    }

  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inner-blocks/index.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */












/**
 * InnerBlocks is a component which allows a single block to have multiple blocks
 * as children. The UncontrolledInnerBlocks component is used whenever the inner
 * blocks are not controlled by another entity. In other words, it is normally
 * used for inner blocks in the post editor
 *
 * @param {Object} props The component props.
 */

function UncontrolledInnerBlocks(props) {
  const {
    clientId,
    allowedBlocks,
    __experimentalDefaultBlock,
    __experimentalDirectInsert,
    template,
    templateLock,
    wrapperRef,
    templateInsertUpdatesSelection,
    __experimentalCaptureToolbars: captureToolbars,
    __experimentalAppenderTagName,
    renderAppender,
    orientation,
    placeholder,
    __experimentalLayout
  } = props;
  useNestedSettingsUpdate(clientId, allowedBlocks, __experimentalDefaultBlock, __experimentalDirectInsert, templateLock, captureToolbars, orientation, __experimentalLayout);
  useInnerBlockTemplateSync(clientId, template, templateLock, templateInsertUpdatesSelection);
  const context = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const block = select(store).getBlock(clientId);
    const blockType = (0,external_wp_blocks_namespaceObject.getBlockType)(block.name);

    if (!blockType || !blockType.providesContext) {
      return;
    }

    return getBlockContext(block.attributes, blockType);
  }, [clientId]); // This component needs to always be synchronous as it's the one changing
  // the async mode depending on the block selection.

  return (0,external_wp_element_namespaceObject.createElement)(BlockContextProvider, {
    value: context
  }, (0,external_wp_element_namespaceObject.createElement)(BlockListItems, {
    rootClientId: clientId,
    renderAppender: renderAppender,
    __experimentalAppenderTagName: __experimentalAppenderTagName,
    __experimentalLayout: __experimentalLayout,
    wrapperRef: wrapperRef,
    placeholder: placeholder
  }));
}
/**
 * The controlled inner blocks component wraps the uncontrolled inner blocks
 * component with the blockSync hook. This keeps the innerBlocks of the block in
 * the block-editor store in sync with the blocks of the controlling entity. An
 * example of an inner block controller is a template part block, which provides
 * its own blocks from the template part entity data source.
 *
 * @param {Object} props The component props.
 */


function ControlledInnerBlocks(props) {
  useBlockSync(props);
  return (0,external_wp_element_namespaceObject.createElement)(UncontrolledInnerBlocks, props);
}

const ForwardedInnerBlocks = (0,external_wp_element_namespaceObject.forwardRef)((props, ref) => {
  const innerBlocksProps = useInnerBlocksProps({
    ref
  }, props);
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-inner-blocks"
  }, (0,external_wp_element_namespaceObject.createElement)("div", innerBlocksProps));
});
/**
 * This hook is used to lightly mark an element as an inner blocks wrapper
 * element. Call this hook and pass the returned props to the element to mark as
 * an inner blocks wrapper, automatically rendering inner blocks as children. If
 * you define a ref for the element, it is important to pass the ref to this
 * hook, which the hook in turn will pass to the component through the props it
 * returns. Optionally, you can also pass any other props through this hook, and
 * they will be merged and returned.
 *
 * @param {Object} props   Optional. Props to pass to the element. Must contain
 *                         the ref if one is defined.
 * @param {Object} options Optional. Inner blocks options.
 *
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/inner-blocks/README.md
 */

function useInnerBlocksProps() {
  let props = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  let options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
  const {
    clientId
  } = useBlockEditContext();
  const isSmallScreen = (0,external_wp_compose_namespaceObject.useViewportMatch)('medium', '<');
  const {
    __experimentalCaptureToolbars,
    hasOverlay
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    if (!clientId) {
      return {};
    }

    const {
      getBlockName,
      isBlockSelected,
      hasSelectedInnerBlock,
      isNavigationMode
    } = select(store);
    const blockName = getBlockName(clientId);
    const enableClickThrough = isNavigationMode() || isSmallScreen;
    return {
      __experimentalCaptureToolbars: select(external_wp_blocks_namespaceObject.store).hasBlockSupport(blockName, '__experimentalExposeControlsToChildren', false),
      hasOverlay: blockName !== 'core/template' && !isBlockSelected(clientId) && !hasSelectedInnerBlock(clientId, true) && enableClickThrough
    };
  }, [clientId, isSmallScreen]);
  const ref = (0,external_wp_compose_namespaceObject.useMergeRefs)([props.ref, useBlockDropZone({
    rootClientId: clientId
  })]);
  const innerBlocksProps = {
    __experimentalCaptureToolbars,
    ...options
  };
  const InnerBlocks = innerBlocksProps.value && innerBlocksProps.onChange ? ControlledInnerBlocks : UncontrolledInnerBlocks;
  return { ...props,
    ref,
    className: classnames_default()(props.className, 'block-editor-block-list__layout', {
      'has-overlay': hasOverlay
    }),
    children: clientId ? (0,external_wp_element_namespaceObject.createElement)(InnerBlocks, _extends({}, innerBlocksProps, {
      clientId: clientId
    })) : (0,external_wp_element_namespaceObject.createElement)(BlockListItems, options)
  };
}
useInnerBlocksProps.save = external_wp_blocks_namespaceObject.__unstableGetInnerBlocksProps; // Expose default appender placeholders as components.

ForwardedInnerBlocks.DefaultBlockAppender = inner_blocks_default_block_appender;
ForwardedInnerBlocks.ButtonBlockAppender = inner_blocks_button_block_appender;

ForwardedInnerBlocks.Content = () => useInnerBlocksProps.save().children;
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/inner-blocks/README.md
 */


/* harmony default export */ var inner_blocks = (ForwardedInnerBlocks);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-list/index.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */











const elementContext = (0,external_wp_element_namespaceObject.createContext)();
const IntersectionObserver = (0,external_wp_element_namespaceObject.createContext)();

function Root(_ref) {
  let {
    className,
    ...settings
  } = _ref;
  const [element, setElement] = (0,external_wp_element_namespaceObject.useState)();
  const isLargeViewport = (0,external_wp_compose_namespaceObject.useViewportMatch)('medium');
  const {
    isOutlineMode,
    isFocusMode,
    isNavigationMode
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getSettings,
      isNavigationMode: _isNavigationMode
    } = select(store);
    const {
      outlineMode,
      focusMode
    } = getSettings();
    return {
      isOutlineMode: outlineMode,
      isFocusMode: focusMode,
      isNavigationMode: _isNavigationMode()
    };
  }, []);
  const innerBlocksProps = useInnerBlocksProps({
    ref: (0,external_wp_compose_namespaceObject.useMergeRefs)([useBlockSelectionClearer(), useInBetweenInserter(), setElement]),
    className: classnames_default()('is-root-container', className, {
      'is-outline-mode': isOutlineMode,
      'is-focus-mode': isFocusMode && isLargeViewport,
      'is-navigate-mode': isNavigationMode
    })
  }, settings);
  return (0,external_wp_element_namespaceObject.createElement)(elementContext.Provider, {
    value: element
  }, (0,external_wp_element_namespaceObject.createElement)("div", innerBlocksProps));
}

function BlockList(settings) {
  usePreParsePatterns();
  return (0,external_wp_element_namespaceObject.createElement)(BlockToolsBackCompat, null, (0,external_wp_element_namespaceObject.createElement)(Provider, {
    value: DEFAULT_BLOCK_EDIT_CONTEXT
  }, (0,external_wp_element_namespaceObject.createElement)(Root, settings)));
}
BlockList.__unstableElementContext = elementContext;

function Items(_ref2) {
  let {
    placeholder,
    rootClientId,
    renderAppender,
    __experimentalAppenderTagName,
    __experimentalLayout: layout = defaultLayout
  } = _ref2;
  const [intersectingBlocks, setIntersectingBlocks] = (0,external_wp_element_namespaceObject.useState)(new Set());
  const intersectionObserver = (0,external_wp_element_namespaceObject.useMemo)(() => {
    const {
      IntersectionObserver: Observer
    } = window;

    if (!Observer) {
      return;
    }

    return new Observer(entries => {
      setIntersectingBlocks(oldIntersectingBlocks => {
        const newIntersectingBlocks = new Set(oldIntersectingBlocks);

        for (const entry of entries) {
          const clientId = entry.target.getAttribute('data-block');
          const action = entry.isIntersecting ? 'add' : 'delete';
          newIntersectingBlocks[action](clientId);
        }

        return newIntersectingBlocks;
      });
    });
  }, [setIntersectingBlocks]);
  const {
    order,
    selectedBlocks
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getBlockOrder,
      getSelectedBlockClientIds
    } = select(store);
    return {
      order: getBlockOrder(rootClientId),
      selectedBlocks: getSelectedBlockClientIds()
    };
  }, [rootClientId]);
  return (0,external_wp_element_namespaceObject.createElement)(LayoutProvider, {
    value: layout
  }, (0,external_wp_element_namespaceObject.createElement)(IntersectionObserver.Provider, {
    value: intersectionObserver
  }, order.map(clientId => (0,external_wp_element_namespaceObject.createElement)(external_wp_data_namespaceObject.AsyncModeProvider, {
    key: clientId,
    value: // Only provide data asynchronously if the block is
    // not visible and not selected.
    !intersectingBlocks.has(clientId) && !selectedBlocks.includes(clientId)
  }, (0,external_wp_element_namespaceObject.createElement)(block, {
    rootClientId: rootClientId,
    clientId: clientId
  })))), order.length < 1 && placeholder, (0,external_wp_element_namespaceObject.createElement)(block_list_appender, {
    tagName: __experimentalAppenderTagName,
    rootClientId: rootClientId,
    renderAppender: renderAppender
  }));
}

function BlockListItems(props) {
  // This component needs to always be synchronous as it's the one changing
  // the async mode depending on the block selection.
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_data_namespaceObject.AsyncModeProvider, {
    value: false
  }, (0,external_wp_element_namespaceObject.createElement)(Items, props));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/colors-gradients/control.js



/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */


const colorsAndGradientKeys = ['colors', 'disableCustomColors', 'gradients', 'disableCustomGradients'];

function ColorGradientControlInner(_ref) {
  let {
    colors,
    gradients,
    disableCustomColors,
    disableCustomGradients,
    __experimentalHasMultipleOrigins,
    __experimentalIsRenderedInSidebar,
    className,
    label,
    onColorChange,
    onGradientChange,
    colorValue,
    gradientValue,
    clearable,
    showTitle = true,
    enableAlpha
  } = _ref;
  const canChooseAColor = onColorChange && (!(0,external_lodash_namespaceObject.isEmpty)(colors) || !disableCustomColors);
  const canChooseAGradient = onGradientChange && (!(0,external_lodash_namespaceObject.isEmpty)(gradients) || !disableCustomGradients);
  const [currentTab, setCurrentTab] = (0,external_wp_element_namespaceObject.useState)(gradientValue ? 'gradient' : !!canChooseAColor && 'color');

  if (!canChooseAColor && !canChooseAGradient) {
    return null;
  }

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.BaseControl, {
    className: classnames_default()('block-editor-color-gradient-control', className)
  }, (0,external_wp_element_namespaceObject.createElement)("fieldset", {
    className: "block-editor-color-gradient-control__fieldset"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalVStack, {
    spacing: 1
  }, showTitle && (0,external_wp_element_namespaceObject.createElement)("legend", null, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-color-gradient-control__color-indicator"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.BaseControl.VisualLabel, null, label))), canChooseAColor && canChooseAGradient && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToggleGroupControl, {
    value: currentTab,
    onChange: setCurrentTab,
    label: (0,external_wp_i18n_namespaceObject.__)('Select color type'),
    hideLabelFromVision: true,
    isBlock: true
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToggleGroupControlOption, {
    value: "color",
    label: (0,external_wp_i18n_namespaceObject.__)('Solid')
  }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToggleGroupControlOption, {
    value: "gradient",
    label: (0,external_wp_i18n_namespaceObject.__)('Gradient')
  })), (currentTab === 'color' || !canChooseAGradient) && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ColorPalette, {
    value: colorValue,
    onChange: canChooseAGradient ? newColor => {
      onColorChange(newColor);
      onGradientChange();
    } : onColorChange,
    colors,
    disableCustomColors,
    __experimentalHasMultipleOrigins: __experimentalHasMultipleOrigins,
    __experimentalIsRenderedInSidebar: __experimentalIsRenderedInSidebar,
    clearable: clearable,
    enableAlpha: enableAlpha
  }), (currentTab === 'gradient' || !canChooseAColor) && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.GradientPicker, {
    value: gradientValue,
    onChange: canChooseAColor ? newGradient => {
      onGradientChange(newGradient);
      onColorChange();
    } : onGradientChange,
    gradients,
    disableCustomGradients,
    __experimentalHasMultipleOrigins: __experimentalHasMultipleOrigins,
    __experimentalIsRenderedInSidebar: __experimentalIsRenderedInSidebar,
    clearable: clearable
  }))));
}

function ColorGradientControlSelect(props) {
  const colorGradientSettings = {};
  colorGradientSettings.colors = useSetting('color.palette');
  colorGradientSettings.gradients = useSetting('color.gradients');
  colorGradientSettings.disableCustomColors = !useSetting('color.custom');
  colorGradientSettings.disableCustomGradients = !useSetting('color.customGradient');
  return (0,external_wp_element_namespaceObject.createElement)(ColorGradientControlInner, _extends({}, colorGradientSettings, props));
}

function ColorGradientControl(props) {
  if ((0,external_lodash_namespaceObject.every)(colorsAndGradientKeys, key => props.hasOwnProperty(key))) {
    return (0,external_wp_element_namespaceObject.createElement)(ColorGradientControlInner, props);
  }

  return (0,external_wp_element_namespaceObject.createElement)(ColorGradientControlSelect, props);
}

/* harmony default export */ var control = (ColorGradientControl);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/colors-gradients/dropdown.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


function ColorGradientSettingsDropdown(_ref) {
  let {
    colors,
    gradients,
    disableCustomColors,
    disableCustomGradients,
    __experimentalHasMultipleOrigins,
    __experimentalIsRenderedInSidebar,
    enableAlpha,
    settings
  } = _ref;
  let dropdownPosition;

  if (__experimentalIsRenderedInSidebar) {
    dropdownPosition = 'bottom left';
  }

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalItemGroup, {
    isBordered: true,
    isSeparated: true,
    className: "block-editor-panel-color-gradient-settings__item-group"
  }, settings.map((setting, index) => setting && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Dropdown, {
    key: index,
    position: dropdownPosition,
    className: "block-editor-panel-color-gradient-settings__dropdown",
    contentClassName: "block-editor-panel-color-gradient-settings__dropdown-content",
    renderToggle: _ref2 => {
      var _setting$gradientValu;

      let {
        isOpen,
        onToggle
      } = _ref2;
      return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalItem, {
        onClick: onToggle,
        className: classnames_default()('block-editor-panel-color-gradient-settings__item', {
          'is-open': isOpen
        })
      }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalHStack, {
        justify: "flex-start"
      }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ColorIndicator, {
        className: "block-editor-panel-color-gradient-settings__color-indicator",
        colorValue: (_setting$gradientValu = setting.gradientValue) !== null && _setting$gradientValu !== void 0 ? _setting$gradientValu : setting.colorValue
      }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.FlexItem, null, setting.label)));
    },
    renderContent: () => (0,external_wp_element_namespaceObject.createElement)(control, _extends({
      showTitle: false,
      colors,
      gradients,
      disableCustomColors,
      disableCustomGradients,
      __experimentalHasMultipleOrigins,
      __experimentalIsRenderedInSidebar,
      enableAlpha
    }, setting))
  })));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/colors-gradients/use-common-single-multiple-selects.js
/**
 * Internal dependencies
 */

function useCommonSingleMultipleSelects() {
  return {
    disableCustomColors: !useSetting('color.custom'),
    disableCustomGradients: !useSetting('color.customGradient')
  };
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/colors-gradients/use-multiple-origin-colors-and-gradients.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */



/**
 * Retrieves color and gradient related settings.
 *
 * The arrays for colors and gradients are made up of color palettes from each
 * origin i.e. "Core", "Theme", and "User".
 *
 * @return {Object} Color and gradient related settings.
 */

function useMultipleOriginColorsAndGradients() {
  const colorGradientSettings = useCommonSingleMultipleSelects();
  const customColors = useSetting('color.palette.custom');
  const themeColors = useSetting('color.palette.theme');
  const defaultColors = useSetting('color.palette.default');
  const shouldDisplayDefaultColors = useSetting('color.defaultPalette');
  colorGradientSettings.colors = (0,external_wp_element_namespaceObject.useMemo)(() => {
    const result = [];

    if (themeColors && themeColors.length) {
      result.push({
        name: (0,external_wp_i18n_namespaceObject._x)('Theme', 'Indicates this palette comes from the theme.'),
        colors: themeColors
      });
    }

    if (shouldDisplayDefaultColors && defaultColors && defaultColors.length) {
      result.push({
        name: (0,external_wp_i18n_namespaceObject._x)('Default', 'Indicates this palette comes from WordPress.'),
        colors: defaultColors
      });
    }

    if (customColors && customColors.length) {
      result.push({
        name: (0,external_wp_i18n_namespaceObject._x)('Custom', 'Indicates this palette comes from the theme.'),
        colors: customColors
      });
    }

    return result;
  }, [defaultColors, themeColors, customColors]);
  const customGradients = useSetting('color.gradients.custom');
  const themeGradients = useSetting('color.gradients.theme');
  const defaultGradients = useSetting('color.gradients.default');
  const shouldDisplayDefaultGradients = useSetting('color.defaultGradients');
  colorGradientSettings.gradients = (0,external_wp_element_namespaceObject.useMemo)(() => {
    const result = [];

    if (themeGradients && themeGradients.length) {
      result.push({
        name: (0,external_wp_i18n_namespaceObject._x)('Theme', 'Indicates this palette comes from the theme.'),
        gradients: themeGradients
      });
    }

    if (shouldDisplayDefaultGradients && defaultGradients && defaultGradients.length) {
      result.push({
        name: (0,external_wp_i18n_namespaceObject._x)('Default', 'Indicates this palette comes from WordPress.'),
        gradients: defaultGradients
      });
    }

    if (customGradients && customGradients.length) {
      result.push({
        name: (0,external_wp_i18n_namespaceObject._x)('Custom', 'Indicates this palette is created by the user.'),
        gradients: customGradients
      });
    }

    return result;
  }, [customGradients, themeGradients, defaultGradients]);
  return colorGradientSettings;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/colors/utils.js
/**
 * External dependencies
 */




k([names, a11y]);
/**
 * Provided an array of color objects as set by the theme or by the editor defaults,
 * and the values of the defined color or custom color returns a color object describing the color.
 *
 * @param {Array}   colors       Array of color objects as set by the theme or by the editor defaults.
 * @param {?string} definedColor A string containing the color slug.
 * @param {?string} customColor  A string containing the customColor value.
 *
 * @return {?Object} If definedColor is passed and the name is found in colors,
 *                   the color object exactly as set by the theme or editor defaults is returned.
 *                   Otherwise, an object that just sets the color is defined.
 */

const getColorObjectByAttributeValues = (colors, definedColor, customColor) => {
  if (definedColor) {
    const colorObj = (0,external_lodash_namespaceObject.find)(colors, {
      slug: definedColor
    });

    if (colorObj) {
      return colorObj;
    }
  }

  return {
    color: customColor
  };
};
/**
 * Provided an array of color objects as set by the theme or by the editor defaults, and a color value returns the color object matching that value or undefined.
 *
 * @param {Array}   colors     Array of color objects as set by the theme or by the editor defaults.
 * @param {?string} colorValue A string containing the color value.
 *
 * @return {?Object} Color object included in the colors array whose color property equals colorValue.
 *                   Returns undefined if no color object matches this requirement.
 */

const getColorObjectByColorValue = (colors, colorValue) => {
  return (0,external_lodash_namespaceObject.find)(colors, {
    color: colorValue
  });
};
/**
 * Returns a class based on the context a color is being used and its slug.
 *
 * @param {string} colorContextName Context/place where color is being used e.g: background, text etc...
 * @param {string} colorSlug        Slug of the color.
 *
 * @return {?string} String with the class corresponding to the color in the provided context.
 *                   Returns undefined if either colorContextName or colorSlug are not provided.
 */

function getColorClassName(colorContextName, colorSlug) {
  if (!colorContextName || !colorSlug) {
    return undefined;
  }

  return `has-${(0,external_lodash_namespaceObject.kebabCase)(colorSlug)}-${colorContextName}`;
}
/**
 * Given an array of color objects and a color value returns the color value of the most readable color in the array.
 *
 * @param {Array}   colors     Array of color objects as set by the theme or by the editor defaults.
 * @param {?string} colorValue A string containing the color value.
 *
 * @return {string} String with the color value of the most readable color.
 */

function getMostReadableColor(colors, colorValue) {
  const colordColor = w(colorValue);
  return (0,external_lodash_namespaceObject.maxBy)(colors, _ref => {
    let {
      color
    } = _ref;
    return colordColor.contrast(color);
  }).color;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/border-color.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */






 // Defining empty array here instead of inline avoids unnecessary re-renders of
// color control.

const border_color_EMPTY_ARRAY = [];
/**
 * Inspector control panel containing the border color related configuration.
 *
 * There is deliberate overlap between the colors and borders block supports
 * relating to border color. It can be argued the border color controls could
 * be included within either, or both, the colors and borders panels in the
 * inspector controls. If they share the same block attributes it should not
 * matter.
 *
 * @param {Object} props Block properties.
 *
 * @return {WPElement} Border color edit element.
 */

function BorderColorEdit(props) {
  const {
    attributes: {
      borderColor,
      style
    },
    setAttributes
  } = props;
  const colorGradientSettings = useMultipleOriginColorsAndGradients();
  const availableColors = colorGradientSettings.colors.reduce((colors, origin) => colors.concat(origin.colors), []);
  const {
    color: customBorderColor
  } = (style === null || style === void 0 ? void 0 : style.border) || {};
  const [colorValue, setColorValue] = (0,external_wp_element_namespaceObject.useState)(() => {
    var _getColorObjectByAttr;

    return (_getColorObjectByAttr = getColorObjectByAttributeValues(availableColors, borderColor, customBorderColor)) === null || _getColorObjectByAttr === void 0 ? void 0 : _getColorObjectByAttr.color;
  }); // Detect changes in the color attributes and update the colorValue to keep the
  // UI in sync. This is necessary for situations when border controls interact with
  // each other: eg, setting the border width to zero causes the color and style
  // selections to be cleared.

  (0,external_wp_element_namespaceObject.useEffect)(() => {
    var _getColorObjectByAttr2;

    setColorValue((_getColorObjectByAttr2 = getColorObjectByAttributeValues(availableColors, borderColor, customBorderColor)) === null || _getColorObjectByAttr2 === void 0 ? void 0 : _getColorObjectByAttr2.color);
  }, [borderColor, customBorderColor, availableColors]);

  const onChangeColor = value => {
    setColorValue(value);
    const colorObject = getColorObjectByColorValue(availableColors, value);
    const newStyle = { ...style,
      border: { ...(style === null || style === void 0 ? void 0 : style.border),
        color: colorObject !== null && colorObject !== void 0 && colorObject.slug ? undefined : value
      }
    }; // If empty slug, ensure undefined to remove attribute.

    const newNamedColor = colorObject !== null && colorObject !== void 0 && colorObject.slug ? colorObject.slug : undefined;
    setAttributes({
      style: cleanEmptyObject(newStyle),
      borderColor: newNamedColor
    });
  };

  const settings = [{
    label: (0,external_wp_i18n_namespaceObject.__)('Color'),
    onColorChange: onChangeColor,
    colorValue,
    clearable: false
  }];
  return (0,external_wp_element_namespaceObject.createElement)(ColorGradientSettingsDropdown, _extends({
    settings: settings,
    disableCustomColors: true,
    disableCustomGradients: true,
    __experimentalHasMultipleOrigins: true,
    __experimentalIsRenderedInSidebar: true,
    enableAlpha: true
  }, colorGradientSettings));
}
/**
 * Checks if there is a current value in the border color block support
 * attributes.
 *
 * @param {Object} props Block props.
 * @return {boolean}     Whether or not the block has a border color value set.
 */

function hasBorderColorValue(props) {
  var _style$border;

  const {
    attributes: {
      borderColor,
      style
    }
  } = props;
  return !!borderColor || !!(style !== null && style !== void 0 && (_style$border = style.border) !== null && _style$border !== void 0 && _style$border.color);
}
/**
 * Resets the border color block support attributes. This can be used when
 * disabling the border color support controls for a block via a progressive
 * discovery panel.
 *
 * @param {Object} props               Block props.
 * @param {Object} props.attributes    Block's attributes.
 * @param {Object} props.setAttributes Function to set block's attributes.
 */

function resetBorderColor(_ref) {
  let {
    attributes = {},
    setAttributes
  } = _ref;
  const {
    style
  } = attributes;
  setAttributes({
    borderColor: undefined,
    style: removeBorderAttribute(style, 'color')
  });
}
/**
 * Filters registered block settings, extending attributes to include
 * `borderColor` if needed.
 *
 * @param {Object} settings Original block settings.
 *
 * @return {Object} Updated block settings.
 */

function addAttributes(settings) {
  if (!hasBorderSupport(settings, 'color')) {
    return settings;
  } // Allow blocks to specify default value if needed.


  if (settings.attributes.borderColor) {
    return settings;
  } // Add new borderColor attribute to block settings.


  return { ...settings,
    attributes: { ...settings.attributes,
      borderColor: {
        type: 'string'
      }
    }
  };
}
/**
 * Override props assigned to save component to inject border color.
 *
 * @param {Object} props      Additional props applied to save element.
 * @param {Object} blockType  Block type definition.
 * @param {Object} attributes Block's attributes.
 *
 * @return {Object} Filtered props to apply to save element.
 */


function border_color_addSaveProps(props, blockType, attributes) {
  var _style$border2;

  if (!hasBorderSupport(blockType, 'color') || shouldSkipSerialization(blockType, BORDER_SUPPORT_KEY, 'color')) {
    return props;
  }

  const {
    borderColor,
    style
  } = attributes;
  const borderColorClass = getColorClassName('border-color', borderColor);
  const newClassName = classnames_default()(props.className, {
    'has-border-color': borderColor || (style === null || style === void 0 ? void 0 : (_style$border2 = style.border) === null || _style$border2 === void 0 ? void 0 : _style$border2.color),
    [borderColorClass]: !!borderColorClass
  }); // If we are clearing the last of the previous classes in `className`
  // set it to `undefined` to avoid rendering empty DOM attributes.

  props.className = newClassName ? newClassName : undefined;
  return props;
}
/**
 * Filters the registered block settings to apply border color styles and
 * classnames to the block edit wrapper.
 *
 * @param {Object} settings Original block settings.
 *
 * @return {Object} Filtered block settings.
 */


function addEditProps(settings) {
  if (!hasBorderSupport(settings, 'color') || shouldSkipSerialization(settings, BORDER_SUPPORT_KEY, 'color')) {
    return settings;
  }

  const existingGetEditWrapperProps = settings.getEditWrapperProps;

  settings.getEditWrapperProps = attributes => {
    let props = {};

    if (existingGetEditWrapperProps) {
      props = existingGetEditWrapperProps(attributes);
    }

    return border_color_addSaveProps(props, settings, attributes);
  };

  return settings;
}
/**
 * This adds inline styles for color palette colors.
 * Ideally, this is not needed and themes should load their palettes on the editor.
 *
 * @param {Function} BlockListBlock Original component.
 *
 * @return {Function} Wrapped component.
 */


const withBorderColorPaletteStyles = (0,external_wp_compose_namespaceObject.createHigherOrderComponent)(BlockListBlock => props => {
  var _getColorObjectByAttr3, _props$wrapperProps;

  const {
    name,
    attributes
  } = props;
  const {
    borderColor
  } = attributes;
  const colors = useSetting('color.palette') || border_color_EMPTY_ARRAY;

  if (!hasBorderSupport(name, 'color') || shouldSkipSerialization(name, BORDER_SUPPORT_KEY, 'color')) {
    return (0,external_wp_element_namespaceObject.createElement)(BlockListBlock, props);
  }

  const extraStyles = {
    borderColor: borderColor ? (_getColorObjectByAttr3 = getColorObjectByAttributeValues(colors, borderColor)) === null || _getColorObjectByAttr3 === void 0 ? void 0 : _getColorObjectByAttr3.color : undefined
  };
  let wrapperProps = props.wrapperProps;
  wrapperProps = { ...props.wrapperProps,
    style: { ...extraStyles,
      ...((_props$wrapperProps = props.wrapperProps) === null || _props$wrapperProps === void 0 ? void 0 : _props$wrapperProps.style)
    }
  };
  return (0,external_wp_element_namespaceObject.createElement)(BlockListBlock, _extends({}, props, {
    wrapperProps: wrapperProps
  }));
});
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.registerBlockType', 'core/border/addAttributes', addAttributes);
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.getSaveContent.extraProps', 'core/border/addSaveProps', border_color_addSaveProps);
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.registerBlockType', 'core/border/addEditProps', addEditProps);
(0,external_wp_hooks_namespaceObject.addFilter)('editor.BlockListBlock', 'core/border/with-border-color-palette-styles', withBorderColorPaletteStyles);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/border-radius-control/utils.js
/**
 * WordPress dependencies
 */

/**
 * Gets the (non-undefined) item with the highest occurrence within an array
 * Based in part on: https://stackoverflow.com/a/20762713
 *
 * Undefined values are always sorted to the end by `sort`, so this function
 * returns the first element, to always prioritize real values over undefined
 * values.
 *
 * See: https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Array/sort#description
 *
 * @param {Array<any>} inputArray Array of items to check.
 * @return {any}                  The item with the most occurrences.
 */

function mode(inputArray) {
  const arr = [...inputArray];
  return arr.sort((a, b) => inputArray.filter(v => v === b).length - inputArray.filter(v => v === a).length).shift();
}
/**
 * Returns the most common CSS unit in the radius values.
 * Falls back to `px` as a default unit.
 *
 * @param {Object|string} values Radius values.
 * @return {string}              Most common CSS unit in values. Default: `px`.
 */

function getAllUnit() {
  let values = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};

  if (typeof values === 'string') {
    const [, unit] = (0,external_wp_components_namespaceObject.__experimentalParseQuantityAndUnitFromRawValue)(values);
    return unit || 'px';
  }

  const allUnits = Object.values(values).map(value => {
    const [, unit] = (0,external_wp_components_namespaceObject.__experimentalParseQuantityAndUnitFromRawValue)(value);
    return unit;
  });
  return mode(allUnits) || 'px';
}
/**
 * Gets the 'all' input value and unit from values data.
 *
 * @param {Object|string} values Radius values.
 * @return {string}              A value + unit for the 'all' input.
 */

function getAllValue() {
  let values = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};

  /**
   * Border radius support was originally a single pixel value.
   *
   * To maintain backwards compatibility treat this case as the all value.
   */
  if (typeof values === 'string') {
    return values;
  }

  const parsedQuantitiesAndUnits = Object.values(values).map(value => (0,external_wp_components_namespaceObject.__experimentalParseQuantityAndUnitFromRawValue)(value));
  const allValues = parsedQuantitiesAndUnits.map(value => {
    var _value$;

    return (_value$ = value[0]) !== null && _value$ !== void 0 ? _value$ : '';
  });
  const allUnits = parsedQuantitiesAndUnits.map(value => value[1]);
  const value = allValues.every(v => v === allValues[0]) ? allValues[0] : '';
  const unit = mode(allUnits);
  const allValue = value === 0 || value ? `${value}${unit}` : undefined;
  return allValue;
}
/**
 * Checks to determine if values are mixed.
 *
 * @param {Object} values Radius values.
 * @return {boolean}      Whether values are mixed.
 */

function hasMixedValues() {
  let values = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  const allValue = getAllValue(values);
  const isMixed = typeof values === 'string' ? false : isNaN(parseFloat(allValue));
  return isMixed;
}
/**
 * Checks to determine if values are defined.
 *
 * @param {Object} values Radius values.
 * @return {boolean}      Whether values are mixed.
 */

function hasDefinedValues(values) {
  if (!values) {
    return false;
  } // A string value represents a shorthand value.


  if (typeof values === 'string') {
    return true;
  } // An object represents longhand border radius values, if any are set
  // flag values as being defined.


  const filteredValues = Object.values(values).filter(value => {
    return !!value || value === 0;
  });
  return !!filteredValues.length;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/border-radius-control/all-input-control.js



/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


function AllInputControl(_ref) {
  let {
    onChange,
    values,
    ...props
  } = _ref;
  const allValue = getAllValue(values);
  const hasValues = hasDefinedValues(values);
  const isMixed = hasValues && hasMixedValues(values);
  const allPlaceholder = isMixed ? (0,external_wp_i18n_namespaceObject.__)('Mixed') : null;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalUnitControl, _extends({}, props, {
    "aria-label": (0,external_wp_i18n_namespaceObject.__)('Border radius'),
    disableUnits: isMixed,
    isOnly: true,
    value: allValue,
    onChange: onChange,
    placeholder: allPlaceholder
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/border-radius-control/input-controls.js



/**
 * WordPress dependencies
 */


const CORNERS = {
  topLeft: (0,external_wp_i18n_namespaceObject.__)('Top left'),
  topRight: (0,external_wp_i18n_namespaceObject.__)('Top right'),
  bottomLeft: (0,external_wp_i18n_namespaceObject.__)('Bottom left'),
  bottomRight: (0,external_wp_i18n_namespaceObject.__)('Bottom right')
};
function BoxInputControls(_ref) {
  let {
    onChange,
    values: valuesProp,
    ...props
  } = _ref;

  const createHandleOnChange = corner => next => {
    if (!onChange) {
      return;
    }

    onChange({ ...values,
      [corner]: next ? next : undefined
    });
  }; // For shorthand style & backwards compatibility, handle flat string value.


  const values = typeof valuesProp !== 'string' ? valuesProp : {
    topLeft: valuesProp,
    topRight: valuesProp,
    bottomLeft: valuesProp,
    bottomRight: valuesProp
  }; // Controls are wrapped in tooltips as visible labels aren't desired here.

  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "components-border-radius-control__input-controls-wrapper"
  }, Object.entries(CORNERS).map(_ref2 => {
    let [key, label] = _ref2;
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalUnitControl, _extends({}, props, {
      key: key,
      "aria-label": label,
      value: values[key],
      onChange: createHandleOnChange(key)
    }));
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/link.js


/**
 * WordPress dependencies
 */

const link_link = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M15.6 7.2H14v1.5h1.6c2 0 3.7 1.7 3.7 3.7s-1.7 3.7-3.7 3.7H14v1.5h1.6c2.8 0 5.2-2.3 5.2-5.2 0-2.9-2.3-5.2-5.2-5.2zM4.7 12.4c0-2 1.7-3.7 3.7-3.7H10V7.2H8.4c-2.9 0-5.2 2.3-5.2 5.2 0 2.9 2.3 5.2 5.2 5.2H10v-1.5H8.4c-2 0-3.7-1.7-3.7-3.7zm4.6.9h5.3v-1.5H9.3v1.5z"
}));
/* harmony default export */ var library_link = (link_link);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/link-off.js


/**
 * WordPress dependencies
 */

const linkOff = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M15.6 7.3h-.7l1.6-3.5-.9-.4-3.9 8.5H9v1.5h2l-1.3 2.8H8.4c-2 0-3.7-1.7-3.7-3.7s1.7-3.7 3.7-3.7H10V7.3H8.4c-2.9 0-5.2 2.3-5.2 5.2 0 2.9 2.3 5.2 5.2 5.2H9l-1.4 3.2.9.4 5.7-12.5h1.4c2 0 3.7 1.7 3.7 3.7s-1.7 3.7-3.7 3.7H14v1.5h1.6c2.9 0 5.2-2.3 5.2-5.2 0-2.9-2.4-5.2-5.2-5.2z"
}));
/* harmony default export */ var link_off = (linkOff);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/border-radius-control/linked-button.js



/**
 * WordPress dependencies
 */



function LinkedButton(_ref) {
  let {
    isLinked,
    ...props
  } = _ref;
  const label = isLinked ? (0,external_wp_i18n_namespaceObject.__)('Unlink Radii') : (0,external_wp_i18n_namespaceObject.__)('Link Radii');
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Tooltip, {
    text: label
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, _extends({}, props, {
    className: "component-border-radius-control__linked-button",
    isPrimary: isLinked,
    isSecondary: !isLinked,
    isSmall: true,
    icon: isLinked ? library_link : link_off,
    iconSize: 16,
    "aria-label": label
  })));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/border-radius-control/index.js


/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */






const DEFAULT_VALUES = {
  topLeft: null,
  topRight: null,
  bottomLeft: null,
  bottomRight: null
};
const MIN_BORDER_RADIUS_VALUE = 0;
const MAX_BORDER_RADIUS_VALUES = {
  px: 100,
  em: 20,
  rem: 20
};
/**
 * Control to display border radius options.
 *
 * @param {Object}   props          Component props.
 * @param {Function} props.onChange Callback to handle onChange.
 * @param {Object}   props.values   Border radius values.
 *
 * @return {WPElement}              Custom border radius control.
 */

function BorderRadiusControl(_ref) {
  let {
    onChange,
    values
  } = _ref;
  const [isLinked, setIsLinked] = (0,external_wp_element_namespaceObject.useState)(!hasDefinedValues(values) || !hasMixedValues(values));
  const units = (0,external_wp_components_namespaceObject.__experimentalUseCustomUnits)({
    availableUnits: useSetting('spacing.units') || ['px', 'em', 'rem']
  });
  const unit = getAllUnit(values);
  const unitConfig = units && units.find(item => item.value === unit);
  const step = (unitConfig === null || unitConfig === void 0 ? void 0 : unitConfig.step) || 1;
  const [allValue] = (0,external_wp_components_namespaceObject.__experimentalParseQuantityAndUnitFromRawValue)(getAllValue(values));

  const toggleLinked = () => setIsLinked(!isLinked);

  const handleSliderChange = next => {
    onChange(next !== undefined ? `${next}${unit}` : undefined);
  };

  return (0,external_wp_element_namespaceObject.createElement)("fieldset", {
    className: "components-border-radius-control"
  }, (0,external_wp_element_namespaceObject.createElement)("legend", null, (0,external_wp_i18n_namespaceObject.__)('Radius')), (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "components-border-radius-control__wrapper"
  }, isLinked ? (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(AllInputControl, {
    className: "components-border-radius-control__unit-control",
    values: values,
    min: MIN_BORDER_RADIUS_VALUE,
    onChange: onChange,
    units: units
  }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.RangeControl, {
    className: "components-border-radius-control__range-control",
    value: allValue !== null && allValue !== void 0 ? allValue : '',
    min: MIN_BORDER_RADIUS_VALUE,
    max: MAX_BORDER_RADIUS_VALUES[unit],
    initialPosition: 0,
    withInputField: false,
    onChange: handleSliderChange,
    step: step
  })) : (0,external_wp_element_namespaceObject.createElement)(BoxInputControls, {
    min: MIN_BORDER_RADIUS_VALUE,
    onChange: onChange,
    values: values || DEFAULT_VALUES,
    units: units
  }), (0,external_wp_element_namespaceObject.createElement)(LinkedButton, {
    onClick: toggleLinked,
    isLinked: isLinked
  })));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/border-radius.js


/**
 * Internal dependencies
 */



/**
 * Inspector control panel containing the border radius related configuration.
 *
 * @param {Object} props Block properties.
 *
 * @return {WPElement} Border radius edit element.
 */

function BorderRadiusEdit(props) {
  var _style$border;

  const {
    attributes: {
      style
    },
    setAttributes
  } = props;

  const onChange = newRadius => {
    let newStyle = { ...style,
      border: { ...(style === null || style === void 0 ? void 0 : style.border),
        radius: newRadius
      }
    };

    if (newRadius === undefined || newRadius === '') {
      newStyle = cleanEmptyObject(newStyle);
    }

    setAttributes({
      style: newStyle
    });
  };

  return (0,external_wp_element_namespaceObject.createElement)(BorderRadiusControl, {
    values: style === null || style === void 0 ? void 0 : (_style$border = style.border) === null || _style$border === void 0 ? void 0 : _style$border.radius,
    onChange: onChange
  });
}
/**
 * Checks if there is a current value in the border radius block support
 * attributes.
 *
 * @param {Object} props Block props.
 * @return {boolean}     Whether or not the block has a border radius value set.
 */

function hasBorderRadiusValue(props) {
  var _props$attributes$sty, _props$attributes$sty2;

  const borderRadius = (_props$attributes$sty = props.attributes.style) === null || _props$attributes$sty === void 0 ? void 0 : (_props$attributes$sty2 = _props$attributes$sty.border) === null || _props$attributes$sty2 === void 0 ? void 0 : _props$attributes$sty2.radius;

  if (typeof borderRadius === 'object') {
    return Object.entries(borderRadius).some(Boolean);
  }

  return !!borderRadius;
}
/**
 * Resets the border radius block support attributes. This can be used when
 * disabling the border radius support controls for a block via a progressive
 * discovery panel.
 *
 * @param {Object} props               Block props.
 * @param {Object} props.attributes    Block's attributes.
 * @param {Object} props.setAttributes Function to set block's attributes.
 */

function resetBorderRadius(_ref) {
  let {
    attributes = {},
    setAttributes
  } = _ref;
  const {
    style
  } = attributes;
  setAttributes({
    style: removeBorderAttribute(style, 'radius')
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/line-solid.js


/**
 * WordPress dependencies
 */

const lineSolid = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  width: "24",
  height: "24",
  fill: "none"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M5 11.25h14v1.5H5z"
}));
/* harmony default export */ var line_solid = (lineSolid);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/line-dashed.js


/**
 * WordPress dependencies
 */

const lineDashed = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  width: "24",
  height: "24",
  fill: "none"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  fillRule: "evenodd",
  d: "M5 11.25h3v1.5H5v-1.5zm5.5 0h3v1.5h-3v-1.5zm8.5 0h-3v1.5h3v-1.5z",
  clipRule: "evenodd"
}));
/* harmony default export */ var line_dashed = (lineDashed);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/line-dotted.js


/**
 * WordPress dependencies
 */

const lineDotted = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  width: "24",
  height: "24",
  fill: "none"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  fillRule: "evenodd",
  d: "M5.25 11.25h1.5v1.5h-1.5v-1.5zm3 0h1.5v1.5h-1.5v-1.5zm4.5 0h-1.5v1.5h1.5v-1.5zm1.5 0h1.5v1.5h-1.5v-1.5zm4.5 0h-1.5v1.5h1.5v-1.5z",
  clipRule: "evenodd"
}));
/* harmony default export */ var line_dotted = (lineDotted);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/border-style-control/index.js


/**
 * WordPress dependencies
 */



const BORDER_STYLES = [{
  label: (0,external_wp_i18n_namespaceObject.__)('Solid'),
  icon: line_solid,
  value: 'solid'
}, {
  label: (0,external_wp_i18n_namespaceObject.__)('Dashed'),
  icon: line_dashed,
  value: 'dashed'
}, {
  label: (0,external_wp_i18n_namespaceObject.__)('Dotted'),
  icon: line_dotted,
  value: 'dotted'
}];
/**
 * Control to display border style options.
 *
 * @param {Object}   props          Component props.
 * @param {Function} props.onChange Handler for changing border style selection.
 * @param {string}   props.value    Currently selected border style value.
 *
 * @return {WPElement} Custom border style segmented control.
 */

function BorderStyleControl(_ref) {
  let {
    onChange,
    value
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)("fieldset", {
    className: "components-border-style-control"
  }, (0,external_wp_element_namespaceObject.createElement)("legend", null, (0,external_wp_i18n_namespaceObject.__)('Style')), (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "components-border-style-control__buttons"
  }, BORDER_STYLES.map(borderStyle => (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    key: borderStyle.value,
    icon: borderStyle.icon,
    isSmall: true,
    isPressed: borderStyle.value === value,
    onClick: () => onChange(borderStyle.value === value ? undefined : borderStyle.value),
    "aria-label": borderStyle.label
  }))));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/border-style.js


/**
 * Internal dependencies
 */



/**
 * Inspector control for configuring border style property.
 *
 * @param {Object} props Block properties.
 *
 * @return {WPElement} Border style edit element.
 */

const BorderStyleEdit = props => {
  var _style$border;

  const {
    attributes: {
      style
    },
    setAttributes
  } = props;

  const onChange = newBorderStyle => {
    const newStyleAttributes = { ...style,
      border: { ...(style === null || style === void 0 ? void 0 : style.border),
        style: newBorderStyle
      }
    };
    setAttributes({
      style: cleanEmptyObject(newStyleAttributes)
    });
  };

  return (0,external_wp_element_namespaceObject.createElement)(BorderStyleControl, {
    value: style === null || style === void 0 ? void 0 : (_style$border = style.border) === null || _style$border === void 0 ? void 0 : _style$border.style,
    onChange: onChange
  });
};
/**
 * Checks if there is a current value in the border style block support
 * attributes.
 *
 * @param {Object} props Block props.
 * @return {boolean}     Whether or not the block has a border style value set.
 */

function hasBorderStyleValue(props) {
  var _props$attributes$sty, _props$attributes$sty2;

  return !!((_props$attributes$sty = props.attributes.style) !== null && _props$attributes$sty !== void 0 && (_props$attributes$sty2 = _props$attributes$sty.border) !== null && _props$attributes$sty2 !== void 0 && _props$attributes$sty2.style);
}
/**
 * Resets the border style block support attribute. This can be used when
 * disabling the border style support control for a block via a progressive
 * discovery panel.
 *
 * @param {Object} props               Block props.
 * @param {Object} props.attributes    Block's attributes.
 * @param {Object} props.setAttributes Function to set block's attributes.
 */

function resetBorderStyle(_ref) {
  let {
    attributes = {},
    setAttributes
  } = _ref;
  const {
    style
  } = attributes;
  setAttributes({
    style: removeBorderAttribute(style, 'style')
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/border-width.js


/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */




const MIN_BORDER_WIDTH = 0;
/**
 * Inspector control for configuring border width property.
 *
 * @param {Object} props Block properties.
 *
 * @return {WPElement} Border width edit element.
 */

const BorderWidthEdit = props => {
  const {
    attributes: {
      borderColor,
      style
    },
    setAttributes
  } = props;
  const {
    width,
    color: customBorderColor,
    style: borderStyle
  } = (style === null || style === void 0 ? void 0 : style.border) || {}; // Used to temporarily track previous border color & style selections to be
  // able to restore them when border width changes from zero value.

  const [styleSelection, setStyleSelection] = (0,external_wp_element_namespaceObject.useState)();
  const [colorSelection, setColorSelection] = (0,external_wp_element_namespaceObject.useState)();
  const [customColorSelection, setCustomColorSelection] = (0,external_wp_element_namespaceObject.useState)();

  const onChange = newWidth => {
    let newStyle = { ...style,
      border: { ...(style === null || style === void 0 ? void 0 : style.border),
        width: newWidth
      }
    }; // Used to clear named border color attribute.

    let borderPaletteColor = borderColor;
    const hasZeroWidth = parseFloat(newWidth) === 0;
    const hadPreviousZeroWidth = parseFloat(width) === 0; // Setting the border width explicitly to zero will also set the
    // border style to `none` and clear border color attributes.

    if (hasZeroWidth && !hadPreviousZeroWidth) {
      // Before clearing color and style selections, keep track of
      // the current selections so they can be restored when the width
      // changes to a non-zero value.
      setColorSelection(borderColor);
      setCustomColorSelection(customBorderColor);
      setStyleSelection(borderStyle); // Clear style and color attributes.

      borderPaletteColor = undefined;
      newStyle.border.color = undefined;
      newStyle.border.style = 'none';
    }

    if (!hasZeroWidth && hadPreviousZeroWidth) {
      // Restore previous border style selection if width is now not zero and
      // border style was 'none'. This is to support changes to the UI which
      // change the border style UI to a segmented control without a "none"
      // option.
      if (borderStyle === 'none') {
        newStyle.border.style = styleSelection;
      } // Restore previous border color selection if width is no longer zero
      // and current border color is undefined.


      if (borderColor === undefined) {
        borderPaletteColor = colorSelection;
        newStyle.border.color = customColorSelection;
      }
    } // If width was reset, clean out undefined styles.


    if (newWidth === undefined || newWidth === '') {
      newStyle = cleanEmptyObject(newStyle);
    }

    setAttributes({
      borderColor: borderPaletteColor,
      style: newStyle
    });
  };

  const units = (0,external_wp_components_namespaceObject.__experimentalUseCustomUnits)({
    availableUnits: useSetting('spacing.units') || ['px', 'em', 'rem']
  });
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalUnitControl, {
    value: width,
    label: (0,external_wp_i18n_namespaceObject.__)('Width'),
    min: MIN_BORDER_WIDTH,
    onChange: onChange,
    units: units
  });
};
/**
 * Checks if there is a current value in the border width block support
 * attributes.
 *
 * @param {Object} props Block props.
 * @return {boolean}     Whether or not the block has a border width value set.
 */

function hasBorderWidthValue(props) {
  var _props$attributes$sty, _props$attributes$sty2;

  return !!((_props$attributes$sty = props.attributes.style) !== null && _props$attributes$sty !== void 0 && (_props$attributes$sty2 = _props$attributes$sty.border) !== null && _props$attributes$sty2 !== void 0 && _props$attributes$sty2.width);
}
/**
 * Resets the border width block support attribute. This can be used when
 * disabling the border width support control for a block via a progressive
 * discovery panel.
 *
 * @param {Object} props               Block props.
 * @param {Object} props.attributes    Block's attributes.
 * @param {Object} props.setAttributes Function to set block's attributes.
 */

function resetBorderWidth(_ref) {
  let {
    attributes = {},
    setAttributes
  } = _ref;
  const {
    style
  } = attributes;
  setAttributes({
    style: removeBorderAttribute(style, 'width')
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/border.js


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */








const BORDER_SUPPORT_KEY = '__experimentalBorder';
function BorderPanel(props) {
  const {
    clientId
  } = props;
  const isColorSupported = useSetting('border.color') && hasBorderSupport(props.name, 'color');
  const isRadiusSupported = useSetting('border.radius') && hasBorderSupport(props.name, 'radius');
  const isStyleSupported = useSetting('border.style') && hasBorderSupport(props.name, 'style');
  const isWidthSupported = useSetting('border.width') && hasBorderSupport(props.name, 'width');
  const isDisabled = [!isColorSupported, !isRadiusSupported, !isStyleSupported, !isWidthSupported].every(Boolean);

  if (isDisabled) {
    return null;
  }

  const defaultBorderControls = (0,external_wp_blocks_namespaceObject.getBlockSupport)(props.name, [BORDER_SUPPORT_KEY, '__experimentalDefaultControls']);

  const createResetAllFilter = function (borderAttribute) {
    let topLevelAttributes = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
    return newAttributes => {
      var _newAttributes$style;

      return { ...newAttributes,
        ...topLevelAttributes,
        style: { ...newAttributes.style,
          border: { ...((_newAttributes$style = newAttributes.style) === null || _newAttributes$style === void 0 ? void 0 : _newAttributes$style.border),
            [borderAttribute]: undefined
          }
        }
      };
    };
  };

  return (0,external_wp_element_namespaceObject.createElement)(inspector_controls, {
    __experimentalGroup: "border"
  }, isWidthSupported && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToolsPanelItem, {
    className: "single-column",
    hasValue: () => hasBorderWidthValue(props),
    label: (0,external_wp_i18n_namespaceObject.__)('Width'),
    onDeselect: () => resetBorderWidth(props),
    isShownByDefault: defaultBorderControls === null || defaultBorderControls === void 0 ? void 0 : defaultBorderControls.width,
    resetAllFilter: createResetAllFilter('width'),
    panelId: clientId
  }, (0,external_wp_element_namespaceObject.createElement)(BorderWidthEdit, props)), isStyleSupported && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToolsPanelItem, {
    className: "single-column",
    hasValue: () => hasBorderStyleValue(props),
    label: (0,external_wp_i18n_namespaceObject.__)('Style'),
    onDeselect: () => resetBorderStyle(props),
    isShownByDefault: defaultBorderControls === null || defaultBorderControls === void 0 ? void 0 : defaultBorderControls.style,
    resetAllFilter: createResetAllFilter('style'),
    panelId: clientId
  }, (0,external_wp_element_namespaceObject.createElement)(BorderStyleEdit, props)), isColorSupported && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToolsPanelItem, {
    hasValue: () => hasBorderColorValue(props),
    label: (0,external_wp_i18n_namespaceObject.__)('Color'),
    onDeselect: () => resetBorderColor(props),
    isShownByDefault: defaultBorderControls === null || defaultBorderControls === void 0 ? void 0 : defaultBorderControls.color,
    resetAllFilter: createResetAllFilter('color', {
      borderColor: undefined
    }),
    panelId: clientId
  }, (0,external_wp_element_namespaceObject.createElement)(BorderColorEdit, props)), isRadiusSupported && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToolsPanelItem, {
    hasValue: () => hasBorderRadiusValue(props),
    label: (0,external_wp_i18n_namespaceObject.__)('Radius'),
    onDeselect: () => resetBorderRadius(props),
    isShownByDefault: defaultBorderControls === null || defaultBorderControls === void 0 ? void 0 : defaultBorderControls.radius,
    resetAllFilter: createResetAllFilter('radius'),
    panelId: clientId
  }, (0,external_wp_element_namespaceObject.createElement)(BorderRadiusEdit, props)));
}
/**
 * Determine whether there is block support for border properties.
 *
 * @param {string} blockName Block name.
 * @param {string} feature   Border feature to check support for.
 *
 * @return {boolean} Whether there is support.
 */

function hasBorderSupport(blockName) {
  let feature = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'any';

  if (external_wp_element_namespaceObject.Platform.OS !== 'web') {
    return false;
  }

  const support = (0,external_wp_blocks_namespaceObject.getBlockSupport)(blockName, BORDER_SUPPORT_KEY);

  if (support === true) {
    return true;
  }

  if (feature === 'any') {
    return !!(support !== null && support !== void 0 && support.color || support !== null && support !== void 0 && support.radius || support !== null && support !== void 0 && support.width || support !== null && support !== void 0 && support.style);
  }

  return !!(support !== null && support !== void 0 && support[feature]);
}
/**
 * Returns a new style object where the specified border attribute has been
 * removed.
 *
 * @param {Object} style     Styles from block attributes.
 * @param {string} attribute The border style attribute to clear.
 *
 * @return {Object} Style object with the specified attribute removed.
 */

function removeBorderAttribute(style, attribute) {
  return cleanEmptyObject({ ...style,
    border: { ...(style === null || style === void 0 ? void 0 : style.border),
      [attribute]: undefined
    }
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/gradients/use-gradient.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */




function __experimentalGetGradientClass(gradientSlug) {
  if (!gradientSlug) {
    return undefined;
  }

  return `has-${gradientSlug}-gradient-background`;
}
/**
 * Retrieves the gradient value per slug.
 *
 * @param {Array}  gradients Gradient Palette
 * @param {string} slug      Gradient slug
 *
 * @return {string} Gradient value.
 */

function getGradientValueBySlug(gradients, slug) {
  const gradient = (0,external_lodash_namespaceObject.find)(gradients, ['slug', slug]);
  return gradient && gradient.gradient;
}
function __experimentalGetGradientObjectByGradientValue(gradients, value) {
  const gradient = (0,external_lodash_namespaceObject.find)(gradients, ['gradient', value]);
  return gradient;
}
/**
 * Retrieves the gradient slug per slug.
 *
 * @param {Array}  gradients Gradient Palette
 * @param {string} value     Gradient value
 * @return {string} Gradient slug.
 */

function getGradientSlugByValue(gradients, value) {
  const gradient = __experimentalGetGradientObjectByGradientValue(gradients, value);

  return gradient && gradient.slug;
}
function __experimentalUseGradient() {
  let {
    gradientAttribute = 'gradient',
    customGradientAttribute = 'customGradient'
  } = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  const {
    clientId
  } = useBlockEditContext();
  const userGradientPalette = useSetting('color.gradients.custom');
  const themeGradientPalette = useSetting('color.gradients.theme');
  const defaultGradientPalette = useSetting('color.gradients.default');
  const allGradients = (0,external_wp_element_namespaceObject.useMemo)(() => [...(userGradientPalette || []), ...(themeGradientPalette || []), ...(defaultGradientPalette || [])], [userGradientPalette, themeGradientPalette, defaultGradientPalette]);
  const {
    gradient,
    customGradient
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getBlockAttributes
    } = select(store);
    const attributes = getBlockAttributes(clientId) || {};
    return {
      customGradient: attributes[customGradientAttribute],
      gradient: attributes[gradientAttribute]
    };
  }, [clientId, gradientAttribute, customGradientAttribute]);
  const {
    updateBlockAttributes
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const setGradient = (0,external_wp_element_namespaceObject.useCallback)(newGradientValue => {
    const slug = getGradientSlugByValue(allGradients, newGradientValue);

    if (slug) {
      updateBlockAttributes(clientId, {
        [gradientAttribute]: slug,
        [customGradientAttribute]: undefined
      });
      return;
    }

    updateBlockAttributes(clientId, {
      [gradientAttribute]: undefined,
      [customGradientAttribute]: newGradientValue
    });
  }, [allGradients, clientId, updateBlockAttributes]);

  const gradientClass = __experimentalGetGradientClass(gradient);

  let gradientValue;

  if (gradient) {
    gradientValue = getGradientValueBySlug(allGradients, gradient);
  } else {
    gradientValue = customGradient;
  }

  return {
    gradientClass,
    gradientValue,
    setGradient
  };
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/contrast-checker/index.js


/**
 * External dependencies
 */



/**
 * WordPress dependencies
 */




k([names, a11y]);

function ContrastChecker(_ref) {
  let {
    backgroundColor,
    fallbackBackgroundColor,
    fallbackTextColor,
    fallbackLinkColor,
    fontSize,
    // Font size value in pixels.
    isLargeText,
    textColor,
    linkColor,
    enableAlphaChecker = false
  } = _ref;
  const currentBackgroundColor = backgroundColor || fallbackBackgroundColor; // Must have a background color.

  if (!currentBackgroundColor) {
    return null;
  }

  const currentTextColor = textColor || fallbackTextColor;
  const currentLinkColor = linkColor || fallbackLinkColor; // Must have at least one text color.

  if (!currentTextColor && !currentLinkColor) {
    return null;
  }

  const textColors = [{
    color: currentTextColor,
    description: (0,external_wp_i18n_namespaceObject.__)('text color')
  }, {
    color: currentLinkColor,
    description: (0,external_wp_i18n_namespaceObject.__)('link color')
  }];
  const colordBackgroundColor = w(currentBackgroundColor);
  const backgroundColorHasTransparency = colordBackgroundColor.alpha() < 1;
  const backgroundColorBrightness = colordBackgroundColor.brightness();
  const isReadableOptions = {
    level: 'AA',
    size: isLargeText || isLargeText !== false && fontSize >= 24 ? 'large' : 'small'
  };
  let message = '';
  let speakMessage = '';

  for (const item of textColors) {
    // If there is no color, go no further.
    if (!item.color) {
      continue;
    }

    const colordTextColor = w(item.color);
    const isColordTextReadable = colordTextColor.isReadable(colordBackgroundColor, isReadableOptions);
    const textHasTransparency = colordTextColor.alpha() < 1; // If the contrast is not readable.

    if (!isColordTextReadable) {
      // Don't show the message if the background or text is transparent.
      if (backgroundColorHasTransparency || textHasTransparency) {
        continue;
      }

      message = backgroundColorBrightness < colordTextColor.brightness() ? (0,external_wp_i18n_namespaceObject.sprintf)( // translators: %s is a type of text color, e.g., "text color" or "link color".
      (0,external_wp_i18n_namespaceObject.__)('This color combination may be hard for people to read. Try using a darker background color and/or a brighter %s.'), item.description) : (0,external_wp_i18n_namespaceObject.sprintf)( // translators: %s is a type of text color, e.g., "text color" or "link color".
      (0,external_wp_i18n_namespaceObject.__)('This color combination may be hard for people to read. Try using a brighter background color and/or a darker %s.'), item.description);
      speakMessage = (0,external_wp_i18n_namespaceObject.__)('This color combination may be hard for people to read.'); // Break from the loop when we have a contrast warning.
      // These messages take priority over the transparency warning.

      break;
    } // If there is no contrast warning and the text is transparent,
    // show the transparent warning if alpha check is enabled.


    if (textHasTransparency && enableAlphaChecker) {
      message = (0,external_wp_i18n_namespaceObject.__)('Transparent text may be hard for people to read.');
      speakMessage = (0,external_wp_i18n_namespaceObject.__)('Transparent text may be hard for people to read.');
    }
  }

  if (!message) {
    return null;
  } // Note: The `Notice` component can speak messages via its `spokenMessage`
  // prop, but the contrast checker requires granular control over when the
  // announcements are made. Notably, the message will be re-announced if a
  // new color combination is selected and the contrast is still insufficient.


  (0,external_wp_a11y_namespaceObject.speak)(speakMessage);
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-contrast-checker"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Notice, {
    spokenMessage: null,
    status: "warning",
    isDismissible: false
  }, message));
}
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/contrast-checker/README.md
 */


/* harmony default export */ var contrast_checker = (ContrastChecker);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/colors-gradients/tools-panel-color-dropdown.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */



function ToolsPanelColorDropdown(_ref) {
  var _settings$gradientVal;

  let {
    settings,
    enableAlpha,
    ...otherProps
  } = _ref;
  const colorGradientSettings = useMultipleOriginColorsAndGradients();
  const controlSettings = { ...colorGradientSettings,
    clearable: false,
    enableAlpha,
    label: settings.label,
    onColorChange: settings.onColorChange,
    onGradientChange: settings.onGradientChange,
    colorValue: settings.colorValue,
    gradientValue: settings.gradientValue
  };
  const selectedColor = (_settings$gradientVal = settings.gradientValue) !== null && _settings$gradientVal !== void 0 ? _settings$gradientVal : settings.colorValue;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToolsPanelItem, _extends({
    hasValue: settings.hasValue,
    label: settings.label,
    onDeselect: settings.onDeselect,
    isShownByDefault: settings.isShownByDefault,
    resetAllFilter: settings.resetAllFilter
  }, otherProps, {
    className: "block-editor-tools-panel-color-gradient-settings__item"
  }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Dropdown, {
    className: "block-editor-tools-panel-color-dropdown",
    contentClassName: "block-editor-panel-color-gradient-settings__dropdown-content",
    renderToggle: _ref2 => {
      let {
        isOpen,
        onToggle
      } = _ref2;
      return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
        onClick: onToggle,
        "aria-expanded": isOpen,
        className: classnames_default()('block-editor-panel-color-gradient-settings__dropdown', {
          'is-open': isOpen
        })
      }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalHStack, {
        justify: "flex-start"
      }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ColorIndicator, {
        className: "block-editor-panel-color-gradient-settings__color-indicator",
        colorValue: selectedColor
      }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.FlexItem, null, settings.label)));
    },
    renderContent: () => (0,external_wp_element_namespaceObject.createElement)(control, _extends({
      showTitle: false,
      __experimentalHasMultipleOrigins: true,
      __experimentalIsRenderedInSidebar: true,
      enableAlpha: true
    }, controlSettings))
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/color-panel.js


/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */






function getComputedStyle(node) {
  return node.ownerDocument.defaultView.getComputedStyle(node);
}

function ColorPanel(_ref) {
  let {
    enableAlpha = false,
    settings,
    clientId,
    enableContrastChecking = true
  } = _ref;
  const [detectedBackgroundColor, setDetectedBackgroundColor] = (0,external_wp_element_namespaceObject.useState)();
  const [detectedColor, setDetectedColor] = (0,external_wp_element_namespaceObject.useState)();
  const [detectedLinkColor, setDetectedLinkColor] = (0,external_wp_element_namespaceObject.useState)();
  const ref = useBlockRef(clientId);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    var _ref$current;

    if (!enableContrastChecking) {
      return;
    }

    if (!ref.current) {
      return;
    }

    setDetectedColor(getComputedStyle(ref.current).color);
    const firstLinkElement = (_ref$current = ref.current) === null || _ref$current === void 0 ? void 0 : _ref$current.querySelector('a');

    if (firstLinkElement && !!firstLinkElement.innerText) {
      setDetectedLinkColor(getComputedStyle(firstLinkElement).color);
    }

    let backgroundColorNode = ref.current;
    let backgroundColor = getComputedStyle(backgroundColorNode).backgroundColor;

    while (backgroundColor === 'rgba(0, 0, 0, 0)' && backgroundColorNode.parentNode && backgroundColorNode.parentNode.nodeType === backgroundColorNode.parentNode.ELEMENT_NODE) {
      backgroundColorNode = backgroundColorNode.parentNode;
      backgroundColor = getComputedStyle(backgroundColorNode).backgroundColor;
    }

    setDetectedBackgroundColor(backgroundColor);
  });
  return (0,external_wp_element_namespaceObject.createElement)(inspector_controls, {
    __experimentalGroup: "color"
  }, settings.map((setting, index) => (0,external_wp_element_namespaceObject.createElement)(ToolsPanelColorDropdown, {
    key: index,
    settings: setting,
    panelId: clientId,
    enableAlpha: enableAlpha
  })), enableContrastChecking && (0,external_wp_element_namespaceObject.createElement)(contrast_checker, {
    backgroundColor: detectedBackgroundColor,
    textColor: detectedColor,
    enableAlphaChecker: enableAlpha,
    linkColor: detectedLinkColor
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/color.js



/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */






const COLOR_SUPPORT_KEY = 'color';

const hasColorSupport = blockType => {
  const colorSupport = (0,external_wp_blocks_namespaceObject.getBlockSupport)(blockType, COLOR_SUPPORT_KEY);
  return colorSupport && (colorSupport.link === true || colorSupport.gradient === true || colorSupport.background !== false || colorSupport.text !== false);
};

const hasLinkColorSupport = blockType => {
  if (external_wp_element_namespaceObject.Platform.OS !== 'web') {
    return false;
  }

  const colorSupport = (0,external_wp_blocks_namespaceObject.getBlockSupport)(blockType, COLOR_SUPPORT_KEY);
  return (0,external_lodash_namespaceObject.isObject)(colorSupport) && !!colorSupport.link;
};

const hasGradientSupport = blockType => {
  const colorSupport = (0,external_wp_blocks_namespaceObject.getBlockSupport)(blockType, COLOR_SUPPORT_KEY);
  return (0,external_lodash_namespaceObject.isObject)(colorSupport) && !!colorSupport.gradients;
};

const hasBackgroundColorSupport = blockType => {
  const colorSupport = (0,external_wp_blocks_namespaceObject.getBlockSupport)(blockType, COLOR_SUPPORT_KEY);
  return colorSupport && colorSupport.background !== false;
};

const hasTextColorSupport = blockType => {
  const colorSupport = (0,external_wp_blocks_namespaceObject.getBlockSupport)(blockType, COLOR_SUPPORT_KEY);
  return colorSupport && colorSupport.text !== false;
};
/**
 * Checks whether a color has been set either with a named preset color in
 * a top level block attribute or as a custom value within the style attribute
 * object.
 *
 * @param {string} name Name of the color to check.
 * @return {boolean} Whether or not a color has a value.
 */


const hasColor = name => props => {
  var _props$attributes$sty9, _props$attributes$sty10;

  if (name === 'background') {
    var _props$attributes$sty, _props$attributes$sty2, _props$attributes$sty3, _props$attributes$sty4;

    return !!props.attributes.backgroundColor || !!((_props$attributes$sty = props.attributes.style) !== null && _props$attributes$sty !== void 0 && (_props$attributes$sty2 = _props$attributes$sty.color) !== null && _props$attributes$sty2 !== void 0 && _props$attributes$sty2.background) || !!props.attributes.gradient || !!((_props$attributes$sty3 = props.attributes.style) !== null && _props$attributes$sty3 !== void 0 && (_props$attributes$sty4 = _props$attributes$sty3.color) !== null && _props$attributes$sty4 !== void 0 && _props$attributes$sty4.gradient);
  }

  if (name === 'link') {
    var _props$attributes$sty5, _props$attributes$sty6, _props$attributes$sty7, _props$attributes$sty8;

    return !!((_props$attributes$sty5 = props.attributes.style) !== null && _props$attributes$sty5 !== void 0 && (_props$attributes$sty6 = _props$attributes$sty5.elements) !== null && _props$attributes$sty6 !== void 0 && (_props$attributes$sty7 = _props$attributes$sty6.link) !== null && _props$attributes$sty7 !== void 0 && (_props$attributes$sty8 = _props$attributes$sty7.color) !== null && _props$attributes$sty8 !== void 0 && _props$attributes$sty8.text);
  }

  return !!props.attributes[`${name}Color`] || !!((_props$attributes$sty9 = props.attributes.style) !== null && _props$attributes$sty9 !== void 0 && (_props$attributes$sty10 = _props$attributes$sty9.color) !== null && _props$attributes$sty10 !== void 0 && _props$attributes$sty10[name]);
};
/**
 * Clears a single color property from a style object.
 *
 * @param {Array}  path  Path to color property to clear within styles object.
 * @param {Object} style Block attributes style object.
 * @return {Object} Styles with the color property omitted.
 */


const clearColorFromStyles = (path, style) => cleanEmptyObject(immutableSet(style, path, undefined));
/**
 * Resets the block attributes for text color.
 *
 * @param {Object}   props               Current block props.
 * @param {Object}   props.attributes    Block attributes.
 * @param {Function} props.setAttributes Block's setAttributes prop used to apply reset.
 */


const resetTextColor = _ref => {
  let {
    attributes,
    setAttributes
  } = _ref;
  setAttributes({
    textColor: undefined,
    style: clearColorFromStyles(['color', 'text'], attributes.style)
  });
};
/**
 * Clears text color related properties from supplied attributes.
 *
 * @param {Object} attributes Block attributes.
 * @return {Object} Update block attributes with text color properties omitted.
 */


const resetAllTextFilter = attributes => ({
  textColor: undefined,
  style: clearColorFromStyles(['color', 'text'], attributes.style)
});
/**
 * Resets the block attributes for link color.
 *
 * @param {Object}   props               Current block props.
 * @param {Object}   props.attributes    Block attributes.
 * @param {Function} props.setAttributes Block's setAttributes prop used to apply reset.
 */


const resetLinkColor = _ref2 => {
  let {
    attributes,
    setAttributes
  } = _ref2;
  const path = ['elements', 'link', 'color', 'text'];
  setAttributes({
    style: clearColorFromStyles(path, attributes.style)
  });
};
/**
 * Clears link color related properties from supplied attributes.
 *
 * @param {Object} attributes Block attributes.
 * @return {Object} Update block attributes with link color properties omitted.
 */


const resetAllLinkFilter = attributes => ({
  style: clearColorFromStyles(['elements', 'link', 'color', 'text'], attributes.style)
});
/**
 * Clears all background color related properties including gradients from
 * supplied block attributes.
 *
 * @param {Object} attributes Block attributes.
 * @return {Object} Block attributes with background and gradient omitted.
 */


const clearBackgroundAndGradient = attributes => {
  var _attributes$style;

  return {
    backgroundColor: undefined,
    gradient: undefined,
    style: { ...attributes.style,
      color: { ...((_attributes$style = attributes.style) === null || _attributes$style === void 0 ? void 0 : _attributes$style.color),
        background: undefined,
        gradient: undefined
      }
    }
  };
};
/**
 * Resets the block attributes for both background color and gradient.
 *
 * @param {Object}   props               Current block props.
 * @param {Object}   props.attributes    Block attributes.
 * @param {Function} props.setAttributes Block's setAttributes prop used to apply reset.
 */


const resetBackgroundAndGradient = _ref3 => {
  let {
    attributes,
    setAttributes
  } = _ref3;
  setAttributes(clearBackgroundAndGradient(attributes));
};
/**
 * Filters registered block settings, extending attributes to include
 * `backgroundColor` and `textColor` attribute.
 *
 * @param {Object} settings Original block settings.
 *
 * @return {Object} Filtered block settings.
 */


function color_addAttributes(settings) {
  if (!hasColorSupport(settings)) {
    return settings;
  } // Allow blocks to specify their own attribute definition with default values if needed.


  if (!settings.attributes.backgroundColor) {
    Object.assign(settings.attributes, {
      backgroundColor: {
        type: 'string'
      }
    });
  }

  if (!settings.attributes.textColor) {
    Object.assign(settings.attributes, {
      textColor: {
        type: 'string'
      }
    });
  }

  if (hasGradientSupport(settings) && !settings.attributes.gradient) {
    Object.assign(settings.attributes, {
      gradient: {
        type: 'string'
      }
    });
  }

  return settings;
}
/**
 * Override props assigned to save component to inject colors classnames.
 *
 * @param {Object} props      Additional props applied to save element.
 * @param {Object} blockType  Block type.
 * @param {Object} attributes Block attributes.
 *
 * @return {Object} Filtered props applied to save element.
 */


function color_addSaveProps(props, blockType, attributes) {
  var _style$color, _style$color2, _style$color3, _style$color4, _style$elements, _style$elements$link;

  if (!hasColorSupport(blockType) || shouldSkipSerialization(blockType, COLOR_SUPPORT_KEY)) {
    return props;
  }

  const hasGradient = hasGradientSupport(blockType); // I'd have preferred to avoid the "style" attribute usage here

  const {
    backgroundColor,
    textColor,
    gradient,
    style
  } = attributes;

  const shouldSerialize = feature => !shouldSkipSerialization(blockType, COLOR_SUPPORT_KEY, feature); // Primary color classes must come before the `has-text-color`,
  // `has-background` and `has-link-color` classes to maintain backwards
  // compatibility and avoid block invalidations.


  const textClass = shouldSerialize('text') ? getColorClassName('color', textColor) : undefined;
  const gradientClass = shouldSerialize('gradients') ? __experimentalGetGradientClass(gradient) : undefined;
  const backgroundClass = shouldSerialize('background') ? getColorClassName('background-color', backgroundColor) : undefined;
  const serializeHasBackground = shouldSerialize('background') || shouldSerialize('gradients');
  const hasBackground = backgroundColor || (style === null || style === void 0 ? void 0 : (_style$color = style.color) === null || _style$color === void 0 ? void 0 : _style$color.background) || hasGradient && (gradient || (style === null || style === void 0 ? void 0 : (_style$color2 = style.color) === null || _style$color2 === void 0 ? void 0 : _style$color2.gradient));
  const newClassName = classnames_default()(props.className, textClass, gradientClass, {
    // Don't apply the background class if there's a custom gradient.
    [backgroundClass]: (!hasGradient || !(style !== null && style !== void 0 && (_style$color3 = style.color) !== null && _style$color3 !== void 0 && _style$color3.gradient)) && !!backgroundClass,
    'has-text-color': shouldSerialize('text') && (textColor || (style === null || style === void 0 ? void 0 : (_style$color4 = style.color) === null || _style$color4 === void 0 ? void 0 : _style$color4.text)),
    'has-background': serializeHasBackground && hasBackground,
    'has-link-color': shouldSerialize('link') && (style === null || style === void 0 ? void 0 : (_style$elements = style.elements) === null || _style$elements === void 0 ? void 0 : (_style$elements$link = _style$elements.link) === null || _style$elements$link === void 0 ? void 0 : _style$elements$link.color)
  });
  props.className = newClassName ? newClassName : undefined;
  return props;
}
/**
 * Filters registered block settings to extend the block edit wrapper
 * to apply the desired styles and classnames properly.
 *
 * @param {Object} settings Original block settings.
 *
 * @return {Object} Filtered block settings.
 */

function color_addEditProps(settings) {
  if (!hasColorSupport(settings) || shouldSkipSerialization(settings, COLOR_SUPPORT_KEY)) {
    return settings;
  }

  const existingGetEditWrapperProps = settings.getEditWrapperProps;

  settings.getEditWrapperProps = attributes => {
    let props = {};

    if (existingGetEditWrapperProps) {
      props = existingGetEditWrapperProps(attributes);
    }

    return color_addSaveProps(props, settings, attributes);
  };

  return settings;
}

const getLinkColorFromAttributeValue = (colors, value) => {
  const attributeParsed = /var:preset\|color\|(.+)/.exec(value);

  if (attributeParsed && attributeParsed[1]) {
    return getColorObjectByAttributeValues(colors, attributeParsed[1]).color;
  }

  return value;
};
/**
 * Inspector control panel containing the color related configuration
 *
 * @param {Object} props
 *
 * @return {WPElement} Color edit element.
 */


function ColorEdit(props) {
  var _style$color6, _style$color7, _style$color8, _style$elements2, _style$elements2$link, _style$elements2$link2, _style$elements3, _style$elements3$link, _style$elements3$link2;

  const {
    name: blockName,
    attributes
  } = props; // Some color settings have a special handling for deprecated flags in `useSetting`,
  // so we can't unwrap them by doing const { ... } = useSetting('color')
  // until https://github.com/WordPress/gutenberg/issues/37094 is fixed.

  const userPalette = useSetting('color.palette.custom');
  const themePalette = useSetting('color.palette.theme');
  const defaultPalette = useSetting('color.palette.default');
  const allSolids = (0,external_wp_element_namespaceObject.useMemo)(() => [...(userPalette || []), ...(themePalette || []), ...(defaultPalette || [])], [userPalette, themePalette, defaultPalette]);
  const userGradientPalette = useSetting('color.gradients.custom');
  const themeGradientPalette = useSetting('color.gradients.theme');
  const defaultGradientPalette = useSetting('color.gradients.default');
  const allGradients = (0,external_wp_element_namespaceObject.useMemo)(() => [...(userGradientPalette || []), ...(themeGradientPalette || []), ...(defaultGradientPalette || [])], [userGradientPalette, themeGradientPalette, defaultGradientPalette]);
  const areCustomSolidsEnabled = useSetting('color.custom');
  const areCustomGradientsEnabled = useSetting('color.customGradient');
  const isBackgroundEnabled = useSetting('color.background');
  const isLinkEnabled = useSetting('color.link');
  const isTextEnabled = useSetting('color.text');
  const solidsEnabled = areCustomSolidsEnabled || !themePalette || (themePalette === null || themePalette === void 0 ? void 0 : themePalette.length) > 0;
  const gradientsEnabled = areCustomGradientsEnabled || !themeGradientPalette || (themeGradientPalette === null || themeGradientPalette === void 0 ? void 0 : themeGradientPalette.length) > 0; // Shouldn't be needed but right now the ColorGradientsPanel
  // can trigger both onChangeColor and onChangeBackground
  // synchronously causing our two callbacks to override changes
  // from each other.

  const localAttributes = (0,external_wp_element_namespaceObject.useRef)(attributes);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    localAttributes.current = attributes;
  }, [attributes]);

  if (!hasColorSupport(blockName)) {
    return null;
  }

  const hasLinkColor = hasLinkColorSupport(blockName) && isLinkEnabled && solidsEnabled;
  const hasTextColor = hasTextColorSupport(blockName) && isTextEnabled && solidsEnabled;
  const hasBackgroundColor = hasBackgroundColorSupport(blockName) && isBackgroundEnabled && solidsEnabled;
  const hasGradientColor = hasGradientSupport(blockName) && gradientsEnabled;

  if (!hasLinkColor && !hasTextColor && !hasBackgroundColor && !hasGradientColor) {
    return null;
  }

  const {
    style,
    textColor,
    backgroundColor,
    gradient
  } = attributes;
  let gradientValue;

  if (hasGradientColor && gradient) {
    gradientValue = getGradientValueBySlug(allGradients, gradient);
  } else if (hasGradientColor) {
    var _style$color5;

    gradientValue = style === null || style === void 0 ? void 0 : (_style$color5 = style.color) === null || _style$color5 === void 0 ? void 0 : _style$color5.gradient;
  }

  const onChangeColor = name => value => {
    var _localAttributes$curr, _localAttributes$curr2;

    const colorObject = getColorObjectByColorValue(allSolids, value);
    const attributeName = name + 'Color';
    const newStyle = { ...localAttributes.current.style,
      color: { ...((_localAttributes$curr = localAttributes.current) === null || _localAttributes$curr === void 0 ? void 0 : (_localAttributes$curr2 = _localAttributes$curr.style) === null || _localAttributes$curr2 === void 0 ? void 0 : _localAttributes$curr2.color),
        [name]: colorObject !== null && colorObject !== void 0 && colorObject.slug ? undefined : value
      }
    };
    const newNamedColor = colorObject !== null && colorObject !== void 0 && colorObject.slug ? colorObject.slug : undefined;
    const newAttributes = {
      style: cleanEmptyObject(newStyle),
      [attributeName]: newNamedColor
    };
    props.setAttributes(newAttributes);
    localAttributes.current = { ...localAttributes.current,
      ...newAttributes
    };
  };

  const onChangeGradient = value => {
    const slug = getGradientSlugByValue(allGradients, value);
    let newAttributes;

    if (slug) {
      var _localAttributes$curr3, _localAttributes$curr4, _localAttributes$curr5;

      const newStyle = { ...((_localAttributes$curr3 = localAttributes.current) === null || _localAttributes$curr3 === void 0 ? void 0 : _localAttributes$curr3.style),
        color: { ...((_localAttributes$curr4 = localAttributes.current) === null || _localAttributes$curr4 === void 0 ? void 0 : (_localAttributes$curr5 = _localAttributes$curr4.style) === null || _localAttributes$curr5 === void 0 ? void 0 : _localAttributes$curr5.color),
          gradient: undefined
        }
      };
      newAttributes = {
        style: cleanEmptyObject(newStyle),
        gradient: slug
      };
    } else {
      var _localAttributes$curr6, _localAttributes$curr7, _localAttributes$curr8;

      const newStyle = { ...((_localAttributes$curr6 = localAttributes.current) === null || _localAttributes$curr6 === void 0 ? void 0 : _localAttributes$curr6.style),
        color: { ...((_localAttributes$curr7 = localAttributes.current) === null || _localAttributes$curr7 === void 0 ? void 0 : (_localAttributes$curr8 = _localAttributes$curr7.style) === null || _localAttributes$curr8 === void 0 ? void 0 : _localAttributes$curr8.color),
          gradient: value
        }
      };
      newAttributes = {
        style: cleanEmptyObject(newStyle),
        gradient: undefined
      };
    }

    props.setAttributes(newAttributes);
    localAttributes.current = { ...localAttributes.current,
      ...newAttributes
    };
  };

  const onChangeLinkColor = value => {
    const colorObject = getColorObjectByColorValue(allSolids, value);
    const newLinkColorValue = colorObject !== null && colorObject !== void 0 && colorObject.slug ? `var:preset|color|${colorObject.slug}` : value;
    const newStyle = cleanEmptyObject(immutableSet(style, ['elements', 'link', 'color', 'text'], newLinkColorValue));
    props.setAttributes({
      style: newStyle
    });
  };

  const enableContrastChecking = external_wp_element_namespaceObject.Platform.OS === 'web' && !gradient && !(style !== null && style !== void 0 && (_style$color6 = style.color) !== null && _style$color6 !== void 0 && _style$color6.gradient);
  const defaultColorControls = (0,external_wp_blocks_namespaceObject.getBlockSupport)(props.name, [COLOR_SUPPORT_KEY, '__experimentalDefaultControls']);
  return (0,external_wp_element_namespaceObject.createElement)(ColorPanel, {
    enableContrastChecking: enableContrastChecking,
    clientId: props.clientId,
    enableAlpha: true,
    settings: [...(hasTextColor ? [{
      label: (0,external_wp_i18n_namespaceObject.__)('Text'),
      onColorChange: onChangeColor('text'),
      colorValue: getColorObjectByAttributeValues(allSolids, textColor, style === null || style === void 0 ? void 0 : (_style$color7 = style.color) === null || _style$color7 === void 0 ? void 0 : _style$color7.text).color,
      isShownByDefault: defaultColorControls === null || defaultColorControls === void 0 ? void 0 : defaultColorControls.text,
      hasValue: () => hasColor('text')(props),
      onDeselect: () => resetTextColor(props),
      resetAllFilter: resetAllTextFilter
    }] : []), ...(hasBackgroundColor || hasGradientColor ? [{
      label: (0,external_wp_i18n_namespaceObject.__)('Background'),
      onColorChange: hasBackgroundColor ? onChangeColor('background') : undefined,
      colorValue: getColorObjectByAttributeValues(allSolids, backgroundColor, style === null || style === void 0 ? void 0 : (_style$color8 = style.color) === null || _style$color8 === void 0 ? void 0 : _style$color8.background).color,
      gradientValue,
      onGradientChange: hasGradientColor ? onChangeGradient : undefined,
      isShownByDefault: defaultColorControls === null || defaultColorControls === void 0 ? void 0 : defaultColorControls.background,
      hasValue: () => hasColor('background')(props),
      onDeselect: () => resetBackgroundAndGradient(props),
      resetAllFilter: clearBackgroundAndGradient
    }] : []), ...(hasLinkColor ? [{
      label: (0,external_wp_i18n_namespaceObject.__)('Link'),
      onColorChange: onChangeLinkColor,
      colorValue: getLinkColorFromAttributeValue(allSolids, style === null || style === void 0 ? void 0 : (_style$elements2 = style.elements) === null || _style$elements2 === void 0 ? void 0 : (_style$elements2$link = _style$elements2.link) === null || _style$elements2$link === void 0 ? void 0 : (_style$elements2$link2 = _style$elements2$link.color) === null || _style$elements2$link2 === void 0 ? void 0 : _style$elements2$link2.text),
      clearable: !!(style !== null && style !== void 0 && (_style$elements3 = style.elements) !== null && _style$elements3 !== void 0 && (_style$elements3$link = _style$elements3.link) !== null && _style$elements3$link !== void 0 && (_style$elements3$link2 = _style$elements3$link.color) !== null && _style$elements3$link2 !== void 0 && _style$elements3$link2.text),
      isShownByDefault: defaultColorControls === null || defaultColorControls === void 0 ? void 0 : defaultColorControls.link,
      hasValue: () => hasColor('link')(props),
      onDeselect: () => resetLinkColor(props),
      resetAllFilter: resetAllLinkFilter
    }] : [])]
  });
}
/**
 * This adds inline styles for color palette colors.
 * Ideally, this is not needed and themes should load their palettes on the editor.
 *
 * @param {Function} BlockListBlock Original component.
 *
 * @return {Function} Wrapped component.
 */

const withColorPaletteStyles = (0,external_wp_compose_namespaceObject.createHigherOrderComponent)(BlockListBlock => props => {
  var _props$wrapperProps;

  const {
    name,
    attributes
  } = props;
  const {
    backgroundColor,
    textColor
  } = attributes;
  const userPalette = useSetting('color.palette.custom') || [];
  const themePalette = useSetting('color.palette.theme') || [];
  const defaultPalette = useSetting('color.palette.default') || [];
  const colors = (0,external_wp_element_namespaceObject.useMemo)(() => [...(userPalette || []), ...(themePalette || []), ...(defaultPalette || [])], [userPalette, themePalette, defaultPalette]);

  if (!hasColorSupport(name) || shouldSkipSerialization(name, COLOR_SUPPORT_KEY)) {
    return (0,external_wp_element_namespaceObject.createElement)(BlockListBlock, props);
  }

  const extraStyles = {};

  if (textColor && !shouldSkipSerialization(name, COLOR_SUPPORT_KEY, 'text')) {
    var _getColorObjectByAttr;

    extraStyles.color = (_getColorObjectByAttr = getColorObjectByAttributeValues(colors, textColor)) === null || _getColorObjectByAttr === void 0 ? void 0 : _getColorObjectByAttr.color;
  }

  if (backgroundColor && !shouldSkipSerialization(name, COLOR_SUPPORT_KEY, 'background')) {
    var _getColorObjectByAttr2;

    extraStyles.backgroundColor = (_getColorObjectByAttr2 = getColorObjectByAttributeValues(colors, backgroundColor)) === null || _getColorObjectByAttr2 === void 0 ? void 0 : _getColorObjectByAttr2.color;
  }

  let wrapperProps = props.wrapperProps;
  wrapperProps = { ...props.wrapperProps,
    style: { ...extraStyles,
      ...((_props$wrapperProps = props.wrapperProps) === null || _props$wrapperProps === void 0 ? void 0 : _props$wrapperProps.style)
    }
  };
  return (0,external_wp_element_namespaceObject.createElement)(BlockListBlock, _extends({}, props, {
    wrapperProps: wrapperProps
  }));
});
const MIGRATION_PATHS = {
  linkColor: [['style', 'elements', 'link', 'color', 'text']],
  textColor: [['textColor'], ['style', 'color', 'text']],
  backgroundColor: [['backgroundColor'], ['style', 'color', 'background']],
  gradient: [['gradient'], ['style', 'color', 'gradient']]
};
function color_addTransforms(result, source, index, results) {
  const destinationBlockType = result.name;
  const activeSupports = {
    linkColor: hasLinkColorSupport(destinationBlockType),
    textColor: hasTextColorSupport(destinationBlockType),
    backgroundColor: hasBackgroundColorSupport(destinationBlockType),
    gradient: hasGradientSupport(destinationBlockType)
  };
  return transformStyles(activeSupports, MIGRATION_PATHS, result, source, index, results);
}
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.registerBlockType', 'core/color/addAttribute', color_addAttributes);
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.getSaveContent.extraProps', 'core/color/addSaveProps', color_addSaveProps);
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.registerBlockType', 'core/color/addEditProps', color_addEditProps);
(0,external_wp_hooks_namespaceObject.addFilter)('editor.BlockListBlock', 'core/color/with-color-palette-styles', withColorPaletteStyles);
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.switchToBlockType.transformedBlock', 'core/color/addTransforms', color_addTransforms);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/font-appearance-control/index.js


/**
 * WordPress dependencies
 */



const FONT_STYLES = [{
  name: (0,external_wp_i18n_namespaceObject._x)('Regular', 'font style'),
  value: 'normal'
}, {
  name: (0,external_wp_i18n_namespaceObject._x)('Italic', 'font style'),
  value: 'italic'
}];
const FONT_WEIGHTS = [{
  name: (0,external_wp_i18n_namespaceObject._x)('Thin', 'font weight'),
  value: '100'
}, {
  name: (0,external_wp_i18n_namespaceObject._x)('Extra Light', 'font weight'),
  value: '200'
}, {
  name: (0,external_wp_i18n_namespaceObject._x)('Light', 'font weight'),
  value: '300'
}, {
  name: (0,external_wp_i18n_namespaceObject._x)('Regular', 'font weight'),
  value: '400'
}, {
  name: (0,external_wp_i18n_namespaceObject._x)('Medium', 'font weight'),
  value: '500'
}, {
  name: (0,external_wp_i18n_namespaceObject._x)('Semi Bold', 'font weight'),
  value: '600'
}, {
  name: (0,external_wp_i18n_namespaceObject._x)('Bold', 'font weight'),
  value: '700'
}, {
  name: (0,external_wp_i18n_namespaceObject._x)('Extra Bold', 'font weight'),
  value: '800'
}, {
  name: (0,external_wp_i18n_namespaceObject._x)('Black', 'font weight'),
  value: '900'
}];
/**
 * Adjusts font appearance field label in case either font styles or weights
 * are disabled.
 *
 * @param {boolean} hasFontStyles  Whether font styles are enabled and present.
 * @param {boolean} hasFontWeights Whether font weights are enabled and present.
 * @return {string} A label representing what font appearance is being edited.
 */

const getFontAppearanceLabel = (hasFontStyles, hasFontWeights) => {
  if (!hasFontStyles) {
    return (0,external_wp_i18n_namespaceObject.__)('Font weight');
  }

  if (!hasFontWeights) {
    return (0,external_wp_i18n_namespaceObject.__)('Font style');
  }

  return (0,external_wp_i18n_namespaceObject.__)('Appearance');
};
/**
 * Control to display unified font style and weight options.
 *
 * @param {Object} props Component props.
 *
 * @return {WPElement} Font appearance control.
 */

function FontAppearanceControl(props) {
  const {
    onChange,
    hasFontStyles = true,
    hasFontWeights = true,
    value: {
      fontStyle,
      fontWeight
    }
  } = props;
  const hasStylesOrWeights = hasFontStyles || hasFontWeights;
  const label = getFontAppearanceLabel(hasFontStyles, hasFontWeights);
  const defaultOption = {
    key: 'default',
    name: (0,external_wp_i18n_namespaceObject.__)('Default'),
    style: {
      fontStyle: undefined,
      fontWeight: undefined
    }
  }; // Combines both font style and weight options into a single dropdown.

  const combineOptions = () => {
    const combinedOptions = [defaultOption];
    FONT_STYLES.forEach(_ref => {
      let {
        name: styleName,
        value: styleValue
      } = _ref;
      FONT_WEIGHTS.forEach(_ref2 => {
        let {
          name: weightName,
          value: weightValue
        } = _ref2;
        const optionName = styleValue === 'normal' ? weightName : (0,external_wp_i18n_namespaceObject.sprintf)(
        /* translators: 1: Font weight name. 2: Font style name. */
        (0,external_wp_i18n_namespaceObject.__)('%1$s %2$s'), weightName, styleName);
        combinedOptions.push({
          key: `${styleValue}-${weightValue}`,
          name: optionName,
          style: {
            fontStyle: styleValue,
            fontWeight: weightValue
          }
        });
      });
    });
    return combinedOptions;
  }; // Generates select options for font styles only.


  const styleOptions = () => {
    const combinedOptions = [defaultOption];
    FONT_STYLES.forEach(_ref3 => {
      let {
        name,
        value
      } = _ref3;
      combinedOptions.push({
        key: value,
        name,
        style: {
          fontStyle: value,
          fontWeight: undefined
        }
      });
    });
    return combinedOptions;
  }; // Generates select options for font weights only.


  const weightOptions = () => {
    const combinedOptions = [defaultOption];
    FONT_WEIGHTS.forEach(_ref4 => {
      let {
        name,
        value
      } = _ref4;
      combinedOptions.push({
        key: value,
        name,
        style: {
          fontStyle: undefined,
          fontWeight: value
        }
      });
    });
    return combinedOptions;
  }; // Map font styles and weights to select options.


  const selectOptions = (0,external_wp_element_namespaceObject.useMemo)(() => {
    if (hasFontStyles && hasFontWeights) {
      return combineOptions();
    }

    return hasFontStyles ? styleOptions() : weightOptions();
  }, [props.options]); // Find current selection by comparing font style & weight against options,
  // and fall back to the Default option if there is no matching option.

  const currentSelection = selectOptions.find(option => option.style.fontStyle === fontStyle && option.style.fontWeight === fontWeight) || selectOptions[0]; // Adjusts screen reader description based on styles or weights.

  const getDescribedBy = () => {
    if (!currentSelection) {
      return (0,external_wp_i18n_namespaceObject.__)('No selected font appearance');
    }

    if (!hasFontStyles) {
      return (0,external_wp_i18n_namespaceObject.sprintf)( // translators: %s: Currently selected font weight.
      (0,external_wp_i18n_namespaceObject.__)('Currently selected font weight: %s'), currentSelection.name);
    }

    if (!hasFontWeights) {
      return (0,external_wp_i18n_namespaceObject.sprintf)( // translators: %s: Currently selected font style.
      (0,external_wp_i18n_namespaceObject.__)('Currently selected font style: %s'), currentSelection.name);
    }

    return (0,external_wp_i18n_namespaceObject.sprintf)( // translators: %s: Currently selected font appearance.
    (0,external_wp_i18n_namespaceObject.__)('Currently selected font appearance: %s'), currentSelection.name);
  };

  return hasStylesOrWeights && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.CustomSelectControl, {
    className: "components-font-appearance-control",
    label: label,
    describedBy: getDescribedBy(),
    options: selectOptions,
    value: currentSelection,
    onChange: _ref5 => {
      let {
        selectedItem
      } = _ref5;
      return onChange(selectedItem.style);
    }
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/line-height-control/utils.js
const BASE_DEFAULT_VALUE = 1.5;
const STEP = 0.1;
/**
 * There are varying value types within LineHeightControl:
 *
 * {undefined} Initial value. No changes from the user.
 * {string} Input value. Value consumed/outputted by the input. Empty would be ''.
 * {number} Block attribute type. Input value needs to be converted for attribute setting.
 *
 * Note: If the value is undefined, the input requires it to be an empty string ('')
 * in order to be considered "controlled" by props (rather than internal state).
 */

const RESET_VALUE = '';
/**
 * Determines if the lineHeight attribute has been properly defined.
 *
 * @param {any} lineHeight The value to check.
 *
 * @return {boolean} Whether the lineHeight attribute is valid.
 */

function isLineHeightDefined(lineHeight) {
  return lineHeight !== undefined && lineHeight !== RESET_VALUE;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/line-height-control/index.js


/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */



const LineHeightControl = _ref => {
  let {
    value: lineHeight,
    onChange,

    /** Start opting into the new margin-free styles that will become the default in a future version. */
    __nextHasNoMarginBottom = false,
    __unstableInputWidth = '60px'
  } = _ref;
  const isDefined = isLineHeightDefined(lineHeight);

  const adjustNextValue = (nextValue, wasTypedOrPasted) => {
    // Set the next value without modification if lineHeight has been defined.
    if (isDefined) return nextValue;
    /**
     * The following logic handles the initial step up/down action
     * (from an undefined value state) so that the next values are better suited for
     * line-height rendering. For example, the first step up should immediately
     * go to 1.6, rather than the normally expected 0.1.
     *
     * Step up/down actions can be triggered by keydowns of the up/down arrow keys,
     * or by clicking the spin buttons.
     */

    switch (`${nextValue}`) {
      case `${STEP}`:
        // Increment by step value.
        return BASE_DEFAULT_VALUE + STEP;

      case '0':
        {
          // This means the user explicitly input '0', rather than stepped down
          // from an undefined value state.
          if (wasTypedOrPasted) return nextValue; // Decrement by step value.

          return BASE_DEFAULT_VALUE - STEP;
        }

      case '':
        return BASE_DEFAULT_VALUE;

      default:
        return nextValue;
    }
  };

  const stateReducer = (state, action) => {
    var _action$payload$event;

    // Be careful when changing this — cross-browser behavior of the
    // `inputType` field in `input` events are inconsistent.
    // For example, Firefox emits an input event with inputType="insertReplacementText"
    // on spin button clicks, while other browsers do not even emit an input event.
    const wasTypedOrPasted = ['insertText', 'insertFromPaste'].includes((_action$payload$event = action.payload.event.nativeEvent) === null || _action$payload$event === void 0 ? void 0 : _action$payload$event.inputType);
    const value = adjustNextValue(state.value, wasTypedOrPasted);
    return { ...state,
      value
    };
  };

  const value = isDefined ? lineHeight : RESET_VALUE;

  if (!__nextHasNoMarginBottom) {
    external_wp_deprecated_default()('Bottom margin styles for wp.blockEditor.LineHeightControl', {
      since: '6.0',
      version: '6.4',
      hint: 'Set the `__nextHasNoMarginBottom` prop to true to start opting into the new styles, which will become the default in a future version'
    });
  }

  const deprecatedStyles = __nextHasNoMarginBottom ? undefined : {
    marginBottom: 24
  };
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-line-height-control",
    style: deprecatedStyles
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalNumberControl, {
    __unstableInputWidth: __unstableInputWidth,
    __unstableStateReducer: stateReducer,
    onChange: onChange,
    label: (0,external_wp_i18n_namespaceObject.__)('Line height'),
    placeholder: BASE_DEFAULT_VALUE,
    step: STEP,
    value: value,
    min: 0
  }));
};
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/line-height-control/README.md
 */


/* harmony default export */ var line_height_control = (LineHeightControl);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/line-height.js


/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */




const LINE_HEIGHT_SUPPORT_KEY = 'typography.lineHeight';
/**
 * Inspector control panel containing the line height related configuration
 *
 * @param {Object} props
 *
 * @return {WPElement} Line height edit element.
 */

function LineHeightEdit(props) {
  var _style$typography;

  const {
    attributes: {
      style
    },
    setAttributes
  } = props;

  const onChange = newLineHeightValue => {
    const newStyle = { ...style,
      typography: { ...(style === null || style === void 0 ? void 0 : style.typography),
        lineHeight: newLineHeightValue
      }
    };
    setAttributes({
      style: cleanEmptyObject(newStyle)
    });
  };

  return (0,external_wp_element_namespaceObject.createElement)(line_height_control, {
    __unstableInputWidth: "100%",
    __nextHasNoMarginBottom: true,
    value: style === null || style === void 0 ? void 0 : (_style$typography = style.typography) === null || _style$typography === void 0 ? void 0 : _style$typography.lineHeight,
    onChange: onChange
  });
}
/**
 * Custom hook that checks if line-height settings have been disabled.
 *
 * @param {string} name The name of the block.
 * @return {boolean} Whether setting is disabled.
 */

function useIsLineHeightDisabled() {
  let {
    name: blockName
  } = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  const isDisabled = !useSetting('typography.lineHeight');
  return !(0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockName, LINE_HEIGHT_SUPPORT_KEY) || isDisabled;
}
/**
 * Checks if there is a current value set for the line height block support.
 *
 * @param {Object} props Block props.
 * @return {boolean}     Whether or not the block has a line height value set.
 */

function hasLineHeightValue(props) {
  var _props$attributes$sty, _props$attributes$sty2;

  return !!((_props$attributes$sty = props.attributes.style) !== null && _props$attributes$sty !== void 0 && (_props$attributes$sty2 = _props$attributes$sty.typography) !== null && _props$attributes$sty2 !== void 0 && _props$attributes$sty2.lineHeight);
}
/**
 * Resets the line height block support attribute. This can be used when
 * disabling the line height support controls for a block via a progressive
 * discovery panel.
 *
 * @param {Object} props               Block props.
 * @param {Object} props.attributes    Block's attributes.
 * @param {Object} props.setAttributes Function to set block's attributes.
 */

function resetLineHeight(_ref) {
  let {
    attributes = {},
    setAttributes
  } = _ref;
  const {
    style
  } = attributes;
  setAttributes({
    style: cleanEmptyObject({ ...style,
      typography: { ...(style === null || style === void 0 ? void 0 : style.typography),
        lineHeight: undefined
      }
    })
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/font-appearance.js


/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */




/**
 * Key within block settings' support array indicating support for font style.
 */

const FONT_STYLE_SUPPORT_KEY = 'typography.__experimentalFontStyle';
/**
 * Key within block settings' support array indicating support for font weight.
 */

const FONT_WEIGHT_SUPPORT_KEY = 'typography.__experimentalFontWeight';
/**
 * Inspector control panel containing the font appearance options.
 *
 * @param {Object} props Block properties.
 *
 * @return {WPElement} Font appearance edit element.
 */

function FontAppearanceEdit(props) {
  var _style$typography, _style$typography2;

  const {
    attributes: {
      style
    },
    setAttributes
  } = props;
  const hasFontStyles = !useIsFontStyleDisabled(props);
  const hasFontWeights = !useIsFontWeightDisabled(props);

  const onChange = newStyles => {
    setAttributes({
      style: cleanEmptyObject({ ...style,
        typography: { ...(style === null || style === void 0 ? void 0 : style.typography),
          fontStyle: newStyles.fontStyle,
          fontWeight: newStyles.fontWeight
        }
      })
    });
  };

  const fontStyle = style === null || style === void 0 ? void 0 : (_style$typography = style.typography) === null || _style$typography === void 0 ? void 0 : _style$typography.fontStyle;
  const fontWeight = style === null || style === void 0 ? void 0 : (_style$typography2 = style.typography) === null || _style$typography2 === void 0 ? void 0 : _style$typography2.fontWeight;
  return (0,external_wp_element_namespaceObject.createElement)(FontAppearanceControl, {
    onChange: onChange,
    hasFontStyles: hasFontStyles,
    hasFontWeights: hasFontWeights,
    value: {
      fontStyle,
      fontWeight
    }
  });
}
/**
 * Checks if font style support has been disabled either by not opting in for
 * support or by failing to provide preset styles.
 *
 * @param {Object} props      Block properties.
 * @param {string} props.name Name for the block type.
 *
 * @return {boolean} Whether font style support has been disabled.
 */

function useIsFontStyleDisabled() {
  let {
    name: blockName
  } = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  const styleSupport = (0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockName, FONT_STYLE_SUPPORT_KEY);
  const hasFontStyles = useSetting('typography.fontStyle');
  return !styleSupport || !hasFontStyles;
}
/**
 * Checks if font weight support has been disabled either by not opting in for
 * support or by failing to provide preset weights.
 *
 * @param {Object} props      Block properties.
 * @param {string} props.name Name for the block type.
 *
 * @return {boolean} Whether font weight support has been disabled.
 */

function useIsFontWeightDisabled() {
  let {
    name: blockName
  } = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  const weightSupport = (0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockName, FONT_WEIGHT_SUPPORT_KEY);
  const hasFontWeights = useSetting('typography.fontWeight');
  return !weightSupport || !hasFontWeights;
}
/**
 * Checks if font appearance support has been disabled.
 *
 * @param {Object} props Block properties.
 *
 * @return {boolean} Whether font appearance support has been disabled.
 */

function useIsFontAppearanceDisabled(props) {
  const stylesDisabled = useIsFontStyleDisabled(props);
  const weightsDisabled = useIsFontWeightDisabled(props);
  return stylesDisabled && weightsDisabled;
}
/**
 * Checks if there is either a font style or weight value set within the
 * typography styles.
 *
 * @param {Object} props Block props.
 * @return {boolean}     Whether or not the block has a font style or weight.
 */

function hasFontAppearanceValue(props) {
  var _props$attributes$sty;

  const {
    fontStyle,
    fontWeight
  } = ((_props$attributes$sty = props.attributes.style) === null || _props$attributes$sty === void 0 ? void 0 : _props$attributes$sty.typography) || {};
  return !!fontStyle || !!fontWeight;
}
/**
 * Resets the font style and weight block support attributes. This can be used
 * when disabling the font appearance support controls for a block via a
 * progressive discovery panel.
 *
 * @param {Object} props               Block props.
 * @param {Object} props.attributes    Block's attributes.
 * @param {Object} props.setAttributes Function to set block's attributes.
 */

function resetFontAppearance(_ref) {
  let {
    attributes = {},
    setAttributes
  } = _ref;
  const {
    style
  } = attributes;
  setAttributes({
    style: cleanEmptyObject({ ...style,
      typography: { ...(style === null || style === void 0 ? void 0 : style.typography),
        fontStyle: undefined,
        fontWeight: undefined
      }
    })
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/font-family/index.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */


function FontFamilyControl(_ref) {
  let {
    value = '',
    onChange,
    fontFamilies,
    ...props
  } = _ref;
  const blockLevelFontFamilies = useSetting('typography.fontFamilies');

  if (!fontFamilies) {
    fontFamilies = blockLevelFontFamilies;
  }

  if ((0,external_lodash_namespaceObject.isEmpty)(fontFamilies)) {
    return null;
  }

  const options = [{
    value: '',
    label: (0,external_wp_i18n_namespaceObject.__)('Default')
  }, ...fontFamilies.map(_ref2 => {
    let {
      fontFamily,
      name
    } = _ref2;
    return {
      value: fontFamily,
      label: name || fontFamily
    };
  })];
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.SelectControl, _extends({
    label: (0,external_wp_i18n_namespaceObject.__)('Font family'),
    options: options,
    value: value,
    onChange: onChange,
    labelPosition: "top"
  }, props));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/font-family.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */





const FONT_FAMILY_SUPPORT_KEY = 'typography.__experimentalFontFamily';
/**
 * Filters registered block settings, extending attributes to include
 * the `fontFamily` attribute.
 *
 * @param {Object} settings Original block settings
 * @return {Object}         Filtered block settings
 */

function font_family_addAttributes(settings) {
  if (!(0,external_wp_blocks_namespaceObject.hasBlockSupport)(settings, FONT_FAMILY_SUPPORT_KEY)) {
    return settings;
  } // Allow blocks to specify a default value if needed.


  if (!settings.attributes.fontFamily) {
    Object.assign(settings.attributes, {
      fontFamily: {
        type: 'string'
      }
    });
  }

  return settings;
}
/**
 * Override props assigned to save component to inject font family.
 *
 * @param {Object} props      Additional props applied to save element
 * @param {Object} blockType  Block type
 * @param {Object} attributes Block attributes
 * @return {Object}           Filtered props applied to save element
 */


function font_family_addSaveProps(props, blockType, attributes) {
  if (!(0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockType, FONT_FAMILY_SUPPORT_KEY)) {
    return props;
  }

  if (shouldSkipSerialization(blockType, TYPOGRAPHY_SUPPORT_KEY, 'fontFamily')) {
    return props;
  }

  if (!(attributes !== null && attributes !== void 0 && attributes.fontFamily)) {
    return props;
  } // Use TokenList to dedupe classes.


  const classes = new (external_wp_tokenList_default())(props.className);
  classes.add(`has-${(0,external_lodash_namespaceObject.kebabCase)(attributes === null || attributes === void 0 ? void 0 : attributes.fontFamily)}-font-family`);
  const newClassName = classes.value;
  props.className = newClassName ? newClassName : undefined;
  return props;
}
/**
 * Filters registered block settings to expand the block edit wrapper
 * by applying the desired styles and classnames.
 *
 * @param {Object} settings Original block settings.
 *
 * @return {Object} Filtered block settings.
 */


function font_family_addEditProps(settings) {
  if (!(0,external_wp_blocks_namespaceObject.hasBlockSupport)(settings, FONT_FAMILY_SUPPORT_KEY)) {
    return settings;
  }

  const existingGetEditWrapperProps = settings.getEditWrapperProps;

  settings.getEditWrapperProps = attributes => {
    let props = {};

    if (existingGetEditWrapperProps) {
      props = existingGetEditWrapperProps(attributes);
    }

    return font_family_addSaveProps(props, settings, attributes);
  };

  return settings;
}

function FontFamilyEdit(_ref) {
  var _find;

  let {
    setAttributes,
    attributes: {
      fontFamily
    }
  } = _ref;
  const fontFamilies = useSetting('typography.fontFamilies');
  const value = (_find = (0,external_lodash_namespaceObject.find)(fontFamilies, _ref2 => {
    let {
      slug
    } = _ref2;
    return fontFamily === slug;
  })) === null || _find === void 0 ? void 0 : _find.fontFamily;

  function onChange(newValue) {
    const predefinedFontFamily = (0,external_lodash_namespaceObject.find)(fontFamilies, _ref3 => {
      let {
        fontFamily: f
      } = _ref3;
      return f === newValue;
    });
    setAttributes({
      fontFamily: predefinedFontFamily === null || predefinedFontFamily === void 0 ? void 0 : predefinedFontFamily.slug
    });
  }

  return (0,external_wp_element_namespaceObject.createElement)(FontFamilyControl, {
    className: "block-editor-hooks-font-family-control",
    fontFamilies: fontFamilies,
    value: value,
    onChange: onChange
  });
}
/**
 * Custom hook that checks if font-family functionality is disabled.
 *
 * @param {string} name The name of the block.
 * @return {boolean} Whether setting is disabled.
 */

function useIsFontFamilyDisabled(_ref4) {
  let {
    name
  } = _ref4;
  const fontFamilies = useSetting('typography.fontFamilies');
  return !fontFamilies || fontFamilies.length === 0 || !(0,external_wp_blocks_namespaceObject.hasBlockSupport)(name, FONT_FAMILY_SUPPORT_KEY);
}
/**
 * Checks if there is a current value set for the font family block support.
 *
 * @param {Object} props Block props.
 * @return {boolean}     Whether or not the block has a font family value set.
 */

function hasFontFamilyValue(props) {
  return !!props.attributes.fontFamily;
}
/**
 * Resets the font family block support attribute. This can be used when
 * disabling the font family support controls for a block via a progressive
 * discovery panel.
 *
 * @param {Object} props               Block props.
 * @param {Object} props.setAttributes Function to set block's attributes.
 */

function resetFontFamily(_ref5) {
  let {
    setAttributes
  } = _ref5;
  setAttributes({
    fontFamily: undefined
  });
}
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.registerBlockType', 'core/fontFamily/addAttribute', font_family_addAttributes);
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.getSaveContent.extraProps', 'core/fontFamily/addSaveProps', font_family_addSaveProps);
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.registerBlockType', 'core/fontFamily/addEditProps', font_family_addEditProps);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/font-sizes/utils.js
/**
 * External dependencies
 */

/**
 *  Returns the font size object based on an array of named font sizes and the namedFontSize and customFontSize values.
 * 	If namedFontSize is undefined or not found in fontSizes an object with just the size value based on customFontSize is returned.
 *
 * @param {Array}   fontSizes               Array of font size objects containing at least the "name" and "size" values as properties.
 * @param {?string} fontSizeAttribute       Content of the font size attribute (slug).
 * @param {?number} customFontSizeAttribute Contents of the custom font size attribute (value).
 *
 * @return {?Object} If fontSizeAttribute is set and an equal slug is found in fontSizes it returns the font size object for that slug.
 * 					 Otherwise, an object with just the size value based on customFontSize is returned.
 */

const getFontSize = (fontSizes, fontSizeAttribute, customFontSizeAttribute) => {
  if (fontSizeAttribute) {
    const fontSizeObject = (0,external_lodash_namespaceObject.find)(fontSizes, {
      slug: fontSizeAttribute
    });

    if (fontSizeObject) {
      return fontSizeObject;
    }
  }

  return {
    size: customFontSizeAttribute
  };
};
/**
 * Returns the corresponding font size object for a given value.
 *
 * @param {Array}  fontSizes Array of font size objects.
 * @param {number} value     Font size value.
 *
 * @return {Object} Font size object.
 */

function getFontSizeObjectByValue(fontSizes, value) {
  const fontSizeObject = (0,external_lodash_namespaceObject.find)(fontSizes, {
    size: value
  });

  if (fontSizeObject) {
    return fontSizeObject;
  }

  return {
    size: value
  };
}
/**
 * Returns a class based on fontSizeName.
 *
 * @param {string} fontSizeSlug Slug of the fontSize.
 *
 * @return {string} String with the class corresponding to the fontSize passed.
 *                  The class is generated by appending 'has-' followed by fontSizeSlug in kebabCase and ending with '-font-size'.
 */

function getFontSizeClass(fontSizeSlug) {
  if (!fontSizeSlug) {
    return;
  }

  return `has-${(0,external_lodash_namespaceObject.kebabCase)(fontSizeSlug)}-font-size`;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/font-sizes/font-size-picker.js



/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */



function FontSizePicker(props) {
  const fontSizes = useSetting('typography.fontSizes');
  const disableCustomFontSizes = !useSetting('typography.customFontSize');
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.FontSizePicker, _extends({}, props, {
    fontSizes: fontSizes,
    disableCustomFontSizes: disableCustomFontSizes
  }));
}
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/font-sizes/README.md
 */


/* harmony default export */ var font_size_picker = (FontSizePicker);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/font-size.js


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */





const FONT_SIZE_SUPPORT_KEY = 'typography.fontSize';
/**
 * Filters registered block settings, extending attributes to include
 * `fontSize` and `fontWeight` attributes.
 *
 * @param {Object} settings Original block settings.
 *
 * @return {Object} Filtered block settings.
 */

function font_size_addAttributes(settings) {
  if (!(0,external_wp_blocks_namespaceObject.hasBlockSupport)(settings, FONT_SIZE_SUPPORT_KEY)) {
    return settings;
  } // Allow blocks to specify a default value if needed.


  if (!settings.attributes.fontSize) {
    Object.assign(settings.attributes, {
      fontSize: {
        type: 'string'
      }
    });
  }

  return settings;
}
/**
 * Override props assigned to save component to inject font size.
 *
 * @param {Object} props      Additional props applied to save element.
 * @param {Object} blockType  Block type.
 * @param {Object} attributes Block attributes.
 *
 * @return {Object} Filtered props applied to save element.
 */


function font_size_addSaveProps(props, blockType, attributes) {
  if (!(0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockType, FONT_SIZE_SUPPORT_KEY)) {
    return props;
  }

  if (shouldSkipSerialization(blockType, TYPOGRAPHY_SUPPORT_KEY, 'fontSize')) {
    return props;
  } // Use TokenList to dedupe classes.


  const classes = new (external_wp_tokenList_default())(props.className);
  classes.add(getFontSizeClass(attributes.fontSize));
  const newClassName = classes.value;
  props.className = newClassName ? newClassName : undefined;
  return props;
}
/**
 * Filters registered block settings to expand the block edit wrapper
 * by applying the desired styles and classnames.
 *
 * @param {Object} settings Original block settings.
 *
 * @return {Object} Filtered block settings.
 */


function font_size_addEditProps(settings) {
  if (!(0,external_wp_blocks_namespaceObject.hasBlockSupport)(settings, FONT_SIZE_SUPPORT_KEY)) {
    return settings;
  }

  const existingGetEditWrapperProps = settings.getEditWrapperProps;

  settings.getEditWrapperProps = attributes => {
    let props = {};

    if (existingGetEditWrapperProps) {
      props = existingGetEditWrapperProps(attributes);
    }

    return font_size_addSaveProps(props, settings, attributes);
  };

  return settings;
}
/**
 * Inspector control panel containing the font size related configuration
 *
 * @param {Object} props
 *
 * @return {WPElement} Font size edit element.
 */


function FontSizeEdit(props) {
  var _style$typography, _style$typography2;

  const {
    attributes: {
      fontSize,
      style
    },
    setAttributes
  } = props;
  const fontSizes = useSetting('typography.fontSizes');

  const onChange = value => {
    const fontSizeSlug = getFontSizeObjectByValue(fontSizes, value).slug;
    setAttributes({
      style: cleanEmptyObject({ ...style,
        typography: { ...(style === null || style === void 0 ? void 0 : style.typography),
          fontSize: fontSizeSlug ? undefined : value
        }
      }),
      fontSize: fontSizeSlug
    });
  };

  const fontSizeObject = getFontSize(fontSizes, fontSize, style === null || style === void 0 ? void 0 : (_style$typography = style.typography) === null || _style$typography === void 0 ? void 0 : _style$typography.fontSize);
  const fontSizeValue = (fontSizeObject === null || fontSizeObject === void 0 ? void 0 : fontSizeObject.size) || (style === null || style === void 0 ? void 0 : (_style$typography2 = style.typography) === null || _style$typography2 === void 0 ? void 0 : _style$typography2.fontSize) || fontSize;
  return (0,external_wp_element_namespaceObject.createElement)(font_size_picker, {
    onChange: onChange,
    value: fontSizeValue,
    withReset: false
  });
}
/**
 * Checks if there is a current value set for the font size block support.
 *
 * @param {Object} props Block props.
 * @return {boolean}     Whether or not the block has a font size value set.
 */

function hasFontSizeValue(props) {
  var _style$typography3;

  const {
    fontSize,
    style
  } = props.attributes;
  return !!fontSize || !!(style !== null && style !== void 0 && (_style$typography3 = style.typography) !== null && _style$typography3 !== void 0 && _style$typography3.fontSize);
}
/**
 * Resets the font size block support attribute. This can be used when
 * disabling the font size support controls for a block via a progressive
 * discovery panel.
 *
 * @param {Object} props               Block props.
 * @param {Object} props.attributes    Block's attributes.
 * @param {Object} props.setAttributes Function to set block's attributes.
 */

function resetFontSize(_ref) {
  let {
    attributes = {},
    setAttributes
  } = _ref;
  const {
    style
  } = attributes;
  setAttributes({
    fontSize: undefined,
    style: cleanEmptyObject({ ...style,
      typography: { ...(style === null || style === void 0 ? void 0 : style.typography),
        fontSize: undefined
      }
    })
  });
}
/**
 * Custom hook that checks if font-size settings have been disabled.
 *
 * @param {string} name The name of the block.
 * @return {boolean} Whether setting is disabled.
 */

function useIsFontSizeDisabled() {
  let {
    name: blockName
  } = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  const fontSizes = useSetting('typography.fontSizes');
  const hasFontSizes = !!(fontSizes !== null && fontSizes !== void 0 && fontSizes.length);
  return !(0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockName, FONT_SIZE_SUPPORT_KEY) || !hasFontSizes;
}
/**
 * Add inline styles for font sizes.
 * Ideally, this is not needed and themes load the font-size classes on the
 * editor.
 *
 * @param {Function} BlockListBlock Original component.
 *
 * @return {Function} Wrapped component.
 */

const withFontSizeInlineStyles = (0,external_wp_compose_namespaceObject.createHigherOrderComponent)(BlockListBlock => props => {
  var _style$typography4, _style$typography5;

  const fontSizes = useSetting('typography.fontSizes');
  const {
    name: blockName,
    attributes: {
      fontSize,
      style
    },
    wrapperProps
  } = props; // Only add inline styles if the block supports font sizes,
  // doesn't skip serialization of font sizes,
  // doesn't already have an inline font size,
  // and does have a class to extract the font size from.

  if (!(0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockName, FONT_SIZE_SUPPORT_KEY) || shouldSkipSerialization(blockName, TYPOGRAPHY_SUPPORT_KEY, 'fontSize') || !fontSize || style !== null && style !== void 0 && (_style$typography4 = style.typography) !== null && _style$typography4 !== void 0 && _style$typography4.fontSize) {
    return (0,external_wp_element_namespaceObject.createElement)(BlockListBlock, props);
  }

  const fontSizeValue = getFontSize(fontSizes, fontSize, style === null || style === void 0 ? void 0 : (_style$typography5 = style.typography) === null || _style$typography5 === void 0 ? void 0 : _style$typography5.fontSize).size;
  const newProps = { ...props,
    wrapperProps: { ...wrapperProps,
      style: {
        fontSize: fontSizeValue,
        ...(wrapperProps === null || wrapperProps === void 0 ? void 0 : wrapperProps.style)
      }
    }
  };
  return (0,external_wp_element_namespaceObject.createElement)(BlockListBlock, newProps);
}, 'withFontSizeInlineStyles');
const font_size_MIGRATION_PATHS = {
  fontSize: [['fontSize'], ['style', 'typography', 'fontSize']]
};
function font_size_addTransforms(result, source, index, results) {
  const destinationBlockType = result.name;
  const activeSupports = {
    fontSize: (0,external_wp_blocks_namespaceObject.hasBlockSupport)(destinationBlockType, FONT_SIZE_SUPPORT_KEY)
  };
  return transformStyles(activeSupports, font_size_MIGRATION_PATHS, result, source, index, results);
}
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.registerBlockType', 'core/font/addAttribute', font_size_addAttributes);
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.getSaveContent.extraProps', 'core/font/addSaveProps', font_size_addSaveProps);
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.registerBlockType', 'core/font/addEditProps', font_size_addEditProps);
(0,external_wp_hooks_namespaceObject.addFilter)('editor.BlockListBlock', 'core/font-size/with-font-size-inline-styles', withFontSizeInlineStyles);
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.switchToBlockType.transformedBlock', 'core/font-size/addTransforms', font_size_addTransforms);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/format-underline.js


/**
 * WordPress dependencies
 */

const formatUnderline = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M7 18v1h10v-1H7zm5-2c1.5 0 2.6-.4 3.4-1.2.8-.8 1.1-2 1.1-3.5V5H15v5.8c0 1.2-.2 2.1-.6 2.8-.4.7-1.2 1-2.4 1s-2-.3-2.4-1c-.4-.7-.6-1.6-.6-2.8V5H7.5v6.2c0 1.5.4 2.7 1.1 3.5.8.9 1.9 1.3 3.4 1.3z"
}));
/* harmony default export */ var format_underline = (formatUnderline);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/format-strikethrough.js


/**
 * WordPress dependencies
 */

const formatStrikethrough = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M9.1 9v-.5c0-.6.2-1.1.7-1.4.5-.3 1.2-.5 2-.5.7 0 1.4.1 2.1.3.7.2 1.4.5 2.1.9l.2-1.9c-.6-.3-1.2-.5-1.9-.7-.8-.1-1.6-.2-2.4-.2-1.5 0-2.7.3-3.6 1-.8.7-1.2 1.5-1.2 2.6V9h2zM20 12H4v1h8.3c.3.1.6.2.8.3.5.2.9.5 1.1.8.3.3.4.7.4 1.2 0 .7-.2 1.1-.8 1.5-.5.3-1.2.5-2.1.5-.8 0-1.6-.1-2.4-.3-.8-.2-1.5-.5-2.2-.8L7 18.1c.5.2 1.2.4 2 .6.8.2 1.6.3 2.4.3 1.7 0 3-.3 3.9-1 .9-.7 1.3-1.6 1.3-2.8 0-.9-.2-1.7-.7-2.2H20v-1z"
}));
/* harmony default export */ var format_strikethrough = (formatStrikethrough);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/text-decoration-control/index.js


/**
 * WordPress dependencies
 */



const TEXT_DECORATIONS = [{
  name: (0,external_wp_i18n_namespaceObject.__)('Underline'),
  value: 'underline',
  icon: format_underline
}, {
  name: (0,external_wp_i18n_namespaceObject.__)('Strikethrough'),
  value: 'line-through',
  icon: format_strikethrough
}];
/**
 * Control to facilitate text decoration selections.
 *
 * @param {Object}   props          Component props.
 * @param {string}   props.value    Currently selected text decoration.
 * @param {Function} props.onChange Handles change in text decoration selection.
 *
 * @return {WPElement} Text decoration control.
 */

function TextDecorationControl(_ref) {
  let {
    value,
    onChange
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)("fieldset", {
    className: "block-editor-text-decoration-control"
  }, (0,external_wp_element_namespaceObject.createElement)("legend", null, (0,external_wp_i18n_namespaceObject.__)('Decoration')), (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-text-decoration-control__buttons"
  }, TEXT_DECORATIONS.map(textDecoration => {
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
      key: textDecoration.value,
      icon: textDecoration.icon,
      isSmall: true,
      isPressed: textDecoration.value === value,
      onClick: () => onChange(textDecoration.value === value ? undefined : textDecoration.value),
      "aria-label": textDecoration.name
    });
  })));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/text-decoration.js


/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */




/**
 * Key within block settings' supports array indicating support for text
 * decorations e.g. settings found in `block.json`.
 */

const TEXT_DECORATION_SUPPORT_KEY = 'typography.__experimentalTextDecoration';
/**
 * Inspector control panel containing the text decoration options.
 *
 * @param {Object} props Block properties.
 *
 * @return {WPElement} Text decoration edit element.
 */

function TextDecorationEdit(props) {
  var _style$typography;

  const {
    attributes: {
      style
    },
    setAttributes
  } = props;

  function onChange(newDecoration) {
    setAttributes({
      style: cleanEmptyObject({ ...style,
        typography: { ...(style === null || style === void 0 ? void 0 : style.typography),
          textDecoration: newDecoration
        }
      })
    });
  }

  return (0,external_wp_element_namespaceObject.createElement)(TextDecorationControl, {
    value: style === null || style === void 0 ? void 0 : (_style$typography = style.typography) === null || _style$typography === void 0 ? void 0 : _style$typography.textDecoration,
    onChange: onChange
  });
}
/**
 * Checks if text-decoration settings have been disabled.
 *
 * @param {string} name Name of the block.
 *
 * @return {boolean} Whether or not the setting is disabled.
 */

function useIsTextDecorationDisabled() {
  let {
    name: blockName
  } = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  const notSupported = !(0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockName, TEXT_DECORATION_SUPPORT_KEY);
  const hasTextDecoration = useSetting('typography.textDecoration');
  return notSupported || !hasTextDecoration;
}
/**
 * Checks if there is a current value set for the text decoration block support.
 *
 * @param {Object} props Block props.
 * @return {boolean}     Whether or not the block has a text decoration set.
 */

function hasTextDecorationValue(props) {
  var _props$attributes$sty, _props$attributes$sty2;

  return !!((_props$attributes$sty = props.attributes.style) !== null && _props$attributes$sty !== void 0 && (_props$attributes$sty2 = _props$attributes$sty.typography) !== null && _props$attributes$sty2 !== void 0 && _props$attributes$sty2.textDecoration);
}
/**
 * Resets the text decoration block support attribute. This can be used when
 * disabling the text decoration support controls for a block via a progressive
 * discovery panel.
 *
 * @param {Object} props               Block props.
 * @param {Object} props.attributes    Block's attributes.
 * @param {Object} props.setAttributes Function to set block's attributes.
 */

function resetTextDecoration(_ref) {
  let {
    attributes = {},
    setAttributes
  } = _ref;
  const {
    style
  } = attributes;
  setAttributes({
    style: cleanEmptyObject({ ...style,
      typography: { ...(style === null || style === void 0 ? void 0 : style.typography),
        textDecoration: undefined
      }
    })
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/format-uppercase.js


/**
 * WordPress dependencies
 */

const formatUppercase = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M6.1 6.8L2.1 18h1.6l1.1-3h4.3l1.1 3h1.6l-4-11.2H6.1zm-.8 6.8L7 8.9l1.7 4.7H5.3zm15.1-.7c-.4-.5-.9-.8-1.6-1 .4-.2.7-.5.8-.9.2-.4.3-.9.3-1.4 0-.9-.3-1.6-.8-2-.6-.5-1.3-.7-2.4-.7h-3.5V18h4.2c1.1 0 2-.3 2.6-.8.6-.6 1-1.4 1-2.4-.1-.8-.3-1.4-.6-1.9zm-5.7-4.7h1.8c.6 0 1.1.1 1.4.4.3.2.5.7.5 1.3 0 .6-.2 1.1-.5 1.3-.3.2-.8.4-1.4.4h-1.8V8.2zm4 8c-.4.3-.9.5-1.5.5h-2.6v-3.8h2.6c1.4 0 2 .6 2 1.9.1.6-.1 1-.5 1.4z"
}));
/* harmony default export */ var format_uppercase = (formatUppercase);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/format-lowercase.js


/**
 * WordPress dependencies
 */

const formatLowercase = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M11 16.8c-.1-.1-.2-.3-.3-.5v-2.6c0-.9-.1-1.7-.3-2.2-.2-.5-.5-.9-.9-1.2-.4-.2-.9-.3-1.6-.3-.5 0-1 .1-1.5.2s-.9.3-1.2.6l.2 1.2c.4-.3.7-.4 1.1-.5.3-.1.7-.2 1-.2.6 0 1 .1 1.3.4.3.2.4.7.4 1.4-1.2 0-2.3.2-3.3.7s-1.4 1.1-1.4 2.1c0 .7.2 1.2.7 1.6.4.4 1 .6 1.8.6.9 0 1.7-.4 2.4-1.2.1.3.2.5.4.7.1.2.3.3.6.4.3.1.6.1 1.1.1h.1l.2-1.2h-.1c-.4.1-.6 0-.7-.1zM9.2 16c-.2.3-.5.6-.9.8-.3.1-.7.2-1.1.2-.4 0-.7-.1-.9-.3-.2-.2-.3-.5-.3-.9 0-.6.2-1 .7-1.3.5-.3 1.3-.4 2.5-.5v2zm10.6-3.9c-.3-.6-.7-1.1-1.2-1.5-.6-.4-1.2-.6-1.9-.6-.5 0-.9.1-1.4.3-.4.2-.8.5-1.1.8V6h-1.4v12h1.3l.2-1c.2.4.6.6 1 .8.4.2.9.3 1.4.3.7 0 1.2-.2 1.8-.5.5-.4 1-.9 1.3-1.5.3-.6.5-1.3.5-2.1-.1-.6-.2-1.3-.5-1.9zm-1.7 4c-.4.5-.9.8-1.6.8s-1.2-.2-1.7-.7c-.4-.5-.7-1.2-.7-2.1 0-.9.2-1.6.7-2.1.4-.5 1-.7 1.7-.7s1.2.3 1.6.8c.4.5.6 1.2.6 2s-.2 1.4-.6 2z"
}));
/* harmony default export */ var format_lowercase = (formatLowercase);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/format-capitalize.js


/**
 * WordPress dependencies
 */

const formatCapitalize = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M7.1 6.8L3.1 18h1.6l1.1-3h4.3l1.1 3h1.6l-4-11.2H7.1zm-.8 6.8L8 8.9l1.7 4.7H6.3zm14.5-1.5c-.3-.6-.7-1.1-1.2-1.5-.6-.4-1.2-.6-1.9-.6-.5 0-.9.1-1.4.3-.4.2-.8.5-1.1.8V6h-1.4v12h1.3l.2-1c.2.4.6.6 1 .8.4.2.9.3 1.4.3.7 0 1.2-.2 1.8-.5.5-.4 1-.9 1.3-1.5.3-.6.5-1.3.5-2.1-.1-.6-.2-1.3-.5-1.9zm-1.7 4c-.4.5-.9.8-1.6.8s-1.2-.2-1.7-.7c-.4-.5-.7-1.2-.7-2.1 0-.9.2-1.6.7-2.1.4-.5 1-.7 1.7-.7s1.2.3 1.6.8c.4.5.6 1.2.6 2 .1.8-.2 1.4-.6 2z"
}));
/* harmony default export */ var format_capitalize = (formatCapitalize);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/text-transform-control/index.js


/**
 * WordPress dependencies
 */



const TEXT_TRANSFORMS = [{
  name: (0,external_wp_i18n_namespaceObject.__)('Uppercase'),
  value: 'uppercase',
  icon: format_uppercase
}, {
  name: (0,external_wp_i18n_namespaceObject.__)('Lowercase'),
  value: 'lowercase',
  icon: format_lowercase
}, {
  name: (0,external_wp_i18n_namespaceObject.__)('Capitalize'),
  value: 'capitalize',
  icon: format_capitalize
}];
/**
 * Control to facilitate text transform selections.
 *
 * @param {Object}   props          Component props.
 * @param {string}   props.value    Currently selected text transform.
 * @param {Function} props.onChange Handles change in text transform selection.
 *
 * @return {WPElement} Text transform control.
 */

function TextTransformControl(_ref) {
  let {
    value,
    onChange
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)("fieldset", {
    className: "block-editor-text-transform-control"
  }, (0,external_wp_element_namespaceObject.createElement)("legend", null, (0,external_wp_i18n_namespaceObject.__)('Letter case')), (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-text-transform-control__buttons"
  }, TEXT_TRANSFORMS.map(textTransform => {
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
      key: textTransform.value,
      icon: textTransform.icon,
      isSmall: true,
      isPressed: value === textTransform.value,
      "aria-label": textTransform.name,
      onClick: () => onChange(value === textTransform.value ? undefined : textTransform.value)
    });
  })));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/text-transform.js


/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */




/**
 * Key within block settings' supports array indicating support for text
 * transforms e.g. settings found in `block.json`.
 */

const TEXT_TRANSFORM_SUPPORT_KEY = 'typography.__experimentalTextTransform';
/**
 * Inspector control panel containing the text transform options.
 *
 * @param {Object} props Block properties.
 *
 * @return {WPElement} Text transform edit element.
 */

function TextTransformEdit(props) {
  var _style$typography;

  const {
    attributes: {
      style
    },
    setAttributes
  } = props;

  function onChange(newTransform) {
    setAttributes({
      style: cleanEmptyObject({ ...style,
        typography: { ...(style === null || style === void 0 ? void 0 : style.typography),
          textTransform: newTransform
        }
      })
    });
  }

  return (0,external_wp_element_namespaceObject.createElement)(TextTransformControl, {
    value: style === null || style === void 0 ? void 0 : (_style$typography = style.typography) === null || _style$typography === void 0 ? void 0 : _style$typography.textTransform,
    onChange: onChange
  });
}
/**
 * Checks if text-transform settings have been disabled.
 *
 * @param {string} name Name of the block.
 *
 * @return {boolean} Whether or not the setting is disabled.
 */

function useIsTextTransformDisabled() {
  let {
    name: blockName
  } = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  const notSupported = !(0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockName, TEXT_TRANSFORM_SUPPORT_KEY);
  const hasTextTransforms = useSetting('typography.textTransform');
  return notSupported || !hasTextTransforms;
}
/**
 * Checks if there is a current value set for the text transform block support.
 *
 * @param {Object} props Block props.
 * @return {boolean}     Whether or not the block has a text transform set.
 */

function hasTextTransformValue(props) {
  var _props$attributes$sty, _props$attributes$sty2;

  return !!((_props$attributes$sty = props.attributes.style) !== null && _props$attributes$sty !== void 0 && (_props$attributes$sty2 = _props$attributes$sty.typography) !== null && _props$attributes$sty2 !== void 0 && _props$attributes$sty2.textTransform);
}
/**
 * Resets the text transform block support attribute. This can be used when
 * disabling the text transform support controls for a block via a progressive
 * discovery panel.
 *
 * @param {Object} props               Block props.
 * @param {Object} props.attributes    Block's attributes.
 * @param {Object} props.setAttributes Function to set block's attributes.
 */

function resetTextTransform(_ref) {
  let {
    attributes = {},
    setAttributes
  } = _ref;
  const {
    style
  } = attributes;
  setAttributes({
    style: cleanEmptyObject({ ...style,
      typography: { ...(style === null || style === void 0 ? void 0 : style.typography),
        textTransform: undefined
      }
    })
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/letter-spacing-control/index.js


/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


/**
 * Control for letter-spacing.
 *
 * @param {Object}                  props                      Component props.
 * @param {string}                  props.value                Currently selected letter-spacing.
 * @param {Function}                props.onChange             Handles change in letter-spacing selection.
 * @param {string|number|undefined} props.__unstableInputWidth Input width to pass through to inner UnitControl. Should be a valid CSS value.
 *
 * @return {WPElement} Letter-spacing control.
 */

function LetterSpacingControl(_ref) {
  let {
    value,
    onChange,
    __unstableInputWidth = '60px'
  } = _ref;
  const units = (0,external_wp_components_namespaceObject.__experimentalUseCustomUnits)({
    availableUnits: useSetting('spacing.units') || ['px', 'em', 'rem'],
    defaultValues: {
      px: 2,
      em: 0.2,
      rem: 0.2
    }
  });
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalUnitControl, {
    label: (0,external_wp_i18n_namespaceObject.__)('Letter spacing'),
    value: value,
    __unstableInputWidth: __unstableInputWidth,
    units: units,
    onChange: onChange
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/letter-spacing.js


/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */




/**
 * Key within block settings' supports array indicating support for letter-spacing
 * e.g. settings found in `block.json`.
 */

const LETTER_SPACING_SUPPORT_KEY = 'typography.__experimentalLetterSpacing';
/**
 * Inspector control panel containing the letter-spacing options.
 *
 * @param {Object} props Block properties.
 * @return {WPElement}    Letter-spacing edit element.
 */

function LetterSpacingEdit(props) {
  var _style$typography;

  const {
    attributes: {
      style
    },
    setAttributes
  } = props;

  function onChange(newSpacing) {
    setAttributes({
      style: cleanEmptyObject({ ...style,
        typography: { ...(style === null || style === void 0 ? void 0 : style.typography),
          letterSpacing: newSpacing
        }
      })
    });
  }

  return (0,external_wp_element_namespaceObject.createElement)(LetterSpacingControl, {
    value: style === null || style === void 0 ? void 0 : (_style$typography = style.typography) === null || _style$typography === void 0 ? void 0 : _style$typography.letterSpacing,
    onChange: onChange,
    __unstableInputWidth: '100%'
  });
}
/**
 * Checks if letter-spacing settings have been disabled.
 *
 * @param {string} name Name of the block.
 * @return {boolean}     Whether or not the setting is disabled.
 */

function useIsLetterSpacingDisabled() {
  let {
    name: blockName
  } = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  const notSupported = !(0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockName, LETTER_SPACING_SUPPORT_KEY);
  const hasLetterSpacing = useSetting('typography.letterSpacing');
  return notSupported || !hasLetterSpacing;
}
/**
 * Checks if there is a current value set for the letter spacing block support.
 *
 * @param {Object} props Block props.
 * @return {boolean}     Whether or not the block has a letter spacing set.
 */

function hasLetterSpacingValue(props) {
  var _props$attributes$sty, _props$attributes$sty2;

  return !!((_props$attributes$sty = props.attributes.style) !== null && _props$attributes$sty !== void 0 && (_props$attributes$sty2 = _props$attributes$sty.typography) !== null && _props$attributes$sty2 !== void 0 && _props$attributes$sty2.letterSpacing);
}
/**
 * Resets the letter spacing block support attribute. This can be used when
 * disabling the letter spacing support controls for a block via a progressive
 * discovery panel.
 *
 * @param {Object} props               Block props.
 * @param {Object} props.attributes    Block's attributes.
 * @param {Object} props.setAttributes Function to set block's attributes.
 */

function resetLetterSpacing(_ref) {
  let {
    attributes = {},
    setAttributes
  } = _ref;
  const {
    style
  } = attributes;
  setAttributes({
    style: cleanEmptyObject({ ...style,
      typography: { ...(style === null || style === void 0 ? void 0 : style.typography),
        letterSpacing: undefined
      }
    })
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/typography.js


/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */










const TYPOGRAPHY_SUPPORT_KEY = 'typography';
const TYPOGRAPHY_SUPPORT_KEYS = [LINE_HEIGHT_SUPPORT_KEY, FONT_SIZE_SUPPORT_KEY, FONT_STYLE_SUPPORT_KEY, FONT_WEIGHT_SUPPORT_KEY, FONT_FAMILY_SUPPORT_KEY, TEXT_DECORATION_SUPPORT_KEY, TEXT_TRANSFORM_SUPPORT_KEY, LETTER_SPACING_SUPPORT_KEY];
function TypographyPanel(props) {
  const {
    clientId
  } = props;
  const isFontFamilyDisabled = useIsFontFamilyDisabled(props);
  const isFontSizeDisabled = useIsFontSizeDisabled(props);
  const isFontAppearanceDisabled = useIsFontAppearanceDisabled(props);
  const isLineHeightDisabled = useIsLineHeightDisabled(props);
  const isTextDecorationDisabled = useIsTextDecorationDisabled(props);
  const isTextTransformDisabled = useIsTextTransformDisabled(props);
  const isLetterSpacingDisabled = useIsLetterSpacingDisabled(props);
  const hasFontStyles = !useIsFontStyleDisabled(props);
  const hasFontWeights = !useIsFontWeightDisabled(props);
  const isDisabled = useIsTypographyDisabled(props);
  const isSupported = hasTypographySupport(props.name);
  if (isDisabled || !isSupported) return null;
  const defaultControls = (0,external_wp_blocks_namespaceObject.getBlockSupport)(props.name, [TYPOGRAPHY_SUPPORT_KEY, '__experimentalDefaultControls']);

  const createResetAllFilter = attribute => newAttributes => {
    var _newAttributes$style;

    return { ...newAttributes,
      style: { ...newAttributes.style,
        typography: { ...((_newAttributes$style = newAttributes.style) === null || _newAttributes$style === void 0 ? void 0 : _newAttributes$style.typography),
          [attribute]: undefined
        }
      }
    };
  };

  return (0,external_wp_element_namespaceObject.createElement)(inspector_controls, {
    __experimentalGroup: "typography"
  }, !isFontFamilyDisabled && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToolsPanelItem, {
    hasValue: () => hasFontFamilyValue(props),
    label: (0,external_wp_i18n_namespaceObject.__)('Font family'),
    onDeselect: () => resetFontFamily(props),
    isShownByDefault: defaultControls === null || defaultControls === void 0 ? void 0 : defaultControls.fontFamily,
    resetAllFilter: newAttributes => ({ ...newAttributes,
      fontFamily: undefined
    }),
    panelId: clientId
  }, (0,external_wp_element_namespaceObject.createElement)(FontFamilyEdit, props)), !isFontSizeDisabled && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToolsPanelItem, {
    hasValue: () => hasFontSizeValue(props),
    label: (0,external_wp_i18n_namespaceObject.__)('Font size'),
    onDeselect: () => resetFontSize(props),
    isShownByDefault: defaultControls === null || defaultControls === void 0 ? void 0 : defaultControls.fontSize,
    resetAllFilter: newAttributes => {
      var _newAttributes$style2;

      return { ...newAttributes,
        fontSize: undefined,
        style: { ...newAttributes.style,
          typography: { ...((_newAttributes$style2 = newAttributes.style) === null || _newAttributes$style2 === void 0 ? void 0 : _newAttributes$style2.typography),
            fontSize: undefined
          }
        }
      };
    },
    panelId: clientId
  }, (0,external_wp_element_namespaceObject.createElement)(FontSizeEdit, props)), !isFontAppearanceDisabled && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToolsPanelItem, {
    className: "single-column",
    hasValue: () => hasFontAppearanceValue(props),
    label: getFontAppearanceLabel(hasFontStyles, hasFontWeights),
    onDeselect: () => resetFontAppearance(props),
    isShownByDefault: defaultControls === null || defaultControls === void 0 ? void 0 : defaultControls.fontAppearance,
    resetAllFilter: newAttributes => {
      var _newAttributes$style3;

      return { ...newAttributes,
        style: { ...newAttributes.style,
          typography: { ...((_newAttributes$style3 = newAttributes.style) === null || _newAttributes$style3 === void 0 ? void 0 : _newAttributes$style3.typography),
            fontStyle: undefined,
            fontWeight: undefined
          }
        }
      };
    },
    panelId: clientId
  }, (0,external_wp_element_namespaceObject.createElement)(FontAppearanceEdit, props)), !isLineHeightDisabled && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToolsPanelItem, {
    className: "single-column",
    hasValue: () => hasLineHeightValue(props),
    label: (0,external_wp_i18n_namespaceObject.__)('Line height'),
    onDeselect: () => resetLineHeight(props),
    isShownByDefault: defaultControls === null || defaultControls === void 0 ? void 0 : defaultControls.lineHeight,
    resetAllFilter: createResetAllFilter('lineHeight'),
    panelId: clientId
  }, (0,external_wp_element_namespaceObject.createElement)(LineHeightEdit, props)), !isTextDecorationDisabled && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToolsPanelItem, {
    className: "single-column",
    hasValue: () => hasTextDecorationValue(props),
    label: (0,external_wp_i18n_namespaceObject.__)('Decoration'),
    onDeselect: () => resetTextDecoration(props),
    isShownByDefault: defaultControls === null || defaultControls === void 0 ? void 0 : defaultControls.textDecoration,
    resetAllFilter: createResetAllFilter('textDecoration'),
    panelId: clientId
  }, (0,external_wp_element_namespaceObject.createElement)(TextDecorationEdit, props)), !isTextTransformDisabled && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToolsPanelItem, {
    className: "single-column",
    hasValue: () => hasTextTransformValue(props),
    label: (0,external_wp_i18n_namespaceObject.__)('Letter case'),
    onDeselect: () => resetTextTransform(props),
    isShownByDefault: defaultControls === null || defaultControls === void 0 ? void 0 : defaultControls.textTransform,
    resetAllFilter: createResetAllFilter('textTransform'),
    panelId: clientId
  }, (0,external_wp_element_namespaceObject.createElement)(TextTransformEdit, props)), !isLetterSpacingDisabled && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalToolsPanelItem, {
    className: "single-column",
    hasValue: () => hasLetterSpacingValue(props),
    label: (0,external_wp_i18n_namespaceObject.__)('Letter spacing'),
    onDeselect: () => resetLetterSpacing(props),
    isShownByDefault: defaultControls === null || defaultControls === void 0 ? void 0 : defaultControls.letterSpacing,
    resetAllFilter: createResetAllFilter('letterSpacing'),
    panelId: clientId
  }, (0,external_wp_element_namespaceObject.createElement)(LetterSpacingEdit, props)));
}
const hasTypographySupport = blockName => {
  return TYPOGRAPHY_SUPPORT_KEYS.some(key => (0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockName, key));
};

function useIsTypographyDisabled() {
  let props = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  const configs = [useIsFontAppearanceDisabled(props), useIsFontSizeDisabled(props), useIsLineHeightDisabled(props), useIsFontFamilyDisabled(props), useIsTextDecorationDisabled(props), useIsTextTransformDisabled(props), useIsLetterSpacingDisabled(props)];
  return configs.filter(Boolean).length === configs.length;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/style.js



/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */








const styleSupportKeys = [...TYPOGRAPHY_SUPPORT_KEYS, BORDER_SUPPORT_KEY, COLOR_SUPPORT_KEY, SPACING_SUPPORT_KEY];

const hasStyleSupport = blockType => styleSupportKeys.some(key => (0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockType, key));

const VARIABLE_REFERENCE_PREFIX = 'var:';
const VARIABLE_PATH_SEPARATOR_TOKEN_ATTRIBUTE = '|';
const VARIABLE_PATH_SEPARATOR_TOKEN_STYLE = '--';

function compileStyleValue(uncompiledValue) {
  if ((0,external_lodash_namespaceObject.startsWith)(uncompiledValue, VARIABLE_REFERENCE_PREFIX)) {
    const variable = uncompiledValue.slice(VARIABLE_REFERENCE_PREFIX.length).split(VARIABLE_PATH_SEPARATOR_TOKEN_ATTRIBUTE).join(VARIABLE_PATH_SEPARATOR_TOKEN_STYLE);
    return `var(--wp--${variable})`;
  }

  return uncompiledValue;
}
/**
 * Returns the inline styles to add depending on the style object
 *
 * @param {Object} styles Styles configuration.
 *
 * @return {Object} Flattened CSS variables declaration.
 */


function getInlineStyles() {
  let styles = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  const ignoredStyles = ['spacing.blockGap'];
  const output = {};
  Object.keys(external_wp_blocks_namespaceObject.__EXPERIMENTAL_STYLE_PROPERTY).forEach(propKey => {
    const path = external_wp_blocks_namespaceObject.__EXPERIMENTAL_STYLE_PROPERTY[propKey].value;
    const subPaths = external_wp_blocks_namespaceObject.__EXPERIMENTAL_STYLE_PROPERTY[propKey].properties; // Ignore styles on elements because they are handled on the server.

    if ((0,external_lodash_namespaceObject.has)(styles, path) && 'elements' !== (0,external_lodash_namespaceObject.first)(path)) {
      // Checking if style value is a string allows for shorthand css
      // option and backwards compatibility for border radius support.
      const styleValue = (0,external_lodash_namespaceObject.get)(styles, path);

      if (!external_wp_blocks_namespaceObject.__EXPERIMENTAL_STYLE_PROPERTY[propKey].useEngine) {
        if (!!subPaths && !(0,external_lodash_namespaceObject.isString)(styleValue)) {
          Object.entries(subPaths).forEach(entry => {
            const [name, subPath] = entry;
            const value = (0,external_lodash_namespaceObject.get)(styleValue, [subPath]);

            if (value) {
              output[name] = compileStyleValue(value);
            }
          });
        } else if (!ignoredStyles.includes(path.join('.'))) {
          output[propKey] = compileStyleValue((0,external_lodash_namespaceObject.get)(styles, path));
        }
      }
    }
  }); // The goal is to move everything to server side generated engine styles
  // This is temporary as we absorb more and more styles into the engine.

  const extraRules = getCSSRules(styles, {
    selector: 'self'
  });
  extraRules.forEach(rule => {
    if (rule.selector !== 'self') {
      throw "This style can't be added as inline style";
    }

    output[rule.key] = rule.value;
  });
  return output;
}

function compileElementsStyles(selector) {
  let elements = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
  return (0,external_lodash_namespaceObject.map)(elements, (styles, element) => {
    const elementStyles = getInlineStyles(styles);

    if (!(0,external_lodash_namespaceObject.isEmpty)(elementStyles)) {
      // The .editor-styles-wrapper selector is required on elements styles. As it is
      // added to all other editor styles, not providing it causes reset and global
      // styles to override element styles because of higher specificity.
      return [`.editor-styles-wrapper .${selector} ${external_wp_blocks_namespaceObject.__EXPERIMENTAL_ELEMENTS[element]}{`, ...(0,external_lodash_namespaceObject.map)(elementStyles, (value, property) => `\t${(0,external_lodash_namespaceObject.kebabCase)(property)}: ${value};`), '}'].join('\n');
    }

    return '';
  }).join('\n');
}
/**
 * Filters registered block settings, extending attributes to include `style` attribute.
 *
 * @param {Object} settings Original block settings.
 *
 * @return {Object} Filtered block settings.
 */


function style_addAttribute(settings) {
  if (!hasStyleSupport(settings)) {
    return settings;
  } // Allow blocks to specify their own attribute definition with default values if needed.


  if (!settings.attributes.style) {
    Object.assign(settings.attributes, {
      style: {
        type: 'object'
      }
    });
  }

  return settings;
}
/**
 * A dictionary of paths to flag skipping block support serialization as the key,
 * with values providing the style paths to be omitted from serialization.
 *
 * @constant
 * @type {Record<string, string[]>}
 */


const skipSerializationPathsEdit = {
  [`${BORDER_SUPPORT_KEY}.__experimentalSkipSerialization`]: ['border'],
  [`${COLOR_SUPPORT_KEY}.__experimentalSkipSerialization`]: [COLOR_SUPPORT_KEY],
  [`${TYPOGRAPHY_SUPPORT_KEY}.__experimentalSkipSerialization`]: [TYPOGRAPHY_SUPPORT_KEY],
  [`${SPACING_SUPPORT_KEY}.__experimentalSkipSerialization`]: ['spacing']
};
/**
 * A dictionary of paths to flag skipping block support serialization as the key,
 * with values providing the style paths to be omitted from serialization.
 *
 * Extends the Edit skip paths to enable skipping additional paths in just
 * the Save component. This allows a block support to be serialized within the
 * editor, while using an alternate approach, such as server-side rendering, when
 * the support is saved.
 *
 * @constant
 * @type {Record<string, string[]>}
 */

const skipSerializationPathsSave = { ...skipSerializationPathsEdit,
  [`${SPACING_SUPPORT_KEY}`]: ['spacing.blockGap']
};
/**
 * A dictionary used to normalize feature names between support flags, style
 * object properties and __experimentSkipSerialization configuration arrays.
 *
 * This allows not having to provide a migration for a support flag and possible
 * backwards compatibility bridges, while still achieving consistency between
 * the support flag and the skip serialization array.
 *
 * @constant
 * @type {Record<string, string>}
 */

const renamedFeatures = {
  gradients: 'gradient'
};
/**
 * Override props assigned to save component to inject the CSS variables definition.
 *
 * @param {Object}                    props      Additional props applied to save element.
 * @param {Object}                    blockType  Block type.
 * @param {Object}                    attributes Block attributes.
 * @param {?Record<string, string[]>} skipPaths  An object of keys and paths to skip serialization.
 *
 * @return {Object} Filtered props applied to save element.
 */

function style_addSaveProps(props, blockType, attributes) {
  let skipPaths = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : skipSerializationPathsSave;

  if (!hasStyleSupport(blockType)) {
    return props;
  }

  let {
    style
  } = attributes;
  (0,external_lodash_namespaceObject.forEach)(skipPaths, (path, indicator) => {
    const skipSerialization = (0,external_wp_blocks_namespaceObject.getBlockSupport)(blockType, indicator);

    if (skipSerialization === true) {
      style = (0,external_lodash_namespaceObject.omit)(style, path);
    }

    if (Array.isArray(skipSerialization)) {
      skipSerialization.forEach(featureName => {
        const feature = renamedFeatures[featureName] || featureName;
        style = (0,external_lodash_namespaceObject.omit)(style, [[...path, feature]]);
      });
    }
  });
  props.style = { ...getInlineStyles(style),
    ...props.style
  };
  return props;
}
/**
 * Filters registered block settings to extend the block edit wrapper
 * to apply the desired styles and classnames properly.
 *
 * @param {Object} settings Original block settings.
 *
 * @return {Object}.Filtered block settings.
 */

function style_addEditProps(settings) {
  if (!hasStyleSupport(settings)) {
    return settings;
  }

  const existingGetEditWrapperProps = settings.getEditWrapperProps;

  settings.getEditWrapperProps = attributes => {
    let props = {};

    if (existingGetEditWrapperProps) {
      props = existingGetEditWrapperProps(attributes);
    }

    return style_addSaveProps(props, settings, attributes, skipSerializationPathsEdit);
  };

  return settings;
}
/**
 * Override the default edit UI to include new inspector controls for
 * all the custom styles configs.
 *
 * @param {Function} BlockEdit Original component.
 *
 * @return {Function} Wrapped component.
 */

const withBlockControls = (0,external_wp_compose_namespaceObject.createHigherOrderComponent)(BlockEdit => props => {
  const shouldDisplayControls = useDisplayBlockControls();
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, shouldDisplayControls && (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(ColorEdit, props), (0,external_wp_element_namespaceObject.createElement)(TypographyPanel, props), (0,external_wp_element_namespaceObject.createElement)(BorderPanel, props), (0,external_wp_element_namespaceObject.createElement)(DimensionsPanel, props)), (0,external_wp_element_namespaceObject.createElement)(BlockEdit, props));
}, 'withToolbarControls');
/**
 * Override the default block element to include duotone styles.
 *
 * @param {Function} BlockListBlock Original component
 * @return {Function}                Wrapped component
 */

const withElementsStyles = (0,external_wp_compose_namespaceObject.createHigherOrderComponent)(BlockListBlock => props => {
  var _props$attributes$sty, _props$attributes$sty2;

  const blockElementsContainerIdentifier = `wp-elements-${(0,external_wp_compose_namespaceObject.useInstanceId)(BlockListBlock)}`;
  const skipLinkColorSerialization = shouldSkipSerialization(props.name, COLOR_SUPPORT_KEY, 'link'); // The Elements API only supports link colors for now,
  // hence the specific omission of `link` in the elements styles.
  // This might need to be refactored or removed if the Elements API
  // changes or `link` supports styles beyond `color`.

  const elements = skipLinkColorSerialization ? (0,external_lodash_namespaceObject.omit)((_props$attributes$sty = props.attributes.style) === null || _props$attributes$sty === void 0 ? void 0 : _props$attributes$sty.elements, ['link']) : (_props$attributes$sty2 = props.attributes.style) === null || _props$attributes$sty2 === void 0 ? void 0 : _props$attributes$sty2.elements;
  const styles = compileElementsStyles(blockElementsContainerIdentifier, elements);
  const element = (0,external_wp_element_namespaceObject.useContext)(BlockList.__unstableElementContext);
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, elements && element && (0,external_wp_element_namespaceObject.createPortal)((0,external_wp_element_namespaceObject.createElement)("style", {
    dangerouslySetInnerHTML: {
      __html: styles
    }
  }), element), (0,external_wp_element_namespaceObject.createElement)(BlockListBlock, _extends({}, props, {
    className: elements ? classnames_default()(props.className, blockElementsContainerIdentifier) : props.className
  })));
});
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.registerBlockType', 'core/style/addAttribute', style_addAttribute);
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.getSaveContent.extraProps', 'core/style/addSaveProps', style_addSaveProps);
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.registerBlockType', 'core/style/addEditProps', style_addEditProps);
(0,external_wp_hooks_namespaceObject.addFilter)('editor.BlockEdit', 'core/style/with-block-controls', withBlockControls);
(0,external_wp_hooks_namespaceObject.addFilter)('editor.BlockListBlock', 'core/editor/with-elements-styles', withElementsStyles);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/duotone-control/index.js


/**
 * WordPress dependencies
 */




function DuotoneControl(_ref) {
  let {
    colorPalette,
    duotonePalette,
    disableCustomColors,
    disableCustomDuotone,
    value,
    onChange
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Dropdown, {
    popoverProps: {
      className: 'block-editor-duotone-control__popover',
      headerTitle: (0,external_wp_i18n_namespaceObject.__)('Duotone'),
      isAlternate: true
    },
    renderToggle: _ref2 => {
      let {
        isOpen,
        onToggle
      } = _ref2;

      const openOnArrowDown = event => {
        if (!isOpen && event.keyCode === external_wp_keycodes_namespaceObject.DOWN) {
          event.preventDefault();
          onToggle();
        }
      };

      return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarButton, {
        showTooltip: true,
        onClick: onToggle,
        "aria-haspopup": "true",
        "aria-expanded": isOpen,
        onKeyDown: openOnArrowDown,
        label: (0,external_wp_i18n_namespaceObject.__)('Apply duotone filter'),
        icon: (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.DuotoneSwatch, {
          values: value
        })
      });
    },
    renderContent: () => (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuGroup, {
      label: (0,external_wp_i18n_namespaceObject.__)('Duotone')
    }, (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "block-editor-duotone-control__description"
    }, (0,external_wp_i18n_namespaceObject.__)('Create a two-tone color effect without losing your original image.')), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.DuotonePicker, {
      colorPalette: colorPalette,
      duotonePalette: duotonePalette,
      disableCustomColors: disableCustomColors,
      disableCustomDuotone: disableCustomDuotone,
      value: value,
      onChange: onChange
    }))
  });
}

/* harmony default export */ var duotone_control = (DuotoneControl);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/duotone.js



/**
 * External dependencies
 */



/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */



const duotone_EMPTY_ARRAY = [];
k([names]);
/**
 * Convert a list of colors to an object of R, G, and B values.
 *
 * @param {string[]} colors Array of RBG color strings.
 *
 * @return {Object} R, G, and B values.
 */

function getValuesFromColors() {
  let colors = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : [];
  const values = {
    r: [],
    g: [],
    b: [],
    a: []
  };
  colors.forEach(color => {
    const rgbColor = w(color).toRgb();
    values.r.push(rgbColor.r / 255);
    values.g.push(rgbColor.g / 255);
    values.b.push(rgbColor.b / 255);
    values.a.push(rgbColor.a);
  });
  return values;
}
/**
 * Values for the SVG `feComponentTransfer`.
 *
 * @typedef Values {Object}
 * @property {number[]} r Red values.
 * @property {number[]} g Green values.
 * @property {number[]} b Blue values.
 * @property {number[]} a Alpha values.
 */

/**
 * Stylesheet for rendering the duotone filter.
 *
 * @param {Object} props          Duotone props.
 * @param {string} props.selector Selector to apply the filter to.
 * @param {string} props.id       Unique id for this duotone filter.
 *
 * @return {WPElement} Duotone element.
 */

function DuotoneStylesheet(_ref) {
  let {
    selector,
    id
  } = _ref;
  const css = `
${selector} {
	filter: url( #${id} );
}
`;
  return (0,external_wp_element_namespaceObject.createElement)("style", null, css);
}
/**
 * SVG for rendering the duotone filter.
 *
 * @param {Object} props        Duotone props.
 * @param {string} props.id     Unique id for this duotone filter.
 * @param {Values} props.values R, G, B, and A values to filter with.
 *
 * @return {WPElement} Duotone element.
 */


function DuotoneFilter(_ref2) {
  let {
    id,
    values
  } = _ref2;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.SVG, {
    xmlnsXlink: "http://www.w3.org/1999/xlink",
    viewBox: "0 0 0 0",
    width: "0",
    height: "0",
    focusable: "false",
    role: "none",
    style: {
      visibility: 'hidden',
      position: 'absolute',
      left: '-9999px',
      overflow: 'hidden'
    }
  }, (0,external_wp_element_namespaceObject.createElement)("defs", null, (0,external_wp_element_namespaceObject.createElement)("filter", {
    id: id
  }, (0,external_wp_element_namespaceObject.createElement)("feColorMatrix", {
    // Use sRGB instead of linearRGB so transparency looks correct.
    colorInterpolationFilters: "sRGB",
    type: "matrix" // Use perceptual brightness to convert to grayscale.
    ,
    values: " .299 .587 .114 0 0 .299 .587 .114 0 0 .299 .587 .114 0 0 .299 .587 .114 0 0 "
  }), (0,external_wp_element_namespaceObject.createElement)("feComponentTransfer", {
    // Use sRGB instead of linearRGB to be consistent with how CSS gradients work.
    colorInterpolationFilters: "sRGB"
  }, (0,external_wp_element_namespaceObject.createElement)("feFuncR", {
    type: "table",
    tableValues: values.r.join(' ')
  }), (0,external_wp_element_namespaceObject.createElement)("feFuncG", {
    type: "table",
    tableValues: values.g.join(' ')
  }), (0,external_wp_element_namespaceObject.createElement)("feFuncB", {
    type: "table",
    tableValues: values.b.join(' ')
  }), (0,external_wp_element_namespaceObject.createElement)("feFuncA", {
    type: "table",
    tableValues: values.a.join(' ')
  })), (0,external_wp_element_namespaceObject.createElement)("feComposite", {
    // Re-mask the image with the original transparency since the feColorMatrix above loses that information.
    in2: "SourceGraphic",
    operator: "in"
  }))));
}
/**
 * SVG and stylesheet needed for rendering the duotone filter.
 *
 * @param {Object} props          Duotone props.
 * @param {string} props.selector Selector to apply the filter to.
 * @param {string} props.id       Unique id for this duotone filter.
 * @param {Values} props.values   R, G, B, and A values to filter with.
 *
 * @return {WPElement} Duotone element.
 */


function InlineDuotone(_ref3) {
  let {
    selector,
    id,
    values
  } = _ref3;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(DuotoneFilter, {
    id: id,
    values: values
  }), (0,external_wp_element_namespaceObject.createElement)(DuotoneStylesheet, {
    id: id,
    selector: selector
  }));
}

function useMultiOriginPresets(_ref4) {
  let {
    presetSetting,
    defaultSetting
  } = _ref4;
  const disableDefault = !useSetting(defaultSetting);
  const userPresets = useSetting(`${presetSetting}.custom`) || duotone_EMPTY_ARRAY;
  const themePresets = useSetting(`${presetSetting}.theme`) || duotone_EMPTY_ARRAY;
  const defaultPresets = useSetting(`${presetSetting}.default`) || duotone_EMPTY_ARRAY;
  return (0,external_wp_element_namespaceObject.useMemo)(() => [...userPresets, ...themePresets, ...(disableDefault ? duotone_EMPTY_ARRAY : defaultPresets)], [disableDefault, userPresets, themePresets, defaultPresets]);
}

function DuotonePanel(_ref5) {
  var _style$color;

  let {
    attributes,
    setAttributes
  } = _ref5;
  const style = attributes === null || attributes === void 0 ? void 0 : attributes.style;
  const duotone = style === null || style === void 0 ? void 0 : (_style$color = style.color) === null || _style$color === void 0 ? void 0 : _style$color.duotone;
  const duotonePalette = useMultiOriginPresets({
    presetSetting: 'color.duotone',
    defaultSetting: 'color.defaultDuotone'
  });
  const colorPalette = useMultiOriginPresets({
    presetSetting: 'color.palette',
    defaultSetting: 'color.defaultPalette'
  });
  const disableCustomColors = !useSetting('color.custom');
  const disableCustomDuotone = !useSetting('color.customDuotone') || (colorPalette === null || colorPalette === void 0 ? void 0 : colorPalette.length) === 0 && disableCustomColors;

  if ((duotonePalette === null || duotonePalette === void 0 ? void 0 : duotonePalette.length) === 0 && disableCustomDuotone) {
    return null;
  }

  return (0,external_wp_element_namespaceObject.createElement)(block_controls, {
    group: "block",
    __experimentalShareWithChildBlocks: true
  }, (0,external_wp_element_namespaceObject.createElement)(duotone_control, {
    duotonePalette: duotonePalette,
    colorPalette: colorPalette,
    disableCustomDuotone: disableCustomDuotone,
    disableCustomColors: disableCustomColors,
    value: duotone,
    onChange: newDuotone => {
      const newStyle = { ...style,
        color: { ...(style === null || style === void 0 ? void 0 : style.color),
          duotone: newDuotone
        }
      };
      setAttributes({
        style: newStyle
      });
    }
  }));
}
/**
 * Filters registered block settings, extending attributes to include
 * the `duotone` attribute.
 *
 * @param {Object} settings Original block settings.
 *
 * @return {Object} Filtered block settings.
 */


function addDuotoneAttributes(settings) {
  if (!(0,external_wp_blocks_namespaceObject.hasBlockSupport)(settings, 'color.__experimentalDuotone')) {
    return settings;
  } // Allow blocks to specify their own attribute definition with default
  // values if needed.


  if (!settings.attributes.style) {
    Object.assign(settings.attributes, {
      style: {
        type: 'object'
      }
    });
  }

  return settings;
}
/**
 * Override the default edit UI to include toolbar controls for duotone if the
 * block supports duotone.
 *
 * @param {Function} BlockEdit Original component.
 *
 * @return {Function} Wrapped component.
 */


const withDuotoneControls = (0,external_wp_compose_namespaceObject.createHigherOrderComponent)(BlockEdit => props => {
  const hasDuotoneSupport = (0,external_wp_blocks_namespaceObject.hasBlockSupport)(props.name, 'color.__experimentalDuotone');
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(BlockEdit, props), hasDuotoneSupport && (0,external_wp_element_namespaceObject.createElement)(DuotonePanel, props));
}, 'withDuotoneControls');
/**
 * Function that scopes a selector with another one. This works a bit like
 * SCSS nesting except the `&` operator isn't supported.
 *
 * @example
 * ```js
 * const scope = '.a, .b .c';
 * const selector = '> .x, .y';
 * const merged = scopeSelector( scope, selector );
 * // merged is '.a > .x, .a .y, .b .c > .x, .b .c .y'
 * ```
 *
 * @param {string} scope    Selector to scope to.
 * @param {string} selector Original selector.
 *
 * @return {string} Scoped selector.
 */

function scopeSelector(scope, selector) {
  const scopes = scope.split(',');
  const selectors = selector.split(',');
  const selectorsScoped = [];
  scopes.forEach(outer => {
    selectors.forEach(inner => {
      selectorsScoped.push(`${outer.trim()} ${inner.trim()}`);
    });
  });
  return selectorsScoped.join(', ');
}
/**
 * Override the default block element to include duotone styles.
 *
 * @param {Function} BlockListBlock Original component.
 *
 * @return {Function} Wrapped component.
 */


const withDuotoneStyles = (0,external_wp_compose_namespaceObject.createHigherOrderComponent)(BlockListBlock => props => {
  var _props$attributes, _props$attributes$sty, _props$attributes$sty2;

  const duotoneSupport = (0,external_wp_blocks_namespaceObject.getBlockSupport)(props.name, 'color.__experimentalDuotone');
  const values = props === null || props === void 0 ? void 0 : (_props$attributes = props.attributes) === null || _props$attributes === void 0 ? void 0 : (_props$attributes$sty = _props$attributes.style) === null || _props$attributes$sty === void 0 ? void 0 : (_props$attributes$sty2 = _props$attributes$sty.color) === null || _props$attributes$sty2 === void 0 ? void 0 : _props$attributes$sty2.duotone;

  if (!duotoneSupport || !values) {
    return (0,external_wp_element_namespaceObject.createElement)(BlockListBlock, props);
  }

  const id = `wp-duotone-${(0,external_wp_compose_namespaceObject.useInstanceId)(BlockListBlock)}`; // Extra .editor-styles-wrapper specificity is needed in the editor
  // since we're not using inline styles to apply the filter. We need to
  // override duotone applied by global styles and theme.json.

  const selectorsGroup = scopeSelector(`.editor-styles-wrapper .${id}`, duotoneSupport);
  const className = classnames_default()(props === null || props === void 0 ? void 0 : props.className, id);
  const element = (0,external_wp_element_namespaceObject.useContext)(BlockList.__unstableElementContext);
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, element && (0,external_wp_element_namespaceObject.createPortal)((0,external_wp_element_namespaceObject.createElement)(InlineDuotone, {
    selector: selectorsGroup,
    id: id,
    values: getValuesFromColors(values)
  }), element), (0,external_wp_element_namespaceObject.createElement)(BlockListBlock, _extends({}, props, {
    className: className
  })));
}, 'withDuotoneStyles');
function PresetDuotoneFilter(_ref6) {
  let {
    preset
  } = _ref6;
  return (0,external_wp_element_namespaceObject.createElement)(DuotoneFilter, {
    id: `wp-duotone-${preset.slug}`,
    values: getValuesFromColors(preset.colors)
  });
}
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.registerBlockType', 'core/editor/duotone/add-attributes', addDuotoneAttributes);
(0,external_wp_hooks_namespaceObject.addFilter)('editor.BlockEdit', 'core/editor/duotone/with-editor-controls', withDuotoneControls);
(0,external_wp_hooks_namespaceObject.addFilter)('editor.BlockListBlock', 'core/editor/duotone/with-styles', withDuotoneStyles);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/layout.js



/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */








/**
 * Internal dependencies
 */







const layoutBlockSupportKey = '__experimentalLayout';
/**
 * Generates the utility classnames for the given blocks layout attributes.
 * This method was primarily added to reintroduce classnames that were removed
 * in the 5.9 release (https://github.com/WordPress/gutenberg/issues/38719), rather
 * than providing an extensive list of all possible layout classes. The plan is to
 * have the style engine generate a more extensive list of utility classnames which
 * will then replace this method.
 *
 * @param { Array } attributes Array of block attributes.
 *
 * @return { Array } Array of CSS classname strings.
 */

function getLayoutClasses(attributes) {
  var _attributes$layout, _attributes$layout2, _attributes$layout3;

  const layoutClassnames = [];

  if (!attributes.layout) {
    return layoutClassnames;
  }

  if (attributes !== null && attributes !== void 0 && (_attributes$layout = attributes.layout) !== null && _attributes$layout !== void 0 && _attributes$layout.orientation) {
    layoutClassnames.push(`is-${(0,external_lodash_namespaceObject.kebabCase)(attributes.layout.orientation)}`);
  }

  if (attributes !== null && attributes !== void 0 && (_attributes$layout2 = attributes.layout) !== null && _attributes$layout2 !== void 0 && _attributes$layout2.justifyContent) {
    layoutClassnames.push(`is-content-justification-${(0,external_lodash_namespaceObject.kebabCase)(attributes.layout.justifyContent)}`);
  }

  if (attributes !== null && attributes !== void 0 && (_attributes$layout3 = attributes.layout) !== null && _attributes$layout3 !== void 0 && _attributes$layout3.flexWrap && attributes.layout.flexWrap === 'nowrap') {
    layoutClassnames.push('is-nowrap');
  }

  return layoutClassnames;
}

function LayoutPanel(_ref) {
  let {
    setAttributes,
    attributes,
    name: blockName
  } = _ref;
  const {
    layout
  } = attributes;
  const defaultThemeLayout = useSetting('layout');
  const themeSupportsLayout = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getSettings
    } = select(store);
    return getSettings().supportsLayout;
  }, []);
  const layoutBlockSupport = (0,external_wp_blocks_namespaceObject.getBlockSupport)(blockName, layoutBlockSupportKey, {});
  const {
    allowSwitching,
    allowEditing = true,
    allowInheriting = true,
    default: defaultBlockLayout
  } = layoutBlockSupport;

  if (!allowEditing) {
    return null;
  } // Only show the inherit toggle if it's supported,
  // a default theme layout is set (e.g. one that provides `contentSize` and/or `wideSize` values),
  // and that the default / flow layout type is in use, as this is the only one that supports inheritance.


  const showInheritToggle = !!(allowInheriting && !!defaultThemeLayout && (!(layout !== null && layout !== void 0 && layout.type) || (layout === null || layout === void 0 ? void 0 : layout.type) === 'default' || layout !== null && layout !== void 0 && layout.inherit));
  const usedLayout = layout || defaultBlockLayout || {};
  const {
    inherit = false,
    type = 'default'
  } = usedLayout;
  /**
   * `themeSupportsLayout` is only relevant to the `default/flow`
   * layout and it should not be taken into account when other
   * `layout` types are used.
   */

  if (type === 'default' && !themeSupportsLayout) {
    return null;
  }

  const layoutType = getLayoutType(type);

  const onChangeType = newType => setAttributes({
    layout: {
      type: newType
    }
  });

  const onChangeLayout = newLayout => setAttributes({
    layout: newLayout
  });

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(inspector_controls, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.PanelBody, {
    title: (0,external_wp_i18n_namespaceObject.__)('Layout')
  }, showInheritToggle && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToggleControl, {
    label: (0,external_wp_i18n_namespaceObject.__)('Inherit default layout'),
    checked: !!inherit,
    onChange: () => setAttributes({
      layout: {
        inherit: !inherit
      }
    })
  }), !inherit && allowSwitching && (0,external_wp_element_namespaceObject.createElement)(LayoutTypeSwitcher, {
    type: type,
    onChange: onChangeType
  }), !inherit && layoutType && (0,external_wp_element_namespaceObject.createElement)(layoutType.inspectorControls, {
    layout: usedLayout,
    onChange: onChangeLayout,
    layoutBlockSupport: layoutBlockSupport
  }))), !inherit && layoutType && (0,external_wp_element_namespaceObject.createElement)(layoutType.toolBarControls, {
    layout: usedLayout,
    onChange: onChangeLayout,
    layoutBlockSupport: layoutBlockSupport
  }));
}

function LayoutTypeSwitcher(_ref2) {
  let {
    type,
    onChange
  } = _ref2;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ButtonGroup, null, getLayoutTypes().map(_ref3 => {
    let {
      name,
      label
    } = _ref3;
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
      key: name,
      isPressed: type === name,
      onClick: () => onChange(name)
    }, label);
  }));
}
/**
 * Filters registered block settings, extending attributes to include `layout`.
 *
 * @param {Object} settings Original block settings.
 *
 * @return {Object} Filtered block settings.
 */


function layout_addAttribute(settings) {
  if ((0,external_lodash_namespaceObject.has)(settings.attributes, ['layout', 'type'])) {
    return settings;
  }

  if ((0,external_wp_blocks_namespaceObject.hasBlockSupport)(settings, layoutBlockSupportKey)) {
    settings.attributes = { ...settings.attributes,
      layout: {
        type: 'object'
      }
    };
  }

  return settings;
}
/**
 * Override the default edit UI to include layout controls
 *
 * @param {Function} BlockEdit Original component.
 *
 * @return {Function} Wrapped component.
 */

const withInspectorControls = (0,external_wp_compose_namespaceObject.createHigherOrderComponent)(BlockEdit => props => {
  const {
    name: blockName
  } = props;
  const supportLayout = (0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockName, layoutBlockSupportKey);
  return [supportLayout && (0,external_wp_element_namespaceObject.createElement)(LayoutPanel, _extends({
    key: "layout"
  }, props)), (0,external_wp_element_namespaceObject.createElement)(BlockEdit, _extends({
    key: "edit"
  }, props))];
}, 'withInspectorControls');
/**
 * Override the default block element to add the layout styles.
 *
 * @param {Function} BlockListBlock Original component.
 *
 * @return {Function} Wrapped component.
 */

const withLayoutStyles = (0,external_wp_compose_namespaceObject.createHigherOrderComponent)(BlockListBlock => props => {
  const {
    name,
    attributes
  } = props;
  const shouldRenderLayoutStyles = (0,external_wp_blocks_namespaceObject.hasBlockSupport)(name, layoutBlockSupportKey);
  const id = (0,external_wp_compose_namespaceObject.useInstanceId)(BlockListBlock);
  const defaultThemeLayout = useSetting('layout') || {};
  const element = (0,external_wp_element_namespaceObject.useContext)(BlockList.__unstableElementContext);
  const {
    layout
  } = attributes;
  const {
    default: defaultBlockLayout
  } = (0,external_wp_blocks_namespaceObject.getBlockSupport)(name, layoutBlockSupportKey) || {};
  const usedLayout = layout !== null && layout !== void 0 && layout.inherit ? defaultThemeLayout : layout || defaultBlockLayout || {};
  const layoutClasses = shouldRenderLayoutStyles ? getLayoutClasses(attributes) : null;
  const className = classnames_default()(props === null || props === void 0 ? void 0 : props.className, {
    [`wp-container-${id}`]: shouldRenderLayoutStyles
  }, layoutClasses);
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, shouldRenderLayoutStyles && element && (0,external_wp_element_namespaceObject.createPortal)((0,external_wp_element_namespaceObject.createElement)(LayoutStyle, {
    blockName: name,
    selector: `.wp-container-${id}`,
    layout: usedLayout,
    style: attributes === null || attributes === void 0 ? void 0 : attributes.style
  }), element), (0,external_wp_element_namespaceObject.createElement)(BlockListBlock, _extends({}, props, {
    className: className
  })));
});
(0,external_wp_hooks_namespaceObject.addFilter)('blocks.registerBlockType', 'core/layout/addAttribute', layout_addAttribute);
(0,external_wp_hooks_namespaceObject.addFilter)('editor.BlockListBlock', 'core/editor/layout/with-layout-styles', withLayoutStyles);
(0,external_wp_hooks_namespaceObject.addFilter)('editor.BlockEdit', 'core/editor/layout/with-inspector-controls', withInspectorControls);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/use-border-props.js
/**
 * External dependencies
 */

/**
 * Internal dependencies
 */



 // This utility is intended to assist where the serialization of the border
// block support is being skipped for a block but the border related CSS classes
// & styles still need to be generated so they can be applied to inner elements.

const use_border_props_EMPTY_ARRAY = [];
/**
 * Provides the CSS class names and inline styles for a block's border support
 * attributes.
 *
 * @param {Object} attributes             Block attributes.
 * @param {string} attributes.borderColor Selected named border color.
 * @param {Object} attributes.style       Block's styles attribute.
 *
 * @return {Object} Border block support derived CSS classes & styles.
 */

function getBorderClassesAndStyles(_ref) {
  var _style$border;

  let {
    borderColor,
    style
  } = _ref;
  const borderStyles = (style === null || style === void 0 ? void 0 : style.border) || {};
  const borderClass = getColorClassName('border-color', borderColor);
  const className = classnames_default()({
    [borderClass]: !!borderClass,
    'has-border-color': borderColor || (style === null || style === void 0 ? void 0 : (_style$border = style.border) === null || _style$border === void 0 ? void 0 : _style$border.color)
  });
  return {
    className: className || undefined,
    style: getInlineStyles({
      border: borderStyles
    })
  };
}
/**
 * Derives the border related props for a block from its border block support
 * attributes.
 *
 * Inline styles are forced for named colors to ensure these selections are
 * reflected when themes do not load their color stylesheets in the editor.
 *
 * @param {Object} attributes Block attributes.
 *
 * @return {Object} ClassName & style props from border block support.
 */

function useBorderProps(attributes) {
  const colors = useSetting('color.palette') || use_border_props_EMPTY_ARRAY;
  const borderProps = getBorderClassesAndStyles(attributes); // Force inline style to apply border color when themes do not load their
  // color stylesheets in the editor.

  if (attributes.borderColor) {
    const borderColorObject = getColorObjectByAttributeValues(colors, attributes.borderColor);
    borderProps.style.borderColor = borderColorObject.color;
  }

  return borderProps;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/use-color-props.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */




 // The code in this file has largely been lifted from the color block support
// hook.
//
// This utility is intended to assist where the serialization of the colors
// block support is being skipped for a block but the color related CSS classes
// & styles still need to be generated so they can be applied to inner elements.

/**
 * Provides the CSS class names and inline styles for a block's color support
 * attributes.
 *
 * @param {Object} attributes Block attributes.
 *
 * @return {Object} Color block support derived CSS classes & styles.
 */

function getColorClassesAndStyles(attributes) {
  var _style$color, _style$color2, _style$color3, _style$color4, _style$elements, _style$elements$link;

  const {
    backgroundColor,
    textColor,
    gradient,
    style
  } = attributes; // Collect color CSS classes.

  const backgroundClass = getColorClassName('background-color', backgroundColor);
  const textClass = getColorClassName('color', textColor);

  const gradientClass = __experimentalGetGradientClass(gradient);

  const hasGradient = gradientClass || (style === null || style === void 0 ? void 0 : (_style$color = style.color) === null || _style$color === void 0 ? void 0 : _style$color.gradient); // Determine color CSS class name list.

  const className = classnames_default()(textClass, gradientClass, {
    // Don't apply the background class if there's a gradient.
    [backgroundClass]: !hasGradient && !!backgroundClass,
    'has-text-color': textColor || (style === null || style === void 0 ? void 0 : (_style$color2 = style.color) === null || _style$color2 === void 0 ? void 0 : _style$color2.text),
    'has-background': backgroundColor || (style === null || style === void 0 ? void 0 : (_style$color3 = style.color) === null || _style$color3 === void 0 ? void 0 : _style$color3.background) || gradient || (style === null || style === void 0 ? void 0 : (_style$color4 = style.color) === null || _style$color4 === void 0 ? void 0 : _style$color4.gradient),
    'has-link-color': style === null || style === void 0 ? void 0 : (_style$elements = style.elements) === null || _style$elements === void 0 ? void 0 : (_style$elements$link = _style$elements.link) === null || _style$elements$link === void 0 ? void 0 : _style$elements$link.color
  }); // Collect inline styles for colors.

  const colorStyles = (style === null || style === void 0 ? void 0 : style.color) || {};
  const styleProp = getInlineStyles({
    color: colorStyles
  });
  return {
    className: className || undefined,
    style: styleProp
  };
}
const EMPTY_OBJECT = {};
/**
 * Determines the color related props for a block derived from its color block
 * support attributes.
 *
 * Inline styles are forced for named colors to ensure these selections are
 * reflected when themes do not load their color stylesheets in the editor.
 *
 * @param {Object} attributes Block attributes.
 *
 * @return {Object} ClassName & style props from colors block support.
 */

function useColorProps(attributes) {
  const {
    backgroundColor,
    textColor,
    gradient
  } = attributes; // Some color settings have a special handling for deprecated flags in `useSetting`,
  // so we can't unwrap them by doing const { ... } = useSetting('color')
  // until https://github.com/WordPress/gutenberg/issues/37094 is fixed.

  const userPalette = useSetting('color.palette.custom') || [];
  const themePalette = useSetting('color.palette.theme') || [];
  const defaultPalette = useSetting('color.palette.default') || [];
  const gradientsPerOrigin = useSetting('color.gradients') || EMPTY_OBJECT;
  const colors = (0,external_wp_element_namespaceObject.useMemo)(() => [...(userPalette || []), ...(themePalette || []), ...(defaultPalette || [])], [userPalette, themePalette, defaultPalette]);
  const gradients = (0,external_wp_element_namespaceObject.useMemo)(() => [...((gradientsPerOrigin === null || gradientsPerOrigin === void 0 ? void 0 : gradientsPerOrigin.custom) || []), ...((gradientsPerOrigin === null || gradientsPerOrigin === void 0 ? void 0 : gradientsPerOrigin.theme) || []), ...((gradientsPerOrigin === null || gradientsPerOrigin === void 0 ? void 0 : gradientsPerOrigin.default) || [])], [gradientsPerOrigin]);
  const colorProps = getColorClassesAndStyles(attributes); // Force inline styles to apply colors when themes do not load their color
  // stylesheets in the editor.

  if (backgroundColor) {
    const backgroundColorObject = getColorObjectByAttributeValues(colors, backgroundColor);
    colorProps.style.backgroundColor = backgroundColorObject.color;
  }

  if (gradient) {
    colorProps.style.background = getGradientValueBySlug(gradients, gradient);
  }

  if (textColor) {
    const textColorObject = getColorObjectByAttributeValues(colors, textColor);
    colorProps.style.color = textColorObject.color;
  }

  return colorProps;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/use-spacing-props.js
/**
 * Internal dependencies
 */
 // This utility is intended to assist where the serialization of the spacing
// block support is being skipped for a block but the spacing related CSS
// styles still need to be generated so they can be applied to inner elements.

/**
 * Provides the CSS class names and inline styles for a block's spacing support
 * attributes.
 *
 * @param {Object} attributes Block attributes.
 *
 * @return {Object} Spacing block support derived CSS classes & styles.
 */

function getSpacingClassesAndStyles(attributes) {
  const {
    style
  } = attributes; // Collect inline styles for spacing.

  const spacingStyles = (style === null || style === void 0 ? void 0 : style.spacing) || {};
  const styleProp = getInlineStyles({
    spacing: spacingStyles
  });
  return {
    style: styleProp
  };
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/use-cached-truthy.js
/**
 * WordPress dependencies
 */

/**
 * Keeps an up-to-date copy of the passed value and returns it. If value becomes falsy, it will return the last truthy copy.
 *
 * @param {any} value
 * @return {any} value
 */

function useCachedTruthy(value) {
  const [cachedValue, setCachedValue] = (0,external_wp_element_namespaceObject.useState)(value);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    if (value) {
      setCachedValue(value);
    }
  }, [value]);
  return cachedValue;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/hooks/index.js
/**
 * Internal dependencies
 */



















;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/colors/with-colors.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */



/**
 * Higher order component factory for injecting the `colorsArray` argument as
 * the colors prop in the `withCustomColors` HOC.
 *
 * @param {Array} colorsArray An array of color objects.
 *
 * @return {Function} The higher order component.
 */

const withCustomColorPalette = colorsArray => (0,external_wp_compose_namespaceObject.createHigherOrderComponent)(WrappedComponent => props => (0,external_wp_element_namespaceObject.createElement)(WrappedComponent, _extends({}, props, {
  colors: colorsArray
})), 'withCustomColorPalette');
/**
 * Higher order component factory for injecting the editor colors as the
 * `colors` prop in the `withColors` HOC.
 *
 * @return {Function} The higher order component.
 */


const withEditorColorPalette = () => (0,external_wp_compose_namespaceObject.createHigherOrderComponent)(WrappedComponent => props => {
  // Some color settings have a special handling for deprecated flags in `useSetting`,
  // so we can't unwrap them by doing const { ... } = useSetting('color')
  // until https://github.com/WordPress/gutenberg/issues/37094 is fixed.
  const userPalette = useSetting('color.palette.custom');
  const themePalette = useSetting('color.palette.theme');
  const defaultPalette = useSetting('color.palette.default');
  const allColors = (0,external_wp_element_namespaceObject.useMemo)(() => [...(userPalette || []), ...(themePalette || []), ...(defaultPalette || [])], [userPalette, themePalette, defaultPalette]);
  return (0,external_wp_element_namespaceObject.createElement)(WrappedComponent, _extends({}, props, {
    colors: allColors
  }));
}, 'withEditorColorPalette');
/**
 * Helper function used with `createHigherOrderComponent` to create
 * higher order components for managing color logic.
 *
 * @param {Array}    colorTypes       An array of color types (e.g. 'backgroundColor, borderColor).
 * @param {Function} withColorPalette A HOC for injecting the 'colors' prop into the WrappedComponent.
 *
 * @return {WPComponent} The component that can be used as a HOC.
 */


function createColorHOC(colorTypes, withColorPalette) {
  const colorMap = (0,external_lodash_namespaceObject.reduce)(colorTypes, (colorObject, colorType) => {
    return { ...colorObject,
      ...((0,external_lodash_namespaceObject.isString)(colorType) ? {
        [colorType]: (0,external_lodash_namespaceObject.kebabCase)(colorType)
      } : colorType)
    };
  }, {});
  return (0,external_wp_compose_namespaceObject.compose)([withColorPalette, WrappedComponent => {
    return class extends external_wp_element_namespaceObject.Component {
      constructor(props) {
        super(props);
        this.setters = this.createSetters();
        this.colorUtils = {
          getMostReadableColor: this.getMostReadableColor.bind(this)
        };
        this.state = {};
      }

      getMostReadableColor(colorValue) {
        const {
          colors
        } = this.props;
        return getMostReadableColor(colors, colorValue);
      }

      createSetters() {
        return (0,external_lodash_namespaceObject.reduce)(colorMap, (settersAccumulator, colorContext, colorAttributeName) => {
          const upperFirstColorAttributeName = (0,external_lodash_namespaceObject.upperFirst)(colorAttributeName);
          const customColorAttributeName = `custom${upperFirstColorAttributeName}`;
          settersAccumulator[`set${upperFirstColorAttributeName}`] = this.createSetColor(colorAttributeName, customColorAttributeName);
          return settersAccumulator;
        }, {});
      }

      createSetColor(colorAttributeName, customColorAttributeName) {
        return colorValue => {
          const colorObject = getColorObjectByColorValue(this.props.colors, colorValue);
          this.props.setAttributes({
            [colorAttributeName]: colorObject && colorObject.slug ? colorObject.slug : undefined,
            [customColorAttributeName]: colorObject && colorObject.slug ? undefined : colorValue
          });
        };
      }

      static getDerivedStateFromProps(_ref, previousState) {
        let {
          attributes,
          colors
        } = _ref;
        return (0,external_lodash_namespaceObject.reduce)(colorMap, (newState, colorContext, colorAttributeName) => {
          const colorObject = getColorObjectByAttributeValues(colors, attributes[colorAttributeName], attributes[`custom${(0,external_lodash_namespaceObject.upperFirst)(colorAttributeName)}`]);
          const previousColorObject = previousState[colorAttributeName];
          const previousColor = previousColorObject === null || previousColorObject === void 0 ? void 0 : previousColorObject.color;
          /**
           * The "and previousColorObject" condition checks that a previous color object was already computed.
           * At the start previousColorObject and colorValue are both equal to undefined
           * bus as previousColorObject does not exist we should compute the object.
           */

          if (previousColor === colorObject.color && previousColorObject) {
            newState[colorAttributeName] = previousColorObject;
          } else {
            newState[colorAttributeName] = { ...colorObject,
              class: getColorClassName(colorContext, colorObject.slug)
            };
          }

          return newState;
        }, {});
      }

      render() {
        return (0,external_wp_element_namespaceObject.createElement)(WrappedComponent, _extends({}, this.props, {
          colors: undefined
        }, this.state, this.setters, {
          colorUtils: this.colorUtils
        }));
      }

    };
  }]);
}
/**
 * A higher-order component factory for creating a 'withCustomColors' HOC, which handles color logic
 * for class generation color value, retrieval and color attribute setting.
 *
 * Use this higher-order component to work with a custom set of colors.
 *
 * @example
 *
 * ```jsx
 * const CUSTOM_COLORS = [ { name: 'Red', slug: 'red', color: '#ff0000' }, { name: 'Blue', slug: 'blue', color: '#0000ff' } ];
 * const withCustomColors = createCustomColorsHOC( CUSTOM_COLORS );
 * // ...
 * export default compose(
 *     withCustomColors( 'backgroundColor', 'borderColor' ),
 *     MyColorfulComponent,
 * );
 * ```
 *
 * @param {Array} colorsArray The array of color objects (name, slug, color, etc... ).
 *
 * @return {Function} Higher-order component.
 */


function createCustomColorsHOC(colorsArray) {
  return function () {
    const withColorPalette = withCustomColorPalette(colorsArray);

    for (var _len = arguments.length, colorTypes = new Array(_len), _key = 0; _key < _len; _key++) {
      colorTypes[_key] = arguments[_key];
    }

    return (0,external_wp_compose_namespaceObject.createHigherOrderComponent)(createColorHOC(colorTypes, withColorPalette), 'withCustomColors');
  };
}
/**
 * A higher-order component, which handles color logic for class generation color value, retrieval and color attribute setting.
 *
 * For use with the default editor/theme color palette.
 *
 * @example
 *
 * ```jsx
 * export default compose(
 *     withColors( 'backgroundColor', { textColor: 'color' } ),
 *     MyColorfulComponent,
 * );
 * ```
 *
 * @param {...(Object|string)} colorTypes The arguments can be strings or objects. If the argument is an object,
 *                                        it should contain the color attribute name as key and the color context as value.
 *                                        If the argument is a string the value should be the color attribute name,
 *                                        the color context is computed by applying a kebab case transform to the value.
 *                                        Color context represents the context/place where the color is going to be used.
 *                                        The class name of the color is generated using 'has' followed by the color name
 *                                        and ending with the color context all in kebab case e.g: has-green-background-color.
 *
 * @return {Function} Higher-order component.
 */

function withColors() {
  const withColorPalette = withEditorColorPalette();

  for (var _len2 = arguments.length, colorTypes = new Array(_len2), _key2 = 0; _key2 < _len2; _key2++) {
    colorTypes[_key2] = arguments[_key2];
  }

  return (0,external_wp_compose_namespaceObject.createHigherOrderComponent)(createColorHOC(colorTypes, withColorPalette), 'withColors');
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/colors/index.js



;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/gradients/index.js


;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/font-sizes/with-font-sizes.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */



const DEFAULT_FONT_SIZES = [];
/**
 * Higher-order component, which handles font size logic for class generation,
 * font size value retrieval, and font size change handling.
 *
 * @param {...(Object|string)} fontSizeNames The arguments should all be strings.
 *                                           Each string contains the font size
 *                                           attribute name e.g: 'fontSize'.
 *
 * @return {Function} Higher-order component.
 */

/* harmony default export */ var with_font_sizes = (function () {
  for (var _len = arguments.length, fontSizeNames = new Array(_len), _key = 0; _key < _len; _key++) {
    fontSizeNames[_key] = arguments[_key];
  }

  /*
   * Computes an object whose key is the font size attribute name as passed in the array,
   * and the value is the custom font size attribute name.
   * Custom font size is automatically compted by appending custom followed by the font size attribute name in with the first letter capitalized.
   */
  const fontSizeAttributeNames = (0,external_lodash_namespaceObject.reduce)(fontSizeNames, (fontSizeAttributeNamesAccumulator, fontSizeAttributeName) => {
    fontSizeAttributeNamesAccumulator[fontSizeAttributeName] = `custom${(0,external_lodash_namespaceObject.upperFirst)(fontSizeAttributeName)}`;
    return fontSizeAttributeNamesAccumulator;
  }, {});
  return (0,external_wp_compose_namespaceObject.createHigherOrderComponent)((0,external_wp_compose_namespaceObject.compose)([(0,external_wp_compose_namespaceObject.createHigherOrderComponent)(WrappedComponent => props => {
    const fontSizes = useSetting('typography.fontSizes') || DEFAULT_FONT_SIZES;
    return (0,external_wp_element_namespaceObject.createElement)(WrappedComponent, _extends({}, props, {
      fontSizes: fontSizes
    }));
  }, 'withFontSizes'), WrappedComponent => {
    return class extends external_wp_element_namespaceObject.Component {
      constructor(props) {
        super(props);
        this.setters = this.createSetters();
        this.state = {};
      }

      createSetters() {
        return (0,external_lodash_namespaceObject.reduce)(fontSizeAttributeNames, (settersAccumulator, customFontSizeAttributeName, fontSizeAttributeName) => {
          const upperFirstFontSizeAttributeName = (0,external_lodash_namespaceObject.upperFirst)(fontSizeAttributeName);
          settersAccumulator[`set${upperFirstFontSizeAttributeName}`] = this.createSetFontSize(fontSizeAttributeName, customFontSizeAttributeName);
          return settersAccumulator;
        }, {});
      }

      createSetFontSize(fontSizeAttributeName, customFontSizeAttributeName) {
        return fontSizeValue => {
          const fontSizeObject = (0,external_lodash_namespaceObject.find)(this.props.fontSizes, {
            size: Number(fontSizeValue)
          });
          this.props.setAttributes({
            [fontSizeAttributeName]: fontSizeObject && fontSizeObject.slug ? fontSizeObject.slug : undefined,
            [customFontSizeAttributeName]: fontSizeObject && fontSizeObject.slug ? undefined : fontSizeValue
          });
        };
      }

      static getDerivedStateFromProps(_ref, previousState) {
        let {
          attributes,
          fontSizes
        } = _ref;

        const didAttributesChange = (customFontSizeAttributeName, fontSizeAttributeName) => {
          if (previousState[fontSizeAttributeName]) {
            // If new font size is name compare with the previous slug.
            if (attributes[fontSizeAttributeName]) {
              return attributes[fontSizeAttributeName] !== previousState[fontSizeAttributeName].slug;
            } // If font size is not named, update when the font size value changes.


            return previousState[fontSizeAttributeName].size !== attributes[customFontSizeAttributeName];
          } // In this case we need to build the font size object.


          return true;
        };

        if (!(0,external_lodash_namespaceObject.some)(fontSizeAttributeNames, didAttributesChange)) {
          return null;
        }

        const newState = (0,external_lodash_namespaceObject.reduce)((0,external_lodash_namespaceObject.pickBy)(fontSizeAttributeNames, didAttributesChange), (newStateAccumulator, customFontSizeAttributeName, fontSizeAttributeName) => {
          const fontSizeAttributeValue = attributes[fontSizeAttributeName];
          const fontSizeObject = getFontSize(fontSizes, fontSizeAttributeValue, attributes[customFontSizeAttributeName]);
          newStateAccumulator[fontSizeAttributeName] = { ...fontSizeObject,
            class: getFontSizeClass(fontSizeAttributeValue)
          };
          return newStateAccumulator;
        }, {});
        return { ...previousState,
          ...newState
        };
      }

      render() {
        return (0,external_wp_element_namespaceObject.createElement)(WrappedComponent, _extends({}, this.props, {
          fontSizes: undefined
        }, this.state, this.setters));
      }

    };
  }]), 'withFontSizes');
});

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/font-sizes/index.js




;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/align-left.js


/**
 * WordPress dependencies
 */

const alignLeft = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M4 19.8h8.9v-1.5H4v1.5zm8.9-15.6H4v1.5h8.9V4.2zm-8.9 7v1.5h16v-1.5H4z"
}));
/* harmony default export */ var align_left = (alignLeft);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/align-center.js


/**
 * WordPress dependencies
 */

const align_center_alignCenter = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M16.4 4.2H7.6v1.5h8.9V4.2zM4 11.2v1.5h16v-1.5H4zm3.6 8.6h8.9v-1.5H7.6v1.5z"
}));
/* harmony default export */ var align_center = (align_center_alignCenter);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/align-right.js


/**
 * WordPress dependencies
 */

const alignRight = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M11.1 19.8H20v-1.5h-8.9v1.5zm0-15.6v1.5H20V4.2h-8.9zM4 12.8h16v-1.5H4v1.5z"
}));
/* harmony default export */ var align_right = (alignRight);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/alignment-control/ui.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */




const DEFAULT_ALIGNMENT_CONTROLS = [{
  icon: align_left,
  title: (0,external_wp_i18n_namespaceObject.__)('Align text left'),
  align: 'left'
}, {
  icon: align_center,
  title: (0,external_wp_i18n_namespaceObject.__)('Align text center'),
  align: 'center'
}, {
  icon: align_right,
  title: (0,external_wp_i18n_namespaceObject.__)('Align text right'),
  align: 'right'
}];
const alignment_control_ui_POPOVER_PROPS = {
  position: 'bottom right',
  isAlternate: true
};

function AlignmentUI(_ref) {
  let {
    value,
    onChange,
    alignmentControls = DEFAULT_ALIGNMENT_CONTROLS,
    label = (0,external_wp_i18n_namespaceObject.__)('Align'),
    describedBy = (0,external_wp_i18n_namespaceObject.__)('Change text alignment'),
    isCollapsed = true,
    isToolbar
  } = _ref;

  function applyOrUnset(align) {
    return () => onChange(value === align ? undefined : align);
  }

  const activeAlignment = (0,external_lodash_namespaceObject.find)(alignmentControls, control => control.align === value);

  function setIcon() {
    if (activeAlignment) return activeAlignment.icon;
    return (0,external_wp_i18n_namespaceObject.isRTL)() ? align_right : align_left;
  }

  const UIComponent = isToolbar ? external_wp_components_namespaceObject.ToolbarGroup : external_wp_components_namespaceObject.ToolbarDropdownMenu;
  const extraProps = isToolbar ? {
    isCollapsed
  } : {};
  return (0,external_wp_element_namespaceObject.createElement)(UIComponent, _extends({
    icon: setIcon(),
    label: label,
    toggleProps: {
      describedBy
    },
    popoverProps: alignment_control_ui_POPOVER_PROPS,
    controls: alignmentControls.map(control => {
      const {
        align
      } = control;
      const isActive = value === align;
      return { ...control,
        isActive,
        role: isCollapsed ? 'menuitemradio' : undefined,
        onClick: applyOrUnset(align)
      };
    })
  }, extraProps));
}

/* harmony default export */ var alignment_control_ui = (AlignmentUI);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/alignment-control/index.js



/**
 * Internal dependencies
 */


const AlignmentControl = props => {
  return (0,external_wp_element_namespaceObject.createElement)(alignment_control_ui, _extends({}, props, {
    isToolbar: false
  }));
};

const AlignmentToolbar = props => {
  return (0,external_wp_element_namespaceObject.createElement)(alignment_control_ui, _extends({}, props, {
    isToolbar: true
  }));
};
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/alignment-control/README.md
 */




;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/autocompleters/block.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */





const block_SHOWN_BLOCK_TYPES = 9;
/** @typedef {import('@wordpress/components').WPCompleter} WPCompleter */

/**
 * Creates a blocks repeater for replacing the current block with a selected block type.
 *
 * @return {WPCompleter} A blocks completer.
 */

function createBlockCompleter() {
  return {
    name: 'blocks',
    className: 'block-editor-autocompleters__block',
    triggerPrefix: '/',

    useItems(filterValue) {
      const {
        rootClientId,
        selectedBlockName
      } = (0,external_wp_data_namespaceObject.useSelect)(select => {
        const {
          getSelectedBlockClientId,
          getBlockName,
          getBlockInsertionPoint
        } = select(store);
        const selectedBlockClientId = getSelectedBlockClientId();
        return {
          selectedBlockName: selectedBlockClientId ? getBlockName(selectedBlockClientId) : null,
          rootClientId: getBlockInsertionPoint().rootClientId
        };
      }, []);
      const [items, categories, collections] = use_block_types_state(rootClientId, external_lodash_namespaceObject.noop);
      const filteredItems = (0,external_wp_element_namespaceObject.useMemo)(() => {
        const initialFilteredItems = !!filterValue.trim() ? searchBlockItems(items, categories, collections, filterValue) : (0,external_lodash_namespaceObject.orderBy)(items, ['frecency'], ['desc']);
        return initialFilteredItems.filter(item => item.name !== selectedBlockName).slice(0, block_SHOWN_BLOCK_TYPES);
      }, [filterValue, selectedBlockName, items, categories, collections]);
      const options = (0,external_wp_element_namespaceObject.useMemo)(() => filteredItems.map(blockItem => {
        const {
          title,
          icon,
          isDisabled
        } = blockItem;
        return {
          key: `block-${blockItem.id}`,
          value: blockItem,
          label: (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(block_icon, {
            key: "icon",
            icon: icon,
            showColors: true
          }), title),
          isDisabled
        };
      }), [filteredItems]);
      return [options];
    },

    allowContext(before, after) {
      return !(/\S/.test(before) || /\S/.test(after));
    },

    getOptionCompletion(inserterItem) {
      const {
        name,
        initialAttributes,
        innerBlocks
      } = inserterItem;
      return {
        action: 'replace',
        value: (0,external_wp_blocks_namespaceObject.createBlock)(name, initialAttributes, (0,external_wp_blocks_namespaceObject.createBlocksFromInnerBlocksTemplate)(innerBlocks))
      };
    }

  };
}
/**
 * Creates a blocks repeater for replacing the current block with a selected block type.
 *
 * @return {WPCompleter} A blocks completer.
 */


/* harmony default export */ var autocompleters_block = (createBlockCompleter());

;// CONCATENATED MODULE: external ["wp","apiFetch"]
var external_wp_apiFetch_namespaceObject = window["wp"]["apiFetch"];
var external_wp_apiFetch_default = /*#__PURE__*/__webpack_require__.n(external_wp_apiFetch_namespaceObject);
;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/page.js


/**
 * WordPress dependencies
 */

const page = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M7 5.5h10a.5.5 0 01.5.5v12a.5.5 0 01-.5.5H7a.5.5 0 01-.5-.5V6a.5.5 0 01.5-.5zM17 4H7a2 2 0 00-2 2v12a2 2 0 002 2h10a2 2 0 002-2V6a2 2 0 00-2-2zm-1 3.75H8v1.5h8v-1.5zM8 11h8v1.5H8V11zm6 3.25H8v1.5h6v-1.5z"
}));
/* harmony default export */ var library_page = (page);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/post.js


/**
 * WordPress dependencies
 */

const post = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "m7.3 9.7 1.4 1.4c.2-.2.3-.3.4-.5 0 0 0-.1.1-.1.3-.5.4-1.1.3-1.6L12 7 9 4 7.2 6.5c-.6-.1-1.1 0-1.6.3 0 0-.1 0-.1.1-.3.1-.4.2-.6.4l1.4 1.4L4 11v1h1l2.3-2.3zM4 20h9v-1.5H4V20zm0-5.5V16h16v-1.5H4z"
}));
/* harmony default export */ var library_post = (post);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/autocompleters/link.js


/**
 * WordPress dependencies
 */



const SHOWN_SUGGESTIONS = 10;
/** @typedef {import('@wordpress/components').WPCompleter} WPCompleter */

/**
 * Creates a suggestion list for links to posts or pages.
 *
 * @return {WPCompleter} A links completer.
 */

function createLinkCompleter() {
  return {
    name: 'links',
    className: 'block-editor-autocompleters__link',
    triggerPrefix: '[[',
    options: async letters => {
      let options = await external_wp_apiFetch_default()({
        path: (0,external_wp_url_namespaceObject.addQueryArgs)('/wp/v2/search', {
          per_page: SHOWN_SUGGESTIONS,
          search: letters,
          type: 'post',
          order_by: 'menu_order'
        })
      });
      options = options.filter(option => option.title !== '');
      return options;
    },

    getOptionKeywords(item) {
      const expansionWords = item.title.split(/\s+/);
      return [...expansionWords];
    },

    getOptionLabel(item) {
      return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(build_module_icon, {
        key: "icon",
        icon: item.subtype === 'page' ? library_page : library_post
      }), item.title);
    },

    getOptionCompletion(item) {
      return (0,external_wp_element_namespaceObject.createElement)("a", {
        href: item.url
      }, item.title);
    }

  };
}
/**
 * Creates a suggestion list for links to posts or pages..
 *
 * @return {WPCompleter} A link completer.
 */


/* harmony default export */ var autocompleters_link = (createLinkCompleter());

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/autocomplete/index.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */




/**
 * Shared reference to an empty array for cases where it is important to avoid
 * returning a new array reference on every invocation.
 *
 * @type {Array}
 */

const autocomplete_EMPTY_ARRAY = [];

function useCompleters(_ref) {
  let {
    completers = autocomplete_EMPTY_ARRAY
  } = _ref;
  const {
    name
  } = useBlockEditContext();
  return (0,external_wp_element_namespaceObject.useMemo)(() => {
    let filteredCompleters = completers;

    if (name === (0,external_wp_blocks_namespaceObject.getDefaultBlockName)() || (0,external_wp_blocks_namespaceObject.getBlockSupport)(name, '__experimentalSlashInserter', false)) {
      filteredCompleters = filteredCompleters.concat([autocompleters_block, autocompleters_link]);
    }

    if ((0,external_wp_hooks_namespaceObject.hasFilter)('editor.Autocomplete.completers')) {
      // Provide copies so filters may directly modify them.
      if (filteredCompleters === completers) {
        filteredCompleters = filteredCompleters.map(external_lodash_namespaceObject.clone);
      }

      filteredCompleters = (0,external_wp_hooks_namespaceObject.applyFilters)('editor.Autocomplete.completers', filteredCompleters, name);
    }

    return filteredCompleters;
  }, [completers, name]);
}

function useBlockEditorAutocompleteProps(props) {
  return (0,external_wp_components_namespaceObject.__unstableUseAutocompleteProps)({ ...props,
    completers: useCompleters(props)
  });
}
/**
 * Wrap the default Autocomplete component with one that supports a filter hook
 * for customizing its list of autocompleters.
 *
 * @type {import('react').FC}
 */

function BlockEditorAutocomplete(props) {
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Autocomplete, _extends({}, props, {
    completers: useCompleters(props)
  }));
}
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/autocomplete/README.md
 */


/* harmony default export */ var autocomplete = (BlockEditorAutocomplete);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/fullscreen.js


/**
 * WordPress dependencies
 */

const fullscreen = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M4.2 9h1.5V5.8H9V4.2H4.2V9zm14 9.2H15v1.5h4.8V15h-1.5v3.2zM15 4.2v1.5h3.2V9h1.5V4.2H15zM5.8 15H4.2v4.8H9v-1.5H5.8V15z"
}));
/* harmony default export */ var library_fullscreen = (fullscreen);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-full-height-alignment-control/index.js


/**
 * WordPress dependencies
 */




function BlockFullHeightAlignmentControl(_ref) {
  let {
    isActive,
    label = (0,external_wp_i18n_namespaceObject.__)('Toggle full height'),
    onToggle,
    isDisabled
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarButton, {
    isActive: isActive,
    icon: library_fullscreen,
    label: label,
    onClick: () => onToggle(!isActive),
    disabled: isDisabled
  });
}

/* harmony default export */ var block_full_height_alignment_control = (BlockFullHeightAlignmentControl);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-alignment-matrix-control/index.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */





function BlockAlignmentMatrixControl(props) {
  const {
    label = (0,external_wp_i18n_namespaceObject.__)('Change matrix alignment'),
    onChange = external_lodash_namespaceObject.noop,
    value = 'center',
    isDisabled
  } = props;
  const icon = (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalAlignmentMatrixControl.Icon, {
    value: value
  });
  const className = 'block-editor-block-alignment-matrix-control';
  const popoverClassName = `${className}__popover`;
  const isAlternate = true;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Dropdown, {
    position: "bottom right",
    className: className,
    popoverProps: {
      className: popoverClassName,
      isAlternate
    },
    renderToggle: _ref => {
      let {
        onToggle,
        isOpen
      } = _ref;

      const openOnArrowDown = event => {
        if (!isOpen && event.keyCode === external_wp_keycodes_namespaceObject.DOWN) {
          event.preventDefault();
          onToggle();
        }
      };

      return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarButton, {
        onClick: onToggle,
        "aria-haspopup": "true",
        "aria-expanded": isOpen,
        onKeyDown: openOnArrowDown,
        label: label,
        icon: icon,
        showTooltip: true,
        disabled: isDisabled
      });
    },
    renderContent: () => (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalAlignmentMatrixControl, {
      hasFocusBorder: false,
      onChange: onChange,
      value: value
    })
  });
}

/* harmony default export */ var block_alignment_matrix_control = (BlockAlignmentMatrixControl);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/chevron-right-small.js


/**
 * WordPress dependencies
 */

const chevronRightSmall = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M10.8622 8.04053L14.2805 12.0286L10.8622 16.0167L9.72327 15.0405L12.3049 12.0286L9.72327 9.01672L10.8622 8.04053Z"
}));
/* harmony default export */ var chevron_right_small = (chevronRightSmall);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-breadcrumb/index.js


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */



/**
 * Block breadcrumb component, displaying the hierarchy of the current block selection as a breadcrumb.
 *
 * @param {Object} props               Component props.
 * @param {string} props.rootLabelText Translated label for the root element of the breadcrumb trail.
 * @return {WPElement}                 Block Breadcrumb.
 */

function BlockBreadcrumb(_ref) {
  let {
    rootLabelText
  } = _ref;
  const {
    selectBlock,
    clearSelectedBlock
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const {
    clientId,
    parents,
    hasSelection
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getSelectionStart,
      getSelectedBlockClientId,
      getBlockParents
    } = select(store);
    const selectedBlockClientId = getSelectedBlockClientId();
    return {
      parents: getBlockParents(selectedBlockClientId),
      clientId: selectedBlockClientId,
      hasSelection: !!getSelectionStart().clientId
    };
  }, []);

  const rootLabel = rootLabelText || (0,external_wp_i18n_namespaceObject.__)('Document');
  /*
   * Disable reason: The `list` ARIA role is redundant but
   * Safari+VoiceOver won't announce the list otherwise.
   */

  /* eslint-disable jsx-a11y/no-redundant-roles */


  return (0,external_wp_element_namespaceObject.createElement)("ul", {
    className: "block-editor-block-breadcrumb",
    role: "list",
    "aria-label": (0,external_wp_i18n_namespaceObject.__)('Block breadcrumb')
  }, (0,external_wp_element_namespaceObject.createElement)("li", {
    className: !hasSelection ? 'block-editor-block-breadcrumb__current' : undefined,
    "aria-current": !hasSelection ? 'true' : undefined
  }, hasSelection && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    className: "block-editor-block-breadcrumb__button",
    variant: "tertiary",
    onClick: clearSelectedBlock
  }, rootLabel), !hasSelection && rootLabel, !!clientId && (0,external_wp_element_namespaceObject.createElement)(build_module_icon, {
    icon: chevron_right_small,
    className: "block-editor-block-breadcrumb__separator"
  })), parents.map(parentClientId => (0,external_wp_element_namespaceObject.createElement)("li", {
    key: parentClientId
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    className: "block-editor-block-breadcrumb__button",
    variant: "tertiary",
    onClick: () => selectBlock(parentClientId)
  }, (0,external_wp_element_namespaceObject.createElement)(BlockTitle, {
    clientId: parentClientId,
    maximumLength: 35
  })), (0,external_wp_element_namespaceObject.createElement)(build_module_icon, {
    icon: chevron_right_small,
    className: "block-editor-block-breadcrumb__separator"
  }))), !!clientId && (0,external_wp_element_namespaceObject.createElement)("li", {
    className: "block-editor-block-breadcrumb__current",
    "aria-current": "true"
  }, (0,external_wp_element_namespaceObject.createElement)(BlockTitle, {
    clientId: clientId,
    maximumLength: 35
  })))
  /* eslint-enable jsx-a11y/no-redundant-roles */
  ;
}

/* harmony default export */ var block_breadcrumb = (BlockBreadcrumb);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-content-overlay/index.js



/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


/**
 * External dependencies
 */


function BlockContentOverlay(_ref) {
  let {
    clientId,
    tagName: TagName = 'div',
    wrapperProps,
    className
  } = _ref;
  const baseClassName = 'block-editor-block-content-overlay';
  const [isOverlayActive, setIsOverlayActive] = (0,external_wp_element_namespaceObject.useState)(true);
  const [isHovered, setIsHovered] = (0,external_wp_element_namespaceObject.useState)(false);
  const {
    isParentSelected,
    hasChildSelected,
    isDraggingBlocks,
    isParentHighlighted
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      isBlockSelected,
      hasSelectedInnerBlock,
      isDraggingBlocks: _isDraggingBlocks,
      isBlockHighlighted
    } = select(store);
    return {
      isParentSelected: isBlockSelected(clientId),
      hasChildSelected: hasSelectedInnerBlock(clientId, true),
      isDraggingBlocks: _isDraggingBlocks(),
      isParentHighlighted: isBlockHighlighted(clientId)
    };
  }, [clientId]);
  const classes = classnames_default()(baseClassName, wrapperProps === null || wrapperProps === void 0 ? void 0 : wrapperProps.className, className, {
    'overlay-active': isOverlayActive,
    'parent-highlighted': isParentHighlighted,
    'is-dragging-blocks': isDraggingBlocks
  });
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    // Reenable when blocks are not in use.
    if (!isParentSelected && !hasChildSelected && !isOverlayActive) {
      setIsOverlayActive(true);
    } // Disable if parent selected by another means (such as list view).
    // We check hover to ensure the overlay click interaction is not taking place.
    // Trying to click the overlay will select the parent block via its 'focusin'
    // listener on the wrapper, so if the block is selected while hovered we will
    // let the mouseup disable the overlay instead.


    if (isParentSelected && !isHovered && isOverlayActive) {
      setIsOverlayActive(false);
    } // Ensure overlay is disabled if a child block is selected.


    if (hasChildSelected && isOverlayActive) {
      setIsOverlayActive(false);
    }
  }, [isParentSelected, hasChildSelected, isOverlayActive, isHovered]); // Disabled because the overlay div doesn't actually have a role or functionality
  // as far as the a11y is concerned. We're just catching the first click so that
  // the block can be selected without interacting with its contents.

  /* eslint-disable jsx-a11y/no-static-element-interactions */

  return (0,external_wp_element_namespaceObject.createElement)(TagName, _extends({}, wrapperProps, {
    className: classes,
    onMouseEnter: () => setIsHovered(true),
    onMouseLeave: () => setIsHovered(false),
    onMouseUp: isOverlayActive ? () => setIsOverlayActive(false) : undefined
  }), wrapperProps === null || wrapperProps === void 0 ? void 0 : wrapperProps.children);
}
/* eslint-enable jsx-a11y/no-static-element-interactions */

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/color-style-selector/index.js


/**
 * WordPress dependencies
 */




const ColorSelectorSVGIcon = () => (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.SVG, {
  xmlns: "https://www.w3.org/2000/svg",
  viewBox: "0 0 20 20"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Path, {
  d: "M7.434 5l3.18 9.16H8.538l-.692-2.184H4.628l-.705 2.184H2L5.18 5h2.254zm-1.13 1.904h-.115l-1.148 3.593H7.44L6.304 6.904zM14.348 7.006c1.853 0 2.9.876 2.9 2.374v4.78h-1.79v-.914h-.114c-.362.64-1.123 1.022-2.031 1.022-1.346 0-2.292-.826-2.292-2.108 0-1.27.972-2.006 2.71-2.107l1.696-.102V9.38c0-.584-.42-.914-1.18-.914-.667 0-1.112.228-1.264.647h-1.701c.12-1.295 1.307-2.107 3.066-2.107zm1.079 4.1l-1.416.09c-.793.056-1.18.342-1.18.844 0 .52.45.837 1.091.837.857 0 1.505-.545 1.505-1.256v-.515z"
}));
/**
 * Color Selector Icon component.
 *
 * @param {Object} props           Component properties.
 * @param {Object} props.style     Style object.
 * @param {string} props.className Class name for component.
 *
 * @return {*} React Icon component.
 */


const ColorSelectorIcon = _ref => {
  let {
    style,
    className
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-library-colors-selector__icon-container"
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: `${className} block-library-colors-selector__state-selection`,
    style: style
  }, (0,external_wp_element_namespaceObject.createElement)(ColorSelectorSVGIcon, null)));
};
/**
 * Renders the Colors Selector Toolbar with the icon button.
 *
 * @param {Object} props                 Component properties.
 * @param {Object} props.TextColor       Text color component that wraps icon.
 * @param {Object} props.BackgroundColor Background color component that wraps icon.
 *
 * @return {*} React toggle button component.
 */


const renderToggleComponent = _ref2 => {
  let {
    TextColor,
    BackgroundColor
  } = _ref2;
  return _ref3 => {
    let {
      onToggle,
      isOpen
    } = _ref3;

    const openOnArrowDown = event => {
      if (!isOpen && event.keyCode === external_wp_keycodes_namespaceObject.DOWN) {
        event.preventDefault();
        onToggle();
      }
    };

    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarGroup, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarButton, {
      className: "components-toolbar__control block-library-colors-selector__toggle",
      label: (0,external_wp_i18n_namespaceObject.__)('Open Colors Selector'),
      onClick: onToggle,
      onKeyDown: openOnArrowDown,
      icon: (0,external_wp_element_namespaceObject.createElement)(BackgroundColor, null, (0,external_wp_element_namespaceObject.createElement)(TextColor, null, (0,external_wp_element_namespaceObject.createElement)(ColorSelectorIcon, null)))
    }));
  };
};

const BlockColorsStyleSelector = _ref4 => {
  let {
    children,
    ...other
  } = _ref4;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Dropdown, {
    position: "bottom right",
    className: "block-library-colors-selector",
    contentClassName: "block-library-colors-selector__popover",
    renderToggle: renderToggleComponent(other),
    renderContent: () => children
  });
};

/* harmony default export */ var color_style_selector = (BlockColorsStyleSelector);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/list-view.js


/**
 * WordPress dependencies
 */

const listView = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  viewBox: "0 0 24 24",
  xmlns: "http://www.w3.org/2000/svg"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M13.8 5.2H3v1.5h10.8V5.2zm-3.6 12v1.5H21v-1.5H10.2zm7.2-6H6.6v1.5h10.8v-1.5z"
}));
/* harmony default export */ var list_view = (listView);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/list-view/leaf.js



/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


const AnimatedTreeGridRow = animated(external_wp_components_namespaceObject.__experimentalTreeGridRow);
function ListViewLeaf(_ref) {
  let {
    isSelected,
    position,
    level,
    rowCount,
    children,
    className,
    path,
    ...props
  } = _ref;
  const ref = use_moving_animation({
    isSelected,
    adjustScrolling: false,
    enableAnimation: true,
    triggerAnimationOnChange: path
  });
  return (0,external_wp_element_namespaceObject.createElement)(AnimatedTreeGridRow, _extends({
    ref: ref,
    className: classnames_default()('block-editor-list-view-leaf', className),
    level: level,
    positionInSet: position,
    setSize: rowCount
  }, props), children);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/list-view/expander.js


/**
 * WordPress dependencies
 */

function ListViewExpander(_ref) {
  let {
    onClick
  } = _ref;
  return (// Keyboard events are handled by TreeGrid see: components/src/tree-grid/index.js
    //
    // The expander component is implemented as a pseudo element in the w3 example
    // https://www.w3.org/TR/wai-aria-practices/examples/treegrid/treegrid-1.html
    //
    // We've mimicked this by adding an icon with aria-hidden set to true to hide this from the accessibility tree.
    // For the current tree grid implementation, please do not try to make this a button.
    //
    // eslint-disable-next-line jsx-a11y/click-events-have-key-events,jsx-a11y/no-static-element-interactions
    (0,external_wp_element_namespaceObject.createElement)("span", {
      className: "block-editor-list-view__expander",
      onClick: event => onClick(event, {
        forceToggle: true
      }),
      "aria-hidden": "true"
    }, (0,external_wp_element_namespaceObject.createElement)(build_module_icon, {
      icon: chevron_right_small
    }))
  );
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/list-view/block-select-button.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */







function ListViewBlockSelectButton(_ref, ref) {
  let {
    className,
    block: {
      clientId
    },
    onClick,
    onToggleExpanded,
    tabIndex,
    onFocus,
    onDragStart,
    onDragEnd,
    draggable
  } = _ref;
  const blockInformation = useBlockDisplayInformation(clientId);
  const {
    isLocked
  } = useBlockLock(clientId); // The `href` attribute triggers the browser's native HTML drag operations.
  // When the link is dragged, the element's outerHTML is set in DataTransfer object as text/html.
  // We need to clear any HTML drag data to prevent `pasteHandler` from firing
  // inside the `useOnBlockDrop` hook.

  const onDragStartHandler = event => {
    event.dataTransfer.clearData();
    onDragStart === null || onDragStart === void 0 ? void 0 : onDragStart(event);
  };

  function onKeyDownHandler(event) {
    if (event.keyCode === external_wp_keycodes_namespaceObject.ENTER || event.keyCode === external_wp_keycodes_namespaceObject.SPACE) {
      onClick(event);
    }
  }

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    className: classnames_default()('block-editor-list-view-block-select-button', className),
    onClick: onClick,
    onKeyDown: onKeyDownHandler,
    ref: ref,
    tabIndex: tabIndex,
    onFocus: onFocus,
    onDragStart: onDragStartHandler,
    onDragEnd: onDragEnd,
    draggable: draggable,
    href: `#block-${clientId}`,
    "aria-hidden": true
  }, (0,external_wp_element_namespaceObject.createElement)(ListViewExpander, {
    onClick: onToggleExpanded
  }), (0,external_wp_element_namespaceObject.createElement)(block_icon, {
    icon: blockInformation === null || blockInformation === void 0 ? void 0 : blockInformation.icon,
    showColors: true
  }), (0,external_wp_element_namespaceObject.createElement)("span", {
    className: "block-editor-list-view-block-select-button__title"
  }, (0,external_wp_element_namespaceObject.createElement)(BlockTitle, {
    clientId: clientId,
    maximumLength: 35
  })), (blockInformation === null || blockInformation === void 0 ? void 0 : blockInformation.anchor) && (0,external_wp_element_namespaceObject.createElement)("span", {
    className: "block-editor-list-view-block-select-button__anchor"
  }, blockInformation.anchor), isLocked && (0,external_wp_element_namespaceObject.createElement)("span", {
    className: "block-editor-list-view-block-select-button__lock"
  }, (0,external_wp_element_namespaceObject.createElement)(build_module_icon, {
    icon: library_lock
  }))));
}

/* harmony default export */ var block_select_button = ((0,external_wp_element_namespaceObject.forwardRef)(ListViewBlockSelectButton));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/list-view/block-contents.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */




const ListViewBlockContents = (0,external_wp_element_namespaceObject.forwardRef)((_ref, ref) => {
  let {
    onClick,
    onToggleExpanded,
    block,
    isSelected,
    position,
    siblingBlockCount,
    level,
    isExpanded,
    selectedClientIds,
    ...props
  } = _ref;
  const {
    clientId
  } = block;
  const {
    blockMovingClientId,
    selectedBlockInBlockEditor
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      hasBlockMovingClientId,
      getSelectedBlockClientId
    } = select(store);
    return {
      blockMovingClientId: hasBlockMovingClientId(),
      selectedBlockInBlockEditor: getSelectedBlockClientId()
    };
  }, [clientId]);
  const isBlockMoveTarget = blockMovingClientId && selectedBlockInBlockEditor === clientId;
  const className = classnames_default()('block-editor-list-view-block-contents', {
    'is-dropping-before': isBlockMoveTarget
  }); // Only include all selected blocks if the currently clicked on block
  // is one of the selected blocks. This ensures that if a user attempts
  // to drag a block that isn't part of the selection, they're still able
  // to drag it and rearrange its position.

  const draggableClientIds = selectedClientIds.includes(clientId) ? selectedClientIds : [clientId];
  return (0,external_wp_element_namespaceObject.createElement)(block_draggable, {
    clientIds: draggableClientIds
  }, _ref2 => {
    let {
      draggable,
      onDragStart,
      onDragEnd
    } = _ref2;
    return (0,external_wp_element_namespaceObject.createElement)(block_select_button, _extends({
      ref: ref,
      className: className,
      block: block,
      onClick: onClick,
      onToggleExpanded: onToggleExpanded,
      isSelected: isSelected,
      position: position,
      siblingBlockCount: siblingBlockCount,
      level: level,
      draggable: draggable,
      onDragStart: onDragStart,
      onDragEnd: onDragEnd,
      isExpanded: isExpanded
    }, props));
  });
});
/* harmony default export */ var block_contents = (ListViewBlockContents);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/list-view/context.js
/**
 * WordPress dependencies
 */

const ListViewContext = (0,external_wp_element_namespaceObject.createContext)({
  __experimentalFeatures: false,
  __experimentalPersistentListViewFeatures: false
});
const useListViewContext = () => (0,external_wp_element_namespaceObject.useContext)(ListViewContext);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/list-view/utils.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */


const getBlockPositionDescription = (position, siblingCount, level) => (0,external_wp_i18n_namespaceObject.sprintf)(
/* translators: 1: The numerical position of the block. 2: The total number of blocks. 3. The level of nesting for the block. */
(0,external_wp_i18n_namespaceObject.__)('Block %1$d of %2$d, Level %3$d'), position, siblingCount, level);
/**
 * Returns true if the client ID occurs within the block selection or multi-selection,
 * or false otherwise.
 *
 * @param {string}          clientId               Block client ID.
 * @param {string|string[]} selectedBlockClientIds Selected block client ID, or an array of multi-selected blocks client IDs.
 *
 * @return {boolean} Whether the block is in multi-selection set.
 */

const isClientIdSelected = (clientId, selectedBlockClientIds) => (0,external_lodash_namespaceObject.isArray)(selectedBlockClientIds) && selectedBlockClientIds.length ? selectedBlockClientIds.indexOf(clientId) !== -1 : selectedBlockClientIds === clientId;
/**
 * From a start and end clientId of potentially different nesting levels,
 * return the nearest-depth ids that have a common level of depth in the
 * nesting hierarchy. For multiple block selection, this ensure that the
 * selection is always at the same nesting level, and not split across
 * separate levels.
 *
 * @param {string}   startId      The first id of a selection.
 * @param {string}   endId        The end id of a selection, usually one that has been clicked on.
 * @param {string[]} startParents An array of ancestor ids for the start id, in descending order.
 * @param {string[]} endParents   An array of ancestor ids for the end id, in descending order.
 * @return {Object} An object containing the start and end ids.
 */

function getCommonDepthClientIds(startId, endId, startParents, endParents) {
  const startPath = [...startParents, startId];
  const endPath = [...endParents, endId];
  const depth = Math.min(startPath.length, endPath.length) - 1;
  const start = startPath[depth];
  const end = endPath[depth];
  return {
    start,
    end
  };
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/list-view/block.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */







/**
 * Internal dependencies
 */











function ListViewBlock(_ref) {
  let {
    block,
    isDragged,
    isSelected,
    isBranchSelected,
    selectBlock,
    position,
    level,
    rowCount,
    siblingBlockCount,
    showBlockMovers,
    path,
    isExpanded,
    selectedClientIds,
    preventAnnouncement
  } = _ref;
  const cellRef = (0,external_wp_element_namespaceObject.useRef)(null);
  const [isHovered, setIsHovered] = (0,external_wp_element_namespaceObject.useState)(false);
  const {
    clientId
  } = block;
  const isFirstSelectedBlock = isSelected && selectedClientIds[0] === clientId;
  const isLastSelectedBlock = isSelected && selectedClientIds[selectedClientIds.length - 1] === clientId;
  const {
    toggleBlockHighlight
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const blockInformation = useBlockDisplayInformation(clientId);
  const {
    isLocked
  } = useBlockLock(clientId);
  const instanceId = (0,external_wp_compose_namespaceObject.useInstanceId)(ListViewBlock);
  const descriptionId = `list-view-block-select-button__${instanceId}`;
  const blockPositionDescription = getBlockPositionDescription(position, siblingBlockCount, level);

  let blockAriaLabel = (0,external_wp_i18n_namespaceObject.__)('Link');

  if (blockInformation) {
    blockAriaLabel = isLocked ? (0,external_wp_i18n_namespaceObject.sprintf)( // translators: %s: The title of the block. This string indicates a link to select the locked block.
    (0,external_wp_i18n_namespaceObject.__)('%s link (locked)'), blockInformation.title) : (0,external_wp_i18n_namespaceObject.sprintf)( // translators: %s: The title of the block. This string indicates a link to select the block.
    (0,external_wp_i18n_namespaceObject.__)('%s link'), blockInformation.title);
  }

  const settingsAriaLabel = blockInformation ? (0,external_wp_i18n_namespaceObject.sprintf)( // translators: %s: The title of the block.
  (0,external_wp_i18n_namespaceObject.__)('Options for %s block'), blockInformation.title) : (0,external_wp_i18n_namespaceObject.__)('Options');
  const {
    __experimentalFeatures: withExperimentalFeatures,
    __experimentalPersistentListViewFeatures: withExperimentalPersistentListViewFeatures,
    __experimentalHideContainerBlockActions: hideContainerBlockActions,
    isTreeGridMounted,
    expand,
    collapse
  } = useListViewContext();
  const hasSiblings = siblingBlockCount > 0;
  const hasRenderedMovers = showBlockMovers && hasSiblings;
  const moverCellClassName = classnames_default()('block-editor-list-view-block__mover-cell', {
    'is-visible': isHovered || isSelected
  });
  const listViewBlockSettingsClassName = classnames_default()('block-editor-list-view-block__menu-cell', {
    'is-visible': isHovered || isFirstSelectedBlock
  }); // If ListView has experimental features related to the Persistent List View,
  // only focus the selected list item on mount; otherwise the list would always
  // try to steal the focus from the editor canvas.

  (0,external_wp_element_namespaceObject.useEffect)(() => {
    if (withExperimentalPersistentListViewFeatures && !isTreeGridMounted && isSelected) {
      cellRef.current.focus();
    }
  }, []);
  const highlightBlock = withExperimentalPersistentListViewFeatures ? toggleBlockHighlight : () => {};
  const onMouseEnter = (0,external_wp_element_namespaceObject.useCallback)(() => {
    setIsHovered(true);
    highlightBlock(clientId, true);
  }, [clientId, setIsHovered, highlightBlock]);
  const onMouseLeave = (0,external_wp_element_namespaceObject.useCallback)(() => {
    setIsHovered(false);
    highlightBlock(clientId, false);
  }, [clientId, setIsHovered, highlightBlock]);
  const selectEditorBlock = (0,external_wp_element_namespaceObject.useCallback)(event => {
    selectBlock(event, clientId);
    event.preventDefault();
  }, [clientId, selectBlock]);
  const updateSelection = (0,external_wp_element_namespaceObject.useCallback)(newClientId => {
    selectBlock(undefined, newClientId);
  }, [selectBlock]);
  const toggleExpanded = (0,external_wp_element_namespaceObject.useCallback)(event => {
    // Prevent shift+click from opening link in a new window when toggling.
    event.preventDefault();
    event.stopPropagation();

    if (isExpanded === true) {
      collapse(clientId);
    } else if (isExpanded === false) {
      expand(clientId);
    }
  }, [clientId, expand, collapse, isExpanded]);
  const showBlockActions = withExperimentalFeatures && ( // hide actions for blocks like core/widget-areas
  !hideContainerBlockActions || hideContainerBlockActions && level > 1);
  const hideBlockActions = withExperimentalFeatures && !showBlockActions;
  let colSpan;

  if (hasRenderedMovers) {
    colSpan = 2;
  } else if (hideBlockActions) {
    colSpan = 3;
  }

  const classes = classnames_default()({
    'is-selected': isSelected,
    'is-first-selected': isFirstSelectedBlock,
    'is-last-selected': isLastSelectedBlock,
    'is-branch-selected': withExperimentalPersistentListViewFeatures && isBranchSelected,
    'is-dragging': isDragged,
    'has-single-cell': hideBlockActions
  }); // Only include all selected blocks if the currently clicked on block
  // is one of the selected blocks. This ensures that if a user attempts
  // to alter a block that isn't part of the selection, they're still able
  // to do so.

  const dropdownClientIds = selectedClientIds.includes(clientId) ? selectedClientIds : [clientId];
  return (0,external_wp_element_namespaceObject.createElement)(ListViewLeaf, {
    className: classes,
    onMouseEnter: onMouseEnter,
    onMouseLeave: onMouseLeave,
    onFocus: onMouseEnter,
    onBlur: onMouseLeave,
    level: level,
    position: position,
    rowCount: rowCount,
    path: path,
    id: `list-view-block-${clientId}`,
    "data-block": clientId,
    isExpanded: isExpanded,
    "aria-selected": !!isSelected
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalTreeGridCell, {
    className: "block-editor-list-view-block__contents-cell",
    colSpan: colSpan,
    ref: cellRef,
    "aria-label": blockAriaLabel,
    "aria-selected": !!isSelected,
    "aria-expanded": isExpanded,
    "aria-describedby": descriptionId
  }, _ref2 => {
    let {
      ref,
      tabIndex,
      onFocus
    } = _ref2;
    return (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "block-editor-list-view-block__contents-container"
    }, (0,external_wp_element_namespaceObject.createElement)(block_contents, {
      block: block,
      onClick: selectEditorBlock,
      onToggleExpanded: toggleExpanded,
      isSelected: isSelected,
      position: position,
      siblingBlockCount: siblingBlockCount,
      level: level,
      ref: ref,
      tabIndex: tabIndex,
      onFocus: onFocus,
      isExpanded: isExpanded,
      selectedClientIds: selectedClientIds,
      preventAnnouncement: preventAnnouncement
    }), (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "block-editor-list-view-block-select-button__description",
      id: descriptionId
    }, blockPositionDescription));
  }), hasRenderedMovers && (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalTreeGridCell, {
    className: moverCellClassName,
    withoutGridItem: true
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalTreeGridItem, null, _ref3 => {
    let {
      ref,
      tabIndex,
      onFocus
    } = _ref3;
    return (0,external_wp_element_namespaceObject.createElement)(BlockMoverUpButton, {
      orientation: "vertical",
      clientIds: [clientId],
      ref: ref,
      tabIndex: tabIndex,
      onFocus: onFocus
    });
  }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalTreeGridItem, null, _ref4 => {
    let {
      ref,
      tabIndex,
      onFocus
    } = _ref4;
    return (0,external_wp_element_namespaceObject.createElement)(BlockMoverDownButton, {
      orientation: "vertical",
      clientIds: [clientId],
      ref: ref,
      tabIndex: tabIndex,
      onFocus: onFocus
    });
  }))), showBlockActions && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalTreeGridCell, {
    className: listViewBlockSettingsClassName,
    "aria-selected": !!isSelected
  }, _ref5 => {
    let {
      ref,
      tabIndex,
      onFocus
    } = _ref5;
    return (0,external_wp_element_namespaceObject.createElement)(block_settings_dropdown, {
      clientIds: dropdownClientIds,
      icon: more_vertical,
      label: settingsAriaLabel,
      toggleProps: {
        ref,
        className: 'block-editor-list-view-block__menu',
        tabIndex,
        onFocus
      },
      disableOpenOnArrowDown: true,
      __experimentalSelectBlock: updateSelection
    });
  }));
}

/* harmony default export */ var list_view_block = ((0,external_wp_element_namespaceObject.memo)(ListViewBlock));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/list-view/branch.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */




/**
 * Given a block, returns the total number of blocks in that subtree. This is used to help determine
 * the list position of a block.
 *
 * When a block is collapsed, we do not count their children as part of that total. In the current drag
 * implementation dragged blocks and their children are not counted.
 *
 * @param {Object}  block               block tree
 * @param {Object}  expandedState       state that notes which branches are collapsed
 * @param {Array}   draggedClientIds    a list of dragged client ids
 * @param {boolean} isExpandedByDefault flag to determine the default fallback expanded state.
 * @return {number} block count
 */

function countBlocks(block, expandedState, draggedClientIds, isExpandedByDefault) {
  var _expandedState$block$;

  const isDragged = draggedClientIds === null || draggedClientIds === void 0 ? void 0 : draggedClientIds.includes(block.clientId);

  if (isDragged) {
    return 0;
  }

  const isExpanded = (_expandedState$block$ = expandedState[block.clientId]) !== null && _expandedState$block$ !== void 0 ? _expandedState$block$ : isExpandedByDefault;

  if (isExpanded) {
    return 1 + block.innerBlocks.reduce(countReducer(expandedState, draggedClientIds, isExpandedByDefault), 0);
  }

  return 1;
}

const countReducer = (expandedState, draggedClientIds, isExpandedByDefault) => (count, block) => {
  var _expandedState$block$2;

  const isDragged = draggedClientIds === null || draggedClientIds === void 0 ? void 0 : draggedClientIds.includes(block.clientId);

  if (isDragged) {
    return count;
  }

  const isExpanded = (_expandedState$block$2 = expandedState[block.clientId]) !== null && _expandedState$block$2 !== void 0 ? _expandedState$block$2 : isExpandedByDefault;

  if (isExpanded && block.innerBlocks.length > 0) {
    return count + countBlocks(block, expandedState, draggedClientIds, isExpandedByDefault);
  }

  return count + 1;
};

function ListViewBranch(props) {
  const {
    blocks,
    selectBlock,
    showBlockMovers,
    showNestedBlocks,
    selectedClientIds,
    level = 1,
    path = '',
    isBranchSelected = false,
    listPosition = 0,
    fixedListWindow,
    expandNested
  } = props;
  const {
    expandedState,
    draggedClientIds,
    __experimentalPersistentListViewFeatures
  } = useListViewContext();
  const filteredBlocks = (0,external_lodash_namespaceObject.compact)(blocks);
  const blockCount = filteredBlocks.length;
  let nextPosition = listPosition;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, filteredBlocks.map((block, index) => {
    var _expandedState$client;

    const {
      clientId,
      innerBlocks
    } = block;

    if (index > 0) {
      nextPosition += countBlocks(filteredBlocks[index - 1], expandedState, draggedClientIds, expandNested);
    }

    const usesWindowing = __experimentalPersistentListViewFeatures;
    const {
      itemInView
    } = fixedListWindow;
    const blockInView = !usesWindowing || itemInView(nextPosition);
    const position = index + 1;
    const updatedPath = path.length > 0 ? `${path}_${position}` : `${position}`;
    const hasNestedBlocks = showNestedBlocks && !!innerBlocks && !!innerBlocks.length;
    const isExpanded = hasNestedBlocks ? (_expandedState$client = expandedState[clientId]) !== null && _expandedState$client !== void 0 ? _expandedState$client : expandNested : undefined;
    const isDragged = !!(draggedClientIds !== null && draggedClientIds !== void 0 && draggedClientIds.includes(clientId));
    const showBlock = isDragged || blockInView; // Make updates to the selected or dragged blocks synchronous,
    // but asynchronous for any other block.

    const isSelected = isClientIdSelected(clientId, selectedClientIds);
    const isSelectedBranch = isBranchSelected || isSelected && hasNestedBlocks;
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_data_namespaceObject.AsyncModeProvider, {
      key: clientId,
      value: !isSelected
    }, showBlock && (0,external_wp_element_namespaceObject.createElement)(list_view_block, {
      block: block,
      selectBlock: selectBlock,
      isSelected: isSelected,
      isBranchSelected: isSelectedBranch,
      isDragged: isDragged,
      level: level,
      position: position,
      rowCount: blockCount,
      siblingBlockCount: blockCount,
      showBlockMovers: showBlockMovers,
      path: updatedPath,
      isExpanded: isExpanded,
      listPosition: nextPosition,
      selectedClientIds: selectedClientIds
    }), !showBlock && (0,external_wp_element_namespaceObject.createElement)("tr", null, (0,external_wp_element_namespaceObject.createElement)("td", {
      className: "block-editor-list-view-placeholder"
    })), hasNestedBlocks && isExpanded && !isDragged && (0,external_wp_element_namespaceObject.createElement)(ListViewBranch, {
      blocks: innerBlocks,
      selectBlock: selectBlock,
      showBlockMovers: showBlockMovers,
      showNestedBlocks: showNestedBlocks,
      level: level + 1,
      path: updatedPath,
      listPosition: nextPosition + 1,
      fixedListWindow: fixedListWindow,
      isBranchSelected: isSelectedBranch,
      selectedClientIds: selectedClientIds,
      expandNested: expandNested
    }));
  }));
}

ListViewBranch.defaultProps = {
  selectBlock: () => {}
};
/* harmony default export */ var branch = ((0,external_wp_element_namespaceObject.memo)(ListViewBranch));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/list-view/drop-indicator.js


/**
 * WordPress dependencies
 */


function ListViewDropIndicator(_ref) {
  let {
    listViewRef,
    blockDropTarget
  } = _ref;
  const {
    rootClientId,
    clientId,
    dropPosition
  } = blockDropTarget || {};
  const [rootBlockElement, blockElement] = (0,external_wp_element_namespaceObject.useMemo)(() => {
    if (!listViewRef.current) {
      return [];
    } // The rootClientId will be defined whenever dropping into inner
    // block lists, but is undefined when dropping at the root level.


    const _rootBlockElement = rootClientId ? listViewRef.current.querySelector(`[data-block="${rootClientId}"]`) : undefined; // The clientId represents the sibling block, the dragged block will
    // usually be inserted adjacent to it. It will be undefined when
    // dropping a block into an empty block list.


    const _blockElement = clientId ? listViewRef.current.querySelector(`[data-block="${clientId}"]`) : undefined;

    return [_rootBlockElement, _blockElement];
  }, [rootClientId, clientId]); // The targetElement is the element that the drop indicator will appear
  // before or after. When dropping into an empty block list, blockElement
  // is undefined, so the indicator will appear after the rootBlockElement.

  const targetElement = blockElement || rootBlockElement;
  const getDropIndicatorIndent = (0,external_wp_element_namespaceObject.useCallback)(() => {
    if (!rootBlockElement) {
      return 0;
    } // Calculate the indent using the block icon of the root block.
    // Using a classname selector here might be flaky and could be
    // improved.


    const targetElementRect = targetElement.getBoundingClientRect();
    const rootBlockIconElement = rootBlockElement.querySelector('.block-editor-block-icon');
    const rootBlockIconRect = rootBlockIconElement.getBoundingClientRect();
    return rootBlockIconRect.right - targetElementRect.left;
  }, [rootBlockElement, targetElement]);
  const style = (0,external_wp_element_namespaceObject.useMemo)(() => {
    if (!targetElement) {
      return {};
    }

    const indent = getDropIndicatorIndent();
    return {
      width: targetElement.offsetWidth - indent
    };
  }, [getDropIndicatorIndent, targetElement]);
  const getAnchorRect = (0,external_wp_element_namespaceObject.useCallback)(() => {
    if (!targetElement) {
      return {};
    }

    const ownerDocument = targetElement.ownerDocument;
    const rect = targetElement.getBoundingClientRect();
    const indent = getDropIndicatorIndent();
    const anchorRect = {
      left: rect.left + indent,
      right: rect.right,
      width: 0,
      height: rect.height,
      ownerDocument
    };

    if (dropPosition === 'top') {
      return { ...anchorRect,
        top: rect.top,
        bottom: rect.top
      };
    }

    if (dropPosition === 'bottom' || dropPosition === 'inside') {
      return { ...anchorRect,
        top: rect.bottom,
        bottom: rect.bottom
      };
    }

    return {};
  }, [targetElement, dropPosition, getDropIndicatorIndent]);

  if (!targetElement) {
    return null;
  }

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Popover, {
    noArrow: true,
    animate: false,
    getAnchorRect: getAnchorRect,
    focusOnMount: false,
    className: "block-editor-list-view-drop-indicator"
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    style: style,
    className: "block-editor-list-view-drop-indicator__line"
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/list-view/use-block-selection.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */







/**
 * Internal dependencies
 */



function useBlockSelection() {
  const {
    clearSelectedBlock,
    multiSelect,
    selectBlock
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const {
    getBlockName,
    getBlockParents,
    getBlockSelectionStart,
    getBlockSelectionEnd,
    getSelectedBlockClientIds,
    hasMultiSelection,
    hasSelectedBlock
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const {
    getBlockType
  } = (0,external_wp_data_namespaceObject.useSelect)(external_wp_blocks_namespaceObject.store);
  const updateBlockSelection = (0,external_wp_element_namespaceObject.useCallback)(async (event, clientId, destinationClientId) => {
    if (!(event !== null && event !== void 0 && event.shiftKey)) {
      await clearSelectedBlock();
      selectBlock(clientId);
      return;
    } // To handle multiple block selection via the `SHIFT` key, prevent
    // the browser default behavior of opening the link in a new window.


    event.preventDefault();
    const isKeyPress = event.type === 'keydown' && (event.keyCode === external_wp_keycodes_namespaceObject.UP || event.keyCode === external_wp_keycodes_namespaceObject.DOWN || event.keyCode === external_wp_keycodes_namespaceObject.HOME || event.keyCode === external_wp_keycodes_namespaceObject.END); // Handle clicking on a block when no blocks are selected, and return early.

    if (!isKeyPress && !hasSelectedBlock() && !hasMultiSelection()) {
      selectBlock(clientId, null);
      return;
    }

    const selectedBlocks = getSelectedBlockClientIds();
    const clientIdWithParents = [...getBlockParents(clientId), clientId];

    if (isKeyPress && !selectedBlocks.some(blockId => clientIdWithParents.includes(blockId))) {
      // Ensure that shift-selecting blocks via the keyboard only
      // expands the current selection if focusing over already
      // selected blocks. Otherwise, clear the selection so that
      // a user can create a new selection entirely by keyboard.
      await clearSelectedBlock();
    }

    let startTarget = getBlockSelectionStart();
    let endTarget = clientId; // Handle keyboard behavior for selecting multiple blocks.

    if (isKeyPress) {
      if (!hasSelectedBlock() && !hasMultiSelection()) {
        // Set the starting point of the selection to the currently
        // focused block, if there are no blocks currently selected.
        // This ensures that as the selection is expanded or contracted,
        // the starting point of the selection is anchored to that block.
        startTarget = clientId;
      }

      if (destinationClientId) {
        // If the user presses UP or DOWN, we want to ensure that the block they're
        // moving to is the target for selection, and not the currently focused one.
        endTarget = destinationClientId;
      }
    }

    const startParents = getBlockParents(startTarget);
    const endParents = getBlockParents(endTarget);
    const {
      start,
      end
    } = getCommonDepthClientIds(startTarget, endTarget, startParents, endParents);
    await multiSelect(start, end, null); // Announce deselected block, or number of deselected blocks if
    // the total number of blocks deselected is greater than one.

    const updatedSelectedBlocks = getSelectedBlockClientIds(); // If the selection is greater than 1 and the Home or End keys
    // were used to generate the selection, then skip announcing the
    // deselected blocks.

    if ((event.keyCode === external_wp_keycodes_namespaceObject.HOME || event.keyCode === external_wp_keycodes_namespaceObject.END) && updatedSelectedBlocks.length > 1) {
      return;
    }

    const selectionDiff = (0,external_lodash_namespaceObject.difference)(selectedBlocks, updatedSelectedBlocks);
    let label;

    if (selectionDiff.length === 1) {
      var _getBlockType;

      const title = (_getBlockType = getBlockType(getBlockName(selectionDiff[0]))) === null || _getBlockType === void 0 ? void 0 : _getBlockType.title;

      if (title) {
        label = (0,external_wp_i18n_namespaceObject.sprintf)(
        /* translators: %s: block name */
        (0,external_wp_i18n_namespaceObject.__)('%s deselected.'), title);
      }
    } else if (selectionDiff.length > 1) {
      label = (0,external_wp_i18n_namespaceObject.sprintf)(
      /* translators: %s: number of deselected blocks */
      (0,external_wp_i18n_namespaceObject.__)('%s blocks deselected.'), selectionDiff.length);
    }

    if (label) {
      (0,external_wp_a11y_namespaceObject.speak)(label);
    }
  }, [clearSelectedBlock, getBlockName, getBlockType, getBlockParents, getBlockSelectionStart, getBlockSelectionEnd, getSelectedBlockClientIds, hasMultiSelection, hasSelectedBlock, multiSelect, selectBlock]);
  return {
    updateBlockSelection
  };
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/list-view/use-list-view-client-ids.js
/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */


function useListViewClientIds(blocks) {
  return (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getDraggedBlockClientIds,
      getSelectedBlockClientIds,
      __unstableGetClientIdsTree
    } = select(store);
    return {
      selectedClientIds: getSelectedBlockClientIds(),
      draggedClientIds: getDraggedBlockClientIds(),
      clientIdsTree: blocks ? blocks : __unstableGetClientIdsTree()
    };
  }, [blocks]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/list-view/use-list-view-drop-zone.js
/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */




/** @typedef {import('../../utils/math').WPPoint} WPPoint */

/**
 * The type of a drag event.
 *
 * @typedef {'default'|'file'|'html'} WPDragEventType
 */

/**
 * An array representing data for blocks in the DOM used by drag and drop.
 *
 * @typedef {Object} WPListViewDropZoneBlocks
 * @property {string}  clientId                        The client id for the block.
 * @property {string}  rootClientId                    The root client id for the block.
 * @property {number}  blockIndex                      The block's index.
 * @property {Element} element                         The DOM element representing the block.
 * @property {number}  innerBlockCount                 The number of inner blocks the block has.
 * @property {boolean} isDraggedBlock                  Whether the block is currently being dragged.
 * @property {boolean} canInsertDraggedBlocksAsSibling Whether the dragged block can be a sibling of this block.
 * @property {boolean} canInsertDraggedBlocksAsChild   Whether the dragged block can be a child of this block.
 */

/**
 * An object containing details of a drop target.
 *
 * @typedef {Object} WPListViewDropZoneTarget
 * @property {string}                  blockIndex   The insertion index.
 * @property {string}                  rootClientId The root client id for the block.
 * @property {string|undefined}        clientId     The client id for the block.
 * @property {'top'|'bottom'|'inside'} dropPosition The position relative to the block that the user is dropping to.
 *                                                  'inside' refers to nesting as an inner block.
 */

/**
 * Is the point contained by the rectangle.
 *
 * @param {WPPoint} point The point.
 * @param {DOMRect} rect  The rectangle.
 *
 * @return {boolean} True if the point is contained by the rectangle, false otherwise.
 */

function isPointContainedByRect(point, rect) {
  return rect.left <= point.x && rect.right >= point.x && rect.top <= point.y && rect.bottom >= point.y;
}
/**
 * Determines whether the user positioning the dragged block to nest as an
 * inner block.
 *
 * Presently this is determined by whether the cursor is on the right hand side
 * of the block.
 *
 * @param {WPPoint} point The point representing the cursor position when dragging.
 * @param {DOMRect} rect  The rectangle.
 */


function isNestingGesture(point, rect) {
  const blockCenterX = rect.left + rect.width / 2;
  return point.x > blockCenterX;
} // Block navigation is always a vertical list, so only allow dropping
// to the above or below a block.


const ALLOWED_DROP_EDGES = ['top', 'bottom'];
/**
 * Given blocks data and the cursor position, compute the drop target.
 *
 * @param {WPListViewDropZoneBlocks} blocksData Data about the blocks in list view.
 * @param {WPPoint}                  position   The point representing the cursor position when dragging.
 *
 * @return {WPListViewDropZoneTarget} An object containing data about the drop target.
 */

function getListViewDropTarget(blocksData, position) {
  let candidateEdge;
  let candidateBlockData;
  let candidateDistance;
  let candidateRect;

  for (const blockData of blocksData) {
    if (blockData.isDraggedBlock) {
      continue;
    }

    const rect = blockData.element.getBoundingClientRect();
    const [distance, edge] = getDistanceToNearestEdge(position, rect, ALLOWED_DROP_EDGES);
    const isCursorWithinBlock = isPointContainedByRect(position, rect);

    if (candidateDistance === undefined || distance < candidateDistance || isCursorWithinBlock) {
      candidateDistance = distance;
      const index = blocksData.indexOf(blockData);
      const previousBlockData = blocksData[index - 1]; // If dragging near the top of a block and the preceding block
      // is at the same level, use the preceding block as the candidate
      // instead, as later it makes determining a nesting drop easier.

      if (edge === 'top' && previousBlockData && previousBlockData.rootClientId === blockData.rootClientId && !previousBlockData.isDraggedBlock) {
        candidateBlockData = previousBlockData;
        candidateEdge = 'bottom';
        candidateRect = previousBlockData.element.getBoundingClientRect();
      } else {
        candidateBlockData = blockData;
        candidateEdge = edge;
        candidateRect = rect;
      } // If the mouse position is within the block, break early
      // as the user would intend to drop either before or after
      // this block.
      //
      // This solves an issue where some rows in the list view
      // tree overlap slightly due to sub-pixel rendering.


      if (isCursorWithinBlock) {
        break;
      }
    }
  }

  if (!candidateBlockData) {
    return;
  }

  const isDraggingBelow = candidateEdge === 'bottom'; // If the user is dragging towards the bottom of the block check whether
  // they might be trying to nest the block as a child.
  // If the block already has inner blocks, this should always be treated
  // as nesting since the next block in the tree will be the first child.

  if (isDraggingBelow && candidateBlockData.canInsertDraggedBlocksAsChild && (candidateBlockData.innerBlockCount > 0 || isNestingGesture(position, candidateRect))) {
    return {
      rootClientId: candidateBlockData.clientId,
      blockIndex: 0,
      dropPosition: 'inside'
    };
  } // If dropping as a sibling, but block cannot be inserted in
  // this context, return early.


  if (!candidateBlockData.canInsertDraggedBlocksAsSibling) {
    return;
  }

  const offset = isDraggingBelow ? 1 : 0;
  return {
    rootClientId: candidateBlockData.rootClientId,
    clientId: candidateBlockData.clientId,
    blockIndex: candidateBlockData.blockIndex + offset,
    dropPosition: candidateEdge
  };
}
/**
 * A react hook for implementing a drop zone in list view.
 *
 * @return {WPListViewDropZoneTarget} The drop target.
 */


function useListViewDropZone() {
  const {
    getBlockRootClientId,
    getBlockIndex,
    getBlockCount,
    getDraggedBlockClientIds,
    canInsertBlocks
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const [target, setTarget] = (0,external_wp_element_namespaceObject.useState)();
  const {
    rootClientId: targetRootClientId,
    blockIndex: targetBlockIndex
  } = target || {};
  const onBlockDrop = useOnBlockDrop(targetRootClientId, targetBlockIndex);
  const draggedBlockClientIds = getDraggedBlockClientIds();
  const throttled = (0,external_wp_compose_namespaceObject.useThrottle)((0,external_wp_element_namespaceObject.useCallback)((event, currentTarget) => {
    const position = {
      x: event.clientX,
      y: event.clientY
    };
    const isBlockDrag = !!(draggedBlockClientIds !== null && draggedBlockClientIds !== void 0 && draggedBlockClientIds.length);
    const blockElements = Array.from(currentTarget.querySelectorAll('[data-block]'));
    const blocksData = blockElements.map(blockElement => {
      const clientId = blockElement.dataset.block;
      const rootClientId = getBlockRootClientId(clientId);
      return {
        clientId,
        rootClientId,
        blockIndex: getBlockIndex(clientId),
        element: blockElement,
        isDraggedBlock: isBlockDrag ? draggedBlockClientIds.includes(clientId) : false,
        innerBlockCount: getBlockCount(clientId),
        canInsertDraggedBlocksAsSibling: isBlockDrag ? canInsertBlocks(draggedBlockClientIds, rootClientId) : true,
        canInsertDraggedBlocksAsChild: isBlockDrag ? canInsertBlocks(draggedBlockClientIds, clientId) : true
      };
    });
    const newTarget = getListViewDropTarget(blocksData, position);

    if (newTarget) {
      setTarget(newTarget);
    }
  }, [draggedBlockClientIds]), 200);
  const ref = (0,external_wp_compose_namespaceObject.__experimentalUseDropZone)({
    onDrop: onBlockDrop,

    onDragOver(event) {
      // `currentTarget` is only available while the event is being
      // handled, so get it now and pass it to the thottled function.
      // https://developer.mozilla.org/en-US/docs/Web/API/Event/currentTarget
      throttled(event, event.currentTarget);
    },

    onDragEnd() {
      throttled.cancel();
      setTarget(null);
    }

  });
  return {
    ref,
    target
  };
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/list-view/use-list-view-expand-selected-item.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


function useListViewExpandSelectedItem(_ref) {
  let {
    firstSelectedBlockClientId,
    setExpandedState
  } = _ref;
  const [selectedTreeId, setSelectedTreeId] = (0,external_wp_element_namespaceObject.useState)(null);
  const {
    selectedBlockParentClientIds
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getBlockParents
    } = select(store);
    return {
      selectedBlockParentClientIds: getBlockParents(firstSelectedBlockClientId, false)
    };
  }, [firstSelectedBlockClientId]);
  const parentClientIds = Array.isArray(selectedBlockParentClientIds) && selectedBlockParentClientIds.length ? selectedBlockParentClientIds : null; // Expand tree when a block is selected.

  (0,external_wp_element_namespaceObject.useEffect)(() => {
    // If the selectedTreeId is the same as the selected block,
    // it means that the block was selected using the block list tree.
    if (selectedTreeId === firstSelectedBlockClientId) {
      return;
    } // If the selected block has parents, get the top-level parent.


    if (parentClientIds) {
      // If the selected block has parents,
      // expand the tree branch.
      setExpandedState({
        type: 'expand',
        clientIds: selectedBlockParentClientIds
      });
    }
  }, [firstSelectedBlockClientId]);
  return {
    setSelectedTreeId
  };
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/list-view/index.js



/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */










const expanded = (state, action) => {
  if (Array.isArray(action.clientIds)) {
    return { ...state,
      ...action.clientIds.reduce((newState, id) => ({ ...newState,
        [id]: action.type === 'expand'
      }), {})
    };
  }

  return state;
};

const BLOCK_LIST_ITEM_HEIGHT = 36;
/**
 * Wrap `ListViewRows` with `TreeGrid`. ListViewRows is a
 * recursive component (it renders itself), so this ensures TreeGrid is only
 * present at the very top of the navigation grid.
 *
 * @param {Object}  props                                          Components props.
 * @param {Array}   props.blocks                                   Custom subset of block client IDs to be used instead of the default hierarchy.
 * @param {boolean} props.showNestedBlocks                         Flag to enable displaying nested blocks.
 * @param {boolean} props.showBlockMovers                          Flag to enable block movers
 * @param {boolean} props.__experimentalFeatures                   Flag to enable experimental features.
 * @param {boolean} props.__experimentalPersistentListViewFeatures Flag to enable features for the Persistent List View experiment.
 * @param {boolean} props.__experimentalHideContainerBlockActions  Flag to hide actions of top level blocks (like core/widget-area)
 * @param {string}  props.id                                       Unique identifier for the root list element (primarily for a11y purposes).
 * @param {boolean} props.expandNested                             Flag to determine whether nested levels are expanded by default.
 * @param {Object}  ref                                            Forwarded ref
 */

function ListView(_ref, ref) {
  let {
    blocks,
    __experimentalFeatures,
    __experimentalPersistentListViewFeatures,
    __experimentalHideContainerBlockActions,
    showNestedBlocks,
    showBlockMovers,
    id,
    expandNested = false,
    ...props
  } = _ref;
  const {
    clientIdsTree,
    draggedClientIds,
    selectedClientIds
  } = useListViewClientIds(blocks);
  const {
    visibleBlockCount
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getGlobalBlockCount,
      getClientIdsOfDescendants
    } = select(store);
    const draggedBlockCount = (draggedClientIds === null || draggedClientIds === void 0 ? void 0 : draggedClientIds.length) > 0 ? getClientIdsOfDescendants(draggedClientIds).length + 1 : 0;
    return {
      visibleBlockCount: getGlobalBlockCount() - draggedBlockCount
    };
  }, [draggedClientIds]);
  const {
    updateBlockSelection
  } = useBlockSelection();
  const [expandedState, setExpandedState] = (0,external_wp_element_namespaceObject.useReducer)(expanded, {});
  const {
    ref: dropZoneRef,
    target: blockDropTarget
  } = useListViewDropZone();
  const elementRef = (0,external_wp_element_namespaceObject.useRef)();
  const treeGridRef = (0,external_wp_compose_namespaceObject.useMergeRefs)([elementRef, dropZoneRef, ref]);
  const isMounted = (0,external_wp_element_namespaceObject.useRef)(false);
  const {
    setSelectedTreeId
  } = useListViewExpandSelectedItem({
    firstSelectedBlockClientId: selectedClientIds[0],
    setExpandedState
  });
  const selectEditorBlock = (0,external_wp_element_namespaceObject.useCallback)((event, clientId) => {
    updateBlockSelection(event, clientId);
    setSelectedTreeId(clientId);
  }, [setSelectedTreeId, updateBlockSelection]);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    isMounted.current = true;
  }, []); // List View renders a fixed number of items and relies on each having a fixed item height of 36px.
  // If this value changes, we should also change the itemHeight value set in useFixedWindowList.
  // See: https://github.com/WordPress/gutenberg/pull/35230 for additional context.

  const [fixedListWindow] = (0,external_wp_compose_namespaceObject.__experimentalUseFixedWindowList)(elementRef, BLOCK_LIST_ITEM_HEIGHT, visibleBlockCount, {
    useWindowing: __experimentalPersistentListViewFeatures,
    windowOverscan: 40
  });
  const expand = (0,external_wp_element_namespaceObject.useCallback)(clientId => {
    if (!clientId) {
      return;
    }

    setExpandedState({
      type: 'expand',
      clientIds: [clientId]
    });
  }, [setExpandedState]);
  const collapse = (0,external_wp_element_namespaceObject.useCallback)(clientId => {
    if (!clientId) {
      return;
    }

    setExpandedState({
      type: 'collapse',
      clientIds: [clientId]
    });
  }, [setExpandedState]);
  const expandRow = (0,external_wp_element_namespaceObject.useCallback)(row => {
    var _row$dataset;

    expand(row === null || row === void 0 ? void 0 : (_row$dataset = row.dataset) === null || _row$dataset === void 0 ? void 0 : _row$dataset.block);
  }, [expand]);
  const collapseRow = (0,external_wp_element_namespaceObject.useCallback)(row => {
    var _row$dataset2;

    collapse(row === null || row === void 0 ? void 0 : (_row$dataset2 = row.dataset) === null || _row$dataset2 === void 0 ? void 0 : _row$dataset2.block);
  }, [collapse]);
  const focusRow = (0,external_wp_element_namespaceObject.useCallback)((event, startRow, endRow) => {
    if (event.shiftKey) {
      var _startRow$dataset, _endRow$dataset;

      updateBlockSelection(event, startRow === null || startRow === void 0 ? void 0 : (_startRow$dataset = startRow.dataset) === null || _startRow$dataset === void 0 ? void 0 : _startRow$dataset.block, endRow === null || endRow === void 0 ? void 0 : (_endRow$dataset = endRow.dataset) === null || _endRow$dataset === void 0 ? void 0 : _endRow$dataset.block);
    }
  }, [updateBlockSelection]);
  const contextValue = (0,external_wp_element_namespaceObject.useMemo)(() => ({
    __experimentalFeatures,
    __experimentalPersistentListViewFeatures,
    __experimentalHideContainerBlockActions,
    isTreeGridMounted: isMounted.current,
    draggedClientIds,
    expandedState,
    expand,
    collapse
  }), [__experimentalFeatures, __experimentalPersistentListViewFeatures, __experimentalHideContainerBlockActions, isMounted.current, draggedClientIds, expandedState, expand, collapse]);
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_data_namespaceObject.AsyncModeProvider, {
    value: true
  }, (0,external_wp_element_namespaceObject.createElement)(ListViewDropIndicator, {
    listViewRef: elementRef,
    blockDropTarget: blockDropTarget
  }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalTreeGrid, {
    id: id,
    className: "block-editor-list-view-tree",
    "aria-label": (0,external_wp_i18n_namespaceObject.__)('Block navigation structure'),
    ref: treeGridRef,
    onCollapseRow: collapseRow,
    onExpandRow: expandRow,
    onFocusRow: focusRow
  }, (0,external_wp_element_namespaceObject.createElement)(ListViewContext.Provider, {
    value: contextValue
  }, (0,external_wp_element_namespaceObject.createElement)(branch, _extends({
    blocks: clientIdsTree,
    selectBlock: selectEditorBlock,
    showNestedBlocks: showNestedBlocks,
    showBlockMovers: showBlockMovers,
    fixedListWindow: fixedListWindow,
    selectedClientIds: selectedClientIds,
    expandNested: expandNested
  }, props)))));
}

/* harmony default export */ var components_list_view = ((0,external_wp_element_namespaceObject.forwardRef)(ListView));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-navigation/dropdown.js



/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */




function BlockNavigationDropdownToggle(_ref) {
  let {
    isEnabled,
    onToggle,
    isOpen,
    innerRef,
    ...props
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, _extends({}, props, {
    ref: innerRef,
    icon: list_view,
    "aria-expanded": isOpen,
    "aria-haspopup": "true",
    onClick: isEnabled ? onToggle : undefined
    /* translators: button label text should, if possible, be under 16 characters. */
    ,
    label: (0,external_wp_i18n_namespaceObject.__)('List view'),
    className: "block-editor-block-navigation",
    "aria-disabled": !isEnabled
  }));
}

function BlockNavigationDropdown(_ref2, ref) {
  let {
    isDisabled,
    __experimentalFeatures,
    ...props
  } = _ref2;
  const hasBlocks = (0,external_wp_data_namespaceObject.useSelect)(select => !!select(store).getBlockCount(), []);
  const isEnabled = hasBlocks && !isDisabled;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Dropdown, {
    contentClassName: "block-editor-block-navigation__popover",
    position: "bottom right",
    renderToggle: _ref3 => {
      let {
        isOpen,
        onToggle
      } = _ref3;
      return (0,external_wp_element_namespaceObject.createElement)(BlockNavigationDropdownToggle, _extends({}, props, {
        innerRef: ref,
        isOpen: isOpen,
        onToggle: onToggle,
        isEnabled: isEnabled
      }));
    },
    renderContent: () => (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "block-editor-block-navigation__container"
    }, (0,external_wp_element_namespaceObject.createElement)("p", {
      className: "block-editor-block-navigation__label"
    }, (0,external_wp_i18n_namespaceObject.__)('List view')), (0,external_wp_element_namespaceObject.createElement)(components_list_view, {
      showNestedBlocks: true,
      __experimentalFeatures: __experimentalFeatures
    }))
  });
}

/* harmony default export */ var dropdown = ((0,external_wp_element_namespaceObject.forwardRef)(BlockNavigationDropdown));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-styles/preview-panel.js


/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */



function BlockStylesPreviewPanel(_ref) {
  let {
    genericPreviewBlock,
    style,
    className,
    activeStyle
  } = _ref;
  const styleClassName = replaceActiveStyle(className, activeStyle, style);
  const previewBlocks = (0,external_wp_element_namespaceObject.useMemo)(() => {
    return { ...genericPreviewBlock,
      title: style.label || style.name,
      description: style.description,
      initialAttributes: { ...genericPreviewBlock.attributes,
        className: styleClassName + ' block-editor-block-styles__block-preview-container'
      }
    };
  }, [genericPreviewBlock, styleClassName]);
  return (0,external_wp_element_namespaceObject.createElement)(preview_panel, {
    item: previewBlocks,
    isStylePreview: true
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-styles/index.js


/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */




function BlockStylesPreviewPanelSlot(_ref) {
  let {
    scope
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Slot, {
    name: `BlockStylesPreviewPanel/${scope}`
  });
}

function BlockStylesPreviewPanelFill(_ref2) {
  let {
    children,
    scope,
    ...props
  } = _ref2;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Fill, {
    name: `BlockStylesPreviewPanel/${scope}`
  }, (0,external_wp_element_namespaceObject.createElement)("div", props, children));
} // Top position (in px) of the Block Styles container
// relative to the editor pane.
// The value is the equivalent of the container's right position.


const DEFAULT_POSITION_TOP = 16; // Block Styles component for the Settings Sidebar.

function BlockStyles(_ref3) {
  let {
    clientId,
    onSwitch = external_lodash_namespaceObject.noop,
    onHoverClassName = external_lodash_namespaceObject.noop,
    scope
  } = _ref3;
  const {
    onSelect,
    stylesToRender,
    activeStyle,
    genericPreviewBlock,
    className: previewClassName
  } = useStylesForBlocks({
    clientId,
    onSwitch
  });
  const [hoveredStyle, setHoveredStyle] = (0,external_wp_element_namespaceObject.useState)(null);
  const [containerScrollTop, setContainerScrollTop] = (0,external_wp_element_namespaceObject.useState)(0);
  const isMobileViewport = (0,external_wp_compose_namespaceObject.useViewportMatch)('medium', '<');
  (0,external_wp_element_namespaceObject.useLayoutEffect)(() => {
    const scrollContainer = document.querySelector('.interface-interface-skeleton__content');
    const scrollTop = (scrollContainer === null || scrollContainer === void 0 ? void 0 : scrollContainer.scrollTop) || 0;
    setContainerScrollTop(scrollTop + DEFAULT_POSITION_TOP);
  }, [hoveredStyle]);

  if (!stylesToRender || stylesToRender.length === 0) {
    return null;
  }

  const debouncedSetHoveredStyle = (0,external_lodash_namespaceObject.debounce)(setHoveredStyle, 250);

  const onSelectStylePreview = style => {
    onSelect(style);
    onHoverClassName(null);
    setHoveredStyle(null);
    debouncedSetHoveredStyle.cancel();
  };

  const styleItemHandler = item => {
    var _item$name;

    if (hoveredStyle === item) {
      debouncedSetHoveredStyle.cancel();
      return;
    }

    debouncedSetHoveredStyle(item);
    onHoverClassName((_item$name = item === null || item === void 0 ? void 0 : item.name) !== null && _item$name !== void 0 ? _item$name : null);
  };

  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-styles"
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-styles__variants"
  }, stylesToRender.map(style => {
    const buttonText = style.label || style.name;
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
      className: classnames_default()('block-editor-block-styles__item', {
        'is-active': activeStyle.name === style.name
      }),
      key: style.name,
      variant: "secondary",
      label: buttonText,
      onMouseEnter: () => styleItemHandler(style),
      onFocus: () => styleItemHandler(style),
      onMouseLeave: () => styleItemHandler(null),
      onBlur: () => styleItemHandler(null),
      onKeyDown: event => {
        if (external_wp_keycodes_namespaceObject.ENTER === event.keyCode || external_wp_keycodes_namespaceObject.SPACE === event.keyCode) {
          event.preventDefault();
          onSelectStylePreview(style);
        }
      },
      onClick: () => onSelectStylePreview(style),
      role: "button",
      tabIndex: "0"
    }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalTruncate, {
      numberOfLines: 1,
      className: "block-editor-block-styles__item-text"
    }, buttonText));
  })), hoveredStyle && !isMobileViewport && (0,external_wp_element_namespaceObject.createElement)(BlockStylesPreviewPanelFill, {
    scope: scope,
    className: "block-editor-block-styles__preview-panel",
    style: {
      top: containerScrollTop
    },
    onMouseLeave: () => styleItemHandler(null)
  }, (0,external_wp_element_namespaceObject.createElement)(BlockStylesPreviewPanel, {
    activeStyle: activeStyle,
    className: previewClassName,
    genericPreviewBlock: genericPreviewBlock,
    style: hoveredStyle
  })));
}

BlockStyles.Slot = BlockStylesPreviewPanelSlot;
/* harmony default export */ var block_styles = (BlockStyles);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/layout.js


/**
 * WordPress dependencies
 */

const layout = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M18 5.5H6a.5.5 0 00-.5.5v3h13V6a.5.5 0 00-.5-.5zm.5 5H10v8h8a.5.5 0 00.5-.5v-7.5zm-10 0h-3V18a.5.5 0 00.5.5h2.5v-8zM6 4h12a2 2 0 012 2v12a2 2 0 01-2 2H6a2 2 0 01-2-2V6a2 2 0 012-2z"
}));
/* harmony default export */ var library_layout = (layout);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-variation-picker/index.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */





function BlockVariationPicker(_ref) {
  let {
    icon = library_layout,
    label = (0,external_wp_i18n_namespaceObject.__)('Choose variation'),
    instructions = (0,external_wp_i18n_namespaceObject.__)('Select a variation to start with.'),
    variations,
    onSelect,
    allowSkip
  } = _ref;
  const classes = classnames_default()('block-editor-block-variation-picker', {
    'has-many-variations': variations.length > 4
  });
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Placeholder, {
    icon: icon,
    label: label,
    instructions: instructions,
    className: classes
  }, (0,external_wp_element_namespaceObject.createElement)("ul", {
    className: "block-editor-block-variation-picker__variations",
    role: "list",
    "aria-label": (0,external_wp_i18n_namespaceObject.__)('Block variations')
  }, variations.map(variation => (0,external_wp_element_namespaceObject.createElement)("li", {
    key: variation.name
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    variant: "secondary",
    icon: variation.icon,
    iconSize: 48,
    onClick: () => onSelect(variation),
    className: "block-editor-block-variation-picker__variation",
    label: variation.description || variation.title
  }), (0,external_wp_element_namespaceObject.createElement)("span", {
    className: "block-editor-block-variation-picker__variation-label",
    role: "presentation"
  }, variation.title)))), allowSkip && (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-variation-picker__skip"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    variant: "link",
    onClick: () => onSelect()
  }, (0,external_wp_i18n_namespaceObject.__)('Skip'))));
}

/* harmony default export */ var block_variation_picker = (BlockVariationPicker);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/grid.js


/**
 * WordPress dependencies
 */

const grid = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M19 3H5c-1.1 0-2 .9-2 2v14c0 1.1.9 2 2 2h14c1.1 0 2-.9 2-2V5c0-1.1-.9-2-2-2zm-7.8 16.5H5c-.3 0-.5-.2-.5-.5v-6.2h6.8v6.7zm0-8.3H4.5V5c0-.3.2-.5.5-.5h6.2v6.7zm8.3 7.8c0 .3-.2.5-.5.5h-6.2v-6.8h6.8V19zm0-7.8h-6.8V4.5H19c.3 0 .5.2.5.5v6.2z",
  fillRule: "evenodd",
  clipRule: "evenodd"
}));
/* harmony default export */ var library_grid = (grid);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-pattern-setup/constants.js
const VIEWMODES = {
  carousel: 'carousel',
  grid: 'grid'
};

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-pattern-setup/setup-toolbar.js


/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */



const Actions = _ref => {
  let {
    onStartBlank,
    onBlockPatternSelect
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-pattern-setup__actions"
  }, onStartBlank && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    onClick: onStartBlank
  }, (0,external_wp_i18n_namespaceObject.__)('Start blank')), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    variant: "primary",
    onClick: onBlockPatternSelect
  }, (0,external_wp_i18n_namespaceObject.__)('Choose')));
};

const CarouselNavigation = _ref2 => {
  let {
    handlePrevious,
    handleNext,
    activeSlide,
    totalSlides
  } = _ref2;
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-pattern-setup__navigation"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    icon: chevron_left,
    label: (0,external_wp_i18n_namespaceObject.__)('Previous pattern'),
    onClick: handlePrevious,
    disabled: activeSlide === 0
  }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    icon: chevron_right,
    label: (0,external_wp_i18n_namespaceObject.__)('Next pattern'),
    onClick: handleNext,
    disabled: activeSlide === totalSlides - 1
  }));
};

const SetupToolbar = _ref3 => {
  let {
    viewMode,
    setViewMode,
    handlePrevious,
    handleNext,
    activeSlide,
    totalSlides,
    onBlockPatternSelect,
    onStartBlank
  } = _ref3;
  const isCarouselView = viewMode === VIEWMODES.carousel;
  const displayControls = (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-pattern-setup__display-controls"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    icon: stretch_full_width,
    label: (0,external_wp_i18n_namespaceObject.__)('Carousel view'),
    onClick: () => setViewMode(VIEWMODES.carousel),
    isPressed: isCarouselView
  }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    icon: library_grid,
    label: (0,external_wp_i18n_namespaceObject.__)('Grid view'),
    onClick: () => setViewMode(VIEWMODES.grid),
    isPressed: viewMode === VIEWMODES.grid
  }));
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-pattern-setup__toolbar"
  }, isCarouselView && (0,external_wp_element_namespaceObject.createElement)(CarouselNavigation, {
    handlePrevious: handlePrevious,
    handleNext: handleNext,
    activeSlide: activeSlide,
    totalSlides: totalSlides
  }), displayControls, isCarouselView && (0,external_wp_element_namespaceObject.createElement)(Actions, {
    onBlockPatternSelect: onBlockPatternSelect,
    onStartBlank: onStartBlank
  }));
};

/* harmony default export */ var setup_toolbar = (SetupToolbar);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-pattern-setup/use-patterns-setup.js
/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */



function usePatternsSetup(clientId, blockName, filterPatternsFn) {
  return (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getBlockRootClientId,
      __experimentalGetPatternsByBlockTypes,
      __experimentalGetAllowedPatterns
    } = select(store);
    const rootClientId = getBlockRootClientId(clientId);

    if (filterPatternsFn) {
      return __experimentalGetAllowedPatterns(rootClientId).filter(filterPatternsFn);
    }

    return __experimentalGetPatternsByBlockTypes(blockName, rootClientId);
  }, [clientId, blockName, filterPatternsFn]);
}

/* harmony default export */ var use_patterns_setup = (usePatternsSetup);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-pattern-setup/index.js



/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */







const SetupContent = _ref => {
  let {
    viewMode,
    activeSlide,
    patterns,
    onBlockPatternSelect,
    height
  } = _ref;
  const composite = (0,external_wp_components_namespaceObject.__unstableUseCompositeState)();
  const containerClass = 'block-editor-block-pattern-setup__container';

  if (viewMode === VIEWMODES.carousel) {
    const slideClass = new Map([[activeSlide, 'active-slide'], [activeSlide - 1, 'previous-slide'], [activeSlide + 1, 'next-slide']]);
    return (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "block-editor-block-pattern-setup__carousel",
      style: {
        height
      }
    }, (0,external_wp_element_namespaceObject.createElement)("div", {
      className: containerClass
    }, (0,external_wp_element_namespaceObject.createElement)("ul", {
      className: "carousel-container"
    }, patterns.map((pattern, index) => (0,external_wp_element_namespaceObject.createElement)(BlockPatternSlide, {
      className: slideClass.get(index) || '',
      key: pattern.name,
      pattern: pattern,
      minHeight: height
    })))));
  }

  return (0,external_wp_element_namespaceObject.createElement)("div", {
    style: {
      height
    },
    className: "block-editor-block-pattern-setup__grid"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__unstableComposite, _extends({}, composite, {
    role: "listbox",
    className: containerClass,
    "aria-label": (0,external_wp_i18n_namespaceObject.__)('Patterns list')
  }), patterns.map(pattern => (0,external_wp_element_namespaceObject.createElement)(block_pattern_setup_BlockPattern, {
    key: pattern.name,
    pattern: pattern,
    onSelect: onBlockPatternSelect,
    composite: composite
  }))));
};

function block_pattern_setup_BlockPattern(_ref2) {
  let {
    pattern,
    onSelect,
    composite
  } = _ref2;
  const baseClassName = 'block-editor-block-pattern-setup-list';
  const {
    blocks,
    description,
    viewportWidth = 700
  } = pattern;
  const descriptionId = (0,external_wp_compose_namespaceObject.useInstanceId)(block_pattern_setup_BlockPattern, `${baseClassName}__item-description`);
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: `${baseClassName}__list-item`,
    "aria-label": pattern.title,
    "aria-describedby": pattern.description ? descriptionId : undefined
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__unstableCompositeItem, _extends({
    role: "option",
    as: "div"
  }, composite, {
    className: `${baseClassName}__item`,
    onClick: () => onSelect(blocks)
  }), (0,external_wp_element_namespaceObject.createElement)(block_preview, {
    blocks: blocks,
    viewportWidth: viewportWidth
  })), !!description && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.VisuallyHidden, {
    id: descriptionId
  }, description));
}

function BlockPatternSlide(_ref3) {
  let {
    className,
    pattern,
    minHeight
  } = _ref3;
  const {
    blocks,
    title,
    description
  } = pattern;
  const descriptionId = (0,external_wp_compose_namespaceObject.useInstanceId)(BlockPatternSlide, 'block-editor-block-pattern-setup-list__item-description');
  return (0,external_wp_element_namespaceObject.createElement)("li", {
    className: `pattern-slide ${className}`,
    "aria-label": title,
    "aria-describedby": description ? descriptionId : undefined
  }, (0,external_wp_element_namespaceObject.createElement)(block_preview, {
    blocks: blocks,
    __experimentalMinHeight: minHeight
  }), !!description && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.VisuallyHidden, {
    id: descriptionId
  }, description));
}

const BlockPatternSetup = _ref4 => {
  let {
    clientId,
    blockName,
    filterPatternsFn,
    startBlankComponent,
    onBlockPatternSelect
  } = _ref4;
  const [viewMode, setViewMode] = (0,external_wp_element_namespaceObject.useState)(VIEWMODES.carousel);
  const [activeSlide, setActiveSlide] = (0,external_wp_element_namespaceObject.useState)(0);
  const [showBlank, setShowBlank] = (0,external_wp_element_namespaceObject.useState)(false);
  const {
    replaceBlock
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const patterns = use_patterns_setup(clientId, blockName, filterPatternsFn);
  const [contentResizeListener, {
    height: contentHeight
  }] = (0,external_wp_compose_namespaceObject.useResizeObserver)();

  if (!(patterns !== null && patterns !== void 0 && patterns.length) || showBlank) {
    return startBlankComponent;
  }

  const onBlockPatternSelectDefault = blocks => {
    const clonedBlocks = blocks.map(block => (0,external_wp_blocks_namespaceObject.cloneBlock)(block));
    replaceBlock(clientId, clonedBlocks);
  };

  const onPatternSelectCallback = onBlockPatternSelect || onBlockPatternSelectDefault;
  const onStartBlank = startBlankComponent ? () => {
    setShowBlank(true);
  } : undefined;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, contentResizeListener, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: `block-editor-block-pattern-setup view-mode-${viewMode}`
  }, (0,external_wp_element_namespaceObject.createElement)(SetupContent, {
    viewMode: viewMode,
    activeSlide: activeSlide,
    patterns: patterns,
    onBlockPatternSelect: onPatternSelectCallback,
    height: contentHeight - 2 * 60
  }), (0,external_wp_element_namespaceObject.createElement)(setup_toolbar, {
    viewMode: viewMode,
    setViewMode: setViewMode,
    activeSlide: activeSlide,
    totalSlides: patterns.length,
    handleNext: () => {
      setActiveSlide(active => active + 1);
    },
    handlePrevious: () => {
      setActiveSlide(active => active - 1);
    },
    onBlockPatternSelect: () => {
      onPatternSelectCallback(patterns[activeSlide].blocks);
    },
    onStartBlank: onStartBlank
  })));
};

/* harmony default export */ var block_pattern_setup = (BlockPatternSetup);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-variation-transforms/index.js


/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */



function VariationsButtons(_ref) {
  let {
    className,
    onSelectVariation,
    selectedValue,
    variations
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)("fieldset", {
    className: className
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.VisuallyHidden, {
    as: "legend"
  }, (0,external_wp_i18n_namespaceObject.__)('Transform to variation')), variations.map(variation => (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    key: variation.name,
    icon: variation.icon,
    isPressed: selectedValue === variation.name,
    label: selectedValue === variation.name ? variation.title : (0,external_wp_i18n_namespaceObject.sprintf)(
    /* translators: %s: Name of the block variation */
    (0,external_wp_i18n_namespaceObject.__)('Transform to %s'), variation.title),
    onClick: () => onSelectVariation(variation.name),
    "aria-label": variation.title,
    showTooltip: true
  })));
}

function VariationsDropdown(_ref2) {
  let {
    className,
    onSelectVariation,
    selectedValue,
    variations
  } = _ref2;
  const selectOptions = variations.map(_ref3 => {
    let {
      name,
      title,
      description
    } = _ref3;
    return {
      value: name,
      label: title,
      info: description
    };
  });
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.DropdownMenu, {
    className: className,
    label: (0,external_wp_i18n_namespaceObject.__)('Transform to variation'),
    text: (0,external_wp_i18n_namespaceObject.__)('Transform to variation'),
    popoverProps: {
      position: 'bottom center',
      className: `${className}__popover`
    },
    icon: chevron_down,
    toggleProps: {
      iconPosition: 'right'
    }
  }, () => (0,external_wp_element_namespaceObject.createElement)("div", {
    className: `${className}__container`
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuGroup, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItemsChoice, {
    choices: selectOptions,
    value: selectedValue,
    onSelect: onSelectVariation
  }))));
}

function __experimentalBlockVariationTransforms(_ref4) {
  let {
    blockClientId
  } = _ref4;
  const {
    updateBlockAttributes
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const {
    activeBlockVariation,
    variations
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getActiveBlockVariation,
      getBlockVariations
    } = select(external_wp_blocks_namespaceObject.store);
    const {
      getBlockName,
      getBlockAttributes
    } = select(store);
    const name = blockClientId && getBlockName(blockClientId);
    return {
      activeBlockVariation: getActiveBlockVariation(name, getBlockAttributes(blockClientId)),
      variations: name && getBlockVariations(name, 'transform')
    };
  }, [blockClientId]);
  const selectedValue = activeBlockVariation === null || activeBlockVariation === void 0 ? void 0 : activeBlockVariation.name; // Check if each variation has a unique icon.

  const hasUniqueIcons = (0,external_wp_element_namespaceObject.useMemo)(() => {
    const variationIcons = new Set();

    if (!variations) {
      return false;
    }

    variations.forEach(variation => {
      if (variation.icon) {
        variationIcons.add(variation.icon);
      }
    });
    return variationIcons.size === variations.length;
  }, [variations]);

  const onSelectVariation = variationName => {
    updateBlockAttributes(blockClientId, { ...variations.find(_ref5 => {
        let {
          name
        } = _ref5;
        return name === variationName;
      }).attributes
    });
  };

  const baseClass = 'block-editor-block-variation-transforms'; // Skip rendering if there are no variations

  if (!(variations !== null && variations !== void 0 && variations.length)) return null;
  const Component = hasUniqueIcons ? VariationsButtons : VariationsDropdown;
  return (0,external_wp_element_namespaceObject.createElement)(Component, {
    className: baseClass,
    onSelectVariation: onSelectVariation,
    selectedValue: selectedValue,
    variations: variations
  });
}

/* harmony default export */ var block_variation_transforms = (__experimentalBlockVariationTransforms);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/color-palette/with-color-context.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


/* harmony default export */ var with_color_context = ((0,external_wp_compose_namespaceObject.createHigherOrderComponent)(WrappedComponent => {
  return props => {
    const colorsFeature = useSetting('color.palette');
    const disableCustomColorsFeature = !useSetting('color.custom');
    const colors = props.colors === undefined ? colorsFeature : props.colors;
    const disableCustomColors = props.disableCustomColors === undefined ? disableCustomColorsFeature : props.disableCustomColors;
    const hasColorsToChoose = !(0,external_lodash_namespaceObject.isEmpty)(colors) || !disableCustomColors;
    return (0,external_wp_element_namespaceObject.createElement)(WrappedComponent, _extends({}, props, {
      colors,
      disableCustomColors,
      hasColorsToChoose
    }));
  };
}, 'withColorContext'));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/color-palette/index.js
/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */


/* harmony default export */ var color_palette = (with_color_context(external_wp_components_namespaceObject.ColorPalette));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/color-palette/control.js



/**
 * Internal dependencies
 */

function ColorPaletteControl(_ref) {
  let {
    onChange,
    value,
    ...otherProps
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)(control, _extends({}, otherProps, {
    onColorChange: onChange,
    colorValue: value,
    gradients: [],
    disableCustomGradients: true
  }));
}

;// CONCATENATED MODULE: external ["wp","date"]
var external_wp_date_namespaceObject = window["wp"]["date"];
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/date-format-picker/index.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */




 // So that we can illustrate the different formats in the dropdown properly,
// show a date that has a day greater than 12 and a month with more than three
// letters. Here we're using 2022-01-25 which is when WordPress 5.9 was
// released.

const EXAMPLE_DATE = new Date(2022, 0, 25);
/**
 * The `DateFormatPicker` component renders controls that let the user choose a
 * _date format_. That is, how they want their dates to be formatted.
 *
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/date-format-picker/README.md
 *
 * @param {Object}                          props
 * @param {string|null}                     props.format        The selected date
 *                                                              format. If
 *                                                              `null`,
 *                                                              _Default_ is
 *                                                              selected.
 * @param {string}                          props.defaultFormat The date format that
 *                                                              will be used if the
 *                                                              user selects
 *                                                              'Default'.
 * @param {( format: string|null ) => void} props.onChange      Called when a
 *                                                              selection is
 *                                                              made. If `null`,
 *                                                              _Default_ is
 *                                                              selected.
 */

function DateFormatPicker(_ref) {
  let {
    format,
    defaultFormat,
    onChange
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)("fieldset", {
    className: "block-editor-date-format-picker"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.VisuallyHidden, {
    as: "legend"
  }, (0,external_wp_i18n_namespaceObject.__)('Date format')), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToggleControl, {
    label: (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_i18n_namespaceObject.__)('Default format'), (0,external_wp_element_namespaceObject.createElement)("span", {
      className: "block-editor-date-format-picker__default-format-toggle-control__hint"
    }, (0,external_wp_date_namespaceObject.dateI18n)(defaultFormat, EXAMPLE_DATE))),
    checked: !format,
    onChange: checked => onChange(checked ? null : defaultFormat)
  }), format && (0,external_wp_element_namespaceObject.createElement)(NonDefaultControls, {
    format: format,
    onChange: onChange
  }));
}

function NonDefaultControls(_ref2) {
  var _suggestedOptions$fin;

  let {
    format,
    onChange
  } = _ref2;
  // Suggest a short format, medium format, long format, and a standardised
  // (YYYY-MM-DD) format. The short, medium, and long formats are localised as
  // different languages have different ways of writing these. For example, 'F
  // j, Y' (April 20, 2022) in American English (en_US) is 'j. F Y' (20. April
  // 2022) in German (de). The resultant array is de-duplicated as some
  // languages will use the same format string for short, medium, and long
  // formats.
  const suggestedFormats = (0,external_lodash_namespaceObject.uniq)(['Y-m-d', (0,external_wp_i18n_namespaceObject._x)('n/j/Y', 'short date format'), (0,external_wp_i18n_namespaceObject._x)('n/j/Y g:i A', 'short date format with time'), (0,external_wp_i18n_namespaceObject._x)('M j, Y', 'medium date format'), (0,external_wp_i18n_namespaceObject._x)('M j, Y g:i A', 'medium date format with time'), (0,external_wp_i18n_namespaceObject._x)('F j, Y', 'long date format')]);
  const suggestedOptions = suggestedFormats.map((suggestedFormat, index) => ({
    key: `suggested-${index}`,
    name: (0,external_wp_date_namespaceObject.dateI18n)(suggestedFormat, EXAMPLE_DATE),
    format: suggestedFormat
  }));
  const customOption = {
    key: 'custom',
    name: (0,external_wp_i18n_namespaceObject.__)('Custom'),
    className: 'block-editor-date-format-picker__custom-format-select-control__custom-option',
    __experimentalHint: (0,external_wp_i18n_namespaceObject.__)('Enter your own date format')
  };
  const [isCustom, setIsCustom] = (0,external_wp_element_namespaceObject.useState)(() => !!format && !suggestedFormats.includes(format));
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.BaseControl, {
    className: "block-editor-date-format-picker__custom-format-select-control"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.CustomSelectControl, {
    label: (0,external_wp_i18n_namespaceObject.__)('Choose a format'),
    options: [...suggestedOptions, customOption],
    value: isCustom ? customOption : (_suggestedOptions$fin = suggestedOptions.find(option => option.format === format)) !== null && _suggestedOptions$fin !== void 0 ? _suggestedOptions$fin : customOption,
    onChange: _ref3 => {
      let {
        selectedItem
      } = _ref3;

      if (selectedItem === customOption) {
        setIsCustom(true);
      } else {
        setIsCustom(false);
        onChange(selectedItem.format);
      }
    }
  })), isCustom && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.TextControl, {
    label: (0,external_wp_i18n_namespaceObject.__)('Custom format'),
    hideLabelFromVision: true,
    help: (0,external_wp_element_namespaceObject.createInterpolateElement)((0,external_wp_i18n_namespaceObject.__)('Enter a date or time <Link>format string</Link>.'), {
      Link: (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ExternalLink, {
        href: (0,external_wp_i18n_namespaceObject.__)('https://wordpress.org/support/article/formatting-date-and-time/')
      })
    }),
    value: format,
    onChange: value => onChange(value)
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/colors-gradients/panel-color-gradient-settings.js



/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */






 // translators: first %s: The type of color or gradient (e.g. background, overlay...), second %s: the color name or value (e.g. red or #ff0000)

const colorIndicatorAriaLabel = (0,external_wp_i18n_namespaceObject.__)('(%s: color %s)'); // translators: first %s: The type of color or gradient (e.g. background, overlay...), second %s: the color name or value (e.g. red or #ff0000)


const gradientIndicatorAriaLabel = (0,external_wp_i18n_namespaceObject.__)('(%s: gradient %s)');

const panel_color_gradient_settings_colorsAndGradientKeys = ['colors', 'disableCustomColors', 'gradients', 'disableCustomGradients'];

const Indicators = _ref => {
  let {
    colors,
    gradients,
    settings
  } = _ref;
  return settings.map((_ref2, index) => {
    let {
      colorValue,
      gradientValue,
      label,
      colors: availableColors,
      gradients: availableGradients
    } = _ref2;

    if (!colorValue && !gradientValue) {
      return null;
    }

    let ariaLabel;

    if (colorValue) {
      const colorObject = getColorObjectByColorValue(availableColors || colors, colorValue);
      ariaLabel = (0,external_wp_i18n_namespaceObject.sprintf)(colorIndicatorAriaLabel, label.toLowerCase(), colorObject && colorObject.name || colorValue);
    } else {
      const gradientObject = __experimentalGetGradientObjectByGradientValue(availableGradients || gradients, colorValue);

      ariaLabel = (0,external_wp_i18n_namespaceObject.sprintf)(gradientIndicatorAriaLabel, label.toLowerCase(), gradientObject && gradientObject.name || gradientValue);
    }

    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ColorIndicator, {
      key: index,
      colorValue: colorValue || gradientValue,
      "aria-label": ariaLabel
    });
  });
};

const PanelColorGradientSettingsInner = _ref3 => {
  let {
    className,
    colors,
    gradients,
    disableCustomColors,
    disableCustomGradients,
    children,
    settings,
    title,
    showTitle = true,
    __experimentalHasMultipleOrigins,
    __experimentalIsRenderedInSidebar,
    enableAlpha,
    ...props
  } = _ref3;

  if ((0,external_lodash_namespaceObject.isEmpty)(colors) && (0,external_lodash_namespaceObject.isEmpty)(gradients) && disableCustomColors && disableCustomGradients && (0,external_lodash_namespaceObject.every)(settings, setting => (0,external_lodash_namespaceObject.isEmpty)(setting.colors) && (0,external_lodash_namespaceObject.isEmpty)(setting.gradients) && (setting.disableCustomColors === undefined || setting.disableCustomColors) && (setting.disableCustomGradients === undefined || setting.disableCustomGradients))) {
    return null;
  }

  const titleElement = (0,external_wp_element_namespaceObject.createElement)("span", {
    className: "block-editor-panel-color-gradient-settings__panel-title"
  }, title, (0,external_wp_element_namespaceObject.createElement)(Indicators, {
    colors: colors,
    gradients: gradients,
    settings: settings
  }));
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.PanelBody, _extends({
    className: classnames_default()('block-editor-panel-color-gradient-settings', className),
    title: showTitle ? titleElement : undefined
  }, props), (0,external_wp_element_namespaceObject.createElement)(ColorGradientSettingsDropdown, {
    settings: settings,
    colors,
    gradients,
    disableCustomColors,
    disableCustomGradients,
    __experimentalHasMultipleOrigins,
    __experimentalIsRenderedInSidebar,
    enableAlpha
  }), !!children && (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalSpacer, {
    marginY: 4
  }), " ", children));
};

const PanelColorGradientSettingsSingleSelect = props => {
  const colorGradientSettings = useCommonSingleMultipleSelects();
  colorGradientSettings.colors = useSetting('color.palette');
  colorGradientSettings.gradients = useSetting('color.gradients');
  return (0,external_wp_element_namespaceObject.createElement)(PanelColorGradientSettingsInner, _extends({}, colorGradientSettings, props));
};

const PanelColorGradientSettingsMultipleSelect = props => {
  const colorGradientSettings = useMultipleOriginColorsAndGradients();
  return (0,external_wp_element_namespaceObject.createElement)(PanelColorGradientSettingsInner, _extends({}, colorGradientSettings, props));
};

const PanelColorGradientSettings = props => {
  if ((0,external_lodash_namespaceObject.every)(panel_color_gradient_settings_colorsAndGradientKeys, key => props.hasOwnProperty(key))) {
    return (0,external_wp_element_namespaceObject.createElement)(PanelColorGradientSettingsInner, props);
  }

  if (props.__experimentalHasMultipleOrigins) {
    return (0,external_wp_element_namespaceObject.createElement)(PanelColorGradientSettingsMultipleSelect, props);
  }

  return (0,external_wp_element_namespaceObject.createElement)(PanelColorGradientSettingsSingleSelect, props);
};

/* harmony default export */ var panel_color_gradient_settings = (PanelColorGradientSettings);

;// CONCATENATED MODULE: ./node_modules/react-easy-crop/node_modules/tslib/tslib.es6.js
/*! *****************************************************************************
Copyright (c) Microsoft Corporation.

Permission to use, copy, modify, and/or distribute this software for any
purpose with or without fee is hereby granted.

THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
PERFORMANCE OF THIS SOFTWARE.
***************************************************************************** */
/* global Reflect, Promise */

var extendStatics = function(d, b) {
    extendStatics = Object.setPrototypeOf ||
        ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||
        function (d, b) { for (var p in b) if (Object.prototype.hasOwnProperty.call(b, p)) d[p] = b[p]; };
    return extendStatics(d, b);
};

function __extends(d, b) {
    extendStatics(d, b);
    function __() { this.constructor = d; }
    d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());
}

var __assign = function() {
    __assign = Object.assign || function __assign(t) {
        for (var s, i = 1, n = arguments.length; i < n; i++) {
            s = arguments[i];
            for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];
        }
        return t;
    }
    return __assign.apply(this, arguments);
}

function __rest(s, e) {
    var t = {};
    for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)
        t[p] = s[p];
    if (s != null && typeof Object.getOwnPropertySymbols === "function")
        for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {
            if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))
                t[p[i]] = s[p[i]];
        }
    return t;
}

function __decorate(decorators, target, key, desc) {
    var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;
    if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r = Reflect.decorate(decorators, target, key, desc);
    else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;
    return c > 3 && r && Object.defineProperty(target, key, r), r;
}

function __param(paramIndex, decorator) {
    return function (target, key) { decorator(target, key, paramIndex); }
}

function __metadata(metadataKey, metadataValue) {
    if (typeof Reflect === "object" && typeof Reflect.metadata === "function") return Reflect.metadata(metadataKey, metadataValue);
}

function __awaiter(thisArg, _arguments, P, generator) {
    function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }
    return new (P || (P = Promise))(function (resolve, reject) {
        function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }
        function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } }
        function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }
        step((generator = generator.apply(thisArg, _arguments || [])).next());
    });
}

function __generator(thisArg, body) {
    var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;
    return g = { next: verb(0), "throw": verb(1), "return": verb(2) }, typeof Symbol === "function" && (g[Symbol.iterator] = function() { return this; }), g;
    function verb(n) { return function (v) { return step([n, v]); }; }
    function step(op) {
        if (f) throw new TypeError("Generator is already executing.");
        while (_) try {
            if (f = 1, y && (t = op[0] & 2 ? y["return"] : op[0] ? y["throw"] || ((t = y["return"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;
            if (y = 0, t) op = [op[0] & 2, t.value];
            switch (op[0]) {
                case 0: case 1: t = op; break;
                case 4: _.label++; return { value: op[1], done: false };
                case 5: _.label++; y = op[1]; op = [0]; continue;
                case 7: op = _.ops.pop(); _.trys.pop(); continue;
                default:
                    if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }
                    if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }
                    if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }
                    if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }
                    if (t[2]) _.ops.pop();
                    _.trys.pop(); continue;
            }
            op = body.call(thisArg, _);
        } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }
        if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };
    }
}

var __createBinding = Object.create ? (function(o, m, k, k2) {
    if (k2 === undefined) k2 = k;
    Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } });
}) : (function(o, m, k, k2) {
    if (k2 === undefined) k2 = k;
    o[k2] = m[k];
});

function __exportStar(m, o) {
    for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(o, p)) __createBinding(o, m, p);
}

function __values(o) {
    var s = typeof Symbol === "function" && Symbol.iterator, m = s && o[s], i = 0;
    if (m) return m.call(o);
    if (o && typeof o.length === "number") return {
        next: function () {
            if (o && i >= o.length) o = void 0;
            return { value: o && o[i++], done: !o };
        }
    };
    throw new TypeError(s ? "Object is not iterable." : "Symbol.iterator is not defined.");
}

function __read(o, n) {
    var m = typeof Symbol === "function" && o[Symbol.iterator];
    if (!m) return o;
    var i = m.call(o), r, ar = [], e;
    try {
        while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);
    }
    catch (error) { e = { error: error }; }
    finally {
        try {
            if (r && !r.done && (m = i["return"])) m.call(i);
        }
        finally { if (e) throw e.error; }
    }
    return ar;
}

function __spread() {
    for (var ar = [], i = 0; i < arguments.length; i++)
        ar = ar.concat(__read(arguments[i]));
    return ar;
}

function __spreadArrays() {
    for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;
    for (var r = Array(s), k = 0, i = 0; i < il; i++)
        for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)
            r[k] = a[j];
    return r;
};

function __await(v) {
    return this instanceof __await ? (this.v = v, this) : new __await(v);
}

function __asyncGenerator(thisArg, _arguments, generator) {
    if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined.");
    var g = generator.apply(thisArg, _arguments || []), i, q = [];
    return i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i;
    function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }
    function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }
    function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }
    function fulfill(value) { resume("next", value); }
    function reject(value) { resume("throw", value); }
    function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }
}

function __asyncDelegator(o) {
    var i, p;
    return i = {}, verb("next"), verb("throw", function (e) { throw e; }), verb("return"), i[Symbol.iterator] = function () { return this; }, i;
    function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === "return" } : f ? f(v) : v; } : f; }
}

function __asyncValues(o) {
    if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined.");
    var m = o[Symbol.asyncIterator], i;
    return m ? m.call(o) : (o = typeof __values === "function" ? __values(o) : o[Symbol.iterator](), i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i);
    function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }
    function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }
}

function __makeTemplateObject(cooked, raw) {
    if (Object.defineProperty) { Object.defineProperty(cooked, "raw", { value: raw }); } else { cooked.raw = raw; }
    return cooked;
};

var __setModuleDefault = Object.create ? (function(o, v) {
    Object.defineProperty(o, "default", { enumerable: true, value: v });
}) : function(o, v) {
    o["default"] = v;
};

function __importStar(mod) {
    if (mod && mod.__esModule) return mod;
    var result = {};
    if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);
    __setModuleDefault(result, mod);
    return result;
}

function __importDefault(mod) {
    return (mod && mod.__esModule) ? mod : { default: mod };
}

function __classPrivateFieldGet(receiver, privateMap) {
    if (!privateMap.has(receiver)) {
        throw new TypeError("attempted to get private field on non-instance");
    }
    return privateMap.get(receiver);
}

function __classPrivateFieldSet(receiver, privateMap, value) {
    if (!privateMap.has(receiver)) {
        throw new TypeError("attempted to set private field on non-instance");
    }
    privateMap.set(receiver, value);
    return value;
}

// EXTERNAL MODULE: ./node_modules/normalize-wheel/index.js
var normalize_wheel = __webpack_require__(7970);
var normalize_wheel_default = /*#__PURE__*/__webpack_require__.n(normalize_wheel);
;// CONCATENATED MODULE: ./node_modules/react-easy-crop/index.module.js




/**
 * Compute the dimension of the crop area based on media size,
 * aspect ratio and optionally rotation
 */

function getCropSize(mediaWidth, mediaHeight, containerWidth, containerHeight, aspect, rotation) {
  if (rotation === void 0) {
    rotation = 0;
  }

  var _a = translateSize(mediaWidth, mediaHeight, rotation),
      width = _a.width,
      height = _a.height;

  var fittingWidth = Math.min(width, containerWidth);
  var fittingHeight = Math.min(height, containerHeight);

  if (fittingWidth > fittingHeight * aspect) {
    return {
      width: fittingHeight * aspect,
      height: fittingHeight
    };
  }

  return {
    width: fittingWidth,
    height: fittingWidth / aspect
  };
}
/**
 * Ensure a new media position stays in the crop area.
 */

function restrictPosition(position, mediaSize, cropSize, zoom, rotation) {
  if (rotation === void 0) {
    rotation = 0;
  }

  var _a = translateSize(mediaSize.width, mediaSize.height, rotation),
      width = _a.width,
      height = _a.height;

  return {
    x: restrictPositionCoord(position.x, width, cropSize.width, zoom),
    y: restrictPositionCoord(position.y, height, cropSize.height, zoom)
  };
}

function restrictPositionCoord(position, mediaSize, cropSize, zoom) {
  var maxPosition = mediaSize * zoom / 2 - cropSize / 2;
  return Math.min(maxPosition, Math.max(position, -maxPosition));
}

function getDistanceBetweenPoints(pointA, pointB) {
  return Math.sqrt(Math.pow(pointA.y - pointB.y, 2) + Math.pow(pointA.x - pointB.x, 2));
}
function getRotationBetweenPoints(pointA, pointB) {
  return Math.atan2(pointB.y - pointA.y, pointB.x - pointA.x) * 180 / Math.PI;
}
/**
 * Compute the output cropped area of the media in percentages and pixels.
 * x/y are the top-left coordinates on the src media
 */

function computeCroppedArea(crop, mediaSize, cropSize, aspect, zoom, rotation, restrictPosition) {
  if (rotation === void 0) {
    rotation = 0;
  }

  if (restrictPosition === void 0) {
    restrictPosition = true;
  } // if the media is rotated by the user, we cannot limit the position anymore
  // as it might need to be negative.


  var limitAreaFn = restrictPosition && rotation === 0 ? limitArea : noOp;
  var croppedAreaPercentages = {
    x: limitAreaFn(100, ((mediaSize.width - cropSize.width / zoom) / 2 - crop.x / zoom) / mediaSize.width * 100),
    y: limitAreaFn(100, ((mediaSize.height - cropSize.height / zoom) / 2 - crop.y / zoom) / mediaSize.height * 100),
    width: limitAreaFn(100, cropSize.width / mediaSize.width * 100 / zoom),
    height: limitAreaFn(100, cropSize.height / mediaSize.height * 100 / zoom)
  }; // we compute the pixels size naively

  var widthInPixels = Math.round(limitAreaFn(mediaSize.naturalWidth, croppedAreaPercentages.width * mediaSize.naturalWidth / 100));
  var heightInPixels = Math.round(limitAreaFn(mediaSize.naturalHeight, croppedAreaPercentages.height * mediaSize.naturalHeight / 100));
  var isImgWiderThanHigh = mediaSize.naturalWidth >= mediaSize.naturalHeight * aspect; // then we ensure the width and height exactly match the aspect (to avoid rounding approximations)
  // if the media is wider than high, when zoom is 0, the crop height will be equals to iamge height
  // thus we want to compute the width from the height and aspect for accuracy.
  // Otherwise, we compute the height from width and aspect.

  var sizePixels = isImgWiderThanHigh ? {
    width: Math.round(heightInPixels * aspect),
    height: heightInPixels
  } : {
    width: widthInPixels,
    height: Math.round(widthInPixels / aspect)
  };

  var croppedAreaPixels = __assign(__assign({}, sizePixels), {
    x: Math.round(limitAreaFn(mediaSize.naturalWidth - sizePixels.width, croppedAreaPercentages.x * mediaSize.naturalWidth / 100)),
    y: Math.round(limitAreaFn(mediaSize.naturalHeight - sizePixels.height, croppedAreaPercentages.y * mediaSize.naturalHeight / 100))
  });

  return {
    croppedAreaPercentages: croppedAreaPercentages,
    croppedAreaPixels: croppedAreaPixels
  };
}
/**
 * Ensure the returned value is between 0 and max
 */

function limitArea(max, value) {
  return Math.min(max, Math.max(0, value));
}

function noOp(_max, value) {
  return value;
}
/**
 * Compute the crop and zoom from the croppedAreaPixels
 */


function getZoomFromCroppedAreaPixels(croppedAreaPixels, mediaSize, cropSize) {
  var mediaZoom = mediaSize.width / mediaSize.naturalWidth;

  if (cropSize) {
    var isHeightMaxSize_1 = cropSize.height > cropSize.width;
    return isHeightMaxSize_1 ? cropSize.height / mediaZoom / croppedAreaPixels.height : cropSize.width / mediaZoom / croppedAreaPixels.width;
  }

  var aspect = croppedAreaPixels.width / croppedAreaPixels.height;
  var isHeightMaxSize = mediaSize.naturalWidth >= mediaSize.naturalHeight * aspect;
  return isHeightMaxSize ? mediaSize.naturalHeight / croppedAreaPixels.height : mediaSize.naturalWidth / croppedAreaPixels.width;
}
/**
 * Compute the crop and zoom from the croppedAreaPixels
 */


function getInitialCropFromCroppedAreaPixels(croppedAreaPixels, mediaSize, cropSize) {
  var mediaZoom = mediaSize.width / mediaSize.naturalWidth;
  var zoom = getZoomFromCroppedAreaPixels(croppedAreaPixels, mediaSize, cropSize);
  var cropZoom = mediaZoom * zoom;
  var crop = {
    x: ((mediaSize.naturalWidth - croppedAreaPixels.width) / 2 - croppedAreaPixels.x) * cropZoom,
    y: ((mediaSize.naturalHeight - croppedAreaPixels.height) / 2 - croppedAreaPixels.y) * cropZoom
  };
  return {
    crop: crop,
    zoom: zoom
  };
}
/**
 * Return the point that is the center of point a and b
 */

function getCenter(a, b) {
  return {
    x: (b.x + a.x) / 2,
    y: (b.y + a.y) / 2
  };
}
/**
 *
 * Returns an x,y point once rotated around xMid,yMid
 */

function rotateAroundMidPoint(x, y, xMid, yMid, degrees) {
  var cos = Math.cos;
  var sin = Math.sin;
  var radian = degrees * Math.PI / 180; // Convert to radians
  // Subtract midpoints, so that midpoint is translated to origin
  // and add it in the end again

  var xr = (x - xMid) * cos(radian) - (y - yMid) * sin(radian) + xMid;
  var yr = (x - xMid) * sin(radian) + (y - yMid) * cos(radian) + yMid;
  return [xr, yr];
}
/**
 * Returns the new bounding area of a rotated rectangle.
 */

function translateSize(width, height, rotation) {
  var centerX = width / 2;
  var centerY = height / 2;
  var outerBounds = [rotateAroundMidPoint(0, 0, centerX, centerY, rotation), rotateAroundMidPoint(width, 0, centerX, centerY, rotation), rotateAroundMidPoint(width, height, centerX, centerY, rotation), rotateAroundMidPoint(0, height, centerX, centerY, rotation)];
  var minX = Math.min.apply(Math, outerBounds.map(function (p) {
    return p[0];
  }));
  var maxX = Math.max.apply(Math, outerBounds.map(function (p) {
    return p[0];
  }));
  var minY = Math.min.apply(Math, outerBounds.map(function (p) {
    return p[1];
  }));
  var maxY = Math.max.apply(Math, outerBounds.map(function (p) {
    return p[1];
  }));
  return {
    width: maxX - minX,
    height: maxY - minY
  };
}
/**
 * Combine multiple class names into a single string.
 */

function classNames() {
  var args = [];

  for (var _i = 0; _i < arguments.length; _i++) {
    args[_i] = arguments[_i];
  }

  return args.filter(function (value) {
    if (typeof value === 'string' && value.length > 0) {
      return true;
    }

    return false;
  }).join(' ').trim();
}

var css_248z = ".reactEasyCrop_Container {\n  position: absolute;\n  top: 0;\n  left: 0;\n  right: 0;\n  bottom: 0;\n  overflow: hidden;\n  user-select: none;\n  touch-action: none;\n  cursor: move;\n  display: flex;\n  justify-content: center;\n  align-items: center;\n}\n\n.reactEasyCrop_Image,\n.reactEasyCrop_Video {\n  will-change: transform; /* this improves performances and prevent painting issues on iOS Chrome */\n}\n\n.reactEasyCrop_Contain {\n  max-width: 100%;\n  max-height: 100%;\n  margin: auto;\n  position: absolute;\n  top: 0;\n  bottom: 0;\n  left: 0;\n  right: 0;\n}\n.reactEasyCrop_Cover_Horizontal {\n  width: 100%;\n  height: auto;\n}\n.reactEasyCrop_Cover_Vertical {\n  width: auto;\n  height: 100%;\n}\n\n.reactEasyCrop_CropArea {\n  position: absolute;\n  left: 50%;\n  top: 50%;\n  transform: translate(-50%, -50%);\n  border: 1px solid rgba(255, 255, 255, 0.5);\n  box-sizing: border-box;\n  box-shadow: 0 0 0 9999em;\n  color: rgba(0, 0, 0, 0.5);\n  overflow: hidden;\n}\n\n.reactEasyCrop_CropAreaRound {\n  border-radius: 50%;\n}\n\n.reactEasyCrop_CropAreaGrid::before {\n  content: ' ';\n  box-sizing: border-box;\n  position: absolute;\n  border: 1px solid rgba(255, 255, 255, 0.5);\n  top: 0;\n  bottom: 0;\n  left: 33.33%;\n  right: 33.33%;\n  border-top: 0;\n  border-bottom: 0;\n}\n\n.reactEasyCrop_CropAreaGrid::after {\n  content: ' ';\n  box-sizing: border-box;\n  position: absolute;\n  border: 1px solid rgba(255, 255, 255, 0.5);\n  top: 33.33%;\n  bottom: 33.33%;\n  left: 0;\n  right: 0;\n  border-left: 0;\n  border-right: 0;\n}\n";

var MIN_ZOOM = 1;
var MAX_ZOOM = 3;

var Cropper =
/** @class */
function (_super) {
  __extends(Cropper, _super);

  function Cropper() {
    var _this = _super !== null && _super.apply(this, arguments) || this;

    _this.imageRef = null;
    _this.videoRef = null;
    _this.containerRef = null;
    _this.styleRef = null;
    _this.containerRect = null;
    _this.mediaSize = {
      width: 0,
      height: 0,
      naturalWidth: 0,
      naturalHeight: 0
    };
    _this.dragStartPosition = {
      x: 0,
      y: 0
    };
    _this.dragStartCrop = {
      x: 0,
      y: 0
    };
    _this.lastPinchDistance = 0;
    _this.lastPinchRotation = 0;
    _this.rafDragTimeout = null;
    _this.rafPinchTimeout = null;
    _this.wheelTimer = null;
    _this.state = {
      cropSize: null,
      hasWheelJustStarted: false
    }; // this is to prevent Safari on iOS >= 10 to zoom the page

    _this.preventZoomSafari = function (e) {
      return e.preventDefault();
    };

    _this.cleanEvents = function () {
      document.removeEventListener('mousemove', _this.onMouseMove);
      document.removeEventListener('mouseup', _this.onDragStopped);
      document.removeEventListener('touchmove', _this.onTouchMove);
      document.removeEventListener('touchend', _this.onDragStopped);
    };

    _this.clearScrollEvent = function () {
      if (_this.containerRef) _this.containerRef.removeEventListener('wheel', _this.onWheel);

      if (_this.wheelTimer) {
        clearTimeout(_this.wheelTimer);
      }
    };

    _this.onMediaLoad = function () {
      _this.computeSizes();

      _this.emitCropData();

      _this.setInitialCrop();

      if (_this.props.onMediaLoaded) {
        _this.props.onMediaLoaded(_this.mediaSize);
      }
    };

    _this.setInitialCrop = function () {
      var _a = _this.props,
          initialCroppedAreaPixels = _a.initialCroppedAreaPixels,
          cropSize = _a.cropSize;

      if (!initialCroppedAreaPixels) {
        return;
      }

      var _b = getInitialCropFromCroppedAreaPixels(initialCroppedAreaPixels, _this.mediaSize, cropSize),
          crop = _b.crop,
          zoom = _b.zoom;

      _this.props.onCropChange(crop);

      _this.props.onZoomChange && _this.props.onZoomChange(zoom);
    };

    _this.computeSizes = function () {
      var _a, _b, _c, _d, _e, _f;

      var mediaRef = _this.imageRef || _this.videoRef;

      if (mediaRef && _this.containerRef) {
        _this.containerRect = _this.containerRef.getBoundingClientRect();
        _this.mediaSize = {
          width: mediaRef.offsetWidth,
          height: mediaRef.offsetHeight,
          naturalWidth: ((_a = _this.imageRef) === null || _a === void 0 ? void 0 : _a.naturalWidth) || ((_b = _this.videoRef) === null || _b === void 0 ? void 0 : _b.videoWidth) || 0,
          naturalHeight: ((_c = _this.imageRef) === null || _c === void 0 ? void 0 : _c.naturalHeight) || ((_d = _this.videoRef) === null || _d === void 0 ? void 0 : _d.videoHeight) || 0
        };
        var cropSize = _this.props.cropSize ? _this.props.cropSize : getCropSize(mediaRef.offsetWidth, mediaRef.offsetHeight, _this.containerRect.width, _this.containerRect.height, _this.props.aspect, _this.props.rotation);

        if (((_e = _this.state.cropSize) === null || _e === void 0 ? void 0 : _e.height) !== cropSize.height || ((_f = _this.state.cropSize) === null || _f === void 0 ? void 0 : _f.width) !== cropSize.width) {
          _this.props.onCropSizeChange && _this.props.onCropSizeChange(cropSize);
        }

        _this.setState({
          cropSize: cropSize
        }, _this.recomputeCropPosition);
      }
    };

    _this.onMouseDown = function (e) {
      e.preventDefault();
      document.addEventListener('mousemove', _this.onMouseMove);
      document.addEventListener('mouseup', _this.onDragStopped);

      _this.onDragStart(Cropper.getMousePoint(e));
    };

    _this.onMouseMove = function (e) {
      return _this.onDrag(Cropper.getMousePoint(e));
    };

    _this.onTouchStart = function (e) {
      document.addEventListener('touchmove', _this.onTouchMove, {
        passive: false
      }); // iOS 11 now defaults to passive: true

      document.addEventListener('touchend', _this.onDragStopped);

      if (e.touches.length === 2) {
        _this.onPinchStart(e);
      } else if (e.touches.length === 1) {
        _this.onDragStart(Cropper.getTouchPoint(e.touches[0]));
      }
    };

    _this.onTouchMove = function (e) {
      // Prevent whole page from scrolling on iOS.
      e.preventDefault();

      if (e.touches.length === 2) {
        _this.onPinchMove(e);
      } else if (e.touches.length === 1) {
        _this.onDrag(Cropper.getTouchPoint(e.touches[0]));
      }
    };

    _this.onDragStart = function (_a) {
      var _b, _c;

      var x = _a.x,
          y = _a.y;
      _this.dragStartPosition = {
        x: x,
        y: y
      };
      _this.dragStartCrop = __assign({}, _this.props.crop);
      (_c = (_b = _this.props).onInteractionStart) === null || _c === void 0 ? void 0 : _c.call(_b);
    };

    _this.onDrag = function (_a) {
      var x = _a.x,
          y = _a.y;
      if (_this.rafDragTimeout) window.cancelAnimationFrame(_this.rafDragTimeout);
      _this.rafDragTimeout = window.requestAnimationFrame(function () {
        if (!_this.state.cropSize) return;
        if (x === undefined || y === undefined) return;
        var offsetX = x - _this.dragStartPosition.x;
        var offsetY = y - _this.dragStartPosition.y;
        var requestedPosition = {
          x: _this.dragStartCrop.x + offsetX,
          y: _this.dragStartCrop.y + offsetY
        };
        var newPosition = _this.props.restrictPosition ? restrictPosition(requestedPosition, _this.mediaSize, _this.state.cropSize, _this.props.zoom, _this.props.rotation) : requestedPosition;

        _this.props.onCropChange(newPosition);
      });
    };

    _this.onDragStopped = function () {
      var _a, _b;

      _this.cleanEvents();

      _this.emitCropData();

      (_b = (_a = _this.props).onInteractionEnd) === null || _b === void 0 ? void 0 : _b.call(_a);
    };

    _this.onWheel = function (e) {
      e.preventDefault();
      var point = Cropper.getMousePoint(e);
      var pixelY = normalize_wheel_default()(e).pixelY;
      var newZoom = _this.props.zoom - pixelY * _this.props.zoomSpeed / 200;

      _this.setNewZoom(newZoom, point);

      if (!_this.state.hasWheelJustStarted) {
        _this.setState({
          hasWheelJustStarted: true
        }, function () {
          var _a, _b;

          return (_b = (_a = _this.props).onInteractionStart) === null || _b === void 0 ? void 0 : _b.call(_a);
        });
      }

      if (_this.wheelTimer) {
        clearTimeout(_this.wheelTimer);
      }

      _this.wheelTimer = window.setTimeout(function () {
        return _this.setState({
          hasWheelJustStarted: false
        }, function () {
          var _a, _b;

          return (_b = (_a = _this.props).onInteractionEnd) === null || _b === void 0 ? void 0 : _b.call(_a);
        });
      }, 250);
    };

    _this.getPointOnContainer = function (_a) {
      var x = _a.x,
          y = _a.y;

      if (!_this.containerRect) {
        throw new Error('The Cropper is not mounted');
      }

      return {
        x: _this.containerRect.width / 2 - (x - _this.containerRect.left),
        y: _this.containerRect.height / 2 - (y - _this.containerRect.top)
      };
    };

    _this.getPointOnMedia = function (_a) {
      var x = _a.x,
          y = _a.y;
      var _b = _this.props,
          crop = _b.crop,
          zoom = _b.zoom;
      return {
        x: (x + crop.x) / zoom,
        y: (y + crop.y) / zoom
      };
    };

    _this.setNewZoom = function (zoom, point) {
      if (!_this.state.cropSize || !_this.props.onZoomChange) return;

      var zoomPoint = _this.getPointOnContainer(point);

      var zoomTarget = _this.getPointOnMedia(zoomPoint);

      var newZoom = Math.min(_this.props.maxZoom, Math.max(zoom, _this.props.minZoom));
      var requestedPosition = {
        x: zoomTarget.x * newZoom - zoomPoint.x,
        y: zoomTarget.y * newZoom - zoomPoint.y
      };
      var newPosition = _this.props.restrictPosition ? restrictPosition(requestedPosition, _this.mediaSize, _this.state.cropSize, newZoom, _this.props.rotation) : requestedPosition;

      _this.props.onCropChange(newPosition);

      _this.props.onZoomChange(newZoom);
    };

    _this.getCropData = function () {
      if (!_this.state.cropSize) {
        return null;
      } // this is to ensure the crop is correctly restricted after a zoom back (https://github.com/ricardo-ch/react-easy-crop/issues/6)


      var restrictedPosition = _this.props.restrictPosition ? restrictPosition(_this.props.crop, _this.mediaSize, _this.state.cropSize, _this.props.zoom, _this.props.rotation) : _this.props.crop;
      return computeCroppedArea(restrictedPosition, _this.mediaSize, _this.state.cropSize, _this.getAspect(), _this.props.zoom, _this.props.rotation, _this.props.restrictPosition);
    };

    _this.emitCropData = function () {
      var cropData = _this.getCropData();

      if (!cropData) return;
      var croppedAreaPercentages = cropData.croppedAreaPercentages,
          croppedAreaPixels = cropData.croppedAreaPixels;

      if (_this.props.onCropComplete) {
        _this.props.onCropComplete(croppedAreaPercentages, croppedAreaPixels);
      }

      if (_this.props.onCropAreaChange) {
        _this.props.onCropAreaChange(croppedAreaPercentages, croppedAreaPixels);
      }
    };

    _this.emitCropAreaChange = function () {
      var cropData = _this.getCropData();

      if (!cropData) return;
      var croppedAreaPercentages = cropData.croppedAreaPercentages,
          croppedAreaPixels = cropData.croppedAreaPixels;

      if (_this.props.onCropAreaChange) {
        _this.props.onCropAreaChange(croppedAreaPercentages, croppedAreaPixels);
      }
    };

    _this.recomputeCropPosition = function () {
      if (!_this.state.cropSize) return;
      var newPosition = _this.props.restrictPosition ? restrictPosition(_this.props.crop, _this.mediaSize, _this.state.cropSize, _this.props.zoom, _this.props.rotation) : _this.props.crop;

      _this.props.onCropChange(newPosition);

      _this.emitCropData();
    };

    return _this;
  }

  Cropper.prototype.componentDidMount = function () {
    window.addEventListener('resize', this.computeSizes);

    if (this.containerRef) {
      this.props.zoomWithScroll && this.containerRef.addEventListener('wheel', this.onWheel, {
        passive: false
      });
      this.containerRef.addEventListener('gesturestart', this.preventZoomSafari);
      this.containerRef.addEventListener('gesturechange', this.preventZoomSafari);
    }

    if (!this.props.disableAutomaticStylesInjection) {
      this.styleRef = document.createElement('style');
      this.styleRef.setAttribute('type', 'text/css');
      this.styleRef.innerHTML = css_248z;
      document.head.appendChild(this.styleRef);
    } // when rendered via SSR, the image can already be loaded and its onLoad callback will never be called


    if (this.imageRef && this.imageRef.complete) {
      this.onMediaLoad();
    }
  };

  Cropper.prototype.componentWillUnmount = function () {
    var _a;

    window.removeEventListener('resize', this.computeSizes);

    if (this.containerRef) {
      this.containerRef.removeEventListener('gesturestart', this.preventZoomSafari);
      this.containerRef.removeEventListener('gesturechange', this.preventZoomSafari);
    }

    if (this.styleRef) {
      (_a = this.styleRef.parentNode) === null || _a === void 0 ? void 0 : _a.removeChild(this.styleRef);
    }

    this.cleanEvents();
    this.props.zoomWithScroll && this.clearScrollEvent();
  };

  Cropper.prototype.componentDidUpdate = function (prevProps) {
    var _a, _b, _c, _d, _e, _f, _g, _h, _j;

    if (prevProps.rotation !== this.props.rotation) {
      this.computeSizes();
      this.recomputeCropPosition();
    } else if (prevProps.aspect !== this.props.aspect) {
      this.computeSizes();
    } else if (prevProps.zoom !== this.props.zoom) {
      this.recomputeCropPosition();
    } else if (((_a = prevProps.cropSize) === null || _a === void 0 ? void 0 : _a.height) !== ((_b = this.props.cropSize) === null || _b === void 0 ? void 0 : _b.height) || ((_c = prevProps.cropSize) === null || _c === void 0 ? void 0 : _c.width) !== ((_d = this.props.cropSize) === null || _d === void 0 ? void 0 : _d.width)) {
      this.computeSizes();
    } else if (((_e = prevProps.crop) === null || _e === void 0 ? void 0 : _e.x) !== ((_f = this.props.crop) === null || _f === void 0 ? void 0 : _f.x) || ((_g = prevProps.crop) === null || _g === void 0 ? void 0 : _g.y) !== ((_h = this.props.crop) === null || _h === void 0 ? void 0 : _h.y)) {
      this.emitCropAreaChange();
    }

    if (prevProps.zoomWithScroll !== this.props.zoomWithScroll && this.containerRef) {
      this.props.zoomWithScroll ? this.containerRef.addEventListener('wheel', this.onWheel, {
        passive: false
      }) : this.clearScrollEvent();
    }

    if (prevProps.video !== this.props.video) {
      (_j = this.videoRef) === null || _j === void 0 ? void 0 : _j.load();
    }
  };

  Cropper.prototype.getAspect = function () {
    var _a = this.props,
        cropSize = _a.cropSize,
        aspect = _a.aspect;

    if (cropSize) {
      return cropSize.width / cropSize.height;
    }

    return aspect;
  };

  Cropper.prototype.onPinchStart = function (e) {
    var pointA = Cropper.getTouchPoint(e.touches[0]);
    var pointB = Cropper.getTouchPoint(e.touches[1]);
    this.lastPinchDistance = getDistanceBetweenPoints(pointA, pointB);
    this.lastPinchRotation = getRotationBetweenPoints(pointA, pointB);
    this.onDragStart(getCenter(pointA, pointB));
  };

  Cropper.prototype.onPinchMove = function (e) {
    var _this = this;

    var pointA = Cropper.getTouchPoint(e.touches[0]);
    var pointB = Cropper.getTouchPoint(e.touches[1]);
    var center = getCenter(pointA, pointB);
    this.onDrag(center);
    if (this.rafPinchTimeout) window.cancelAnimationFrame(this.rafPinchTimeout);
    this.rafPinchTimeout = window.requestAnimationFrame(function () {
      var distance = getDistanceBetweenPoints(pointA, pointB);
      var newZoom = _this.props.zoom * (distance / _this.lastPinchDistance);

      _this.setNewZoom(newZoom, center);

      _this.lastPinchDistance = distance;
      var rotation = getRotationBetweenPoints(pointA, pointB);
      var newRotation = _this.props.rotation + (rotation - _this.lastPinchRotation);
      _this.props.onRotationChange && _this.props.onRotationChange(newRotation);
      _this.lastPinchRotation = rotation;
    });
  };

  Cropper.prototype.render = function () {
    var _this = this;

    var _a = this.props,
        image = _a.image,
        video = _a.video,
        mediaProps = _a.mediaProps,
        transform = _a.transform,
        _b = _a.crop,
        x = _b.x,
        y = _b.y,
        rotation = _a.rotation,
        zoom = _a.zoom,
        cropShape = _a.cropShape,
        showGrid = _a.showGrid,
        _c = _a.style,
        containerStyle = _c.containerStyle,
        cropAreaStyle = _c.cropAreaStyle,
        mediaStyle = _c.mediaStyle,
        _d = _a.classes,
        containerClassName = _d.containerClassName,
        cropAreaClassName = _d.cropAreaClassName,
        mediaClassName = _d.mediaClassName,
        objectFit = _a.objectFit;
    return /*#__PURE__*/external_React_default().createElement("div", {
      onMouseDown: this.onMouseDown,
      onTouchStart: this.onTouchStart,
      ref: function ref(el) {
        return _this.containerRef = el;
      },
      "data-testid": "container",
      style: containerStyle,
      className: classNames('reactEasyCrop_Container', containerClassName)
    }, image ? /*#__PURE__*/external_React_default().createElement("img", __assign({
      alt: "",
      className: classNames('reactEasyCrop_Image', objectFit === 'contain' && 'reactEasyCrop_Contain', objectFit === 'horizontal-cover' && 'reactEasyCrop_Cover_Horizontal', objectFit === 'vertical-cover' && 'reactEasyCrop_Cover_Vertical', mediaClassName)
    }, mediaProps, {
      src: image,
      ref: function ref(el) {
        return _this.imageRef = el;
      },
      style: __assign(__assign({}, mediaStyle), {
        transform: transform || "translate(" + x + "px, " + y + "px) rotate(" + rotation + "deg) scale(" + zoom + ")"
      }),
      onLoad: this.onMediaLoad
    })) : video && /*#__PURE__*/external_React_default().createElement("video", __assign({
      autoPlay: true,
      loop: true,
      muted: true,
      className: classNames('reactEasyCrop_Video', objectFit === 'contain' && 'reactEasyCrop_Contain', objectFit === 'horizontal-cover' && 'reactEasyCrop_Cover_Horizontal', objectFit === 'vertical-cover' && 'reactEasyCrop_Cover_Vertical', mediaClassName)
    }, mediaProps, {
      ref: function ref(el) {
        return _this.videoRef = el;
      },
      onLoadedMetadata: this.onMediaLoad,
      style: __assign(__assign({}, mediaStyle), {
        transform: transform || "translate(" + x + "px, " + y + "px) rotate(" + rotation + "deg) scale(" + zoom + ")"
      }),
      controls: false
    }), (Array.isArray(video) ? video : [{
      src: video
    }]).map(function (item) {
      return /*#__PURE__*/external_React_default().createElement("source", __assign({
        key: item.src
      }, item));
    })), this.state.cropSize && /*#__PURE__*/external_React_default().createElement("div", {
      style: __assign(__assign({}, cropAreaStyle), {
        width: this.state.cropSize.width,
        height: this.state.cropSize.height
      }),
      "data-testid": "cropper",
      className: classNames('reactEasyCrop_CropArea', cropShape === 'round' && 'reactEasyCrop_CropAreaRound', showGrid && 'reactEasyCrop_CropAreaGrid', cropAreaClassName)
    }));
  };

  Cropper.defaultProps = {
    zoom: 1,
    rotation: 0,
    aspect: 4 / 3,
    maxZoom: MAX_ZOOM,
    minZoom: MIN_ZOOM,
    cropShape: 'rect',
    objectFit: 'contain',
    showGrid: true,
    style: {},
    classes: {},
    mediaProps: {},
    zoomSpeed: 1,
    restrictPosition: true,
    zoomWithScroll: true
  };

  Cropper.getMousePoint = function (e) {
    return {
      x: Number(e.clientX),
      y: Number(e.clientY)
    };
  };

  Cropper.getTouchPoint = function (touch) {
    return {
      x: Number(touch.clientX),
      y: Number(touch.clientY)
    };
  };

  return Cropper;
}((external_React_default()).Component);

/* harmony default export */ var index_module = (Cropper);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/image-editor/constants.js
const constants_MIN_ZOOM = 100;
const constants_MAX_ZOOM = 300;
const constants_POPOVER_PROPS = {
  position: 'bottom right',
  isAlternate: true
};

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/image-editor/use-save-image.js
/**
 * WordPress dependencies
 */





function useSaveImage(_ref) {
  let {
    crop,
    rotation,
    height,
    width,
    aspect,
    url,
    id,
    onSaveImage,
    onFinishEditing
  } = _ref;
  const {
    createErrorNotice
  } = (0,external_wp_data_namespaceObject.useDispatch)(external_wp_notices_namespaceObject.store);
  const [isInProgress, setIsInProgress] = (0,external_wp_element_namespaceObject.useState)(false);
  const cancel = (0,external_wp_element_namespaceObject.useCallback)(() => {
    setIsInProgress(false);
    onFinishEditing();
  }, [setIsInProgress, onFinishEditing]);
  const apply = (0,external_wp_element_namespaceObject.useCallback)(() => {
    setIsInProgress(true);
    let attrs = {}; // The crop script may return some very small, sub-pixel values when the image was not cropped.
    // Crop only when the new size has changed by more than 0.1%.

    if (crop.width < 99.9 || crop.height < 99.9) {
      attrs = crop;
    }

    if (rotation > 0) {
      attrs.rotation = rotation;
    }

    attrs.src = url;
    external_wp_apiFetch_default()({
      path: `/wp/v2/media/${id}/edit`,
      method: 'POST',
      data: attrs
    }).then(response => {
      onSaveImage({
        id: response.id,
        url: response.source_url,
        height: height && width ? width / aspect : undefined
      });
    }).catch(error => {
      createErrorNotice((0,external_wp_i18n_namespaceObject.sprintf)(
      /* translators: 1. Error message */
      (0,external_wp_i18n_namespaceObject.__)('Could not edit image. %s'), error.message), {
        id: 'image-editing-error',
        type: 'snackbar'
      });
    }).finally(() => {
      setIsInProgress(false);
      onFinishEditing();
    });
  }, [setIsInProgress, crop, rotation, height, width, aspect, url, onSaveImage, createErrorNotice, setIsInProgress, onFinishEditing]);
  return (0,external_wp_element_namespaceObject.useMemo)(() => ({
    isInProgress,
    apply,
    cancel
  }), [isInProgress, apply, cancel]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/image-editor/use-transform-image.js
/**
 * WordPress dependencies
 */



function useTransformState(_ref) {
  let {
    url,
    naturalWidth,
    naturalHeight
  } = _ref;
  const [editedUrl, setEditedUrl] = (0,external_wp_element_namespaceObject.useState)();
  const [crop, setCrop] = (0,external_wp_element_namespaceObject.useState)();
  const [position, setPosition] = (0,external_wp_element_namespaceObject.useState)({
    x: 0,
    y: 0
  });
  const [zoom, setZoom] = (0,external_wp_element_namespaceObject.useState)();
  const [rotation, setRotation] = (0,external_wp_element_namespaceObject.useState)();
  const [aspect, setAspect] = (0,external_wp_element_namespaceObject.useState)();
  const [defaultAspect, setDefaultAspect] = (0,external_wp_element_namespaceObject.useState)();
  const initializeTransformValues = (0,external_wp_element_namespaceObject.useCallback)(() => {
    setPosition({
      x: 0,
      y: 0
    });
    setZoom(100);
    setRotation(0);
    setAspect(naturalWidth / naturalHeight);
    setDefaultAspect(naturalWidth / naturalHeight);
  }, [naturalWidth, naturalHeight, setPosition, setZoom, setRotation, setAspect, setDefaultAspect]);
  const rotateClockwise = (0,external_wp_element_namespaceObject.useCallback)(() => {
    const angle = (rotation + 90) % 360;
    let naturalAspectRatio = naturalWidth / naturalHeight;

    if (rotation % 180 === 90) {
      naturalAspectRatio = naturalHeight / naturalWidth;
    }

    if (angle === 0) {
      setEditedUrl();
      setRotation(angle);
      setAspect(1 / aspect);
      setPosition({
        x: -(position.y * naturalAspectRatio),
        y: position.x * naturalAspectRatio
      });
      return;
    }

    function editImage(event) {
      const canvas = document.createElement('canvas');
      let translateX = 0;
      let translateY = 0;

      if (angle % 180) {
        canvas.width = event.target.height;
        canvas.height = event.target.width;
      } else {
        canvas.width = event.target.width;
        canvas.height = event.target.height;
      }

      if (angle === 90 || angle === 180) {
        translateX = canvas.width;
      }

      if (angle === 270 || angle === 180) {
        translateY = canvas.height;
      }

      const context = canvas.getContext('2d');
      context.translate(translateX, translateY);
      context.rotate(angle * Math.PI / 180);
      context.drawImage(event.target, 0, 0);
      canvas.toBlob(blob => {
        setEditedUrl(URL.createObjectURL(blob));
        setRotation(angle);
        setAspect(1 / aspect);
        setPosition({
          x: -(position.y * naturalAspectRatio),
          y: position.x * naturalAspectRatio
        });
      });
    }

    const el = new window.Image();
    el.src = url;
    el.onload = editImage;
    const imgCrossOrigin = (0,external_wp_hooks_namespaceObject.applyFilters)('media.crossOrigin', undefined, url);

    if (typeof imgCrossOrigin === 'string') {
      el.crossOrigin = imgCrossOrigin;
    }
  }, [rotation, naturalWidth, naturalHeight, setEditedUrl, setRotation, setAspect, setPosition]);
  return (0,external_wp_element_namespaceObject.useMemo)(() => ({
    editedUrl,
    setEditedUrl,
    crop,
    setCrop,
    position,
    setPosition,
    zoom,
    setZoom,
    rotation,
    setRotation,
    rotateClockwise,
    aspect,
    setAspect,
    defaultAspect,
    initializeTransformValues
  }), [editedUrl, setEditedUrl, crop, setCrop, position, setPosition, zoom, setZoom, rotation, setRotation, rotateClockwise, aspect, setAspect, defaultAspect, initializeTransformValues]);
}

function useTransformImage(imageProperties, isEditing) {
  const transformState = useTransformState(imageProperties);
  const {
    initializeTransformValues
  } = transformState;
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    if (isEditing) {
      initializeTransformValues();
    }
  }, [isEditing, initializeTransformValues]);
  return transformState;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/image-editor/context.js


/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */



const ImageEditingContext = (0,external_wp_element_namespaceObject.createContext)({});
const useImageEditingContext = () => (0,external_wp_element_namespaceObject.useContext)(ImageEditingContext);
function ImageEditingProvider(_ref) {
  let {
    id,
    url,
    naturalWidth,
    naturalHeight,
    isEditing,
    onFinishEditing,
    onSaveImage,
    children
  } = _ref;
  const transformImage = useTransformImage({
    url,
    naturalWidth,
    naturalHeight
  }, isEditing);
  const saveImage = useSaveImage({
    id,
    url,
    onSaveImage,
    onFinishEditing,
    ...transformImage
  });
  const providerValue = (0,external_wp_element_namespaceObject.useMemo)(() => ({ ...transformImage,
    ...saveImage
  }), [transformImage, saveImage]);
  return (0,external_wp_element_namespaceObject.createElement)(ImageEditingContext.Provider, {
    value: providerValue
  }, children);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/image-editor/cropper.js


/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */



function ImageCropper(_ref) {
  let {
    url,
    width,
    height,
    clientWidth,
    naturalHeight,
    naturalWidth
  } = _ref;
  const {
    isInProgress,
    editedUrl,
    position,
    zoom,
    aspect,
    setPosition,
    setCrop,
    setZoom,
    rotation
  } = useImageEditingContext();
  let editedHeight = height || clientWidth * naturalHeight / naturalWidth;

  if (rotation % 180 === 90) {
    editedHeight = clientWidth * naturalWidth / naturalHeight;
  }

  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: classnames_default()('wp-block-image__crop-area', {
      'is-applying': isInProgress
    }),
    style: {
      width: width || clientWidth,
      height: editedHeight
    }
  }, (0,external_wp_element_namespaceObject.createElement)(index_module, {
    image: editedUrl || url,
    disabled: isInProgress,
    minZoom: constants_MIN_ZOOM / 100,
    maxZoom: constants_MAX_ZOOM / 100,
    crop: position,
    zoom: zoom / 100,
    aspect: aspect,
    onCropChange: setPosition,
    onCropComplete: newCropPercent => {
      setCrop(newCropPercent);
    },
    onZoomChange: newZoom => {
      setZoom(newZoom * 100);
    }
  }), isInProgress && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Spinner, null));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/search.js


/**
 * WordPress dependencies
 */

const search = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M13.5 6C10.5 6 8 8.5 8 11.5c0 1.1.3 2.1.9 3l-3.4 3 1 1.1 3.4-2.9c1 .9 2.2 1.4 3.6 1.4 3 0 5.5-2.5 5.5-5.5C19 8.5 16.5 6 13.5 6zm0 9.5c-2.2 0-4-1.8-4-4s1.8-4 4-4 4 1.8 4 4-1.8 4-4 4z"
}));
/* harmony default export */ var library_search = (search);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/image-editor/zoom-dropdown.js


/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */



function ZoomDropdown() {
  const {
    isInProgress,
    zoom,
    setZoom
  } = useImageEditingContext();
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Dropdown, {
    contentClassName: "wp-block-image__zoom",
    popoverProps: constants_POPOVER_PROPS,
    renderToggle: _ref => {
      let {
        isOpen,
        onToggle
      } = _ref;
      return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarButton, {
        icon: library_search,
        label: (0,external_wp_i18n_namespaceObject.__)('Zoom'),
        onClick: onToggle,
        "aria-expanded": isOpen,
        disabled: isInProgress
      });
    },
    renderContent: () => (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.RangeControl, {
      label: (0,external_wp_i18n_namespaceObject.__)('Zoom'),
      min: constants_MIN_ZOOM,
      max: constants_MAX_ZOOM,
      value: Math.round(zoom),
      onChange: setZoom
    })
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/aspect-ratio.js


/**
 * WordPress dependencies
 */

const aspectRatio = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M18.5 5.5h-13c-1.1 0-2 .9-2 2v9c0 1.1.9 2 2 2h13c1.1 0 2-.9 2-2v-9c0-1.1-.9-2-2-2zm.5 11c0 .3-.2.5-.5.5h-13c-.3 0-.5-.2-.5-.5v-9c0-.3.2-.5.5-.5h13c.3 0 .5.2.5.5v9zM6.5 12H8v-2h2V8.5H6.5V12zm9.5 2h-2v1.5h3.5V12H16v2z"
}));
/* harmony default export */ var aspect_ratio = (aspectRatio);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/image-editor/aspect-ratio-dropdown.js


/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */




function AspectGroup(_ref) {
  let {
    aspectRatios,
    isDisabled,
    label,
    onClick,
    value
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuGroup, {
    label: label
  }, aspectRatios.map(_ref2 => {
    let {
      title,
      aspect
    } = _ref2;
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
      key: aspect,
      disabled: isDisabled,
      onClick: () => {
        onClick(aspect);
      },
      role: "menuitemradio",
      isSelected: aspect === value,
      icon: aspect === value ? library_check : undefined
    }, title);
  }));
}

function AspectRatioDropdown(_ref3) {
  let {
    toggleProps
  } = _ref3;
  const {
    isInProgress,
    aspect,
    setAspect,
    defaultAspect
  } = useImageEditingContext();
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.DropdownMenu, {
    icon: aspect_ratio,
    label: (0,external_wp_i18n_namespaceObject.__)('Aspect Ratio'),
    popoverProps: constants_POPOVER_PROPS,
    toggleProps: toggleProps,
    className: "wp-block-image__aspect-ratio"
  }, _ref4 => {
    let {
      onClose
    } = _ref4;
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(AspectGroup, {
      isDisabled: isInProgress,
      onClick: newAspect => {
        setAspect(newAspect);
        onClose();
      },
      value: aspect,
      aspectRatios: [{
        title: (0,external_wp_i18n_namespaceObject.__)('Original'),
        aspect: defaultAspect
      }, {
        title: (0,external_wp_i18n_namespaceObject.__)('Square'),
        aspect: 1
      }]
    }), (0,external_wp_element_namespaceObject.createElement)(AspectGroup, {
      label: (0,external_wp_i18n_namespaceObject.__)('Landscape'),
      isDisabled: isInProgress,
      onClick: newAspect => {
        setAspect(newAspect);
        onClose();
      },
      value: aspect,
      aspectRatios: [{
        title: (0,external_wp_i18n_namespaceObject.__)('16:10'),
        aspect: 16 / 10
      }, {
        title: (0,external_wp_i18n_namespaceObject.__)('16:9'),
        aspect: 16 / 9
      }, {
        title: (0,external_wp_i18n_namespaceObject.__)('4:3'),
        aspect: 4 / 3
      }, {
        title: (0,external_wp_i18n_namespaceObject.__)('3:2'),
        aspect: 3 / 2
      }]
    }), (0,external_wp_element_namespaceObject.createElement)(AspectGroup, {
      label: (0,external_wp_i18n_namespaceObject.__)('Portrait'),
      isDisabled: isInProgress,
      onClick: newAspect => {
        setAspect(newAspect);
        onClose();
      },
      value: aspect,
      aspectRatios: [{
        title: (0,external_wp_i18n_namespaceObject.__)('10:16'),
        aspect: 10 / 16
      }, {
        title: (0,external_wp_i18n_namespaceObject.__)('9:16'),
        aspect: 9 / 16
      }, {
        title: (0,external_wp_i18n_namespaceObject.__)('3:4'),
        aspect: 3 / 4
      }, {
        title: (0,external_wp_i18n_namespaceObject.__)('2:3'),
        aspect: 2 / 3
      }]
    }));
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/rotate-right.js


/**
 * WordPress dependencies
 */

const rotateRight = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M15.1 4.8l-3-2.5V4c-4.4 0-8 3.6-8 8 0 3.7 2.5 6.9 6 7.7.3.1.6.1 1 .2l.2-1.5c-.4 0-.7-.1-1.1-.2l-.1.2v-.2c-2.6-.8-4.5-3.3-4.5-6.2 0-3.6 2.9-6.5 6.5-6.5v1.8l3-2.5zM20 11c-.2-1.4-.7-2.7-1.6-3.8l-1.2.8c.7.9 1.1 2 1.3 3.1L20 11zm-1.5 1.8c-.1.5-.2 1.1-.4 1.6s-.5 1-.8 1.5l1.2.9c.4-.5.8-1.1 1-1.8s.5-1.3.5-2l-1.5-.2zm-5.6 5.6l.2 1.5c1.4-.2 2.7-.7 3.8-1.6l-.9-1.1c-.9.7-2 1.1-3.1 1.2z"
}));
/* harmony default export */ var rotate_right = (rotateRight);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/image-editor/rotation-button.js


/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */


function RotationButton() {
  const {
    isInProgress,
    rotateClockwise
  } = useImageEditingContext();
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarButton, {
    icon: rotate_right,
    label: (0,external_wp_i18n_namespaceObject.__)('Rotate'),
    onClick: rotateClockwise,
    disabled: isInProgress
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/image-editor/form-controls.js


/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


function FormControls() {
  const {
    isInProgress,
    apply,
    cancel
  } = useImageEditingContext();
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarButton, {
    onClick: apply,
    disabled: isInProgress
  }, (0,external_wp_i18n_namespaceObject.__)('Apply')), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarButton, {
    onClick: cancel
  }, (0,external_wp_i18n_namespaceObject.__)('Cancel')));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/image-editor/index.js


/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */







function ImageEditor(_ref) {
  let {
    url,
    width,
    height,
    clientWidth,
    naturalHeight,
    naturalWidth
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(ImageCropper, {
    url: url,
    width: width,
    height: height,
    clientWidth: clientWidth,
    naturalHeight: naturalHeight,
    naturalWidth: naturalWidth
  }), (0,external_wp_element_namespaceObject.createElement)(block_controls, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarGroup, null, (0,external_wp_element_namespaceObject.createElement)(ZoomDropdown, null), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarItem, null, toggleProps => (0,external_wp_element_namespaceObject.createElement)(AspectRatioDropdown, {
    toggleProps: toggleProps
  })), (0,external_wp_element_namespaceObject.createElement)(RotationButton, null)), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarGroup, null, (0,external_wp_element_namespaceObject.createElement)(FormControls, null))));
}


;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/image-size-control/use-dimension-handler.js
/**
 * WordPress dependencies
 */

function useDimensionHandler(customHeight, customWidth, defaultHeight, defaultWidth, onChange) {
  var _ref, _ref2;

  const [currentWidth, setCurrentWidth] = (0,external_wp_element_namespaceObject.useState)((_ref = customWidth !== null && customWidth !== void 0 ? customWidth : defaultWidth) !== null && _ref !== void 0 ? _ref : '');
  const [currentHeight, setCurrentHeight] = (0,external_wp_element_namespaceObject.useState)((_ref2 = customHeight !== null && customHeight !== void 0 ? customHeight : defaultHeight) !== null && _ref2 !== void 0 ? _ref2 : ''); // When an image is first inserted, the default dimensions are initially
  // undefined. This effect updates the dimensions when the default values
  // come through.

  (0,external_wp_element_namespaceObject.useEffect)(() => {
    if (customWidth === undefined && defaultWidth !== undefined) {
      setCurrentWidth(defaultWidth);
    }

    if (customHeight === undefined && defaultHeight !== undefined) {
      setCurrentHeight(defaultHeight);
    }
  }, [defaultWidth, defaultHeight]); // If custom values change, it means an outsider has resized the image using some other method (eg resize box)
  // this keeps track of these values too. We need to parse before comparing; custom values can be strings.

  (0,external_wp_element_namespaceObject.useEffect)(() => {
    if (customWidth !== undefined && Number.parseInt(customWidth) !== Number.parseInt(currentWidth)) {
      setCurrentWidth(customWidth);
    }

    if (customHeight !== undefined && Number.parseInt(customHeight) !== Number.parseInt(currentHeight)) {
      setCurrentHeight(customHeight);
    }
  }, [customWidth, customHeight]);

  const updateDimension = (dimension, value) => {
    if (dimension === 'width') {
      setCurrentWidth(value);
    } else {
      setCurrentHeight(value);
    }

    onChange({
      [dimension]: value === '' ? undefined : parseInt(value, 10)
    });
  };

  const updateDimensions = (nextHeight, nextWidth) => {
    setCurrentHeight(nextHeight !== null && nextHeight !== void 0 ? nextHeight : defaultHeight);
    setCurrentWidth(nextWidth !== null && nextWidth !== void 0 ? nextWidth : defaultWidth);
    onChange({
      height: nextHeight,
      width: nextWidth
    });
  };

  return {
    currentHeight,
    currentWidth,
    updateDimension,
    updateDimensions
  };
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/image-size-control/index.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */


const IMAGE_SIZE_PRESETS = [25, 50, 75, 100];
function ImageSizeControl(_ref) {
  let {
    imageWidth,
    imageHeight,
    imageSizeOptions = [],
    isResizable = true,
    slug,
    width,
    height,
    onChange,
    onChangeImage = external_lodash_namespaceObject.noop
  } = _ref;
  const {
    currentHeight,
    currentWidth,
    updateDimension,
    updateDimensions
  } = useDimensionHandler(height, width, imageHeight, imageWidth, onChange);
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, !(0,external_lodash_namespaceObject.isEmpty)(imageSizeOptions) && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.SelectControl, {
    label: (0,external_wp_i18n_namespaceObject.__)('Image size'),
    value: slug,
    options: imageSizeOptions,
    onChange: onChangeImage
  }), isResizable && (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-image-size-control"
  }, (0,external_wp_element_namespaceObject.createElement)("p", {
    className: "block-editor-image-size-control__row"
  }, (0,external_wp_i18n_namespaceObject.__)('Image dimensions')), (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-image-size-control__row"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.TextControl, {
    type: "number",
    className: "block-editor-image-size-control__width",
    label: (0,external_wp_i18n_namespaceObject.__)('Width'),
    value: currentWidth,
    min: 1,
    onChange: value => updateDimension('width', value)
  }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.TextControl, {
    type: "number",
    className: "block-editor-image-size-control__height",
    label: (0,external_wp_i18n_namespaceObject.__)('Height'),
    value: currentHeight,
    min: 1,
    onChange: value => updateDimension('height', value)
  })), (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-image-size-control__row"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ButtonGroup, {
    "aria-label": (0,external_wp_i18n_namespaceObject.__)('Image size presets')
  }, IMAGE_SIZE_PRESETS.map(scale => {
    const scaledWidth = Math.round(imageWidth * (scale / 100));
    const scaledHeight = Math.round(imageHeight * (scale / 100));
    const isCurrent = currentWidth === scaledWidth && currentHeight === scaledHeight;
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
      key: scale,
      isSmall: true,
      variant: isCurrent ? 'primary' : undefined,
      isPressed: isCurrent,
      onClick: () => updateDimensions(scaledHeight, scaledWidth)
    }, scale, "%");
  })), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    isSmall: true,
    onClick: () => updateDimensions()
  }, (0,external_wp_i18n_namespaceObject.__)('Reset')))));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/keyboard-return.js


/**
 * WordPress dependencies
 */

const keyboardReturn = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "-2 -2 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M6.734 16.106l2.176-2.38-1.093-1.028-3.846 4.158 3.846 4.157 1.093-1.027-2.176-2.38h2.811c1.125 0 2.25.03 3.374 0 1.428-.001 3.362-.25 4.963-1.277 1.66-1.065 2.868-2.906 2.868-5.859 0-2.479-1.327-4.896-3.65-5.93-1.82-.813-3.044-.8-4.806-.788l-.567.002v1.5c.184 0 .368 0 .553-.002 1.82-.007 2.704-.014 4.21.657 1.854.827 2.76 2.657 2.76 4.561 0 2.472-.973 3.824-2.178 4.596-1.258.807-2.864 1.04-4.163 1.04h-.02c-1.115.03-2.229 0-3.344 0H6.734z"
}));
/* harmony default export */ var keyboard_return = (keyboardReturn);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/link-control/settings-drawer.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */




const LinkControlSettingsDrawer = _ref => {
  let {
    value,
    onChange = external_lodash_namespaceObject.noop,
    settings
  } = _ref;

  if (!settings || !settings.length) {
    return null;
  }

  const handleSettingChange = setting => newValue => {
    onChange({ ...value,
      [setting.id]: newValue
    });
  };

  const theSettings = settings.map(setting => (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToggleControl, {
    className: "block-editor-link-control__setting",
    key: setting.id,
    label: setting.title,
    onChange: handleSettingChange(setting),
    checked: value ? !!value[setting.id] : false
  }));
  return (0,external_wp_element_namespaceObject.createElement)("fieldset", {
    className: "block-editor-link-control__settings"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.VisuallyHidden, {
    as: "legend"
  }, (0,external_wp_i18n_namespaceObject.__)('Currently selected link settings')), theSettings);
};

/* harmony default export */ var settings_drawer = (LinkControlSettingsDrawer);

// EXTERNAL MODULE: ./node_modules/dom-scroll-into-view/lib/index.js
var dom_scroll_into_view_lib = __webpack_require__(5425);
var lib_default = /*#__PURE__*/__webpack_require__.n(dom_scroll_into_view_lib);
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/url-input/index.js



/**
 * External dependencies
 */



/**
 * WordPress dependencies
 */








/**
 * Internal dependencies
 */



class URLInput extends external_wp_element_namespaceObject.Component {
  constructor(props) {
    super(props);
    this.onChange = this.onChange.bind(this);
    this.onFocus = this.onFocus.bind(this);
    this.onKeyDown = this.onKeyDown.bind(this);
    this.selectLink = this.selectLink.bind(this);
    this.handleOnClick = this.handleOnClick.bind(this);
    this.bindSuggestionNode = this.bindSuggestionNode.bind(this);
    this.autocompleteRef = props.autocompleteRef || (0,external_wp_element_namespaceObject.createRef)();
    this.inputRef = (0,external_wp_element_namespaceObject.createRef)();
    this.updateSuggestions = (0,external_lodash_namespaceObject.debounce)(this.updateSuggestions.bind(this), 200);
    this.suggestionNodes = [];
    this.isUpdatingSuggestions = false;
    this.state = {
      suggestions: [],
      showSuggestions: false,
      selectedSuggestion: null,
      suggestionsListboxId: '',
      suggestionOptionIdPrefix: ''
    };
  }

  componentDidUpdate(prevProps) {
    const {
      showSuggestions,
      selectedSuggestion
    } = this.state;
    const {
      value,
      __experimentalShowInitialSuggestions = false
    } = this.props; // Only have to worry about scrolling selected suggestion into view
    // when already expanded.

    if (showSuggestions && selectedSuggestion !== null && this.suggestionNodes[selectedSuggestion] && !this.scrollingIntoView) {
      this.scrollingIntoView = true;
      lib_default()(this.suggestionNodes[selectedSuggestion], this.autocompleteRef.current, {
        onlyScrollIfNeeded: true
      });
      this.props.setTimeout(() => {
        this.scrollingIntoView = false;
      }, 100);
    } // Update suggestions when the value changes.


    if (prevProps.value !== value && !this.props.disableSuggestions && !this.isUpdatingSuggestions) {
      if (value !== null && value !== void 0 && value.length) {
        // If the new value is not empty we need to update with suggestions for it.
        this.updateSuggestions(value);
      } else if (__experimentalShowInitialSuggestions) {
        // If the new value is empty and we can show initial suggestions, then show initial suggestions.
        this.updateSuggestions();
      }
    }
  }

  componentDidMount() {
    if (this.shouldShowInitialSuggestions()) {
      this.updateSuggestions();
    }
  }

  componentWillUnmount() {
    var _this$suggestionsRequ, _this$suggestionsRequ2;

    (_this$suggestionsRequ = this.suggestionsRequest) === null || _this$suggestionsRequ === void 0 ? void 0 : (_this$suggestionsRequ2 = _this$suggestionsRequ.cancel) === null || _this$suggestionsRequ2 === void 0 ? void 0 : _this$suggestionsRequ2.call(_this$suggestionsRequ);
    delete this.suggestionsRequest;
  }

  bindSuggestionNode(index) {
    return ref => {
      this.suggestionNodes[index] = ref;
    };
  }

  shouldShowInitialSuggestions() {
    const {
      suggestions
    } = this.state;
    const {
      __experimentalShowInitialSuggestions = false,
      value
    } = this.props;
    return !this.isUpdatingSuggestions && __experimentalShowInitialSuggestions && !(value && value.length) && !(suggestions && suggestions.length);
  }

  updateSuggestions() {
    var _value;

    let value = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : '';
    const {
      __experimentalFetchLinkSuggestions: fetchLinkSuggestions,
      __experimentalHandleURLSuggestions: handleURLSuggestions
    } = this.props;

    if (!fetchLinkSuggestions) {
      return;
    } // Initial suggestions may only show if there is no value
    // (note: this includes whitespace).


    const isInitialSuggestions = !((_value = value) !== null && _value !== void 0 && _value.length); // Trim only now we've determined whether or not it originally had a "length"
    // (even if that value was all whitespace).

    value = value.trim(); // Allow a suggestions request if:
    // - there are at least 2 characters in the search input (except manual searches where
    //   search input length is not required to trigger a fetch)
    // - this is a direct entry (eg: a URL)

    if (!isInitialSuggestions && (value.length < 2 || !handleURLSuggestions && (0,external_wp_url_namespaceObject.isURL)(value))) {
      this.setState({
        showSuggestions: false,
        selectedSuggestion: null,
        loading: false
      });
      return;
    }

    this.isUpdatingSuggestions = true;
    this.setState({
      selectedSuggestion: null,
      loading: true
    });
    const request = fetchLinkSuggestions(value, {
      isInitialSuggestions
    });
    request.then(suggestions => {
      // A fetch Promise doesn't have an abort option. It's mimicked by
      // comparing the request reference in on the instance, which is
      // reset or deleted on subsequent requests or unmounting.
      if (this.suggestionsRequest !== request) {
        return;
      }

      this.setState({
        suggestions,
        loading: false,
        showSuggestions: !!suggestions.length
      });

      if (!!suggestions.length) {
        this.props.debouncedSpeak((0,external_wp_i18n_namespaceObject.sprintf)(
        /* translators: %s: number of results. */
        (0,external_wp_i18n_namespaceObject._n)('%d result found, use up and down arrow keys to navigate.', '%d results found, use up and down arrow keys to navigate.', suggestions.length), suggestions.length), 'assertive');
      } else {
        this.props.debouncedSpeak((0,external_wp_i18n_namespaceObject.__)('No results.'), 'assertive');
      }

      this.isUpdatingSuggestions = false;
    }).catch(() => {
      if (this.suggestionsRequest === request) {
        this.setState({
          loading: false
        });
        this.isUpdatingSuggestions = false;
      }
    }); // Note that this assignment is handled *before* the async search request
    // as a Promise always resolves on the next tick of the event loop.

    this.suggestionsRequest = request;
  }

  onChange(event) {
    const inputValue = event.target.value;
    this.props.onChange(inputValue);

    if (!this.props.disableSuggestions) {
      this.updateSuggestions(inputValue);
    }
  }

  onFocus() {
    const {
      suggestions
    } = this.state;
    const {
      disableSuggestions,
      value
    } = this.props; // When opening the link editor, if there's a value present, we want to load the suggestions pane with the results for this input search value
    // Don't re-run the suggestions on focus if there are already suggestions present (prevents searching again when tabbing between the input and buttons)

    if (value && !disableSuggestions && !this.isUpdatingSuggestions && !(suggestions && suggestions.length)) {
      // Ensure the suggestions are updated with the current input value.
      this.updateSuggestions(value);
    }
  }

  onKeyDown(event) {
    const {
      showSuggestions,
      selectedSuggestion,
      suggestions,
      loading
    } = this.state; // If the suggestions are not shown or loading, we shouldn't handle the arrow keys
    // We shouldn't preventDefault to allow block arrow keys navigation.

    if (!showSuggestions || !suggestions.length || loading) {
      // In the Windows version of Firefox the up and down arrows don't move the caret
      // within an input field like they do for Mac Firefox/Chrome/Safari. This causes
      // a form of focus trapping that is disruptive to the user experience. This disruption
      // only happens if the caret is not in the first or last position in the text input.
      // See: https://github.com/WordPress/gutenberg/issues/5693#issuecomment-436684747
      switch (event.keyCode) {
        // When UP is pressed, if the caret is at the start of the text, move it to the 0
        // position.
        case external_wp_keycodes_namespaceObject.UP:
          {
            if (0 !== event.target.selectionStart) {
              event.preventDefault(); // Set the input caret to position 0.

              event.target.setSelectionRange(0, 0);
            }

            break;
          }
        // When DOWN is pressed, if the caret is not at the end of the text, move it to the
        // last position.

        case external_wp_keycodes_namespaceObject.DOWN:
          {
            if (this.props.value.length !== event.target.selectionStart) {
              event.preventDefault(); // Set the input caret to the last position.

              event.target.setSelectionRange(this.props.value.length, this.props.value.length);
            }

            break;
          }
        // Submitting while loading should trigger onSubmit.

        case external_wp_keycodes_namespaceObject.ENTER:
          {
            if (this.props.onSubmit) {
              this.props.onSubmit(null, event);
            }

            break;
          }
      }

      return;
    }

    const suggestion = this.state.suggestions[this.state.selectedSuggestion];

    switch (event.keyCode) {
      case external_wp_keycodes_namespaceObject.UP:
        {
          event.preventDefault();
          const previousIndex = !selectedSuggestion ? suggestions.length - 1 : selectedSuggestion - 1;
          this.setState({
            selectedSuggestion: previousIndex
          });
          break;
        }

      case external_wp_keycodes_namespaceObject.DOWN:
        {
          event.preventDefault();
          const nextIndex = selectedSuggestion === null || selectedSuggestion === suggestions.length - 1 ? 0 : selectedSuggestion + 1;
          this.setState({
            selectedSuggestion: nextIndex
          });
          break;
        }

      case external_wp_keycodes_namespaceObject.TAB:
        {
          if (this.state.selectedSuggestion !== null) {
            this.selectLink(suggestion); // Announce a link has been selected when tabbing away from the input field.

            this.props.speak((0,external_wp_i18n_namespaceObject.__)('Link selected.'));
          }

          break;
        }

      case external_wp_keycodes_namespaceObject.ENTER:
        {
          if (this.state.selectedSuggestion !== null) {
            this.selectLink(suggestion);

            if (this.props.onSubmit) {
              this.props.onSubmit(suggestion, event);
            }
          } else if (this.props.onSubmit) {
            this.props.onSubmit(null, event);
          }

          break;
        }
    }
  }

  selectLink(suggestion) {
    this.props.onChange(suggestion.url, suggestion);
    this.setState({
      selectedSuggestion: null,
      showSuggestions: false
    });
  }

  handleOnClick(suggestion) {
    this.selectLink(suggestion); // Move focus to the input field when a link suggestion is clicked.

    this.inputRef.current.focus();
  }

  static getDerivedStateFromProps(_ref, _ref2) {
    let {
      value,
      instanceId,
      disableSuggestions,
      __experimentalShowInitialSuggestions = false
    } = _ref;
    let {
      showSuggestions
    } = _ref2;
    let shouldShowSuggestions = showSuggestions;
    const hasValue = value && value.length;

    if (!__experimentalShowInitialSuggestions && !hasValue) {
      shouldShowSuggestions = false;
    }

    if (disableSuggestions === true) {
      shouldShowSuggestions = false;
    }

    return {
      showSuggestions: shouldShowSuggestions,
      suggestionsListboxId: `block-editor-url-input-suggestions-${instanceId}`,
      suggestionOptionIdPrefix: `block-editor-url-input-suggestion-${instanceId}`
    };
  }

  render() {
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, this.renderControl(), this.renderSuggestions());
  }

  renderControl() {
    const {
      label,
      className,
      isFullWidth,
      instanceId,
      placeholder = (0,external_wp_i18n_namespaceObject.__)('Paste URL or type to search'),
      __experimentalRenderControl: renderControl,
      value = ''
    } = this.props;
    const {
      loading,
      showSuggestions,
      selectedSuggestion,
      suggestionsListboxId,
      suggestionOptionIdPrefix
    } = this.state;
    const controlProps = {
      id: `url-input-control-${instanceId}`,
      label,
      className: classnames_default()('block-editor-url-input', className, {
        'is-full-width': isFullWidth
      })
    };
    const inputProps = {
      value,
      required: true,
      className: 'block-editor-url-input__input',
      type: 'text',
      onChange: this.onChange,
      onFocus: this.onFocus,
      placeholder,
      onKeyDown: this.onKeyDown,
      role: 'combobox',
      'aria-label': (0,external_wp_i18n_namespaceObject.__)('URL'),
      'aria-expanded': showSuggestions,
      'aria-autocomplete': 'list',
      'aria-owns': suggestionsListboxId,
      'aria-activedescendant': selectedSuggestion !== null ? `${suggestionOptionIdPrefix}-${selectedSuggestion}` : undefined,
      ref: this.inputRef
    };

    if (renderControl) {
      return renderControl(controlProps, inputProps, loading);
    }

    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.BaseControl, controlProps, (0,external_wp_element_namespaceObject.createElement)("input", inputProps), loading && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Spinner, null));
  }

  renderSuggestions() {
    const {
      className,
      __experimentalRenderSuggestions: renderSuggestions,
      value = '',
      __experimentalShowInitialSuggestions = false
    } = this.props;
    const {
      showSuggestions,
      suggestions,
      selectedSuggestion,
      suggestionsListboxId,
      suggestionOptionIdPrefix,
      loading
    } = this.state;
    const suggestionsListProps = {
      id: suggestionsListboxId,
      ref: this.autocompleteRef,
      role: 'listbox'
    };

    const buildSuggestionItemProps = (suggestion, index) => {
      return {
        role: 'option',
        tabIndex: '-1',
        id: `${suggestionOptionIdPrefix}-${index}`,
        ref: this.bindSuggestionNode(index),
        'aria-selected': index === selectedSuggestion
      };
    };

    if ((0,external_lodash_namespaceObject.isFunction)(renderSuggestions) && showSuggestions && !!suggestions.length) {
      return renderSuggestions({
        suggestions,
        selectedSuggestion,
        suggestionsListProps,
        buildSuggestionItemProps,
        isLoading: loading,
        handleSuggestionClick: this.handleOnClick,
        isInitialSuggestions: __experimentalShowInitialSuggestions && !(value && value.length)
      });
    }

    if (!(0,external_lodash_namespaceObject.isFunction)(renderSuggestions) && showSuggestions && !!suggestions.length) {
      return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Popover, {
        position: "bottom",
        noArrow: true,
        focusOnMount: false
      }, (0,external_wp_element_namespaceObject.createElement)("div", _extends({}, suggestionsListProps, {
        className: classnames_default()('block-editor-url-input__suggestions', `${className}__suggestions`)
      }), suggestions.map((suggestion, index) => (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, _extends({}, buildSuggestionItemProps(suggestion, index), {
        key: suggestion.id,
        className: classnames_default()('block-editor-url-input__suggestion', {
          'is-selected': index === selectedSuggestion
        }),
        onClick: () => this.handleOnClick(suggestion)
      }), suggestion.title))));
    }

    return null;
  }

}
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/url-input/README.md
 */


/* harmony default export */ var url_input = ((0,external_wp_compose_namespaceObject.compose)(external_wp_compose_namespaceObject.withSafeTimeout, external_wp_components_namespaceObject.withSpokenMessages, external_wp_compose_namespaceObject.withInstanceId, (0,external_wp_data_namespaceObject.withSelect)((select, props) => {
  // If a link suggestions handler is already provided then
  // bail.
  if ((0,external_lodash_namespaceObject.isFunction)(props.__experimentalFetchLinkSuggestions)) {
    return;
  }

  const {
    getSettings
  } = select(store);
  return {
    __experimentalFetchLinkSuggestions: getSettings().__experimentalFetchLinkSuggestions
  };
}))(URLInput));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/link-control/search-create-button.js



/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */





const LinkControlSearchCreate = _ref => {
  let {
    searchTerm,
    onClick,
    itemProps,
    isSelected,
    buttonText
  } = _ref;

  if (!searchTerm) {
    return null;
  }

  let text;

  if (buttonText) {
    text = (0,external_lodash_namespaceObject.isFunction)(buttonText) ? buttonText(searchTerm) : buttonText;
  } else {
    text = (0,external_wp_element_namespaceObject.createInterpolateElement)((0,external_wp_i18n_namespaceObject.sprintf)(
    /* translators: %s: search term. */
    (0,external_wp_i18n_namespaceObject.__)('Create: <mark>%s</mark>'), searchTerm), {
      mark: (0,external_wp_element_namespaceObject.createElement)("mark", null)
    });
  }

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, _extends({}, itemProps, {
    className: classnames_default()('block-editor-link-control__search-create block-editor-link-control__search-item', {
      'is-selected': isSelected
    }),
    onClick: onClick
  }), (0,external_wp_element_namespaceObject.createElement)(build_module_icon, {
    className: "block-editor-link-control__search-item-icon",
    icon: library_plus
  }), (0,external_wp_element_namespaceObject.createElement)("span", {
    className: "block-editor-link-control__search-item-header"
  }, (0,external_wp_element_namespaceObject.createElement)("span", {
    className: "block-editor-link-control__search-item-title"
  }, text)));
};
/* harmony default export */ var search_create_button = (LinkControlSearchCreate);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/globe.js


/**
 * WordPress dependencies
 */

const globe = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M12 3.3c-4.8 0-8.8 3.9-8.8 8.8 0 4.8 3.9 8.8 8.8 8.8 4.8 0 8.8-3.9 8.8-8.8s-4-8.8-8.8-8.8zm6.5 5.5h-2.6C15.4 7.3 14.8 6 14 5c2 .6 3.6 2 4.5 3.8zm.7 3.2c0 .6-.1 1.2-.2 1.8h-2.9c.1-.6.1-1.2.1-1.8s-.1-1.2-.1-1.8H19c.2.6.2 1.2.2 1.8zM12 18.7c-1-.7-1.8-1.9-2.3-3.5h4.6c-.5 1.6-1.3 2.9-2.3 3.5zm-2.6-4.9c-.1-.6-.1-1.1-.1-1.8 0-.6.1-1.2.1-1.8h5.2c.1.6.1 1.1.1 1.8s-.1 1.2-.1 1.8H9.4zM4.8 12c0-.6.1-1.2.2-1.8h2.9c-.1.6-.1 1.2-.1 1.8 0 .6.1 1.2.1 1.8H5c-.2-.6-.2-1.2-.2-1.8zM12 5.3c1 .7 1.8 1.9 2.3 3.5H9.7c.5-1.6 1.3-2.9 2.3-3.5zM10 5c-.8 1-1.4 2.3-1.8 3.8H5.5C6.4 7 8 5.6 10 5zM5.5 15.3h2.6c.4 1.5 1 2.8 1.8 3.7-1.8-.6-3.5-2-4.4-3.7zM14 19c.8-1 1.4-2.2 1.8-3.7h2.6C17.6 17 16 18.4 14 19z"
}));
/* harmony default export */ var library_globe = (globe);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/link-control/search-item.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */





const LinkControlSearchItem = _ref => {
  let {
    itemProps,
    suggestion,
    isSelected = false,
    onClick,
    isURL = false,
    searchTerm = '',
    shouldShowType = false
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, _extends({}, itemProps, {
    onClick: onClick,
    className: classnames_default()('block-editor-link-control__search-item', {
      'is-selected': isSelected,
      'is-url': isURL,
      'is-entity': !isURL
    })
  }), isURL && (0,external_wp_element_namespaceObject.createElement)(build_module_icon, {
    className: "block-editor-link-control__search-item-icon",
    icon: library_globe
  }), (0,external_wp_element_namespaceObject.createElement)("span", {
    className: "block-editor-link-control__search-item-header"
  }, (0,external_wp_element_namespaceObject.createElement)("span", {
    className: "block-editor-link-control__search-item-title"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.TextHighlight, {
    text: suggestion.title,
    highlight: searchTerm
  })), (0,external_wp_element_namespaceObject.createElement)("span", {
    "aria-hidden": !isURL,
    className: "block-editor-link-control__search-item-info"
  }, !isURL && ((0,external_wp_url_namespaceObject.filterURLForDisplay)((0,external_wp_url_namespaceObject.safeDecodeURI)(suggestion.url)) || ''), isURL && (0,external_wp_i18n_namespaceObject.__)('Press ENTER to add this link'))), shouldShowType && suggestion.type && (0,external_wp_element_namespaceObject.createElement)("span", {
    className: "block-editor-link-control__search-item-type"
  }, getVisualTypeName(suggestion)));
};

function getVisualTypeName(suggestion) {
  if (suggestion.isFrontPage) {
    return 'front page';
  } // Rename 'post_tag' to 'tag'. Ideally, the API would return the localised CPT or taxonomy label.


  return suggestion.type === 'post_tag' ? 'tag' : suggestion.type;
}

/* harmony default export */ var search_item = (LinkControlSearchItem);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/link-control/constants.js
/**
 * WordPress dependencies
 */
 // Used as a unique identifier for the "Create" option within search results.
// Used to help distinguish the "Create" suggestion within the search results in
// order to handle it as a unique case.

const CREATE_TYPE = '__CREATE__';
const DEFAULT_LINK_SETTINGS = [{
  id: 'opensInNewTab',
  title: (0,external_wp_i18n_namespaceObject.__)('Open in new tab')
}];

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/link-control/search-results.js


/**
 * WordPress dependencies
 */


/**
 * External dependencies
 */



/**
 * Internal dependencies
 */




function LinkControlSearchResults(_ref) {
  let {
    instanceId,
    withCreateSuggestion,
    currentInputValue,
    handleSuggestionClick,
    suggestionsListProps,
    buildSuggestionItemProps,
    suggestions,
    selectedSuggestion,
    isLoading,
    isInitialSuggestions,
    createSuggestionButtonText,
    suggestionsQuery
  } = _ref;
  const resultsListClasses = classnames_default()('block-editor-link-control__search-results', {
    'is-loading': isLoading
  });
  const directLinkEntryTypes = ['url', 'mailto', 'tel', 'internal'];
  const isSingleDirectEntryResult = suggestions.length === 1 && directLinkEntryTypes.includes(suggestions[0].type.toLowerCase());
  const shouldShowCreateSuggestion = withCreateSuggestion && !isSingleDirectEntryResult && !isInitialSuggestions; // If the query has a specified type, then we can skip showing them in the result. See #24839.

  const shouldShowSuggestionsTypes = !(suggestionsQuery !== null && suggestionsQuery !== void 0 && suggestionsQuery.type); // According to guidelines aria-label should be added if the label
  // itself is not visible.
  // See: https://developer.mozilla.org/en-US/docs/Web/Accessibility/ARIA/Roles/listbox_role

  const searchResultsLabelId = `block-editor-link-control-search-results-label-${instanceId}`;
  const labelText = isInitialSuggestions ? (0,external_wp_i18n_namespaceObject.__)('Recently updated') : (0,external_wp_i18n_namespaceObject.sprintf)(
  /* translators: %s: search term. */
  (0,external_wp_i18n_namespaceObject.__)('Search results for "%s"'), currentInputValue); // VisuallyHidden rightly doesn't accept custom classNames
  // so we conditionally render it as a wrapper to visually hide the label
  // when that is required.

  const searchResultsLabel = (0,external_wp_element_namespaceObject.createElement)(isInitialSuggestions ? external_wp_element_namespaceObject.Fragment : external_wp_components_namespaceObject.VisuallyHidden, {}, // Empty props.
  (0,external_wp_element_namespaceObject.createElement)("span", {
    className: "block-editor-link-control__search-results-label",
    id: searchResultsLabelId
  }, labelText));
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-link-control__search-results-wrapper"
  }, searchResultsLabel, (0,external_wp_element_namespaceObject.createElement)("div", _extends({}, suggestionsListProps, {
    className: resultsListClasses,
    "aria-labelledby": searchResultsLabelId
  }), suggestions.map((suggestion, index) => {
    if (shouldShowCreateSuggestion && CREATE_TYPE === suggestion.type) {
      return (0,external_wp_element_namespaceObject.createElement)(search_create_button, {
        searchTerm: currentInputValue,
        buttonText: createSuggestionButtonText,
        onClick: () => handleSuggestionClick(suggestion) // Intentionally only using `type` here as
        // the constant is enough to uniquely
        // identify the single "CREATE" suggestion.
        ,
        key: suggestion.type,
        itemProps: buildSuggestionItemProps(suggestion, index),
        isSelected: index === selectedSuggestion
      });
    } // If we're not handling "Create" suggestions above then
    // we don't want them in the main results so exit early.


    if (CREATE_TYPE === suggestion.type) {
      return null;
    }

    return (0,external_wp_element_namespaceObject.createElement)(search_item, {
      key: `${suggestion.id}-${suggestion.type}`,
      itemProps: buildSuggestionItemProps(suggestion, index),
      suggestion: suggestion,
      index: index,
      onClick: () => {
        handleSuggestionClick(suggestion);
      },
      isSelected: index === selectedSuggestion,
      isURL: directLinkEntryTypes.includes(suggestion.type.toLowerCase()),
      searchTerm: currentInputValue,
      shouldShowType: shouldShowSuggestionsTypes,
      isFrontPage: suggestion === null || suggestion === void 0 ? void 0 : suggestion.isFrontPage
    });
  })));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/link-control/is-url-like.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */


/**
 * Determines whether a given value could be a URL. Note this does not
 * guarantee the value is a URL only that it looks like it might be one. For
 * example, just because a string has `www.` in it doesn't make it a URL,
 * but it does make it highly likely that it will be so in the context of
 * creating a link it makes sense to treat it like one.
 *
 * @param {string} val the candidate for being URL-like (or not).
 *
 * @return {boolean} whether or not the value is potentially a URL.
 */

function isURLLike(val) {
  const isInternal = (0,external_lodash_namespaceObject.startsWith)(val, '#');
  return (0,external_wp_url_namespaceObject.isURL)(val) || val && val.includes('www.') || isInternal;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/link-control/use-search-handler.js
/**
 * WordPress dependencies
 */



/**
 * External dependencies
 */


/**
 * Internal dependencies
 */




const handleNoop = () => Promise.resolve([]);
const handleDirectEntry = val => {
  let type = 'URL';
  const protocol = (0,external_wp_url_namespaceObject.getProtocol)(val) || '';

  if (protocol.includes('mailto')) {
    type = 'mailto';
  }

  if (protocol.includes('tel')) {
    type = 'tel';
  }

  if ((0,external_lodash_namespaceObject.startsWith)(val, '#')) {
    type = 'internal';
  }

  return Promise.resolve([{
    id: val,
    title: val,
    url: type === 'URL' ? (0,external_wp_url_namespaceObject.prependHTTP)(val) : val,
    type
  }]);
};

const handleEntitySearch = async (val, suggestionsQuery, fetchSearchSuggestions, directEntryHandler, withCreateSuggestion, withURLSuggestion, pageOnFront) => {
  const {
    isInitialSuggestions
  } = suggestionsQuery;
  let resultsIncludeFrontPage = false;
  let results = await Promise.all([fetchSearchSuggestions(val, suggestionsQuery), directEntryHandler(val)]); // Identify front page and update type to match.

  results[0] = results[0].map(result => {
    if (Number(result.id) === pageOnFront) {
      resultsIncludeFrontPage = true;
      result.isFrontPage = true;
      return result;
    }

    return result;
  });
  const couldBeURL = !val.includes(' '); // If it's potentially a URL search then concat on a URL search suggestion
  // just for good measure. That way once the actual results run out we always
  // have a URL option to fallback on.

  if (!resultsIncludeFrontPage && couldBeURL && withURLSuggestion && !isInitialSuggestions) {
    results = results[0].concat(results[1]);
  } else {
    results = results[0];
  } // If displaying initial suggestions just return plain results.


  if (isInitialSuggestions) {
    return results;
  } // Here we append a faux suggestion to represent a "CREATE" option. This
  // is detected in the rendering of the search results and handled as a
  // special case. This is currently necessary because the suggestions
  // dropdown will only appear if there are valid suggestions and
  // therefore unless the create option is a suggestion it will not
  // display in scenarios where there are no results returned from the
  // API. In addition promoting CREATE to a first class suggestion affords
  // the a11y benefits afforded by `URLInput` to all suggestions (eg:
  // keyboard handling, ARIA roles...etc).
  //
  // Note also that the value of the `title` and `url` properties must correspond
  // to the text value of the `<input>`. This is because `title` is used
  // when creating the suggestion. Similarly `url` is used when using keyboard to select
  // the suggestion (the <form> `onSubmit` handler falls-back to `url`).


  return isURLLike(val) || !withCreateSuggestion ? results : results.concat({
    // the `id` prop is intentionally ommitted here because it
    // is never exposed as part of the component's public API.
    // see: https://github.com/WordPress/gutenberg/pull/19775#discussion_r378931316.
    title: val,
    // Must match the existing `<input>`s text value.
    url: val,
    // Must match the existing `<input>`s text value.
    type: CREATE_TYPE
  });
};

function useSearchHandler(suggestionsQuery, allowDirectEntry, withCreateSuggestion, withURLSuggestion) {
  const {
    fetchSearchSuggestions,
    pageOnFront
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getSettings
    } = select(store);
    return {
      pageOnFront: getSettings().pageOnFront,
      fetchSearchSuggestions: getSettings().__experimentalFetchLinkSuggestions
    };
  }, []);
  const directEntryHandler = allowDirectEntry ? handleDirectEntry : handleNoop;
  return (0,external_wp_element_namespaceObject.useCallback)((val, _ref) => {
    let {
      isInitialSuggestions
    } = _ref;
    return isURLLike(val) ? directEntryHandler(val, {
      isInitialSuggestions
    }) : handleEntitySearch(val, { ...suggestionsQuery,
      isInitialSuggestions
    }, fetchSearchSuggestions, directEntryHandler, withCreateSuggestion, withURLSuggestion, pageOnFront);
  }, [directEntryHandler, fetchSearchSuggestions, withCreateSuggestion]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/link-control/search-input.js


/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */




 // Must be a function as otherwise URLInput will default
// to the fetchLinkSuggestions passed in block editor settings
// which will cause an unintended http request.

const noopSearchHandler = () => Promise.resolve([]);

const LinkControlSearchInput = (0,external_wp_element_namespaceObject.forwardRef)((_ref, ref) => {
  let {
    value,
    children,
    currentLink = {},
    className = null,
    placeholder = null,
    withCreateSuggestion = false,
    onCreateSuggestion = external_lodash_namespaceObject.noop,
    onChange = external_lodash_namespaceObject.noop,
    onSelect = external_lodash_namespaceObject.noop,
    showSuggestions = true,
    renderSuggestions = props => (0,external_wp_element_namespaceObject.createElement)(LinkControlSearchResults, props),
    fetchSuggestions = null,
    allowDirectEntry = true,
    showInitialSuggestions = false,
    suggestionsQuery = {},
    withURLSuggestion = true,
    createSuggestionButtonText,
    useLabel = false
  } = _ref;
  const genericSearchHandler = useSearchHandler(suggestionsQuery, allowDirectEntry, withCreateSuggestion, withURLSuggestion);
  const searchHandler = showSuggestions ? fetchSuggestions || genericSearchHandler : noopSearchHandler;
  const instanceId = (0,external_wp_compose_namespaceObject.useInstanceId)(LinkControlSearchInput);
  const [focusedSuggestion, setFocusedSuggestion] = (0,external_wp_element_namespaceObject.useState)();
  /**
   * Handles the user moving between different suggestions. Does not handle
   * choosing an individual item.
   *
   * @param {string} selection  the url of the selected suggestion.
   * @param {Object} suggestion the suggestion object.
   */

  const onInputChange = (selection, suggestion) => {
    onChange(selection);
    setFocusedSuggestion(suggestion);
  };

  const handleRenderSuggestions = props => renderSuggestions({ ...props,
    instanceId,
    withCreateSuggestion,
    currentInputValue: value,
    createSuggestionButtonText,
    suggestionsQuery,
    handleSuggestionClick: suggestion => {
      if (props.handleSuggestionClick) {
        props.handleSuggestionClick(suggestion);
      }

      onSuggestionSelected(suggestion);
    }
  });

  const onSuggestionSelected = async selectedSuggestion => {
    let suggestion = selectedSuggestion;

    if (CREATE_TYPE === selectedSuggestion.type) {
      // Create a new page and call onSelect with the output from the onCreateSuggestion callback.
      try {
        var _suggestion;

        suggestion = await onCreateSuggestion(selectedSuggestion.title);

        if ((_suggestion = suggestion) !== null && _suggestion !== void 0 && _suggestion.url) {
          onSelect(suggestion);
        }
      } catch (e) {}

      return;
    }

    if (allowDirectEntry || suggestion && Object.keys(suggestion).length >= 1) {
      onSelect( // Some direct entries don't have types or IDs, and we still need to clear the previous ones.
      { ...(0,external_lodash_namespaceObject.omit)(currentLink, 'id', 'url'),
        ...suggestion
      }, suggestion);
    }
  };

  const inputClasses = classnames_default()(className, {
    'has-no-label': !useLabel
  });
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-link-control__search-input-container"
  }, (0,external_wp_element_namespaceObject.createElement)(url_input, {
    label: useLabel ? 'URL' : undefined,
    className: inputClasses,
    value: value,
    onChange: onInputChange,
    placeholder: placeholder !== null && placeholder !== void 0 ? placeholder : (0,external_wp_i18n_namespaceObject.__)('Search or type url'),
    __experimentalRenderSuggestions: showSuggestions ? handleRenderSuggestions : null,
    __experimentalFetchLinkSuggestions: searchHandler,
    __experimentalHandleURLSuggestions: true,
    __experimentalShowInitialSuggestions: showInitialSuggestions,
    onSubmit: (suggestion, event) => {
      var _value$trim;

      const hasSuggestion = suggestion || focusedSuggestion; // If there is no suggestion and the value (ie: any manually entered URL) is empty
      // then don't allow submission otherwise we get empty links.

      if (!hasSuggestion && !(value !== null && value !== void 0 && (_value$trim = value.trim()) !== null && _value$trim !== void 0 && _value$trim.length)) {
        event.preventDefault();
      } else {
        onSuggestionSelected(hasSuggestion || {
          url: value
        });
      }
    },
    ref: ref
  }), children);
});
/* harmony default export */ var search_input = (LinkControlSearchInput);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/info.js


/**
 * WordPress dependencies
 */

const info = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M12 3.2c-4.8 0-8.8 3.9-8.8 8.8 0 4.8 3.9 8.8 8.8 8.8 4.8 0 8.8-3.9 8.8-8.8 0-4.8-4-8.8-8.8-8.8zm0 16c-4 0-7.2-3.3-7.2-7.2C4.8 8 8 4.8 12 4.8s7.2 3.3 7.2 7.2c0 4-3.2 7.2-7.2 7.2zM11 17h2v-6h-2v6zm0-8h2V7h-2v2z"
}));
/* harmony default export */ var library_info = (info);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/pencil.js


/**
 * WordPress dependencies
 */

const pencil = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M20.1 5.1L16.9 2 6.2 12.7l-1.3 4.4 4.5-1.3L20.1 5.1zM4 20.8h8v-1.5H4v1.5z"
}));
/* harmony default export */ var library_pencil = (pencil);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/edit.js
/**
 * Internal dependencies
 */

/* harmony default export */ var library_edit = (library_pencil);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/link-control/viewer-slot.js
/**
 * WordPress dependencies
 */

const {
  Slot: ViewerSlot,
  Fill: ViewerFill
} = (0,external_wp_components_namespaceObject.createSlotFill)('BlockEditorLinkControlViewer');

/* harmony default export */ var viewer_slot = ((/* unused pure expression or super */ null && (ViewerSlot)));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/link-control/use-rich-url-data.js
/**
 * Internal dependencies
 */

/**
 * WordPress dependencies
 */




function use_rich_url_data_reducer(state, action) {
  switch (action.type) {
    case 'RESOLVED':
      return { ...state,
        isFetching: false,
        richData: action.richData
      };

    case 'ERROR':
      return { ...state,
        isFetching: false,
        richData: null
      };

    case 'LOADING':
      return { ...state,
        isFetching: true
      };

    default:
      throw new Error(`Unexpected action type ${action.type}`);
  }
}

function useRemoteUrlData(url) {
  const [state, dispatch] = (0,external_wp_element_namespaceObject.useReducer)(use_rich_url_data_reducer, {
    richData: null,
    isFetching: false
  });
  const {
    fetchRichUrlData
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getSettings
    } = select(store);
    return {
      fetchRichUrlData: getSettings().__experimentalFetchRichUrlData
    };
  }, []);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    // Only make the request if we have an actual URL
    // and the fetching util is available. In some editors
    // there may not be such a util.
    if (url !== null && url !== void 0 && url.length && fetchRichUrlData && typeof AbortController !== 'undefined') {
      dispatch({
        type: 'LOADING'
      });
      const controller = new window.AbortController();
      const signal = controller.signal;
      fetchRichUrlData(url, {
        signal
      }).then(urlData => {
        dispatch({
          type: 'RESOLVED',
          richData: urlData
        });
      }).catch(() => {
        // Avoid setting state on unmounted component
        if (!signal.aborted) {
          dispatch({
            type: 'ERROR'
          });
        }
      }); // Cleanup: when the URL changes the abort the current request.

      return () => {
        controller.abort();
      };
    }
  }, [url]);
  return state;
}

/* harmony default export */ var use_rich_url_data = (useRemoteUrlData);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/link-control/link-preview.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */



function LinkPreview(_ref) {
  var _value$url;

  let {
    value,
    onEditClick,
    hasRichPreviews = false,
    hasUnlinkControl = false,
    onRemove
  } = _ref;
  // Avoid fetching if rich previews are not desired.
  const showRichPreviews = hasRichPreviews ? value === null || value === void 0 ? void 0 : value.url : null;
  const {
    richData,
    isFetching
  } = use_rich_url_data(showRichPreviews); // Rich data may be an empty object so test for that.

  const hasRichData = richData && Object.keys(richData).length;
  const displayURL = value && (0,external_wp_url_namespaceObject.filterURLForDisplay)((0,external_wp_url_namespaceObject.safeDecodeURI)(value.url), 16) || '';
  const displayTitle = (richData === null || richData === void 0 ? void 0 : richData.title) || (value === null || value === void 0 ? void 0 : value.title) || displayURL; // url can be undefined if the href attribute is unset

  const isEmptyURL = !(value !== null && value !== void 0 && (_value$url = value.url) !== null && _value$url !== void 0 && _value$url.length);
  let icon;

  if (richData !== null && richData !== void 0 && richData.icon) {
    icon = (0,external_wp_element_namespaceObject.createElement)("img", {
      src: richData === null || richData === void 0 ? void 0 : richData.icon,
      alt: ""
    });
  } else if (isEmptyURL) {
    icon = (0,external_wp_element_namespaceObject.createElement)(build_module_icon, {
      icon: library_info,
      size: 32
    });
  } else {
    icon = (0,external_wp_element_namespaceObject.createElement)(build_module_icon, {
      icon: library_globe
    });
  }

  return (0,external_wp_element_namespaceObject.createElement)("div", {
    "aria-label": (0,external_wp_i18n_namespaceObject.__)('Currently selected'),
    "aria-selected": "true",
    className: classnames_default()('block-editor-link-control__search-item', {
      'is-current': true,
      'is-rich': hasRichData,
      'is-fetching': !!isFetching,
      'is-preview': true,
      'is-error': isEmptyURL
    })
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-link-control__search-item-top"
  }, (0,external_wp_element_namespaceObject.createElement)("span", {
    className: "block-editor-link-control__search-item-header"
  }, (0,external_wp_element_namespaceObject.createElement)("span", {
    className: classnames_default()('block-editor-link-control__search-item-icon', {
      'is-image': richData === null || richData === void 0 ? void 0 : richData.icon
    })
  }, icon), (0,external_wp_element_namespaceObject.createElement)("span", {
    className: "block-editor-link-control__search-item-details"
  }, !isEmptyURL ? (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ExternalLink, {
    className: "block-editor-link-control__search-item-title",
    href: value.url
  }, (0,external_wp_dom_namespaceObject.__unstableStripHTML)(displayTitle)), (value === null || value === void 0 ? void 0 : value.url) && (0,external_wp_element_namespaceObject.createElement)("span", {
    className: "block-editor-link-control__search-item-info"
  }, displayURL)) : (0,external_wp_element_namespaceObject.createElement)("span", {
    className: "block-editor-link-control__search-item-error-notice"
  }, (0,external_wp_i18n_namespaceObject.__)('Link is empty')))), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    icon: library_edit,
    label: (0,external_wp_i18n_namespaceObject.__)('Edit'),
    className: "block-editor-link-control__search-item-action",
    onClick: onEditClick,
    iconSize: 24
  }), hasUnlinkControl && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    icon: link_off,
    label: (0,external_wp_i18n_namespaceObject.__)('Unlink'),
    className: "block-editor-link-control__search-item-action block-editor-link-control__unlink",
    onClick: onRemove,
    iconSize: 24
  }), (0,external_wp_element_namespaceObject.createElement)(ViewerSlot, {
    fillProps: value
  })), (hasRichData && ((richData === null || richData === void 0 ? void 0 : richData.image) || (richData === null || richData === void 0 ? void 0 : richData.description)) || isFetching) && (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-link-control__search-item-bottom"
  }, ((richData === null || richData === void 0 ? void 0 : richData.image) || isFetching) && (0,external_wp_element_namespaceObject.createElement)("div", {
    "aria-hidden": !(richData !== null && richData !== void 0 && richData.image),
    className: classnames_default()('block-editor-link-control__search-item-image', {
      'is-placeholder': !(richData !== null && richData !== void 0 && richData.image)
    })
  }, (richData === null || richData === void 0 ? void 0 : richData.image) && (0,external_wp_element_namespaceObject.createElement)("img", {
    src: richData === null || richData === void 0 ? void 0 : richData.image,
    alt: ""
  })), ((richData === null || richData === void 0 ? void 0 : richData.description) || isFetching) && (0,external_wp_element_namespaceObject.createElement)("div", {
    "aria-hidden": !(richData !== null && richData !== void 0 && richData.description),
    className: classnames_default()('block-editor-link-control__search-item-description', {
      'is-placeholder': !(richData !== null && richData !== void 0 && richData.description)
    })
  }, (richData === null || richData === void 0 ? void 0 : richData.description) && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalText, {
    truncate: true,
    numberOfLines: "2"
  }, richData.description))));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/link-control/use-create-page.js
/**
 * WordPress dependencies
 */


function useCreatePage(handleCreatePage) {
  const cancelableCreateSuggestion = (0,external_wp_element_namespaceObject.useRef)();
  const [isCreatingPage, setIsCreatingPage] = (0,external_wp_element_namespaceObject.useState)(false);
  const [errorMessage, setErrorMessage] = (0,external_wp_element_namespaceObject.useState)(null);

  const createPage = async function (suggestionTitle) {
    setIsCreatingPage(true);
    setErrorMessage(null);

    try {
      // Make cancellable in order that we can avoid setting State
      // if the component unmounts during the call to `createSuggestion`
      cancelableCreateSuggestion.current = makeCancelable( // Using Promise.resolve to allow createSuggestion to return a
      // non-Promise based value.
      Promise.resolve(handleCreatePage(suggestionTitle)));
      return await cancelableCreateSuggestion.current.promise;
    } catch (error) {
      if (error && error.isCanceled) {
        return; // bail if canceled to avoid setting state
      }

      setErrorMessage(error.message || (0,external_wp_i18n_namespaceObject.__)('An unknown error occurred during creation. Please try again.'));
      throw error;
    } finally {
      setIsCreatingPage(false);
    }
  };
  /**
   * Handles cancelling any pending Promises that have been made cancelable.
   */


  (0,external_wp_element_namespaceObject.useEffect)(() => {
    return () => {
      // componentDidUnmount
      if (cancelableCreateSuggestion.current) {
        cancelableCreateSuggestion.current.cancel();
      }
    };
  }, []);
  return {
    createPage,
    isCreatingPage,
    errorMessage
  };
}
/**
 * Creates a wrapper around a promise which allows it to be programmatically
 * cancelled.
 * See: https://reactjs.org/blog/2015/12/16/ismounted-antipattern.html
 *
 * @param {Promise} promise the Promise to make cancelable
 */

const makeCancelable = promise => {
  let hasCanceled_ = false;
  const wrappedPromise = new Promise((resolve, reject) => {
    promise.then(val => hasCanceled_ ? reject({
      isCanceled: true
    }) : resolve(val), error => hasCanceled_ ? reject({
      isCanceled: true
    }) : reject(error));
  });
  return {
    promise: wrappedPromise,

    cancel() {
      hasCanceled_ = true;
    }

  };
};

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/link-control/index.js


/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */







/**
 * Internal dependencies
 */







/**
 * Default properties associated with a link control value.
 *
 * @typedef WPLinkControlDefaultValue
 *
 * @property {string}   url           Link URL.
 * @property {string=}  title         Link title.
 * @property {boolean=} opensInNewTab Whether link should open in a new browser
 *                                    tab. This value is only assigned if not
 *                                    providing a custom `settings` prop.
 */

/* eslint-disable jsdoc/valid-types */

/**
 * Custom settings values associated with a link.
 *
 * @typedef {{[setting:string]:any}} WPLinkControlSettingsValue
 */

/* eslint-enable */

/**
 * Custom settings values associated with a link.
 *
 * @typedef WPLinkControlSetting
 *
 * @property {string} id    Identifier to use as property for setting value.
 * @property {string} title Human-readable label to show in user interface.
 */

/**
 * Properties associated with a link control value, composed as a union of the
 * default properties and any custom settings values.
 *
 * @typedef {WPLinkControlDefaultValue&WPLinkControlSettingsValue} WPLinkControlValue
 */

/** @typedef {(nextValue:WPLinkControlValue)=>void} WPLinkControlOnChangeProp */

/**
 * Properties associated with a search suggestion used within the LinkControl.
 *
 * @typedef WPLinkControlSuggestion
 *
 * @property {string} id    Identifier to use to uniquely identify the suggestion.
 * @property {string} type  Identifies the type of the suggestion (eg: `post`,
 *                          `page`, `url`...etc)
 * @property {string} title Human-readable label to show in user interface.
 * @property {string} url   A URL for the suggestion.
 */

/** @typedef {(title:string)=>WPLinkControlSuggestion} WPLinkControlCreateSuggestionProp */

/**
 * @typedef WPLinkControlProps
 *
 * @property {(WPLinkControlSetting[])=}  settings                   An array of settings objects. Each object will used to
 *                                                                   render a `ToggleControl` for that setting.
 * @property {boolean=}                   forceIsEditingLink         If passed as either `true` or `false`, controls the
 *                                                                   internal editing state of the component to respective
 *                                                                   show or not show the URL input field.
 * @property {WPLinkControlValue=}        value                      Current link value.
 * @property {WPLinkControlOnChangeProp=} onChange                   Value change handler, called with the updated value if
 *                                                                   the user selects a new link or updates settings.
 * @property {boolean=}                   noDirectEntry              Whether to allow turning a URL-like search query directly into a link.
 * @property {boolean=}                   showSuggestions            Whether to present suggestions when typing the URL.
 * @property {boolean=}                   showInitialSuggestions     Whether to present initial suggestions immediately.
 * @property {boolean=}                   withCreateSuggestion       Whether to allow creation of link value from suggestion.
 * @property {Object=}                    suggestionsQuery           Query parameters to pass along to wp.blockEditor.__experimentalFetchLinkSuggestions.
 * @property {boolean=}                   noURLSuggestion            Whether to add a fallback suggestion which treats the search query as a URL.
 * @property {string|Function|undefined}  createSuggestionButtonText The text to use in the button that calls createSuggestion.
 * @property {Function}                   renderControlBottom        Optional controls to be rendered at the bottom of the component.
 */

/**
 * Renders a link control. A link control is a controlled input which maintains
 * a value associated with a link (HTML anchor element) and relevant settings
 * for how that link is expected to behave.
 *
 * @param {WPLinkControlProps} props Component props.
 */

function LinkControl(_ref) {
  var _currentInputValue$tr, _value$url, _value$url$trim;

  let {
    searchInputPlaceholder,
    value,
    settings = DEFAULT_LINK_SETTINGS,
    onChange = external_lodash_namespaceObject.noop,
    onRemove,
    noDirectEntry = false,
    showSuggestions = true,
    showInitialSuggestions,
    forceIsEditingLink,
    createSuggestion,
    withCreateSuggestion,
    inputValue: propInputValue = '',
    suggestionsQuery = {},
    noURLSuggestion = false,
    createSuggestionButtonText,
    hasRichPreviews = false,
    hasTextControl = false,
    renderControlBottom = null
  } = _ref;

  if (withCreateSuggestion === undefined && createSuggestion) {
    withCreateSuggestion = true;
  }

  const isMounting = (0,external_wp_element_namespaceObject.useRef)(true);
  const wrapperNode = (0,external_wp_element_namespaceObject.useRef)();
  const textInputRef = (0,external_wp_element_namespaceObject.useRef)();
  const [internalInputValue, setInternalInputValue] = (0,external_wp_element_namespaceObject.useState)((value === null || value === void 0 ? void 0 : value.url) || '');
  const [internalTextValue, setInternalTextValue] = (0,external_wp_element_namespaceObject.useState)((value === null || value === void 0 ? void 0 : value.title) || '');
  const currentInputValue = propInputValue || internalInputValue;
  const [isEditingLink, setIsEditingLink] = (0,external_wp_element_namespaceObject.useState)(forceIsEditingLink !== undefined ? forceIsEditingLink : !value || !value.url);
  const isEndingEditWithFocus = (0,external_wp_element_namespaceObject.useRef)(false);
  const currentInputIsEmpty = !(currentInputValue !== null && currentInputValue !== void 0 && (_currentInputValue$tr = currentInputValue.trim()) !== null && _currentInputValue$tr !== void 0 && _currentInputValue$tr.length);
  const {
    createPage,
    isCreatingPage,
    errorMessage
  } = useCreatePage(createSuggestion);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    if (forceIsEditingLink !== undefined && forceIsEditingLink !== isEditingLink) {
      setIsEditingLink(forceIsEditingLink);
    }
  }, [forceIsEditingLink]);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    // We don't auto focus into the Link UI on mount
    // because otherwise using the keyboard to select text
    // *within* the link format is not possible.
    if (isMounting.current) {
      isMounting.current = false;
      return;
    } // Unless we are mounting, we always want to focus either:
    // - the URL input
    // - the first focusable element in the Link UI.
    // But in editing mode if there is a text input present then
    // the URL input is at index 1. If not then it is at index 0.


    const whichFocusTargetIndex = textInputRef !== null && textInputRef !== void 0 && textInputRef.current ? 1 : 0; // Scenario - when:
    // - switching between editable and non editable LinkControl
    // - clicking on a link
    // ...then move focus to the *first* element to avoid focus loss
    // and to ensure focus is *within* the Link UI.

    const nextFocusTarget = external_wp_dom_namespaceObject.focus.focusable.find(wrapperNode.current)[whichFocusTargetIndex] || wrapperNode.current;
    nextFocusTarget.focus();
    isEndingEditWithFocus.current = false;
  }, [isEditingLink, isCreatingPage]);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    /**
     * If the value's `text` property changes then sync this
     * back up with state.
     */
    if (value !== null && value !== void 0 && value.title && value.title !== internalTextValue) {
      setInternalTextValue(value.title);
    }
    /**
     * Update the state value internalInputValue if the url value changes
     * for example when clicking on another anchor
     */


    if (value !== null && value !== void 0 && value.url) {
      setInternalInputValue(value.url);
    }
  }, [value]);
  /**
   * Cancels editing state and marks that focus may need to be restored after
   * the next render, if focus was within the wrapper when editing finished.
   */

  function stopEditing() {
    var _wrapperNode$current;

    isEndingEditWithFocus.current = !!((_wrapperNode$current = wrapperNode.current) !== null && _wrapperNode$current !== void 0 && _wrapperNode$current.contains(wrapperNode.current.ownerDocument.activeElement));
    setIsEditingLink(false);
  }

  const handleSelectSuggestion = updatedValue => {
    onChange({ ...updatedValue,
      title: internalTextValue || (updatedValue === null || updatedValue === void 0 ? void 0 : updatedValue.title)
    });
    stopEditing();
  };

  const handleSubmit = () => {
    if (currentInputValue !== (value === null || value === void 0 ? void 0 : value.url) || internalTextValue !== (value === null || value === void 0 ? void 0 : value.title)) {
      onChange({
        url: currentInputValue,
        title: internalTextValue
      });
    }

    stopEditing();
  };

  const handleSubmitWithEnter = event => {
    const {
      keyCode
    } = event;

    if (keyCode === external_wp_keycodes_namespaceObject.ENTER && !currentInputIsEmpty // Disallow submitting empty values.
    ) {
      event.preventDefault();
      handleSubmit();
    }
  };

  const shownUnlinkControl = onRemove && value && !isEditingLink && !isCreatingPage;
  const showSettingsDrawer = !!(settings !== null && settings !== void 0 && settings.length); // Only show text control once a URL value has been committed
  // and it isn't just empty whitespace.
  // See https://github.com/WordPress/gutenberg/pull/33849/#issuecomment-932194927.

  const showTextControl = (value === null || value === void 0 ? void 0 : (_value$url = value.url) === null || _value$url === void 0 ? void 0 : (_value$url$trim = _value$url.trim()) === null || _value$url$trim === void 0 ? void 0 : _value$url$trim.length) > 0 && hasTextControl;
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    tabIndex: -1,
    ref: wrapperNode,
    className: "block-editor-link-control"
  }, isCreatingPage && (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-link-control__loading"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Spinner, null), " ", (0,external_wp_i18n_namespaceObject.__)('Creating'), "\u2026"), (isEditingLink || !value) && !isCreatingPage && (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: classnames_default()({
      'block-editor-link-control__search-input-wrapper': true,
      'has-text-control': showTextControl
    })
  }, showTextControl && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.TextControl, {
    ref: textInputRef,
    className: "block-editor-link-control__field block-editor-link-control__text-content",
    label: "Text",
    value: internalTextValue,
    onChange: setInternalTextValue,
    onKeyDown: handleSubmitWithEnter
  }), (0,external_wp_element_namespaceObject.createElement)(search_input, {
    currentLink: value,
    className: "block-editor-link-control__field block-editor-link-control__search-input",
    placeholder: searchInputPlaceholder,
    value: currentInputValue,
    withCreateSuggestion: withCreateSuggestion,
    onCreateSuggestion: createPage,
    onChange: setInternalInputValue,
    onSelect: handleSelectSuggestion,
    showInitialSuggestions: showInitialSuggestions,
    allowDirectEntry: !noDirectEntry,
    showSuggestions: showSuggestions,
    suggestionsQuery: suggestionsQuery,
    withURLSuggestion: !noURLSuggestion,
    createSuggestionButtonText: createSuggestionButtonText,
    useLabel: showTextControl
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-link-control__search-actions"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    onClick: handleSubmit,
    label: (0,external_wp_i18n_namespaceObject.__)('Submit'),
    icon: keyboard_return,
    className: "block-editor-link-control__search-submit",
    disabled: currentInputIsEmpty // Disallow submitting empty values.

  })))), errorMessage && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Notice, {
    className: "block-editor-link-control__search-error",
    status: "error",
    isDismissible: false
  }, errorMessage)), value && !isEditingLink && !isCreatingPage && (0,external_wp_element_namespaceObject.createElement)(LinkPreview, {
    key: value === null || value === void 0 ? void 0 : value.url // force remount when URL changes to avoid race conditions for rich previews
    ,
    value: value,
    onEditClick: () => setIsEditingLink(true),
    hasRichPreviews: hasRichPreviews,
    hasUnlinkControl: shownUnlinkControl,
    onRemove: onRemove
  }), showSettingsDrawer && (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-link-control__tools"
  }, (0,external_wp_element_namespaceObject.createElement)(settings_drawer, {
    value: value,
    settings: settings,
    onChange: onChange
  })), renderControlBottom && renderControlBottom());
}

LinkControl.ViewerFill = ViewerFill;
/* harmony default export */ var link_control = (LinkControl);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/media.js


/**
 * WordPress dependencies
 */

const media = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M18.7 3H5.3C4 3 3 4 3 5.3v13.4C3 20 4 21 5.3 21h13.4c1.3 0 2.3-1 2.3-2.3V5.3C21 4 20 3 18.7 3zm.8 15.7c0 .4-.4.8-.8.8H5.3c-.4 0-.8-.4-.8-.8V5.3c0-.4.4-.8.8-.8h13.4c.4 0 .8.4.8.8v13.4zM10 15l5-3-5-3v6z"
}));
/* harmony default export */ var library_media = (media);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/upload.js


/**
 * WordPress dependencies
 */

const upload = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M18.5 15v3.5H13V6.7l4.5 4.1 1-1.1-6.2-5.8-5.8 5.8 1 1.1 4-4v11.7h-6V15H4v5h16v-5z"
}));
/* harmony default export */ var library_upload = (upload);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/media-upload/index.js
/**
 * WordPress dependencies
 */

/**
 * This is a placeholder for the media upload component necessary to make it possible to provide
 * an integration with the core blocks that handle media files. By default it renders nothing but
 * it provides a way to have it overridden with the `editor.MediaUpload` filter.
 *
 * @return {WPComponent} The component to be rendered.
 */

const MediaUpload = () => null;
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/media-upload/README.md
 */


/* harmony default export */ var media_upload = ((0,external_wp_components_namespaceObject.withFilters)('editor.MediaUpload')(MediaUpload));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/media-upload/check.js
/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */


function MediaUploadCheck(_ref) {
  let {
    fallback = null,
    children
  } = _ref;
  const hasUploadPermissions = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getSettings
    } = select(store);
    return !!getSettings().mediaUpload;
  }, []);
  return hasUploadPermissions ? children : fallback;
}
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/media-upload/README.md
 */

/* harmony default export */ var media_upload_check = (MediaUploadCheck);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/media-replace-flow/index.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */











/**
 * Internal dependencies
 */






const MediaReplaceFlow = _ref => {
  let {
    mediaURL,
    mediaId,
    mediaIds,
    allowedTypes,
    accept,
    onError,
    onSelect,
    onSelectURL,
    onFilesUpload = external_lodash_namespaceObject.noop,
    name = (0,external_wp_i18n_namespaceObject.__)('Replace'),
    createNotice,
    removeNotice,
    children,
    multiple = false,
    addToGallery,
    handleUpload = true
  } = _ref;
  const [mediaURLValue, setMediaURLValue] = (0,external_wp_element_namespaceObject.useState)(mediaURL);
  const mediaUpload = (0,external_wp_data_namespaceObject.useSelect)(select => {
    return select(store).getSettings().mediaUpload;
  }, []);
  const editMediaButtonRef = (0,external_wp_element_namespaceObject.useRef)();
  const errorNoticeID = (0,external_lodash_namespaceObject.uniqueId)('block-editor/media-replace-flow/error-notice/');

  const onUploadError = message => {
    const safeMessage = (0,external_wp_dom_namespaceObject.__unstableStripHTML)(message);

    if (onError) {
      onError(safeMessage);
      return;
    } // We need to set a timeout for showing the notice
    // so that VoiceOver and possibly other screen readers
    // can announce the error afer the toolbar button
    // regains focus once the upload dialog closes.
    // Otherwise VO simply skips over the notice and announces
    // the focused element and the open menu.


    setTimeout(() => {
      createNotice('error', safeMessage, {
        speak: true,
        id: errorNoticeID,
        isDismissible: true
      });
    }, 1000);
  };

  const selectMedia = (media, closeMenu) => {
    closeMenu();
    setMediaURLValue(media === null || media === void 0 ? void 0 : media.url); // Calling `onSelect` after the state update since it might unmount the component.

    onSelect(media);
    (0,external_wp_a11y_namespaceObject.speak)((0,external_wp_i18n_namespaceObject.__)('The media file has been replaced'));
    removeNotice(errorNoticeID);
  };

  const uploadFiles = (event, closeMenu) => {
    const files = event.target.files;

    if (!handleUpload) {
      closeMenu();
      return onSelect(files);
    }

    onFilesUpload(files);
    mediaUpload({
      allowedTypes,
      filesList: files,
      onFileChange: _ref2 => {
        let [media] = _ref2;
        selectMedia(media, closeMenu);
      },
      onError: onUploadError
    });
  };

  const openOnArrowDown = event => {
    if (event.keyCode === external_wp_keycodes_namespaceObject.DOWN) {
      event.preventDefault();
      event.target.click();
    }
  };

  const onlyAllowsImages = () => {
    if (!allowedTypes || allowedTypes.length === 0) {
      return false;
    }

    return allowedTypes.every(allowedType => allowedType === 'image' || allowedType.startsWith('image/'));
  };

  const gallery = multiple && onlyAllowsImages();
  const POPOVER_PROPS = {
    isAlternate: true
  };
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Dropdown, {
    popoverProps: POPOVER_PROPS,
    contentClassName: "block-editor-media-replace-flow__options",
    renderToggle: _ref3 => {
      let {
        isOpen,
        onToggle
      } = _ref3;
      return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarButton, {
        ref: editMediaButtonRef,
        "aria-expanded": isOpen,
        "aria-haspopup": "true",
        onClick: onToggle,
        onKeyDown: openOnArrowDown
      }, name);
    },
    renderContent: _ref4 => {
      let {
        onClose
      } = _ref4;
      return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.NavigableMenu, {
        className: "block-editor-media-replace-flow__media-upload-menu"
      }, (0,external_wp_element_namespaceObject.createElement)(media_upload, {
        gallery: gallery,
        addToGallery: addToGallery,
        multiple: multiple,
        value: multiple ? mediaIds : mediaId,
        onSelect: media => selectMedia(media, onClose),
        allowedTypes: allowedTypes,
        render: _ref5 => {
          let {
            open
          } = _ref5;
          return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
            icon: library_media,
            onClick: open
          }, (0,external_wp_i18n_namespaceObject.__)('Open Media Library'));
        }
      }), (0,external_wp_element_namespaceObject.createElement)(media_upload_check, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.FormFileUpload, {
        onChange: event => {
          uploadFiles(event, onClose);
        },
        accept: accept,
        multiple: multiple,
        render: _ref6 => {
          let {
            openFileDialog
          } = _ref6;
          return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
            icon: library_upload,
            onClick: () => {
              openFileDialog();
            }
          }, (0,external_wp_i18n_namespaceObject.__)('Upload'));
        }
      })), children), onSelectURL && // eslint-disable-next-line jsx-a11y/no-noninteractive-element-interactions
      (0,external_wp_element_namespaceObject.createElement)("form", {
        className: "block-editor-media-flow__url-input"
      }, (0,external_wp_element_namespaceObject.createElement)("span", {
        className: "block-editor-media-replace-flow__image-url-label"
      }, (0,external_wp_i18n_namespaceObject.__)('Current media URL:')), (0,external_wp_element_namespaceObject.createElement)(link_control, {
        value: {
          url: mediaURLValue
        },
        settings: [],
        showSuggestions: false,
        onChange: _ref7 => {
          let {
            url
          } = _ref7;
          setMediaURLValue(url);
          onSelectURL(url);
          editMediaButtonRef.current.focus();
        }
      })));
    }
  });
};
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/media-replace-flow/README.md
 */


/* harmony default export */ var media_replace_flow = ((0,external_wp_compose_namespaceObject.compose)([(0,external_wp_data_namespaceObject.withDispatch)(dispatch => {
  const {
    createNotice,
    removeNotice
  } = dispatch(external_wp_notices_namespaceObject.store);
  return {
    createNotice,
    removeNotice
  };
}), (0,external_wp_components_namespaceObject.withFilters)('editor.MediaReplaceFlow')])(MediaReplaceFlow));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/url-popover/link-viewer-url.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



function LinkViewerURL(_ref) {
  let {
    url,
    urlLabel,
    className
  } = _ref;
  const linkClassName = classnames_default()(className, 'block-editor-url-popover__link-viewer-url');

  if (!url) {
    return (0,external_wp_element_namespaceObject.createElement)("span", {
      className: linkClassName
    });
  }

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ExternalLink, {
    className: linkClassName,
    href: url
  }, urlLabel || (0,external_wp_url_namespaceObject.filterURLForDisplay)((0,external_wp_url_namespaceObject.safeDecodeURI)(url)));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/url-popover/link-viewer.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */


function LinkViewer(_ref) {
  let {
    className,
    linkClassName,
    onEditLinkClick,
    url,
    urlLabel,
    ...props
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)("div", _extends({
    className: classnames_default()('block-editor-url-popover__link-viewer', className)
  }, props), (0,external_wp_element_namespaceObject.createElement)(LinkViewerURL, {
    url: url,
    urlLabel: urlLabel,
    className: linkClassName
  }), onEditLinkClick && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    icon: library_edit,
    label: (0,external_wp_i18n_namespaceObject.__)('Edit'),
    onClick: onEditLinkClick
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/url-popover/link-editor.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */


function LinkEditor(_ref) {
  let {
    autocompleteRef,
    className,
    onChangeInputValue,
    value,
    ...props
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)("form", _extends({
    className: classnames_default()('block-editor-url-popover__link-editor', className)
  }, props), (0,external_wp_element_namespaceObject.createElement)(url_input, {
    value: value,
    onChange: onChangeInputValue,
    autocompleteRef: autocompleteRef
  }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    icon: keyboard_return,
    label: (0,external_wp_i18n_namespaceObject.__)('Apply'),
    type: "submit"
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/url-popover/index.js



/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */




function URLPopover(_ref) {
  let {
    additionalControls,
    children,
    renderSettings,
    position = 'bottom center',
    focusOnMount = 'firstElement',
    ...popoverProps
  } = _ref;
  const [isSettingsExpanded, setIsSettingsExpanded] = (0,external_wp_element_namespaceObject.useState)(false);
  const showSettings = !!renderSettings && isSettingsExpanded;

  const toggleSettingsVisibility = () => {
    setIsSettingsExpanded(!isSettingsExpanded);
  };

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Popover, _extends({
    className: "block-editor-url-popover",
    focusOnMount: focusOnMount,
    position: position
  }, popoverProps), (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-url-popover__input-container"
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-url-popover__row"
  }, children, !!renderSettings && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    className: "block-editor-url-popover__settings-toggle",
    icon: chevron_down,
    label: (0,external_wp_i18n_namespaceObject.__)('Link settings'),
    onClick: toggleSettingsVisibility,
    "aria-expanded": isSettingsExpanded
  })), showSettings && (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-url-popover__row block-editor-url-popover__settings"
  }, renderSettings())), additionalControls && !showSettings && (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-url-popover__additional-controls"
  }, additionalControls));
}

URLPopover.LinkEditor = LinkEditor;
URLPopover.LinkViewer = LinkViewer;
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/url-popover/README.md
 */

/* harmony default export */ var url_popover = (URLPopover);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/media-placeholder/index.js


/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */






const InsertFromURLPopover = _ref => {
  let {
    src,
    onChange,
    onSubmit,
    onClose
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)(url_popover, {
    onClose: onClose
  }, (0,external_wp_element_namespaceObject.createElement)("form", {
    className: "block-editor-media-placeholder__url-input-form",
    onSubmit: onSubmit
  }, (0,external_wp_element_namespaceObject.createElement)("input", {
    className: "block-editor-media-placeholder__url-input-field",
    type: "text",
    "aria-label": (0,external_wp_i18n_namespaceObject.__)('URL'),
    placeholder: (0,external_wp_i18n_namespaceObject.__)('Paste or type URL'),
    onChange: onChange,
    value: src
  }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    className: "block-editor-media-placeholder__url-input-submit-button",
    icon: keyboard_return,
    label: (0,external_wp_i18n_namespaceObject.__)('Apply'),
    type: "submit"
  })));
};

function MediaPlaceholder(_ref2) {
  let {
    value = {},
    allowedTypes,
    className,
    icon,
    labels = {},
    mediaPreview,
    notices,
    isAppender,
    accept,
    addToGallery,
    multiple = false,
    handleUpload = true,
    disableDropZone,
    disableMediaButtons,
    onError,
    onSelect,
    onCancel,
    onSelectURL,
    onDoubleClick,
    onFilesPreUpload = external_lodash_namespaceObject.noop,
    onHTMLDrop = external_lodash_namespaceObject.noop,
    children,
    mediaLibraryButton,
    placeholder,
    style
  } = _ref2;
  const mediaUpload = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getSettings
    } = select(store);
    return getSettings().mediaUpload;
  }, []);
  const [src, setSrc] = (0,external_wp_element_namespaceObject.useState)('');
  const [isURLInputVisible, setIsURLInputVisible] = (0,external_wp_element_namespaceObject.useState)(false);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    var _value$src;

    setSrc((_value$src = value === null || value === void 0 ? void 0 : value.src) !== null && _value$src !== void 0 ? _value$src : '');
  }, [value === null || value === void 0 ? void 0 : value.src]);

  const onlyAllowsImages = () => {
    if (!allowedTypes || allowedTypes.length === 0) {
      return false;
    }

    return allowedTypes.every(allowedType => allowedType === 'image' || allowedType.startsWith('image/'));
  };

  const onChangeSrc = event => {
    setSrc(event.target.value);
  };

  const openURLInput = () => {
    setIsURLInputVisible(true);
  };

  const closeURLInput = () => {
    setIsURLInputVisible(false);
  };

  const onSubmitSrc = event => {
    event.preventDefault();

    if (src && onSelectURL) {
      onSelectURL(src);
      closeURLInput();
    }
  };

  const onFilesUpload = files => {
    if (!handleUpload) {
      return onSelect(files);
    }

    onFilesPreUpload(files);
    let setMedia;

    if (multiple) {
      if (addToGallery) {
        // Since the setMedia function runs multiple times per upload group
        // and is passed newMedia containing every item in its group each time, we must
        // filter out whatever this upload group had previously returned to the
        // gallery before adding and returning the image array with replacement newMedia
        // values.
        // Define an array to store urls from newMedia between subsequent function calls.
        let lastMediaPassed = [];

        setMedia = newMedia => {
          // Remove any images this upload group is responsible for (lastMediaPassed).
          // Their replacements are contained in newMedia.
          const filteredMedia = (value !== null && value !== void 0 ? value : []).filter(item => {
            // If Item has id, only remove it if lastMediaPassed has an item with that id.
            if (item.id) {
              return !lastMediaPassed.some( // Be sure to convert to number for comparison.
              _ref3 => {
                let {
                  id
                } = _ref3;
                return Number(id) === Number(item.id);
              });
            } // Compare transient images via .includes since gallery may append extra info onto the url.


            return !lastMediaPassed.some(_ref4 => {
              let {
                urlSlug
              } = _ref4;
              return item.url.includes(urlSlug);
            });
          }); // Return the filtered media array along with newMedia.

          onSelect(filteredMedia.concat(newMedia)); // Reset lastMediaPassed and set it with ids and urls from newMedia.

          lastMediaPassed = newMedia.map(media => {
            // Add everything up to '.fileType' to compare via .includes.
            const cutOffIndex = media.url.lastIndexOf('.');
            const urlSlug = media.url.slice(0, cutOffIndex);
            return {
              id: media.id,
              urlSlug
            };
          });
        };
      } else {
        setMedia = onSelect;
      }
    } else {
      setMedia = _ref5 => {
        let [media] = _ref5;
        return onSelect(media);
      };
    }

    mediaUpload({
      allowedTypes,
      filesList: files,
      onFileChange: setMedia,
      onError
    });
  };

  const onUpload = event => {
    onFilesUpload(event.target.files);
  };

  const defaultRenderPlaceholder = content => {
    let {
      instructions,
      title
    } = labels;

    if (!mediaUpload && !onSelectURL) {
      instructions = (0,external_wp_i18n_namespaceObject.__)('To edit this block, you need permission to upload media.');
    }

    if (instructions === undefined || title === undefined) {
      const typesAllowed = allowedTypes !== null && allowedTypes !== void 0 ? allowedTypes : [];
      const [firstAllowedType] = typesAllowed;
      const isOneType = 1 === typesAllowed.length;
      const isAudio = isOneType && 'audio' === firstAllowedType;
      const isImage = isOneType && 'image' === firstAllowedType;
      const isVideo = isOneType && 'video' === firstAllowedType;

      if (instructions === undefined && mediaUpload) {
        instructions = (0,external_wp_i18n_namespaceObject.__)('Upload a media file or pick one from your media library.');

        if (isAudio) {
          instructions = (0,external_wp_i18n_namespaceObject.__)('Upload an audio file, pick one from your media library, or add one with a URL.');
        } else if (isImage) {
          instructions = (0,external_wp_i18n_namespaceObject.__)('Upload an image file, pick one from your media library, or add one with a URL.');
        } else if (isVideo) {
          instructions = (0,external_wp_i18n_namespaceObject.__)('Upload a video file, pick one from your media library, or add one with a URL.');
        }
      }

      if (title === undefined) {
        title = (0,external_wp_i18n_namespaceObject.__)('Media');

        if (isAudio) {
          title = (0,external_wp_i18n_namespaceObject.__)('Audio');
        } else if (isImage) {
          title = (0,external_wp_i18n_namespaceObject.__)('Image');
        } else if (isVideo) {
          title = (0,external_wp_i18n_namespaceObject.__)('Video');
        }
      }
    }

    const placeholderClassName = classnames_default()('block-editor-media-placeholder', className, {
      'is-appender': isAppender
    });
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Placeholder, {
      icon: icon,
      label: title,
      instructions: instructions,
      className: placeholderClassName,
      notices: notices,
      onDoubleClick: onDoubleClick,
      preview: mediaPreview,
      style: style
    }, content, children);
  };

  const renderPlaceholder = placeholder !== null && placeholder !== void 0 ? placeholder : defaultRenderPlaceholder;

  const renderDropZone = () => {
    if (disableDropZone) {
      return null;
    }

    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.DropZone, {
      onFilesDrop: onFilesUpload,
      onHTMLDrop: onHTMLDrop
    });
  };

  const renderCancelLink = () => {
    return onCancel && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
      className: "block-editor-media-placeholder__cancel-button",
      title: (0,external_wp_i18n_namespaceObject.__)('Cancel'),
      variant: "link",
      onClick: onCancel
    }, (0,external_wp_i18n_namespaceObject.__)('Cancel'));
  };

  const renderUrlSelectionUI = () => {
    return onSelectURL && (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "block-editor-media-placeholder__url-input-container"
    }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
      className: "block-editor-media-placeholder__button",
      onClick: openURLInput,
      isPressed: isURLInputVisible,
      variant: "tertiary"
    }, (0,external_wp_i18n_namespaceObject.__)('Insert from URL')), isURLInputVisible && (0,external_wp_element_namespaceObject.createElement)(InsertFromURLPopover, {
      src: src,
      onChange: onChangeSrc,
      onSubmit: onSubmitSrc,
      onClose: closeURLInput
    }));
  };

  const renderMediaUploadChecked = () => {
    const defaultButton = _ref6 => {
      let {
        open
      } = _ref6;
      return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
        variant: "tertiary",
        onClick: () => {
          open();
        }
      }, (0,external_wp_i18n_namespaceObject.__)('Media Library'));
    };

    const libraryButton = mediaLibraryButton !== null && mediaLibraryButton !== void 0 ? mediaLibraryButton : defaultButton;
    const uploadMediaLibraryButton = (0,external_wp_element_namespaceObject.createElement)(media_upload, {
      addToGallery: addToGallery,
      gallery: multiple && onlyAllowsImages(),
      multiple: multiple,
      onSelect: onSelect,
      allowedTypes: allowedTypes,
      value: Array.isArray(value) ? value.map(_ref7 => {
        let {
          id
        } = _ref7;
        return id;
      }) : value.id,
      render: libraryButton
    });

    if (mediaUpload && isAppender) {
      return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, renderDropZone(), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.FormFileUpload, {
        onChange: onUpload,
        accept: accept,
        multiple: multiple,
        render: _ref8 => {
          let {
            openFileDialog
          } = _ref8;
          const content = (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
            variant: "primary",
            className: classnames_default()('block-editor-media-placeholder__button', 'block-editor-media-placeholder__upload-button'),
            onClick: openFileDialog
          }, (0,external_wp_i18n_namespaceObject.__)('Upload')), uploadMediaLibraryButton, renderUrlSelectionUI(), renderCancelLink());
          return renderPlaceholder(content);
        }
      }));
    }

    if (mediaUpload) {
      const content = (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, renderDropZone(), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.FormFileUpload, {
        variant: "primary",
        className: classnames_default()('block-editor-media-placeholder__button', 'block-editor-media-placeholder__upload-button'),
        onChange: onUpload,
        accept: accept,
        multiple: multiple
      }, (0,external_wp_i18n_namespaceObject.__)('Upload')), uploadMediaLibraryButton, renderUrlSelectionUI(), renderCancelLink());
      return renderPlaceholder(content);
    }

    return renderPlaceholder(uploadMediaLibraryButton);
  };

  if (disableMediaButtons) {
    return (0,external_wp_element_namespaceObject.createElement)(media_upload_check, null, renderDropZone());
  }

  return (0,external_wp_element_namespaceObject.createElement)(media_upload_check, {
    fallback: renderPlaceholder(renderUrlSelectionUI())
  }, renderMediaUploadChecked());
}
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/media-placeholder/README.md
 */

/* harmony default export */ var media_placeholder = ((0,external_wp_components_namespaceObject.withFilters)('editor.MediaPlaceholder')(MediaPlaceholder));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/panel-color-settings/index.js



/**
 * Internal dependencies
 */


const PanelColorSettings = _ref => {
  let {
    colorSettings,
    ...props
  } = _ref;
  const settings = colorSettings.map(setting => {
    if (!setting) {
      return setting;
    }

    const {
      value,
      onChange,
      ...otherSettings
    } = setting;
    return { ...otherSettings,
      colorValue: value,
      onColorChange: onChange
    };
  });
  return (0,external_wp_element_namespaceObject.createElement)(panel_color_gradient_settings, _extends({
    settings: settings,
    gradients: [],
    disableCustomGradients: true
  }, props));
};

/* harmony default export */ var panel_color_settings = (PanelColorSettings);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/format-toolbar/index.js


/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */




const format_toolbar_POPOVER_PROPS = {
  position: 'bottom right',
  isAlternate: true
};

const FormatToolbar = () => {
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, ['bold', 'italic', 'link'].map(format => (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Slot, {
    name: `RichText.ToolbarControls.${format}`,
    key: format
  })), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Slot, {
    name: "RichText.ToolbarControls"
  }, fills => {
    if (!fills.length) {
      return null;
    }

    const allProps = fills.map(_ref => {
      let [{
        props
      }] = _ref;
      return props;
    });
    const hasActive = allProps.some(_ref2 => {
      let {
        isActive
      } = _ref2;
      return isActive;
    });
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarItem, null, toggleProps => (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.DropdownMenu, {
      icon: chevron_down
      /* translators: button label text should, if possible, be under 16 characters. */
      ,
      label: (0,external_wp_i18n_namespaceObject.__)('More'),
      toggleProps: { ...toggleProps,
        className: classnames_default()(toggleProps.className, {
          'is-pressed': hasActive
        }),
        describedBy: (0,external_wp_i18n_namespaceObject.__)('Displays more block tools')
      },
      controls: (0,external_lodash_namespaceObject.orderBy)(fills.map(_ref3 => {
        let [{
          props
        }] = _ref3;
        return props;
      }), 'title'),
      popoverProps: format_toolbar_POPOVER_PROPS
    }));
  }));
};

/* harmony default export */ var format_toolbar = (FormatToolbar);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/format-toolbar-container.js


/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */




const FormatToolbarContainer = _ref => {
  let {
    inline,
    anchorRef
  } = _ref;

  if (inline) {
    // Render in popover.
    return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Popover, {
      noArrow: true,
      position: "top center",
      focusOnMount: false,
      anchorRef: anchorRef,
      className: "block-editor-rich-text__inline-format-toolbar",
      __unstableSlotName: "block-toolbar"
    }, (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "block-editor-rich-text__inline-format-toolbar-group"
    }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarGroup, null, (0,external_wp_element_namespaceObject.createElement)(format_toolbar, null))));
  } // Render regular toolbar.


  return (0,external_wp_element_namespaceObject.createElement)(block_controls, {
    group: "inline"
  }, (0,external_wp_element_namespaceObject.createElement)(format_toolbar, null));
};

/* harmony default export */ var format_toolbar_container = (FormatToolbarContainer);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/use-undo-automatic-change.js
/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */


function useUndoAutomaticChange() {
  const {
    didAutomaticChange,
    getSettings
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  return (0,external_wp_compose_namespaceObject.useRefEffect)(element => {
    function onKeyDown(event) {
      const {
        keyCode
      } = event;

      if (event.defaultPrevented) {
        return;
      }

      if (keyCode !== external_wp_keycodes_namespaceObject.DELETE && keyCode !== external_wp_keycodes_namespaceObject.BACKSPACE && keyCode !== external_wp_keycodes_namespaceObject.ESCAPE) {
        return;
      }

      if (!didAutomaticChange()) {
        return;
      }

      event.preventDefault();

      getSettings().__experimentalUndo();
    }

    element.addEventListener('keydown', onKeyDown);
    return () => {
      element.removeEventListener('keydown', onKeyDown);
    };
  }, []);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/use-caret-in-format.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


function useCaretInFormat(_ref) {
  let {
    value
  } = _ref;
  const hasActiveFormats = value.activeFormats && !!value.activeFormats.length;
  const {
    isCaretWithinFormattedText
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const {
    enterFormattedText,
    exitFormattedText
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    if (hasActiveFormats) {
      if (!isCaretWithinFormattedText()) {
        enterFormattedText();
      }
    } else if (isCaretWithinFormattedText()) {
      exitFormattedText();
    }
  }, [hasActiveFormats]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/use-mark-persistent.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


function useMarkPersistent(_ref) {
  let {
    html,
    value
  } = _ref;
  const previousText = (0,external_wp_element_namespaceObject.useRef)();
  const hasActiveFormats = value.activeFormats && !!value.activeFormats.length;
  const {
    __unstableMarkLastChangeAsPersistent
  } = (0,external_wp_data_namespaceObject.useDispatch)(store); // Must be set synchronously to make sure it applies to the last change.

  (0,external_wp_element_namespaceObject.useLayoutEffect)(() => {
    // Ignore mount.
    if (!previousText.current) {
      previousText.current = value.text;
      return;
    } // Text input, so don't create an undo level for every character.
    // Create an undo level after 1 second of no input.


    if (previousText.current !== value.text) {
      const timeout = window.setTimeout(() => {
        __unstableMarkLastChangeAsPersistent();
      }, 1000);
      previousText.current = value.text;
      return () => {
        window.clearTimeout(timeout);
      };
    }

    __unstableMarkLastChangeAsPersistent();
  }, [html, hasActiveFormats]);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/file-paste-handler.js
/**
 * WordPress dependencies
 */

function filePasteHandler(files) {
  return files.filter(_ref => {
    let {
      type
    } = _ref;
    return /^image\/(?:jpe?g|png|gif|webp)$/.test(type);
  }).map(file => `<img src="${(0,external_wp_blob_namespaceObject.createBlobURL)(file)}">`).join('');
}

;// CONCATENATED MODULE: external ["wp","shortcode"]
var external_wp_shortcode_namespaceObject = window["wp"]["shortcode"];
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/utils.js


/**
 * WordPress dependencies
 */




function addActiveFormats(value, activeFormats) {
  if (activeFormats !== null && activeFormats !== void 0 && activeFormats.length) {
    let index = value.formats.length;

    while (index--) {
      value.formats[index] = [...activeFormats, ...(value.formats[index] || [])];
    }
  }
}
/**
 * Get the multiline tag based on the multiline prop.
 *
 * @param {?(string|boolean)} multiline The multiline prop.
 *
 * @return {?string} The multiline tag.
 */

function getMultilineTag(multiline) {
  if (multiline !== true && multiline !== 'p' && multiline !== 'li') {
    return;
  }

  return multiline === true ? 'p' : multiline;
}
function getAllowedFormats(_ref) {
  let {
    allowedFormats,
    formattingControls,
    disableFormats
  } = _ref;

  if (disableFormats) {
    return getAllowedFormats.EMPTY_ARRAY;
  }

  if (!allowedFormats && !formattingControls) {
    return;
  }

  if (allowedFormats) {
    return allowedFormats;
  }

  external_wp_deprecated_default()('wp.blockEditor.RichText formattingControls prop', {
    since: '5.4',
    alternative: 'allowedFormats',
    version: '6.2'
  });
  return formattingControls.map(name => `core/${name}`);
}
getAllowedFormats.EMPTY_ARRAY = [];
const isShortcode = text => (0,external_wp_shortcode_namespaceObject.regexp)('.*').test(text);
/**
 * Creates a link from pasted URL.
 * Creates a paragraph block containing a link to the URL, and calls `onReplace`.
 *
 * @param {string}   url       The URL that could not be embedded.
 * @param {Function} onReplace Function to call with the created fallback block.
 */

function createLinkInParagraph(url, onReplace) {
  const link = createElement("a", {
    href: url
  }, url);
  onReplace(createBlock('core/paragraph', {
    content: renderToString(link)
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/split-value.js
/**
 * WordPress dependencies
 */

/*
 * Signals to the RichText owner that the block can be replaced with two blocks
 * as a result of splitting the block by pressing enter, or with blocks as a
 * result of splitting the block by pasting block content in the instance.
 */

function splitValue(_ref) {
  let {
    value,
    pastedBlocks = [],
    onReplace,
    onSplit,
    onSplitMiddle,
    multilineTag
  } = _ref;

  if (!onReplace || !onSplit) {
    return;
  } // Ensure the value has a selection. This might happen when trying to split
  // an empty value before there was a `selectionchange` event.


  const {
    start = 0,
    end = 0
  } = value;
  const valueWithEnsuredSelection = { ...value,
    start,
    end
  };
  const blocks = [];
  const [before, after] = (0,external_wp_richText_namespaceObject.split)(valueWithEnsuredSelection);
  const hasPastedBlocks = pastedBlocks.length > 0;
  let lastPastedBlockIndex = -1; // Consider the after value to be the original it is not empty and the
  // before value *is* empty.

  const isAfterOriginal = (0,external_wp_richText_namespaceObject.isEmpty)(before) && !(0,external_wp_richText_namespaceObject.isEmpty)(after); // Create a block with the content before the caret if there's no pasted
  // blocks, or if there are pasted blocks and the value is not empty. We do
  // not want a leading empty block on paste, but we do if split with e.g. the
  // enter key.

  if (!hasPastedBlocks || !(0,external_wp_richText_namespaceObject.isEmpty)(before)) {
    blocks.push(onSplit((0,external_wp_richText_namespaceObject.toHTMLString)({
      value: before,
      multilineTag
    }), !isAfterOriginal));
    lastPastedBlockIndex += 1;
  }

  if (hasPastedBlocks) {
    blocks.push(...pastedBlocks);
    lastPastedBlockIndex += pastedBlocks.length;
  } else if (onSplitMiddle) {
    blocks.push(onSplitMiddle());
  } // If there's pasted blocks, append a block with non empty content / after
  // the caret. Otherwise, do append an empty block if there is no
  // `onSplitMiddle` prop, but if there is and the content is empty, the
  // middle block is enough to set focus in.


  if (hasPastedBlocks ? !(0,external_wp_richText_namespaceObject.isEmpty)(after) : !onSplitMiddle || !(0,external_wp_richText_namespaceObject.isEmpty)(after)) {
    blocks.push(onSplit((0,external_wp_richText_namespaceObject.toHTMLString)({
      value: after,
      multilineTag
    }), isAfterOriginal));
  } // If there are pasted blocks, set the selection to the last one. Otherwise,
  // set the selection to the second block.


  const indexToSelect = hasPastedBlocks ? lastPastedBlockIndex : 1; // If there are pasted blocks, move the caret to the end of the selected
  // block Otherwise, retain the default value.

  const initialPosition = hasPastedBlocks ? -1 : 0;
  onReplace(blocks, indexToSelect, initialPosition);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/use-paste-handler.js
/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */





/** @typedef {import('@wordpress/rich-text').RichTextValue} RichTextValue */

/**
 * Replaces line separators with line breaks if not multiline.
 * Replaces line breaks with line separators if multiline.
 *
 * @param {RichTextValue} value       Value to adjust.
 * @param {boolean}       isMultiline Whether to adjust to multiline or not.
 *
 * @return {RichTextValue} Adjusted value.
 */

function adjustLines(value, isMultiline) {
  if (isMultiline) {
    return (0,external_wp_richText_namespaceObject.replace)(value, /\n+/g, external_wp_richText_namespaceObject.__UNSTABLE_LINE_SEPARATOR);
  }

  return (0,external_wp_richText_namespaceObject.replace)(value, new RegExp(external_wp_richText_namespaceObject.__UNSTABLE_LINE_SEPARATOR, 'g'), '\n');
}

function usePasteHandler(props) {
  const propsRef = (0,external_wp_element_namespaceObject.useRef)(props);
  propsRef.current = props;
  return (0,external_wp_compose_namespaceObject.useRefEffect)(element => {
    function _onPaste(event) {
      const {
        isSelected,
        disableFormats,
        onChange,
        value,
        formatTypes,
        tagName,
        onReplace,
        onSplit,
        onSplitMiddle,
        __unstableEmbedURLOnPaste,
        multilineTag,
        preserveWhiteSpace,
        pastePlainText
      } = propsRef.current;

      if (!isSelected) {
        return;
      }

      const {
        clipboardData
      } = event;
      let plainText = '';
      let html = ''; // IE11 only supports `Text` as an argument for `getData` and will
      // otherwise throw an invalid argument error, so we try the standard
      // arguments first, then fallback to `Text` if they fail.

      try {
        plainText = clipboardData.getData('text/plain');
        html = clipboardData.getData('text/html');
      } catch (error1) {
        try {
          html = clipboardData.getData('Text');
        } catch (error2) {
          // Some browsers like UC Browser paste plain text by default and
          // don't support clipboardData at all, so allow default
          // behaviour.
          return;
        }
      } // Remove Windows-specific metadata appended within copied HTML text.


      html = removeWindowsFragments(html); // Strip meta tag.

      html = removeCharsetMetaTag(html);
      event.preventDefault(); // Allows us to ask for this information when we get a report.

      window.console.log('Received HTML:\n\n', html);
      window.console.log('Received plain text:\n\n', plainText);

      if (disableFormats) {
        onChange((0,external_wp_richText_namespaceObject.insert)(value, plainText));
        return;
      }

      const transformed = formatTypes.reduce((accumlator, _ref) => {
        let {
          __unstablePasteRule
        } = _ref;

        // Only allow one transform.
        if (__unstablePasteRule && accumlator === value) {
          accumlator = __unstablePasteRule(value, {
            html,
            plainText
          });
        }

        return accumlator;
      }, value);

      if (transformed !== value) {
        onChange(transformed);
        return;
      }

      const files = [...(0,external_wp_dom_namespaceObject.getFilesFromDataTransfer)(clipboardData)];
      const isInternal = clipboardData.getData('rich-text') === 'true'; // If the data comes from a rich text instance, we can directly use it
      // without filtering the data. The filters are only meant for externally
      // pasted content and remove inline styles.

      if (isInternal) {
        const pastedMultilineTag = clipboardData.getData('rich-text-multi-line-tag') || undefined;
        let pastedValue = (0,external_wp_richText_namespaceObject.create)({
          html,
          multilineTag: pastedMultilineTag,
          multilineWrapperTags: pastedMultilineTag === 'li' ? ['ul', 'ol'] : undefined,
          preserveWhiteSpace
        });
        pastedValue = adjustLines(pastedValue, !!multilineTag);
        addActiveFormats(pastedValue, value.activeFormats);
        onChange((0,external_wp_richText_namespaceObject.insert)(value, pastedValue));
        return;
      }

      if (pastePlainText) {
        onChange((0,external_wp_richText_namespaceObject.insert)(value, (0,external_wp_richText_namespaceObject.create)({
          text: plainText
        })));
        return;
      } // Process any attached files, unless we infer that the files in
      // question are redundant "screenshots" of the actual HTML payload,
      // as created by certain office-type programs.
      //
      // @see shouldDismissPastedFiles


      if (files !== null && files !== void 0 && files.length && !shouldDismissPastedFiles(files, html, plainText)) {
        const content = (0,external_wp_blocks_namespaceObject.pasteHandler)({
          HTML: filePasteHandler(files),
          mode: 'BLOCKS',
          tagName,
          preserveWhiteSpace
        }); // Allows us to ask for this information when we get a report.
        // eslint-disable-next-line no-console

        window.console.log('Received items:\n\n', files);

        if (onReplace && (0,external_wp_richText_namespaceObject.isEmpty)(value)) {
          onReplace(content);
        } else {
          splitValue({
            value,
            pastedBlocks: content,
            onReplace,
            onSplit,
            onSplitMiddle,
            multilineTag
          });
        }

        return;
      }

      let mode = onReplace && onSplit ? 'AUTO' : 'INLINE'; // Force the blocks mode when the user is pasting
      // on a new line & the content resembles a shortcode.
      // Otherwise it's going to be detected as inline
      // and the shortcode won't be replaced.

      if (mode === 'AUTO' && (0,external_wp_richText_namespaceObject.isEmpty)(value) && isShortcode(plainText)) {
        mode = 'BLOCKS';
      }

      if (__unstableEmbedURLOnPaste && (0,external_wp_richText_namespaceObject.isEmpty)(value) && (0,external_wp_url_namespaceObject.isURL)(plainText.trim())) {
        mode = 'BLOCKS';
      }

      const content = (0,external_wp_blocks_namespaceObject.pasteHandler)({
        HTML: html,
        plainText,
        mode,
        tagName,
        preserveWhiteSpace
      });

      if (typeof content === 'string') {
        let valueToInsert = (0,external_wp_richText_namespaceObject.create)({
          html: content
        }); // If the content should be multiline, we should process text
        // separated by a line break as separate lines.

        valueToInsert = adjustLines(valueToInsert, !!multilineTag);
        addActiveFormats(valueToInsert, value.activeFormats);
        onChange((0,external_wp_richText_namespaceObject.insert)(value, valueToInsert));
      } else if (content.length > 0) {
        if (onReplace && (0,external_wp_richText_namespaceObject.isEmpty)(value)) {
          onReplace(content, content.length - 1, -1);
        } else {
          splitValue({
            value,
            pastedBlocks: content,
            onReplace,
            onSplit,
            onSplitMiddle,
            multilineTag
          });
        }
      }
    }

    element.addEventListener('paste', _onPaste);
    return () => {
      element.removeEventListener('paste', _onPaste);
    };
  }, []);
}
/**
 * Normalizes a given string of HTML to remove the Windows-specific "Fragment"
 * comments and any preceeding and trailing content.
 *
 * @param {string} html the html to be normalized
 * @return {string} the normalized html
 */

function removeWindowsFragments(html) {
  const startStr = '<!--StartFragment-->';
  const startIdx = html.indexOf(startStr);

  if (startIdx > -1) {
    html = html.substring(startIdx + startStr.length);
  } else {
    // No point looking for EndFragment
    return html;
  }

  const endStr = '<!--EndFragment-->';
  const endIdx = html.indexOf(endStr);

  if (endIdx > -1) {
    html = html.substring(0, endIdx);
  }

  return html;
}
/**
 * Removes the charset meta tag inserted by Chromium.
 * See:
 * - https://github.com/WordPress/gutenberg/issues/33585
 * - https://bugs.chromium.org/p/chromium/issues/detail?id=1264616#c4
 *
 * @param {string} html the html to be stripped of the meta tag.
 * @return {string} the cleaned html
 */


function removeCharsetMetaTag(html) {
  const metaTag = `<meta charset='utf-8'>`;

  if (html.startsWith(metaTag)) {
    return html.slice(metaTag.length);
  }

  return html;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/prevent-event-discovery.js
/**
 * WordPress dependencies
 */

function preventEventDiscovery(value) {
  const searchText = 'tales of gutenberg';
  const addText = ' 🐡🐢🦀🐤🦋🐘🐧🐹🦁🦄🦍🐼🐿🎃🐴🐝🐆🦕🦔🌱🍇π🍌🐉💧🥨🌌🍂🍠🥦🥚🥝🎟🥥🥒🛵🥖🍒🍯🎾🎲🐺🐚🐮⌛️';
  const {
    start,
    text
  } = value;

  if (start < searchText.length) {
    return value;
  }

  const charactersBefore = text.slice(start - searchText.length, start);

  if (charactersBefore.toLowerCase() !== searchText) {
    return value;
  }

  return (0,external_wp_richText_namespaceObject.insert)(value, addText);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/use-input-rules.js
/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */


 // A robust way to retain selection position through various
// transforms is to insert a special character at the position and
// then recover it.

const START_OF_SELECTED_AREA = '\u0086';

function findSelection(blocks) {
  let i = blocks.length;

  while (i--) {
    const attributeKey = (0,external_lodash_namespaceObject.findKey)(blocks[i].attributes, v => typeof v === 'string' && v.indexOf(START_OF_SELECTED_AREA) !== -1);

    if (attributeKey) {
      blocks[i].attributes[attributeKey] = blocks[i].attributes[attributeKey].replace(START_OF_SELECTED_AREA, '');
      return blocks[i].clientId;
    }

    const nestedSelection = findSelection(blocks[i].innerBlocks);

    if (nestedSelection) {
      return nestedSelection;
    }
  }
}

function useInputRules(props) {
  const {
    __unstableMarkLastChangeAsPersistent,
    __unstableMarkAutomaticChange
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const propsRef = (0,external_wp_element_namespaceObject.useRef)(props);
  propsRef.current = props;
  return (0,external_wp_compose_namespaceObject.useRefEffect)(element => {
    function inputRule() {
      const {
        value,
        onReplace,
        selectionChange
      } = propsRef.current;

      if (!onReplace) {
        return;
      }

      const {
        start,
        text
      } = value;
      const characterBefore = text.slice(start - 1, start); // The character right before the caret must be a plain space.

      if (characterBefore !== ' ') {
        return;
      }

      const trimmedTextBefore = text.slice(0, start).trim();
      const prefixTransforms = (0,external_wp_blocks_namespaceObject.getBlockTransforms)('from').filter(_ref => {
        let {
          type
        } = _ref;
        return type === 'prefix';
      });
      const transformation = (0,external_wp_blocks_namespaceObject.findTransform)(prefixTransforms, _ref2 => {
        let {
          prefix
        } = _ref2;
        return trimmedTextBefore === prefix;
      });

      if (!transformation) {
        return;
      }

      const content = (0,external_wp_richText_namespaceObject.toHTMLString)({
        value: (0,external_wp_richText_namespaceObject.insert)(value, START_OF_SELECTED_AREA, 0, start)
      });
      const block = transformation.transform(content);
      selectionChange(findSelection([block]));
      onReplace([block]);

      __unstableMarkAutomaticChange();
    }

    function onInput(event) {
      const {
        inputType,
        type
      } = event;
      const {
        value,
        onChange,
        __unstableAllowPrefixTransformations,
        formatTypes
      } = propsRef.current; // Only run input rules when inserting text.

      if (inputType !== 'insertText' && type !== 'compositionend') {
        return;
      }

      if (__unstableAllowPrefixTransformations && inputRule) {
        inputRule();
      }

      const transformed = formatTypes.reduce((accumlator, _ref3) => {
        let {
          __unstableInputRule
        } = _ref3;

        if (__unstableInputRule) {
          accumlator = __unstableInputRule(accumlator);
        }

        return accumlator;
      }, preventEventDiscovery(value));

      if (transformed !== value) {
        __unstableMarkLastChangeAsPersistent();

        onChange({ ...transformed,
          activeFormats: value.activeFormats
        });

        __unstableMarkAutomaticChange();
      }
    }

    element.addEventListener('input', onInput);
    element.addEventListener('compositionend', onInput);
    return () => {
      element.removeEventListener('input', onInput);
      element.removeEventListener('compositionend', onInput);
    };
  }, []);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/use-enter.js
/**
 * WordPress dependencies
 */

/**
 * WordPress dependencies
 */






/**
 * Internal dependencies
 */



function useEnter(props) {
  const {
    __unstableMarkAutomaticChange
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const propsRef = (0,external_wp_element_namespaceObject.useRef)(props);
  propsRef.current = props;
  return (0,external_wp_compose_namespaceObject.useRefEffect)(element => {
    function onKeyDown(event) {
      if (event.defaultPrevented) {
        return;
      }

      const {
        removeEditorOnlyFormats,
        value,
        onReplace,
        onSplit,
        onSplitMiddle,
        multilineTag,
        onChange,
        disableLineBreaks,
        onSplitAtEnd
      } = propsRef.current;

      if (event.keyCode !== external_wp_keycodes_namespaceObject.ENTER) {
        return;
      }

      event.preventDefault();
      const _value = { ...value
      };
      _value.formats = removeEditorOnlyFormats(value);
      const canSplit = onReplace && onSplit;

      if (onReplace) {
        const transforms = (0,external_wp_blocks_namespaceObject.getBlockTransforms)('from').filter(_ref => {
          let {
            type
          } = _ref;
          return type === 'enter';
        });
        const transformation = (0,external_wp_blocks_namespaceObject.findTransform)(transforms, item => {
          return item.regExp.test(_value.text);
        });

        if (transformation) {
          onReplace([transformation.transform({
            content: _value.text
          })]);

          __unstableMarkAutomaticChange();
        }
      }

      if (multilineTag) {
        if (event.shiftKey) {
          if (!disableLineBreaks) {
            onChange((0,external_wp_richText_namespaceObject.insert)(_value, '\n'));
          }
        } else if (canSplit && (0,external_wp_richText_namespaceObject.__unstableIsEmptyLine)(_value)) {
          splitValue({
            value: _value,
            onReplace,
            onSplit,
            onSplitMiddle,
            multilineTag
          });
        } else {
          onChange((0,external_wp_richText_namespaceObject.__unstableInsertLineSeparator)(_value));
        }
      } else {
        const {
          text,
          start,
          end
        } = _value;
        const canSplitAtEnd = onSplitAtEnd && start === end && end === text.length;

        if (event.shiftKey || !canSplit && !canSplitAtEnd) {
          if (!disableLineBreaks) {
            onChange((0,external_wp_richText_namespaceObject.insert)(_value, '\n'));
          }
        } else if (!canSplit && canSplitAtEnd) {
          onSplitAtEnd();
        } else if (canSplit) {
          splitValue({
            value: _value,
            onReplace,
            onSplit,
            onSplitMiddle,
            multilineTag
          });
        }
      }
    }

    element.addEventListener('keydown', onKeyDown);
    return () => {
      element.removeEventListener('keydown', onKeyDown);
    };
  }, []);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/use-format-types.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */



function formatTypesSelector(select) {
  return select(external_wp_richText_namespaceObject.store).getFormatTypes();
}
/**
 * Set of all interactive content tags.
 *
 * @see https://html.spec.whatwg.org/multipage/dom.html#interactive-content
 */


const interactiveContentTags = new Set(['a', 'audio', 'button', 'details', 'embed', 'iframe', 'input', 'label', 'select', 'textarea', 'video']);
/**
 * This hook provides RichText with the `formatTypes` and its derived props from
 * experimental format type settings.
 *
 * @param {Object}  $0                              Options
 * @param {string}  $0.clientId                     Block client ID.
 * @param {string}  $0.identifier                   Block attribute.
 * @param {boolean} $0.withoutInteractiveFormatting Whether to clean the interactive formattings or not.
 * @param {Array}   $0.allowedFormats               Allowed formats
 */

function useFormatTypes(_ref) {
  let {
    clientId,
    identifier,
    withoutInteractiveFormatting,
    allowedFormats
  } = _ref;
  const allFormatTypes = (0,external_wp_data_namespaceObject.useSelect)(formatTypesSelector, []);
  const formatTypes = (0,external_wp_element_namespaceObject.useMemo)(() => {
    return allFormatTypes.filter(_ref2 => {
      let {
        name,
        tagName
      } = _ref2;

      if (allowedFormats && !allowedFormats.includes(name)) {
        return false;
      }

      if (withoutInteractiveFormatting && interactiveContentTags.has(tagName)) {
        return false;
      }

      return true;
    });
  }, [allFormatTypes, allowedFormats, interactiveContentTags]);
  const keyedSelected = (0,external_wp_data_namespaceObject.useSelect)(select => formatTypes.reduce((accumulator, type) => {
    if (type.__experimentalGetPropsForEditableTreePreparation) {
      accumulator[type.name] = type.__experimentalGetPropsForEditableTreePreparation(select, {
        richTextIdentifier: identifier,
        blockClientId: clientId
      });
    }

    return accumulator;
  }, {}), [formatTypes, clientId, identifier]);
  const dispatch = (0,external_wp_data_namespaceObject.useDispatch)();
  const prepareHandlers = [];
  const valueHandlers = [];
  const changeHandlers = [];
  const dependencies = [];
  formatTypes.forEach(type => {
    if (type.__experimentalCreatePrepareEditableTree) {
      const selected = keyedSelected[type.name];

      const handler = type.__experimentalCreatePrepareEditableTree(selected, {
        richTextIdentifier: identifier,
        blockClientId: clientId
      });

      if (type.__experimentalCreateOnChangeEditableValue) {
        valueHandlers.push(handler);
      } else {
        prepareHandlers.push(handler);
      }

      for (const key in selected) {
        dependencies.push(selected[key]);
      }
    }

    if (type.__experimentalCreateOnChangeEditableValue) {
      let dispatchers = {};

      if (type.__experimentalGetPropsForEditableTreeChangeHandler) {
        dispatchers = type.__experimentalGetPropsForEditableTreeChangeHandler(dispatch, {
          richTextIdentifier: identifier,
          blockClientId: clientId
        });
      }

      changeHandlers.push(type.__experimentalCreateOnChangeEditableValue({ ...(keyedSelected[type.name] || {}),
        ...dispatchers
      }, {
        richTextIdentifier: identifier,
        blockClientId: clientId
      }));
    }
  });
  return {
    formatTypes,
    prepareHandlers,
    valueHandlers,
    changeHandlers,
    dependencies
  };
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/use-remove-browser-shortcuts.js
/**
 * WordPress dependencies
 */


/**
 * Hook to prevent default behaviors for key combinations otherwise handled
 * internally by RichText.
 *
 * @return {import('react').RefObject} The component to be rendered.
 */

function useRemoveBrowserShortcuts() {
  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    function onKeydown(event) {
      if (external_wp_keycodes_namespaceObject.isKeyboardEvent.primary(event, 'z') || external_wp_keycodes_namespaceObject.isKeyboardEvent.primary(event, 'y') || external_wp_keycodes_namespaceObject.isKeyboardEvent.primaryShift(event, 'z')) {
        event.preventDefault();
      }
    }

    node.addEventListener('keydown', onKeydown);
    return () => {
      node.addEventListener('keydown', onKeydown);
    };
  }, []);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/use-shortcuts.js
/**
 * WordPress dependencies
 */

function useShortcuts(keyboardShortcuts) {
  return (0,external_wp_compose_namespaceObject.useRefEffect)(element => {
    function onKeyDown(event) {
      for (const keyboardShortcut of keyboardShortcuts.current) {
        keyboardShortcut(event);
      }
    }

    element.addEventListener('keydown', onKeyDown);
    return () => {
      element.removeEventListener('keydown', onKeyDown);
    };
  }, []);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/use-input-events.js
/**
 * WordPress dependencies
 */

function useInputEvents(inputEvents) {
  return (0,external_wp_compose_namespaceObject.useRefEffect)(element => {
    function onInput(event) {
      for (const keyboardShortcut of inputEvents.current) {
        keyboardShortcut(event);
      }
    }

    element.addEventListener('input', onInput);
    return () => {
      element.removeEventListener('input', onInput);
    };
  }, []);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/use-firefox-compat.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


function useFirefoxCompat() {
  const {
    isMultiSelecting
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  return (0,external_wp_compose_namespaceObject.useRefEffect)(element => {
    function onFocus() {
      if (!isMultiSelecting()) {
        return;
      } // This is a little hack to work around focus issues with nested
      // editable elements in Firefox. For some reason the editable child
      // element sometimes regains focus, while it should not be focusable
      // and focus should remain on the editable parent element.
      // To do: try to find the cause of the shifting focus.


      const parentEditable = element.parentElement.closest('[contenteditable="true"]');

      if (parentEditable) {
        parentEditable.focus();
      }
    }

    element.addEventListener('focus', onFocus);
    return () => {
      element.removeEventListener('focus', onFocus);
    };
  }, []);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/format-edit.js


/**
 * WordPress dependencies
 */

/**
 * External dependencies
 */


function FormatEdit(_ref) {
  let {
    formatTypes,
    onChange,
    onFocus,
    value,
    forwardedRef
  } = _ref;
  return formatTypes.map(settings => {
    const {
      name,
      edit: Edit
    } = settings;

    if (!Edit) {
      return null;
    }

    const activeFormat = (0,external_wp_richText_namespaceObject.getActiveFormat)(value, name);
    let isActive = activeFormat !== undefined;
    const activeObject = (0,external_wp_richText_namespaceObject.getActiveObject)(value);
    const isObjectActive = activeObject !== undefined && activeObject.type === name; // Edge case: un-collapsed link formats.
    // If there is a missing link format at either end of the selection
    // then we shouldn't show the Edit UI because the selection has exceeded
    // the bounds of the link format.
    // Also if the format objects don't match then we're dealing with two separate
    // links so we should not allow the link to be modified over the top.

    if (name === 'core/link' && !(0,external_wp_richText_namespaceObject.isCollapsed)(value)) {
      const formats = value.formats;
      const linkFormatAtStart = (0,external_lodash_namespaceObject.find)(formats[value.start], {
        type: 'core/link'
      });
      const linkFormatAtEnd = (0,external_lodash_namespaceObject.find)(formats[value.end - 1], {
        type: 'core/link'
      });

      if (!linkFormatAtStart || !linkFormatAtEnd || linkFormatAtStart !== linkFormatAtEnd) {
        isActive = false;
      }
    }

    return (0,external_wp_element_namespaceObject.createElement)(Edit, {
      key: name,
      isActive: isActive,
      activeAttributes: isActive ? activeFormat.attributes || {} : {},
      isObjectActive: isObjectActive,
      activeObjectAttributes: isObjectActive ? activeObject.attributes || {} : {},
      value: value,
      onChange: onChange,
      onFocus: onFocus,
      contentRef: forwardedRef
    });
  });
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/index.js



/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */









/**
 * Internal dependencies
 */


















const keyboardShortcutContext = (0,external_wp_element_namespaceObject.createContext)();
const inputEventContext = (0,external_wp_element_namespaceObject.createContext)();
/**
 * Removes props used for the native version of RichText so that they are not
 * passed to the DOM element and log warnings.
 *
 * @param {Object} props Props to filter.
 *
 * @return {Object} Filtered props.
 */

function removeNativeProps(props) {
  return (0,external_lodash_namespaceObject.omit)(props, ['__unstableMobileNoFocusOnMount', 'deleteEnter', 'placeholderTextColor', 'textAlign', 'selectionColor', 'tagsToEliminate', 'rootTagsToEliminate', 'disableEditingMenu', 'fontSize', 'fontFamily', 'fontWeight', 'fontStyle', 'minWidth', 'maxWidth', 'setRef']);
}

function RichTextWrapper(_ref, forwardedRef) {
  let {
    children,
    tagName = 'div',
    value: originalValue = '',
    onChange: originalOnChange,
    isSelected: originalIsSelected,
    multiline,
    inlineToolbar,
    wrapperClassName,
    autocompleters,
    onReplace,
    placeholder,
    allowedFormats,
    formattingControls,
    withoutInteractiveFormatting,
    onRemove,
    onMerge,
    onSplit,
    __unstableOnSplitAtEnd: onSplitAtEnd,
    __unstableOnSplitMiddle: onSplitMiddle,
    identifier,
    preserveWhiteSpace,
    __unstablePastePlainText: pastePlainText,
    __unstableEmbedURLOnPaste,
    __unstableDisableFormats: disableFormats,
    disableLineBreaks,
    unstableOnFocus,
    __unstableAllowPrefixTransformations,
    ...props
  } = _ref;
  const instanceId = (0,external_wp_compose_namespaceObject.useInstanceId)(RichTextWrapper);
  identifier = identifier || instanceId;
  props = removeNativeProps(props);
  const anchorRef = (0,external_wp_element_namespaceObject.useRef)();
  const {
    clientId
  } = useBlockEditContext();

  const selector = select => {
    const {
      getSelectionStart,
      getSelectionEnd
    } = select(store);
    const selectionStart = getSelectionStart();
    const selectionEnd = getSelectionEnd();
    let isSelected;

    if (originalIsSelected === undefined) {
      isSelected = selectionStart.clientId === clientId && selectionEnd.clientId === clientId && selectionStart.attributeKey === identifier;
    } else if (originalIsSelected) {
      isSelected = selectionStart.clientId === clientId;
    }

    return {
      selectionStart: isSelected ? selectionStart.offset : undefined,
      selectionEnd: isSelected ? selectionEnd.offset : undefined,
      isSelected
    };
  }; // This selector must run on every render so the right selection state is
  // retreived from the store on merge.
  // To do: fix this somehow.


  const {
    selectionStart,
    selectionEnd,
    isSelected
  } = (0,external_wp_data_namespaceObject.useSelect)(selector);
  const {
    selectionChange
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const multilineTag = getMultilineTag(multiline);
  const adjustedAllowedFormats = getAllowedFormats({
    allowedFormats,
    formattingControls,
    disableFormats
  });
  const hasFormats = !adjustedAllowedFormats || adjustedAllowedFormats.length > 0;
  let adjustedValue = originalValue;
  let adjustedOnChange = originalOnChange; // Handle deprecated format.

  if (Array.isArray(originalValue)) {
    adjustedValue = external_wp_blocks_namespaceObject.children.toHTML(originalValue);

    adjustedOnChange = newValue => originalOnChange(external_wp_blocks_namespaceObject.children.fromDOM((0,external_wp_richText_namespaceObject.__unstableCreateElement)(document, newValue).childNodes));
  }

  const onSelectionChange = (0,external_wp_element_namespaceObject.useCallback)((start, end) => {
    const selection = {};
    const unset = start === undefined && end === undefined;

    if (typeof start === 'number' || unset) {
      selection.start = {
        clientId,
        attributeKey: identifier,
        offset: start
      };
    }

    if (typeof end === 'number' || unset) {
      selection.end = {
        clientId,
        attributeKey: identifier,
        offset: end
      };
    }

    selectionChange(selection);
  }, [clientId, identifier]);
  const {
    formatTypes,
    prepareHandlers,
    valueHandlers,
    changeHandlers,
    dependencies
  } = useFormatTypes({
    clientId,
    identifier,
    withoutInteractiveFormatting,
    allowedFormats: adjustedAllowedFormats
  });

  function addEditorOnlyFormats(value) {
    return valueHandlers.reduce((accumulator, fn) => fn(accumulator, value.text), value.formats);
  }

  function removeEditorOnlyFormats(value) {
    formatTypes.forEach(formatType => {
      // Remove formats created by prepareEditableTree, because they are editor only.
      if (formatType.__experimentalCreatePrepareEditableTree) {
        value = (0,external_wp_richText_namespaceObject.removeFormat)(value, formatType.name, 0, value.text.length);
      }
    });
    return value.formats;
  }

  function addInvisibleFormats(value) {
    return prepareHandlers.reduce((accumulator, fn) => fn(accumulator, value.text), value.formats);
  }

  const {
    value,
    onChange,
    ref: richTextRef
  } = (0,external_wp_richText_namespaceObject.__unstableUseRichText)({
    value: adjustedValue,

    onChange(html, _ref2) {
      let {
        __unstableFormats,
        __unstableText
      } = _ref2;
      adjustedOnChange(html);
      Object.values(changeHandlers).forEach(changeHandler => {
        changeHandler(__unstableFormats, __unstableText);
      });
    },

    selectionStart,
    selectionEnd,
    onSelectionChange,
    placeholder,
    __unstableIsSelected: isSelected,
    __unstableMultilineTag: multilineTag,
    __unstableDisableFormats: disableFormats,
    preserveWhiteSpace,
    __unstableDependencies: [...dependencies, tagName],
    __unstableAfterParse: addEditorOnlyFormats,
    __unstableBeforeSerialize: removeEditorOnlyFormats,
    __unstableAddInvisibleFormats: addInvisibleFormats
  });
  const autocompleteProps = useBlockEditorAutocompleteProps({
    onReplace,
    completers: autocompleters,
    record: value,
    onChange
  });
  useCaretInFormat({
    value
  });
  useMarkPersistent({
    html: adjustedValue,
    value
  });
  const keyboardShortcuts = (0,external_wp_element_namespaceObject.useRef)(new Set());
  const inputEvents = (0,external_wp_element_namespaceObject.useRef)(new Set());

  function onKeyDown(event) {
    const {
      keyCode
    } = event;

    if (event.defaultPrevented) {
      return;
    }

    if (keyCode === external_wp_keycodes_namespaceObject.DELETE || keyCode === external_wp_keycodes_namespaceObject.BACKSPACE) {
      const {
        start,
        end,
        text
      } = value;
      const isReverse = keyCode === external_wp_keycodes_namespaceObject.BACKSPACE;
      const hasActiveFormats = value.activeFormats && !!value.activeFormats.length; // Only process delete if the key press occurs at an uncollapsed edge.

      if (!(0,external_wp_richText_namespaceObject.isCollapsed)(value) || hasActiveFormats || isReverse && start !== 0 || !isReverse && end !== text.length) {
        return;
      }

      if (onMerge) {
        onMerge(!isReverse);
      } // Only handle remove on Backspace. This serves dual-purpose of being
      // an intentional user interaction distinguishing between Backspace and
      // Delete to remove the empty field, but also to avoid merge & remove
      // causing destruction of two fields (merge, then removed merged).


      if (onRemove && (0,external_wp_richText_namespaceObject.isEmpty)(value) && isReverse) {
        onRemove(!isReverse);
      }

      event.preventDefault();
    }
  }

  function onFocus() {
    anchorRef.current.focus();
  }

  const TagName = tagName;
  const content = (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, isSelected && (0,external_wp_element_namespaceObject.createElement)(keyboardShortcutContext.Provider, {
    value: keyboardShortcuts
  }, (0,external_wp_element_namespaceObject.createElement)(inputEventContext.Provider, {
    value: inputEvents
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Popover.__unstableSlotNameProvider, {
    value: "__unstable-block-tools-after"
  }, children && children({
    value,
    onChange,
    onFocus
  }), (0,external_wp_element_namespaceObject.createElement)(FormatEdit, {
    value: value,
    onChange: onChange,
    onFocus: onFocus,
    formatTypes: formatTypes,
    forwardedRef: anchorRef
  })))), isSelected && hasFormats && (0,external_wp_element_namespaceObject.createElement)(format_toolbar_container, {
    inline: inlineToolbar,
    anchorRef: anchorRef.current
  }), (0,external_wp_element_namespaceObject.createElement)(TagName // Overridable props.
  , _extends({
    role: "textbox",
    "aria-multiline": !disableLineBreaks,
    "aria-label": placeholder
  }, props, autocompleteProps, {
    ref: (0,external_wp_compose_namespaceObject.useMergeRefs)([forwardedRef, autocompleteProps.ref, props.ref, richTextRef, useInputRules({
      value,
      onChange,
      __unstableAllowPrefixTransformations,
      formatTypes,
      onReplace,
      selectionChange
    }), useRemoveBrowserShortcuts(), useShortcuts(keyboardShortcuts), useInputEvents(inputEvents), useUndoAutomaticChange(), usePasteHandler({
      isSelected,
      disableFormats,
      onChange,
      value,
      formatTypes,
      tagName,
      onReplace,
      onSplit,
      onSplitMiddle,
      __unstableEmbedURLOnPaste,
      multilineTag,
      preserveWhiteSpace,
      pastePlainText
    }), useEnter({
      removeEditorOnlyFormats,
      value,
      onReplace,
      onSplit,
      onSplitMiddle,
      multilineTag,
      onChange,
      disableLineBreaks,
      onSplitAtEnd
    }), useFirefoxCompat(), anchorRef]),
    contentEditable: true,
    suppressContentEditableWarning: true,
    className: classnames_default()('block-editor-rich-text__editable', props.className, 'rich-text'),
    onFocus: unstableOnFocus,
    onKeyDown: onKeyDown
  })));

  if (!wrapperClassName) {
    return content;
  }

  external_wp_deprecated_default()('wp.blockEditor.RichText wrapperClassName prop', {
    since: '5.4',
    alternative: 'className prop or create your own wrapper div',
    version: '6.2'
  });
  const className = classnames_default()('block-editor-rich-text', wrapperClassName);
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: className
  }, content);
}

const ForwardedRichTextContainer = (0,external_wp_element_namespaceObject.forwardRef)(RichTextWrapper);

ForwardedRichTextContainer.Content = _ref3 => {
  let {
    value,
    tagName: Tag,
    multiline,
    ...props
  } = _ref3;

  // Handle deprecated `children` and `node` sources.
  if (Array.isArray(value)) {
    value = external_wp_blocks_namespaceObject.children.toHTML(value);
  }

  const MultilineTag = getMultilineTag(multiline);

  if (!value && MultilineTag) {
    value = `<${MultilineTag}></${MultilineTag}>`;
  }

  const content = (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.RawHTML, null, value);

  if (Tag) {
    return (0,external_wp_element_namespaceObject.createElement)(Tag, (0,external_lodash_namespaceObject.omit)(props, ['format']), content);
  }

  return content;
};

ForwardedRichTextContainer.isEmpty = value => {
  return !value || value.length === 0;
};
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/rich-text/README.md
 */


/* harmony default export */ var rich_text = (ForwardedRichTextContainer);




;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/editable-text/index.js



/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */


const EditableText = (0,external_wp_element_namespaceObject.forwardRef)((props, ref) => {
  return (0,external_wp_element_namespaceObject.createElement)(rich_text, _extends({
    ref: ref
  }, props, {
    __unstableDisableFormats: true,
    preserveWhiteSpace: true
  }));
});

EditableText.Content = _ref => {
  let {
    value = '',
    tagName: Tag = 'div',
    ...props
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)(Tag, props, value);
};
/**
 * Renders an editable text input in which text formatting is not allowed.
 */


/* harmony default export */ var editable_text = (EditableText);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/plain-text/index.js



/**
 * External dependencies
 */


/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/plain-text/README.md
 */

const PlainText = (0,external_wp_element_namespaceObject.forwardRef)((_ref, ref) => {
  let {
    __experimentalVersion,
    ...props
  } = _ref;

  if (__experimentalVersion === 2) {
    return (0,external_wp_element_namespaceObject.createElement)(editable_text, _extends({
      ref: ref
    }, props));
  }

  const {
    className,
    onChange,
    ...remainingProps
  } = props;
  return (0,external_wp_element_namespaceObject.createElement)(lib/* default */.Z, _extends({
    ref: ref,
    className: classnames_default()('block-editor-plain-text', className),
    onChange: event => onChange(event.target.value)
  }, remainingProps));
});
/* harmony default export */ var plain_text = (PlainText);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/responsive-block-control/label.js


/**
 * WordPress dependencies
 */




function ResponsiveBlockControlLabel(_ref) {
  let {
    property,
    viewport,
    desc
  } = _ref;
  const instanceId = (0,external_wp_compose_namespaceObject.useInstanceId)(ResponsiveBlockControlLabel);
  const accessibleLabel = desc || (0,external_wp_i18n_namespaceObject.sprintf)(
  /* translators: 1: property name. 2: viewport name. */
  (0,external_wp_i18n_namespaceObject._x)('Controls the %1$s property for %2$s viewports.', 'Text labelling a interface as controlling a given layout property (eg: margin) for a given screen size.'), property, viewport.label);
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)("span", {
    "aria-describedby": `rbc-desc-${instanceId}`
  }, viewport.label), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.VisuallyHidden, {
    as: "span",
    id: `rbc-desc-${instanceId}`
  }, accessibleLabel));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/responsive-block-control/index.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */



function ResponsiveBlockControl(props) {
  const {
    title,
    property,
    toggleLabel,
    onIsResponsiveChange,
    renderDefaultControl,
    renderResponsiveControls,
    isResponsive = false,
    defaultLabel = {
      id: 'all',

      /* translators: 'Label. Used to signify a layout property (eg: margin, padding) will apply uniformly to all screensizes.' */
      label: (0,external_wp_i18n_namespaceObject.__)('All')
    },
    viewports = [{
      id: 'small',
      label: (0,external_wp_i18n_namespaceObject.__)('Small screens')
    }, {
      id: 'medium',
      label: (0,external_wp_i18n_namespaceObject.__)('Medium screens')
    }, {
      id: 'large',
      label: (0,external_wp_i18n_namespaceObject.__)('Large screens')
    }]
  } = props;

  if (!title || !property || !renderDefaultControl) {
    return null;
  }

  const toggleControlLabel = toggleLabel || (0,external_wp_i18n_namespaceObject.sprintf)(
  /* translators: 'Toggle control label. Should the property be the same across all screen sizes or unique per screen size.'. %s property value for the control (eg: margin, padding...etc) */
  (0,external_wp_i18n_namespaceObject.__)('Use the same %s on all screensizes.'), property);
  /* translators: 'Help text for the responsive mode toggle control.' */

  const toggleHelpText = (0,external_wp_i18n_namespaceObject.__)('Toggle between using the same value for all screen sizes or using a unique value per screen size.');

  const defaultControl = renderDefaultControl((0,external_wp_element_namespaceObject.createElement)(ResponsiveBlockControlLabel, {
    property: property,
    viewport: defaultLabel
  }), defaultLabel);

  const defaultResponsiveControls = () => {
    return viewports.map(viewport => (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, {
      key: viewport.id
    }, renderDefaultControl((0,external_wp_element_namespaceObject.createElement)(ResponsiveBlockControlLabel, {
      property: property,
      viewport: viewport
    }), viewport)));
  };

  return (0,external_wp_element_namespaceObject.createElement)("fieldset", {
    className: "block-editor-responsive-block-control"
  }, (0,external_wp_element_namespaceObject.createElement)("legend", {
    className: "block-editor-responsive-block-control__title"
  }, title), (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-responsive-block-control__inner"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToggleControl, {
    className: "block-editor-responsive-block-control__toggle",
    label: toggleControlLabel,
    checked: !isResponsive,
    onChange: onIsResponsiveChange,
    help: toggleHelpText
  }), (0,external_wp_element_namespaceObject.createElement)("div", {
    className: classnames_default()('block-editor-responsive-block-control__group', {
      'is-responsive': isResponsive
    })
  }, !isResponsive && defaultControl, isResponsive && (renderResponsiveControls ? renderResponsiveControls(viewports) : defaultResponsiveControls()))));
}

/* harmony default export */ var responsive_block_control = (ResponsiveBlockControl);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/shortcut.js
/**
 * WordPress dependencies
 */


/**
 * Internal dependencies
 */


function RichTextShortcut(_ref) {
  let {
    character,
    type,
    onUse
  } = _ref;
  const keyboardShortcuts = (0,external_wp_element_namespaceObject.useContext)(keyboardShortcutContext);
  const onUseRef = (0,external_wp_element_namespaceObject.useRef)();
  onUseRef.current = onUse;
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    function callback(event) {
      if (external_wp_keycodes_namespaceObject.isKeyboardEvent[type](event, character)) {
        onUseRef.current();
        event.preventDefault();
      }
    }

    keyboardShortcuts.current.add(callback);
    return () => {
      keyboardShortcuts.current.delete(callback);
    };
  }, [character, type]);
  return null;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/toolbar-button.js



/**
 * WordPress dependencies
 */


function RichTextToolbarButton(_ref) {
  let {
    name,
    shortcutType,
    shortcutCharacter,
    ...props
  } = _ref;
  let shortcut;
  let fillName = 'RichText.ToolbarControls';

  if (name) {
    fillName += `.${name}`;
  }

  if (shortcutType && shortcutCharacter) {
    shortcut = external_wp_keycodes_namespaceObject.displayShortcut[shortcutType](shortcutCharacter);
  }

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Fill, {
    name: fillName
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarButton, _extends({}, props, {
    shortcut: shortcut
  })));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/rich-text/input-event.js
/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */


function __unstableRichTextInputEvent(_ref) {
  let {
    inputType,
    onInput
  } = _ref;
  const callbacks = (0,external_wp_element_namespaceObject.useContext)(inputEventContext);
  const onInputRef = (0,external_wp_element_namespaceObject.useRef)();
  onInputRef.current = onInput;
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    function callback(event) {
      if (event.inputType === inputType) {
        onInputRef.current();
        event.preventDefault();
      }
    }

    callbacks.current.add(callback);
    return () => {
      callbacks.current.delete(callback);
    };
  }, [inputType]);
  return null;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/tool-selector/index.js



/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */


const selectIcon = (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  width: "24",
  height: "24",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Path, {
  d: "M9.4 20.5L5.2 3.8l14.6 9-2 .3c-.2 0-.4.1-.7.1-.9.2-1.6.3-2.2.5-.8.3-1.4.5-1.8.8-.4.3-.8.8-1.3 1.5-.4.5-.8 1.2-1.2 2l-.3.6-.9 1.9zM7.6 7.1l2.4 9.3c.2-.4.5-.8.7-1.1.6-.8 1.1-1.4 1.6-1.8.5-.4 1.3-.8 2.2-1.1l1.2-.3-8.1-5z"
}));

function ToolSelector(props, ref) {
  const isNavigationTool = (0,external_wp_data_namespaceObject.useSelect)(select => select(store).isNavigationMode(), []);
  const {
    setNavigationMode
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);

  const onSwitchMode = mode => {
    setNavigationMode(mode === 'edit' ? false : true);
  };

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Dropdown, {
    renderToggle: _ref => {
      let {
        isOpen,
        onToggle
      } = _ref;
      return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, _extends({}, props, {
        ref: ref,
        icon: isNavigationTool ? selectIcon : library_edit,
        "aria-expanded": isOpen,
        "aria-haspopup": "true",
        onClick: onToggle
        /* translators: button label text should, if possible, be under 16 characters. */
        ,
        label: (0,external_wp_i18n_namespaceObject.__)('Tools')
      }));
    },
    position: "bottom right",
    renderContent: () => (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.NavigableMenu, {
      role: "menu",
      "aria-label": (0,external_wp_i18n_namespaceObject.__)('Tools')
    }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItemsChoice, {
      value: isNavigationTool ? 'select' : 'edit',
      onSelect: onSwitchMode,
      choices: [{
        value: 'edit',
        label: (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(build_module_icon, {
          icon: library_edit
        }), (0,external_wp_i18n_namespaceObject.__)('Edit'))
      }, {
        value: 'select',
        label: (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, selectIcon, (0,external_wp_i18n_namespaceObject.__)('Select'))
      }]
    })), (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "block-editor-tool-selector__help"
    }, (0,external_wp_i18n_namespaceObject.__)('Tools provide different interactions for selecting, navigating, and editing blocks. Toggle between select and edit by pressing Escape and Enter.')))
  });
}

/* harmony default export */ var tool_selector = ((0,external_wp_element_namespaceObject.forwardRef)(ToolSelector));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/unit-control/index.js



/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */


function UnitControl(_ref) {
  let {
    units: unitsProp,
    ...props
  } = _ref;
  const units = (0,external_wp_components_namespaceObject.__experimentalUseCustomUnits)({
    availableUnits: useSetting('spacing.units') || ['%', 'px', 'em', 'rem', 'vw'],
    units: unitsProp
  });
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.__experimentalUnitControl, _extends({
    units: units
  }, props));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/arrow-left.js


/**
 * WordPress dependencies
 */

const arrowLeft = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M20 10.8H6.7l4.1-4.5-1.1-1.1-5.8 6.3 5.8 5.8 1.1-1.1-4-3.9H20z"
}));
/* harmony default export */ var arrow_left = (arrowLeft);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/url-input/button.js


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */



class URLInputButton extends external_wp_element_namespaceObject.Component {
  constructor() {
    super(...arguments);
    this.toggle = this.toggle.bind(this);
    this.submitLink = this.submitLink.bind(this);
    this.state = {
      expanded: false
    };
  }

  toggle() {
    this.setState({
      expanded: !this.state.expanded
    });
  }

  submitLink(event) {
    event.preventDefault();
    this.toggle();
  }

  render() {
    const {
      url,
      onChange
    } = this.props;
    const {
      expanded
    } = this.state;
    const buttonLabel = url ? (0,external_wp_i18n_namespaceObject.__)('Edit link') : (0,external_wp_i18n_namespaceObject.__)('Insert link');
    return (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "block-editor-url-input__button"
    }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
      icon: library_link,
      label: buttonLabel,
      onClick: this.toggle,
      className: "components-toolbar__control",
      isPressed: !!url
    }), expanded && (0,external_wp_element_namespaceObject.createElement)("form", {
      className: "block-editor-url-input__button-modal",
      onSubmit: this.submitLink
    }, (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "block-editor-url-input__button-modal-line"
    }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
      className: "block-editor-url-input__back",
      icon: arrow_left,
      label: (0,external_wp_i18n_namespaceObject.__)('Close'),
      onClick: this.toggle
    }), (0,external_wp_element_namespaceObject.createElement)(url_input, {
      value: url || '',
      onChange: onChange
    }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
      icon: keyboard_return,
      label: (0,external_wp_i18n_namespaceObject.__)('Submit'),
      type: "submit"
    }))));
  }

}
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/url-input/README.md
 */


/* harmony default export */ var url_input_button = (URLInputButton);

;// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/close.js


/**
 * WordPress dependencies
 */

const close_close = (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.SVG, {
  xmlns: "http://www.w3.org/2000/svg",
  viewBox: "0 0 24 24"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_primitives_namespaceObject.Path, {
  d: "M13 11.8l6.1-6.3-1-1-6.1 6.2-6.1-6.2-1 1 6.1 6.3-6.5 6.7 1 1 6.5-6.6 6.5 6.6 1-1z"
}));
/* harmony default export */ var library_close = (close_close);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/url-popover/image-url-input-ui.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */


const LINK_DESTINATION_NONE = 'none';
const LINK_DESTINATION_CUSTOM = 'custom';
const LINK_DESTINATION_MEDIA = 'media';
const LINK_DESTINATION_ATTACHMENT = 'attachment';
const NEW_TAB_REL = ['noreferrer', 'noopener'];
const icon = (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.SVG, {
  viewBox: "0 0 24 24",
  xmlns: "http://www.w3.org/2000/svg"
}, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Path, {
  d: "M0,0h24v24H0V0z",
  fill: "none"
}), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Path, {
  d: "m19 5v14h-14v-14h14m0-2h-14c-1.1 0-2 0.9-2 2v14c0 1.1 0.9 2 2 2h14c1.1 0 2-0.9 2-2v-14c0-1.1-0.9-2-2-2z"
}), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Path, {
  d: "m14.14 11.86l-3 3.87-2.14-2.59-3 3.86h12l-3.86-5.14z"
}));

const ImageURLInputUI = _ref => {
  let {
    linkDestination,
    onChangeUrl,
    url,
    mediaType = 'image',
    mediaUrl,
    mediaLink,
    linkTarget,
    linkClass,
    rel
  } = _ref;
  const [isOpen, setIsOpen] = (0,external_wp_element_namespaceObject.useState)(false);
  const openLinkUI = (0,external_wp_element_namespaceObject.useCallback)(() => {
    setIsOpen(true);
  });
  const [isEditingLink, setIsEditingLink] = (0,external_wp_element_namespaceObject.useState)(false);
  const [urlInput, setUrlInput] = (0,external_wp_element_namespaceObject.useState)(null);
  const autocompleteRef = (0,external_wp_element_namespaceObject.useRef)(null);
  const startEditLink = (0,external_wp_element_namespaceObject.useCallback)(() => {
    if (linkDestination === LINK_DESTINATION_MEDIA || linkDestination === LINK_DESTINATION_ATTACHMENT) {
      setUrlInput('');
    }

    setIsEditingLink(true);
  });
  const stopEditLink = (0,external_wp_element_namespaceObject.useCallback)(() => {
    setIsEditingLink(false);
  });
  const closeLinkUI = (0,external_wp_element_namespaceObject.useCallback)(() => {
    setUrlInput(null);
    stopEditLink();
    setIsOpen(false);
  });

  const getUpdatedLinkTargetSettings = value => {
    const newLinkTarget = value ? '_blank' : undefined;
    let updatedRel;

    if (newLinkTarget) {
      const rels = (rel !== null && rel !== void 0 ? rel : '').split(' ');
      NEW_TAB_REL.forEach(relVal => {
        if (!rels.includes(relVal)) {
          rels.push(relVal);
        }
      });
      updatedRel = rels.join(' ');
    } else {
      const rels = (rel !== null && rel !== void 0 ? rel : '').split(' ').filter(relVal => NEW_TAB_REL.includes(relVal) === false);
      updatedRel = rels.length ? rels.join(' ') : undefined;
    }

    return {
      linkTarget: newLinkTarget,
      rel: updatedRel
    };
  };

  const onFocusOutside = (0,external_wp_element_namespaceObject.useCallback)(() => {
    return event => {
      // The autocomplete suggestions list renders in a separate popover (in a portal),
      // so onFocusOutside fails to detect that a click on a suggestion occurred in the
      // LinkContainer. Detect clicks on autocomplete suggestions using a ref here, and
      // return to avoid the popover being closed.
      const autocompleteElement = autocompleteRef.current;

      if (autocompleteElement && autocompleteElement.contains(event.target)) {
        return;
      }

      setIsOpen(false);
      setUrlInput(null);
      stopEditLink();
    };
  });
  const onSubmitLinkChange = (0,external_wp_element_namespaceObject.useCallback)(() => {
    return event => {
      if (urlInput) {
        var _getLinkDestinations$;

        // It is possible the entered URL actually matches a named link destination.
        // This check will ensure our link destination is correct.
        const selectedDestination = ((_getLinkDestinations$ = getLinkDestinations().find(destination => destination.url === urlInput)) === null || _getLinkDestinations$ === void 0 ? void 0 : _getLinkDestinations$.linkDestination) || LINK_DESTINATION_CUSTOM;
        onChangeUrl({
          href: urlInput,
          linkDestination: selectedDestination
        });
      }

      stopEditLink();
      setUrlInput(null);
      event.preventDefault();
    };
  });
  const onLinkRemove = (0,external_wp_element_namespaceObject.useCallback)(() => {
    onChangeUrl({
      linkDestination: LINK_DESTINATION_NONE,
      href: ''
    });
  });

  const getLinkDestinations = () => {
    const linkDestinations = [{
      linkDestination: LINK_DESTINATION_MEDIA,
      title: (0,external_wp_i18n_namespaceObject.__)('Media File'),
      url: mediaType === 'image' ? mediaUrl : undefined,
      icon
    }];

    if (mediaType === 'image' && mediaLink) {
      linkDestinations.push({
        linkDestination: LINK_DESTINATION_ATTACHMENT,
        title: (0,external_wp_i18n_namespaceObject.__)('Attachment Page'),
        url: mediaType === 'image' ? mediaLink : undefined,
        icon: (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.SVG, {
          viewBox: "0 0 24 24",
          xmlns: "http://www.w3.org/2000/svg"
        }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Path, {
          d: "M0 0h24v24H0V0z",
          fill: "none"
        }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Path, {
          d: "M14 2H6c-1.1 0-1.99.9-1.99 2L4 20c0 1.1.89 2 1.99 2H18c1.1 0 2-.9 2-2V8l-6-6zM6 20V4h7v5h5v11H6z"
        }))
      });
    }

    return linkDestinations;
  };

  const onSetHref = value => {
    const linkDestinations = getLinkDestinations();
    let linkDestinationInput;

    if (!value) {
      linkDestinationInput = LINK_DESTINATION_NONE;
    } else {
      linkDestinationInput = ((0,external_lodash_namespaceObject.find)(linkDestinations, destination => {
        return destination.url === value;
      }) || {
        linkDestination: LINK_DESTINATION_CUSTOM
      }).linkDestination;
    }

    onChangeUrl({
      linkDestination: linkDestinationInput,
      href: value
    });
  };

  const onSetNewTab = value => {
    const updatedLinkTarget = getUpdatedLinkTargetSettings(value);
    onChangeUrl(updatedLinkTarget);
  };

  const onSetLinkRel = value => {
    onChangeUrl({
      rel: value
    });
  };

  const onSetLinkClass = value => {
    onChangeUrl({
      linkClass: value
    });
  };

  const advancedOptions = (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToggleControl, {
    label: (0,external_wp_i18n_namespaceObject.__)('Open in new tab'),
    onChange: onSetNewTab,
    checked: linkTarget === '_blank'
  }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.TextControl, {
    label: (0,external_wp_i18n_namespaceObject.__)('Link Rel'),
    value: rel !== null && rel !== void 0 ? rel : '',
    onChange: onSetLinkRel
  }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.TextControl, {
    label: (0,external_wp_i18n_namespaceObject.__)('Link CSS Class'),
    value: linkClass || '',
    onChange: onSetLinkClass
  }));
  const linkEditorValue = urlInput !== null ? urlInput : url;
  const urlLabel = ((0,external_lodash_namespaceObject.find)(getLinkDestinations(), ['linkDestination', linkDestination]) || {}).title;
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.ToolbarButton, {
    icon: library_link,
    className: "components-toolbar__control",
    label: url ? (0,external_wp_i18n_namespaceObject.__)('Edit link') : (0,external_wp_i18n_namespaceObject.__)('Insert link'),
    "aria-expanded": isOpen,
    onClick: openLinkUI
  }), isOpen && (0,external_wp_element_namespaceObject.createElement)(url_popover, {
    onFocusOutside: onFocusOutside(),
    onClose: closeLinkUI,
    renderSettings: () => advancedOptions,
    additionalControls: !linkEditorValue && (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.NavigableMenu, null, (0,external_lodash_namespaceObject.map)(getLinkDestinations(), link => (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
      key: link.linkDestination,
      icon: link.icon,
      onClick: () => {
        setUrlInput(null);
        onSetHref(link.url);
        stopEditLink();
      }
    }, link.title)))
  }, (!url || isEditingLink) && (0,external_wp_element_namespaceObject.createElement)(url_popover.LinkEditor, {
    className: "block-editor-format-toolbar__link-container-content",
    value: linkEditorValue,
    onChangeInputValue: setUrlInput,
    onSubmit: onSubmitLinkChange(),
    autocompleteRef: autocompleteRef
  }), url && !isEditingLink && (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(url_popover.LinkViewer, {
    className: "block-editor-format-toolbar__link-container-content",
    url: url,
    onEditLinkClick: startEditLink,
    urlLabel: urlLabel
  }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    icon: library_close,
    label: (0,external_wp_i18n_namespaceObject.__)('Remove link'),
    onClick: onLinkRemove
  }))));
};



;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/preview-options/index.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */





function PreviewOptions(_ref) {
  let {
    children,
    className,
    isEnabled = true,
    deviceType,
    setDeviceType
  } = _ref;
  const isMobile = (0,external_wp_compose_namespaceObject.useViewportMatch)('small', '<');
  if (isMobile) return null;
  const popoverProps = {
    className: classnames_default()(className, 'block-editor-post-preview__dropdown-content'),
    position: 'bottom left'
  };
  const toggleProps = {
    variant: 'tertiary',
    className: 'block-editor-post-preview__button-toggle',
    disabled: !isEnabled,

    /* translators: button label text should, if possible, be under 16 characters. */
    children: (0,external_wp_i18n_namespaceObject.__)('Preview')
  };
  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.DropdownMenu, {
    className: "block-editor-post-preview__dropdown",
    popoverProps: popoverProps,
    toggleProps: toggleProps,
    icon: null
  }, () => (0,external_wp_element_namespaceObject.createElement)(external_wp_element_namespaceObject.Fragment, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuGroup, null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
    className: "block-editor-post-preview__button-resize",
    onClick: () => setDeviceType('Desktop'),
    icon: deviceType === 'Desktop' && library_check
  }, (0,external_wp_i18n_namespaceObject.__)('Desktop')), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
    className: "block-editor-post-preview__button-resize",
    onClick: () => setDeviceType('Tablet'),
    icon: deviceType === 'Tablet' && library_check
  }, (0,external_wp_i18n_namespaceObject.__)('Tablet')), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.MenuItem, {
    className: "block-editor-post-preview__button-resize",
    onClick: () => setDeviceType('Mobile'),
    icon: deviceType === 'Mobile' && library_check
  }, (0,external_wp_i18n_namespaceObject.__)('Mobile'))), children));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/use-resize-canvas/index.js
/**
 * WordPress dependencies
 */

/**
 * Function to resize the editor window.
 *
 * @param {string} deviceType Used for determining the size of the container (e.g. Desktop, Tablet, Mobile)
 *
 * @return {Object} Inline styles to be added to resizable container.
 */

function useResizeCanvas(deviceType) {
  const [actualWidth, updateActualWidth] = (0,external_wp_element_namespaceObject.useState)(window.innerWidth);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    if (deviceType === 'Desktop') {
      return;
    }

    const resizeListener = () => updateActualWidth(window.innerWidth);

    window.addEventListener('resize', resizeListener);
    return () => {
      window.removeEventListener('resize', resizeListener);
    };
  }, [deviceType]);

  const getCanvasWidth = device => {
    let deviceWidth;

    switch (device) {
      case 'Tablet':
        deviceWidth = 780;
        break;

      case 'Mobile':
        deviceWidth = 360;
        break;

      default:
        return null;
    }

    return deviceWidth < actualWidth ? deviceWidth : actualWidth;
  };

  const marginValue = () => window.innerHeight < 800 ? 36 : 72;

  const contentInlineStyles = device => {
    const height = device === 'Mobile' ? '768px' : '1024px';

    switch (device) {
      case 'Tablet':
      case 'Mobile':
        return {
          width: getCanvasWidth(device),
          margin: marginValue() + 'px auto',
          height,
          borderRadius: '2px 2px 2px 2px',
          border: '1px solid #ddd',
          overflowY: 'auto'
        };

      default:
        return null;
    }
  };

  return contentInlineStyles(deviceType);
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/skip-to-selected-block/index.js


/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */




const SkipToSelectedBlock = _ref => {
  let {
    selectedBlockClientId
  } = _ref;
  const ref = useBlockRef(selectedBlockClientId);

  const onClick = () => {
    ref.current.focus();
  };

  return selectedBlockClientId ? (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Button, {
    variant: "secondary",
    className: "block-editor-skip-to-selected-block",
    onClick: onClick
  }, (0,external_wp_i18n_namespaceObject.__)('Skip to the selected block')) : null;
};
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/skip-to-selected-block/README.md
 */


/* harmony default export */ var skip_to_selected_block = ((0,external_wp_data_namespaceObject.withSelect)(select => {
  return {
    selectedBlockClientId: select(store).getBlockSelectionStart()
  };
})(SkipToSelectedBlock));

;// CONCATENATED MODULE: external ["wp","wordcount"]
var external_wp_wordcount_namespaceObject = window["wp"]["wordcount"];
;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/multi-selection-inspector/index.js


/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */




function MultiSelectionInspector(_ref) {
  let {
    blocks
  } = _ref;
  const words = (0,external_wp_wordcount_namespaceObject.count)((0,external_wp_blocks_namespaceObject.serialize)(blocks), 'words');
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-multi-selection-inspector__card"
  }, (0,external_wp_element_namespaceObject.createElement)(block_icon, {
    icon: library_copy,
    showColors: true
  }), (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-multi-selection-inspector__card-content"
  }, (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-multi-selection-inspector__card-title"
  }, (0,external_wp_i18n_namespaceObject.sprintf)(
  /* translators: %d: number of blocks */
  (0,external_wp_i18n_namespaceObject._n)('%d block', '%d blocks', blocks.length), blocks.length)), (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-multi-selection-inspector__card-description"
  }, (0,external_wp_i18n_namespaceObject.sprintf)(
  /* translators: %d: number of words */
  (0,external_wp_i18n_namespaceObject._n)('%d word', '%d words', words), words))));
}

/* harmony default export */ var multi_selection_inspector = ((0,external_wp_data_namespaceObject.withSelect)(select => {
  const {
    getMultiSelectedBlocks
  } = select(store);
  return {
    blocks: getMultiSelectedBlocks()
  };
})(MultiSelectionInspector));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/default-style-picker/index.js


/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */



function DefaultStylePicker(_ref) {
  let {
    blockName
  } = _ref;
  const {
    preferredStyle,
    onUpdatePreferredStyleVariations,
    styles
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    var _preferredStyleVariat, _preferredStyleVariat2;

    const settings = select(store).getSettings();
    const preferredStyleVariations = settings.__experimentalPreferredStyleVariations;
    return {
      preferredStyle: preferredStyleVariations === null || preferredStyleVariations === void 0 ? void 0 : (_preferredStyleVariat = preferredStyleVariations.value) === null || _preferredStyleVariat === void 0 ? void 0 : _preferredStyleVariat[blockName],
      onUpdatePreferredStyleVariations: (_preferredStyleVariat2 = preferredStyleVariations === null || preferredStyleVariations === void 0 ? void 0 : preferredStyleVariations.onChange) !== null && _preferredStyleVariat2 !== void 0 ? _preferredStyleVariat2 : null,
      styles: select(external_wp_blocks_namespaceObject.store).getBlockStyles(blockName)
    };
  }, [blockName]);
  const selectOptions = (0,external_wp_element_namespaceObject.useMemo)(() => [{
    label: (0,external_wp_i18n_namespaceObject.__)('Not set'),
    value: ''
  }, ...styles.map(_ref2 => {
    let {
      label,
      name
    } = _ref2;
    return {
      label,
      value: name
    };
  })], [styles]);
  const defaultStyleName = (0,external_wp_element_namespaceObject.useMemo)(() => {
    var _getDefaultStyle;

    return (_getDefaultStyle = getDefaultStyle(styles)) === null || _getDefaultStyle === void 0 ? void 0 : _getDefaultStyle.name;
  }, [styles]);
  const selectOnChange = (0,external_wp_element_namespaceObject.useCallback)(blockStyle => {
    onUpdatePreferredStyleVariations(blockName, blockStyle);
  }, [blockName, onUpdatePreferredStyleVariations]); // Until the functionality is migrated to global styles,
  // only show the default style picker if a non-default style has already been selected.

  if (!preferredStyle || preferredStyle === defaultStyleName) {
    return null;
  }

  return onUpdatePreferredStyleVariations && (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "default-style-picker__default-switcher"
  }, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.SelectControl, {
    options: selectOptions,
    value: preferredStyle || '',
    label: (0,external_wp_i18n_namespaceObject.__)('Default Style'),
    onChange: selectOnChange
  }));
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-inspector/index.js


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */











const BlockInspector = _ref => {
  let {
    showNoBlockSelectedMessage = true
  } = _ref;
  const {
    count,
    hasBlockStyles,
    selectedBlockName,
    selectedBlockClientId,
    blockType
  } = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getSelectedBlockClientId,
      getSelectedBlockCount,
      getBlockName
    } = select(store);
    const {
      getBlockStyles
    } = select(external_wp_blocks_namespaceObject.store);

    const _selectedBlockClientId = getSelectedBlockClientId();

    const _selectedBlockName = _selectedBlockClientId && getBlockName(_selectedBlockClientId);

    const _blockType = _selectedBlockName && (0,external_wp_blocks_namespaceObject.getBlockType)(_selectedBlockName);

    const blockStyles = _selectedBlockName && getBlockStyles(_selectedBlockName);

    return {
      count: getSelectedBlockCount(),
      selectedBlockClientId: _selectedBlockClientId,
      selectedBlockName: _selectedBlockName,
      blockType: _blockType,
      hasBlockStyles: blockStyles && blockStyles.length > 0
    };
  }, []);

  if (count > 1) {
    return (0,external_wp_element_namespaceObject.createElement)("div", {
      className: "block-editor-block-inspector"
    }, (0,external_wp_element_namespaceObject.createElement)(multi_selection_inspector, null), (0,external_wp_element_namespaceObject.createElement)(inspector_controls.Slot, null), (0,external_wp_element_namespaceObject.createElement)(inspector_controls.Slot, {
      __experimentalGroup: "color",
      label: (0,external_wp_i18n_namespaceObject.__)('Color'),
      className: "color-block-support-panel__inner-wrapper"
    }), (0,external_wp_element_namespaceObject.createElement)(inspector_controls.Slot, {
      __experimentalGroup: "typography",
      label: (0,external_wp_i18n_namespaceObject.__)('Typography')
    }), (0,external_wp_element_namespaceObject.createElement)(inspector_controls.Slot, {
      __experimentalGroup: "dimensions",
      label: (0,external_wp_i18n_namespaceObject.__)('Dimensions')
    }), (0,external_wp_element_namespaceObject.createElement)(inspector_controls.Slot, {
      __experimentalGroup: "border",
      label: (0,external_wp_i18n_namespaceObject.__)('Border')
    }));
  }

  const isSelectedBlockUnregistered = selectedBlockName === (0,external_wp_blocks_namespaceObject.getUnregisteredTypeHandlerName)();
  /*
   * If the selected block is of an unregistered type, avoid showing it as an actual selection
   * because we want the user to focus on the unregistered block warning, not block settings.
   */

  if (!blockType || !selectedBlockClientId || isSelectedBlockUnregistered) {
    if (showNoBlockSelectedMessage) {
      return (0,external_wp_element_namespaceObject.createElement)("span", {
        className: "block-editor-block-inspector__no-blocks"
      }, (0,external_wp_i18n_namespaceObject.__)('No block selected.'));
    }

    return null;
  }

  return (0,external_wp_element_namespaceObject.createElement)(BlockInspectorSingleBlock, {
    clientId: selectedBlockClientId,
    blockName: blockType.name,
    hasBlockStyles: hasBlockStyles
  });
};

const BlockInspectorSingleBlock = _ref2 => {
  let {
    clientId,
    blockName,
    hasBlockStyles
  } = _ref2;
  const blockInformation = useBlockDisplayInformation(clientId);
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    className: "block-editor-block-inspector"
  }, (0,external_wp_element_namespaceObject.createElement)(block_card, blockInformation), (0,external_wp_element_namespaceObject.createElement)(block_variation_transforms, {
    blockClientId: clientId
  }), hasBlockStyles && (0,external_wp_element_namespaceObject.createElement)("div", null, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.PanelBody, {
    title: (0,external_wp_i18n_namespaceObject.__)('Styles')
  }, (0,external_wp_element_namespaceObject.createElement)(block_styles, {
    scope: "core/block-inspector",
    clientId: clientId
  }), (0,external_wp_blocks_namespaceObject.hasBlockSupport)(blockName, 'defaultStylePicker', true) && (0,external_wp_element_namespaceObject.createElement)(DefaultStylePicker, {
    blockName: blockName
  }))), (0,external_wp_element_namespaceObject.createElement)(inspector_controls.Slot, null), (0,external_wp_element_namespaceObject.createElement)(inspector_controls.Slot, {
    __experimentalGroup: "color",
    label: (0,external_wp_i18n_namespaceObject.__)('Color'),
    className: "color-block-support-panel__inner-wrapper"
  }), (0,external_wp_element_namespaceObject.createElement)(inspector_controls.Slot, {
    __experimentalGroup: "typography",
    label: (0,external_wp_i18n_namespaceObject.__)('Typography')
  }), (0,external_wp_element_namespaceObject.createElement)(inspector_controls.Slot, {
    __experimentalGroup: "dimensions",
    label: (0,external_wp_i18n_namespaceObject.__)('Dimensions')
  }), (0,external_wp_element_namespaceObject.createElement)(inspector_controls.Slot, {
    __experimentalGroup: "border",
    label: (0,external_wp_i18n_namespaceObject.__)('Border')
  }), (0,external_wp_element_namespaceObject.createElement)("div", null, (0,external_wp_element_namespaceObject.createElement)(AdvancedControls, null)), (0,external_wp_element_namespaceObject.createElement)(skip_to_selected_block, {
    key: "back"
  }));
};

const AdvancedControls = () => {
  const slot = (0,external_wp_components_namespaceObject.__experimentalUseSlot)(InspectorAdvancedControls.slotName);
  const hasFills = Boolean(slot.fills && slot.fills.length);

  if (!hasFills) {
    return null;
  }

  return (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.PanelBody, {
    className: "block-editor-block-inspector__advanced",
    title: (0,external_wp_i18n_namespaceObject.__)('Advanced'),
    initialOpen: false
  }, (0,external_wp_element_namespaceObject.createElement)(inspector_controls.Slot, {
    __experimentalGroup: "advanced"
  }));
};
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/block-inspector/README.md
 */


/* harmony default export */ var block_inspector = (BlockInspector);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/block-tools/index.js



/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */





/**
 * Internal dependencies
 */






/**
 * Renders block tools (the block toolbar, select/navigation mode toolbar, the
 * insertion point and a slot for the inline rich text toolbar). Must be wrapped
 * around the block content and editor styles wrapper or iframe.
 *
 * @param {Object} $0                      Props.
 * @param {Object} $0.children             The block content and style container.
 * @param {Object} $0.__unstableContentRef Ref holding the content scroll container.
 */

function BlockTools(_ref) {
  let {
    children,
    __unstableContentRef,
    ...props
  } = _ref;
  const isLargeViewport = (0,external_wp_compose_namespaceObject.useViewportMatch)('medium');
  const hasFixedToolbar = (0,external_wp_data_namespaceObject.useSelect)(select => select(store).getSettings().hasFixedToolbar, []);
  const isMatch = (0,external_wp_keyboardShortcuts_namespaceObject.__unstableUseShortcutEventMatch)();
  const {
    getSelectedBlockClientIds,
    getBlockRootClientId
  } = (0,external_wp_data_namespaceObject.useSelect)(store);
  const {
    duplicateBlocks,
    removeBlocks,
    insertAfterBlock,
    insertBeforeBlock,
    clearSelectedBlock,
    moveBlocksUp,
    moveBlocksDown
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);

  function onKeyDown(event) {
    if (isMatch('core/block-editor/move-up', event)) {
      const clientIds = getSelectedBlockClientIds();

      if (clientIds.length) {
        event.preventDefault();
        const rootClientId = getBlockRootClientId((0,external_lodash_namespaceObject.first)(clientIds));
        moveBlocksUp(clientIds, rootClientId);
      }
    } else if (isMatch('core/block-editor/move-down', event)) {
      const clientIds = getSelectedBlockClientIds();

      if (clientIds.length) {
        event.preventDefault();
        const rootClientId = getBlockRootClientId((0,external_lodash_namespaceObject.first)(clientIds));
        moveBlocksDown(clientIds, rootClientId);
      }
    } else if (isMatch('core/block-editor/duplicate', event)) {
      const clientIds = getSelectedBlockClientIds();

      if (clientIds.length) {
        event.preventDefault();
        duplicateBlocks(clientIds);
      }
    } else if (isMatch('core/block-editor/remove', event)) {
      const clientIds = getSelectedBlockClientIds();

      if (clientIds.length) {
        event.preventDefault();
        removeBlocks(clientIds);
      }
    } else if (isMatch('core/block-editor/insert-after', event)) {
      const clientIds = getSelectedBlockClientIds();

      if (clientIds.length) {
        event.preventDefault();
        insertAfterBlock((0,external_lodash_namespaceObject.last)(clientIds));
      }
    } else if (isMatch('core/block-editor/insert-before', event)) {
      const clientIds = getSelectedBlockClientIds();

      if (clientIds.length) {
        event.preventDefault();
        insertBeforeBlock((0,external_lodash_namespaceObject.first)(clientIds));
      }
    } else if (isMatch('core/block-editor/unselect', event)) {
      const clientIds = getSelectedBlockClientIds();

      if (clientIds.length > 1) {
        event.preventDefault();
        clearSelectedBlock();
        event.target.ownerDocument.defaultView.getSelection().removeAllRanges();
      }
    }
  }

  return (// eslint-disable-next-line jsx-a11y/no-static-element-interactions
    (0,external_wp_element_namespaceObject.createElement)("div", _extends({}, props, {
      onKeyDown: onKeyDown
    }), (0,external_wp_element_namespaceObject.createElement)(InsertionPoint, {
      __unstableContentRef: __unstableContentRef
    }, (hasFixedToolbar || !isLargeViewport) && (0,external_wp_element_namespaceObject.createElement)(block_contextual_toolbar, {
      isFixed: true
    }), (0,external_wp_element_namespaceObject.createElement)(WrappedBlockPopover, {
      __unstableContentRef: __unstableContentRef
    }), (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Popover.Slot, {
      name: "block-toolbar",
      ref: usePopoverScroll(__unstableContentRef)
    }), children, (0,external_wp_element_namespaceObject.createElement)(external_wp_components_namespaceObject.Popover.Slot, {
      name: "__unstable-block-tools-after",
      ref: usePopoverScroll(__unstableContentRef)
    })))
  );
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/inserter/library.js


/**
 * External dependencies
 */

/**
 * WordPress dependencies
 */



/**
 * Internal dependencies
 */




function InserterLibrary(_ref, ref) {
  let {
    rootClientId,
    clientId,
    isAppender,
    showInserterHelpPanel,
    showMostUsedBlocks = false,
    __experimentalInsertionIndex,
    __experimentalFilterValue,
    onSelect = external_lodash_namespaceObject.noop,
    shouldFocusBlock = false
  } = _ref;
  const destinationRootClientId = (0,external_wp_data_namespaceObject.useSelect)(select => {
    const {
      getBlockRootClientId
    } = select(store);
    return rootClientId || getBlockRootClientId(clientId) || undefined;
  }, [clientId, rootClientId]);
  return (0,external_wp_element_namespaceObject.createElement)(menu, {
    onSelect: onSelect,
    rootClientId: destinationRootClientId,
    clientId: clientId,
    isAppender: isAppender,
    showInserterHelpPanel: showInserterHelpPanel,
    showMostUsedBlocks: showMostUsedBlocks,
    __experimentalInsertionIndex: __experimentalInsertionIndex,
    __experimentalFilterValue: __experimentalFilterValue,
    shouldFocusBlock: shouldFocusBlock,
    ref: ref
  });
}

/* harmony default export */ var library = ((0,external_wp_element_namespaceObject.forwardRef)(InserterLibrary));

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/keyboard-shortcuts/index.js
/**
 * WordPress dependencies
 */





function KeyboardShortcuts() {
  return null;
}

function KeyboardShortcutsRegister() {
  // Registering the shortcuts.
  const {
    registerShortcut
  } = (0,external_wp_data_namespaceObject.useDispatch)(external_wp_keyboardShortcuts_namespaceObject.store);
  (0,external_wp_element_namespaceObject.useEffect)(() => {
    registerShortcut({
      name: 'core/block-editor/duplicate',
      category: 'block',
      description: (0,external_wp_i18n_namespaceObject.__)('Duplicate the selected block(s).'),
      keyCombination: {
        modifier: 'primaryShift',
        character: 'd'
      }
    });
    registerShortcut({
      name: 'core/block-editor/remove',
      category: 'block',
      description: (0,external_wp_i18n_namespaceObject.__)('Remove the selected block(s).'),
      keyCombination: {
        modifier: 'access',
        character: 'z'
      }
    });
    registerShortcut({
      name: 'core/block-editor/insert-before',
      category: 'block',
      description: (0,external_wp_i18n_namespaceObject.__)('Insert a new block before the selected block(s).'),
      keyCombination: {
        modifier: 'primaryAlt',
        character: 't'
      }
    });
    registerShortcut({
      name: 'core/block-editor/insert-after',
      category: 'block',
      description: (0,external_wp_i18n_namespaceObject.__)('Insert a new block after the selected block(s).'),
      keyCombination: {
        modifier: 'primaryAlt',
        character: 'y'
      }
    });
    registerShortcut({
      name: 'core/block-editor/delete-multi-selection',
      category: 'block',
      description: (0,external_wp_i18n_namespaceObject.__)('Delete selection.'),
      keyCombination: {
        character: 'del'
      },
      aliases: [{
        character: 'backspace'
      }]
    });
    registerShortcut({
      name: 'core/block-editor/select-all',
      category: 'selection',
      description: (0,external_wp_i18n_namespaceObject.__)('Select all text when typing. Press again to select all blocks.'),
      keyCombination: {
        modifier: 'primary',
        character: 'a'
      }
    });
    registerShortcut({
      name: 'core/block-editor/unselect',
      category: 'selection',
      description: (0,external_wp_i18n_namespaceObject.__)('Clear selection.'),
      keyCombination: {
        character: 'escape'
      }
    });
    registerShortcut({
      name: 'core/block-editor/focus-toolbar',
      category: 'global',
      description: (0,external_wp_i18n_namespaceObject.__)('Navigate to the nearest toolbar.'),
      keyCombination: {
        modifier: 'alt',
        character: 'F10'
      }
    });
    registerShortcut({
      name: 'core/block-editor/move-up',
      category: 'block',
      description: (0,external_wp_i18n_namespaceObject.__)('Move the selected block(s) up.'),
      keyCombination: {
        modifier: 'secondary',
        character: 't'
      }
    });
    registerShortcut({
      name: 'core/block-editor/move-down',
      category: 'block',
      description: (0,external_wp_i18n_namespaceObject.__)('Move the selected block(s) down.'),
      keyCombination: {
        modifier: 'secondary',
        character: 'y'
      }
    });
  }, [registerShortcut]);
  return null;
}

KeyboardShortcuts.Register = KeyboardShortcutsRegister;
/* harmony default export */ var keyboard_shortcuts = (KeyboardShortcuts);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/selection-scroll-into-view/index.js
/**
 * WordPress dependencies
 */

/**
 * Scrolls the multi block selection end into view if not in view already. This
 * is important to do after selection by keyboard.
 *
 * @deprecated
 */

function MultiSelectScrollIntoView() {
  external_wp_deprecated_default()('wp.blockEditor.MultiSelectScrollIntoView', {
    hint: 'This behaviour is now built-in.',
    since: '5.8'
  });
  return null;
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/observe-typing/index.js


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */


/**
 * Set of key codes upon which typing is to be initiated on a keydown event.
 *
 * @type {Set<number>}
 */

const KEY_DOWN_ELIGIBLE_KEY_CODES = new Set([external_wp_keycodes_namespaceObject.UP, external_wp_keycodes_namespaceObject.RIGHT, external_wp_keycodes_namespaceObject.DOWN, external_wp_keycodes_namespaceObject.LEFT, external_wp_keycodes_namespaceObject.ENTER, external_wp_keycodes_namespaceObject.BACKSPACE]);
/**
 * Returns true if a given keydown event can be inferred as intent to start
 * typing, or false otherwise. A keydown is considered eligible if it is a
 * text navigation without shift active.
 *
 * @param {KeyboardEvent} event Keydown event to test.
 *
 * @return {boolean} Whether event is eligible to start typing.
 */

function isKeyDownEligibleForStartTyping(event) {
  const {
    keyCode,
    shiftKey
  } = event;
  return !shiftKey && KEY_DOWN_ELIGIBLE_KEY_CODES.has(keyCode);
}
/**
 * Removes the `isTyping` flag when the mouse moves in the document of the given
 * element.
 */


function useMouseMoveTypingReset() {
  const isTyping = (0,external_wp_data_namespaceObject.useSelect)(select => select(store).isTyping(), []);
  const {
    stopTyping
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    if (!isTyping) {
      return;
    }

    const {
      ownerDocument
    } = node;
    let lastClientX;
    let lastClientY;
    /**
     * On mouse move, unset typing flag if user has moved cursor.
     *
     * @param {MouseEvent} event Mousemove event.
     */

    function stopTypingOnMouseMove(event) {
      const {
        clientX,
        clientY
      } = event; // We need to check that the mouse really moved because Safari
      // triggers mousemove events when shift or ctrl are pressed.

      if (lastClientX && lastClientY && (lastClientX !== clientX || lastClientY !== clientY)) {
        stopTyping();
      }

      lastClientX = clientX;
      lastClientY = clientY;
    }

    ownerDocument.addEventListener('mousemove', stopTypingOnMouseMove);
    return () => {
      ownerDocument.removeEventListener('mousemove', stopTypingOnMouseMove);
    };
  }, [isTyping, stopTyping]);
}
/**
 * Sets and removes the `isTyping` flag based on user actions:
 *
 * - Sets the flag if the user types within the given element.
 * - Removes the flag when the user selects some text, focusses a non-text
 *   field, presses ESC or TAB, or moves the mouse in the document.
 */

function useTypingObserver() {
  const isTyping = (0,external_wp_data_namespaceObject.useSelect)(select => select(store).isTyping());
  const {
    startTyping,
    stopTyping
  } = (0,external_wp_data_namespaceObject.useDispatch)(store);
  const ref1 = useMouseMoveTypingReset();
  const ref2 = (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    const {
      ownerDocument
    } = node;
    const {
      defaultView
    } = ownerDocument; // Listeners to stop typing should only be added when typing.
    // Listeners to start typing should only be added when not typing.

    if (isTyping) {
      let timerId;
      /**
       * Stops typing when focus transitions to a non-text field element.
       *
       * @param {FocusEvent} event Focus event.
       */

      function stopTypingOnNonTextField(event) {
        const {
          target
        } = event; // Since focus to a non-text field via arrow key will trigger
        // before the keydown event, wait until after current stack
        // before evaluating whether typing is to be stopped. Otherwise,
        // typing will re-start.

        timerId = defaultView.setTimeout(() => {
          if (!(0,external_wp_dom_namespaceObject.isTextField)(target)) {
            stopTyping();
          }
        });
      }
      /**
       * Unsets typing flag if user presses Escape while typing flag is
       * active.
       *
       * @param {KeyboardEvent} event Keypress or keydown event to
       *                              interpret.
       */


      function stopTypingOnEscapeKey(event) {
        const {
          keyCode
        } = event;

        if (keyCode === external_wp_keycodes_namespaceObject.ESCAPE || keyCode === external_wp_keycodes_namespaceObject.TAB) {
          stopTyping();
        }
      }
      /**
       * On selection change, unset typing flag if user has made an
       * uncollapsed (shift) selection.
       */


      function stopTypingOnSelectionUncollapse() {
        const selection = defaultView.getSelection();
        const isCollapsed = selection.rangeCount > 0 && selection.getRangeAt(0).collapsed;

        if (!isCollapsed) {
          stopTyping();
        }
      }

      node.addEventListener('focus', stopTypingOnNonTextField);
      node.addEventListener('keydown', stopTypingOnEscapeKey);
      ownerDocument.addEventListener('selectionchange', stopTypingOnSelectionUncollapse);
      return () => {
        defaultView.clearTimeout(timerId);
        node.removeEventListener('focus', stopTypingOnNonTextField);
        node.removeEventListener('keydown', stopTypingOnEscapeKey);
        ownerDocument.removeEventListener('selectionchange', stopTypingOnSelectionUncollapse);
      };
    }
    /**
     * Handles a keypress or keydown event to infer intention to start
     * typing.
     *
     * @param {KeyboardEvent} event Keypress or keydown event to interpret.
     */


    function startTypingInTextField(event) {
      const {
        type,
        target
      } = event; // Abort early if already typing, or key press is incurred outside a
      // text field (e.g. arrow-ing through toolbar buttons).
      // Ignore typing if outside the current DOM container

      if (!(0,external_wp_dom_namespaceObject.isTextField)(target) || !node.contains(target)) {
        return;
      } // Special-case keydown because certain keys do not emit a keypress
      // event. Conversely avoid keydown as the canonical event since
      // there are many keydown which are explicitly not targeted for
      // typing.


      if (type === 'keydown' && !isKeyDownEligibleForStartTyping(event)) {
        return;
      }

      startTyping();
    }

    node.addEventListener('keypress', startTypingInTextField);
    node.addEventListener('keydown', startTypingInTextField);
    return () => {
      node.removeEventListener('keypress', startTypingInTextField);
      node.removeEventListener('keydown', startTypingInTextField);
    };
  }, [isTyping, startTyping, stopTyping]);
  return (0,external_wp_compose_namespaceObject.useMergeRefs)([ref1, ref2]);
}

function ObserveTyping(_ref) {
  let {
    children
  } = _ref;
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    ref: useTypingObserver()
  }, children);
}
/**
 * @see https://github.com/WordPress/gutenberg/blob/HEAD/packages/block-editor/src/components/observe-typing/README.md
 */


/* harmony default export */ var observe_typing = (ObserveTyping);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/typewriter/index.js


/**
 * WordPress dependencies
 */




/**
 * Internal dependencies
 */


const isIE = window.navigator.userAgent.indexOf('Trident') !== -1;
const arrowKeyCodes = new Set([external_wp_keycodes_namespaceObject.UP, external_wp_keycodes_namespaceObject.DOWN, external_wp_keycodes_namespaceObject.LEFT, external_wp_keycodes_namespaceObject.RIGHT]);
const initialTriggerPercentage = 0.75;
function useTypewriter() {
  const hasSelectedBlock = (0,external_wp_data_namespaceObject.useSelect)(select => select(store).hasSelectedBlock(), []);
  return (0,external_wp_compose_namespaceObject.useRefEffect)(node => {
    if (!hasSelectedBlock) {
      return;
    }

    const {
      ownerDocument
    } = node;
    const {
      defaultView
    } = ownerDocument;
    let scrollResizeRafId;
    let onKeyDownRafId;
    let caretRect;

    function onScrollResize() {
      if (scrollResizeRafId) {
        return;
      }

      scrollResizeRafId = defaultView.requestAnimationFrame(() => {
        computeCaretRectangle();
        scrollResizeRafId = null;
      });
    }

    function onKeyDown(event) {
      // Ensure the any remaining request is cancelled.
      if (onKeyDownRafId) {
        defaultView.cancelAnimationFrame(onKeyDownRafId);
      } // Use an animation frame for a smooth result.


      onKeyDownRafId = defaultView.requestAnimationFrame(() => {
        maintainCaretPosition(event);
        onKeyDownRafId = null;
      });
    }
    /**
     * Maintains the scroll position after a selection change caused by a
     * keyboard event.
     *
     * @param {KeyboardEvent} event Keyboard event.
     */


    function maintainCaretPosition(_ref) {
      let {
        keyCode
      } = _ref;

      if (!isSelectionEligibleForScroll()) {
        return;
      }

      const currentCaretRect = (0,external_wp_dom_namespaceObject.computeCaretRect)(defaultView);

      if (!currentCaretRect) {
        return;
      } // If for some reason there is no position set to be scrolled to, let
      // this be the position to be scrolled to in the future.


      if (!caretRect) {
        caretRect = currentCaretRect;
        return;
      } // Even though enabling the typewriter effect for arrow keys results in
      // a pleasant experience, it may not be the case for everyone, so, for
      // now, let's disable it.


      if (arrowKeyCodes.has(keyCode)) {
        // Reset the caret position to maintain.
        caretRect = currentCaretRect;
        return;
      }

      const diff = currentCaretRect.top - caretRect.top;

      if (diff === 0) {
        return;
      }

      const scrollContainer = (0,external_wp_dom_namespaceObject.getScrollContainer)(node); // The page must be scrollable.

      if (!scrollContainer) {
        return;
      }

      const windowScroll = scrollContainer === ownerDocument.body;
      const scrollY = windowScroll ? defaultView.scrollY : scrollContainer.scrollTop;
      const scrollContainerY = windowScroll ? 0 : scrollContainer.getBoundingClientRect().top;
      const relativeScrollPosition = windowScroll ? caretRect.top / defaultView.innerHeight : (caretRect.top - scrollContainerY) / (defaultView.innerHeight - scrollContainerY); // If the scroll position is at the start, the active editable element
      // is the last one, and the caret is positioned within the initial
      // trigger percentage of the page, do not scroll the page.
      // The typewriter effect should not kick in until an empty page has been
      // filled with the initial trigger percentage or the user scrolls
      // intentionally down.

      if (scrollY === 0 && relativeScrollPosition < initialTriggerPercentage && isLastEditableNode()) {
        // Reset the caret position to maintain.
        caretRect = currentCaretRect;
        return;
      }

      const scrollContainerHeight = windowScroll ? defaultView.innerHeight : scrollContainer.clientHeight; // Abort if the target scroll position would scroll the caret out of
      // view.

      if ( // The caret is under the lower fold.
      caretRect.top + caretRect.height > scrollContainerY + scrollContainerHeight || // The caret is above the upper fold.
      caretRect.top < scrollContainerY) {
        // Reset the caret position to maintain.
        caretRect = currentCaretRect;
        return;
      }

      if (windowScroll) {
        defaultView.scrollBy(0, diff);
      } else {
        scrollContainer.scrollTop += diff;
      }
    }
    /**
     * Adds a `selectionchange` listener to reset the scroll position to be
     * maintained.
     */


    function addSelectionChangeListener() {
      ownerDocument.addEventListener('selectionchange', computeCaretRectOnSelectionChange);
    }
    /**
     * Resets the scroll position to be maintained during a `selectionchange`
     * event. Also removes the listener, so it acts as a one-time listener.
     */


    function computeCaretRectOnSelectionChange() {
      ownerDocument.removeEventListener('selectionchange', computeCaretRectOnSelectionChange);
      computeCaretRectangle();
    }
    /**
     * Resets the scroll position to be maintained.
     */


    function computeCaretRectangle() {
      if (isSelectionEligibleForScroll()) {
        caretRect = (0,external_wp_dom_namespaceObject.computeCaretRect)(defaultView);
      }
    }
    /**
     * Checks if the current situation is elegible for scroll:
     * - There should be one and only one block selected.
     * - The component must contain the selection.
     * - The active element must be contenteditable.
     */


    function isSelectionEligibleForScroll() {
      return node.contains(ownerDocument.activeElement) && ownerDocument.activeElement.isContentEditable;
    }

    function isLastEditableNode() {
      const editableNodes = node.querySelectorAll('[contenteditable="true"]');
      const lastEditableNode = editableNodes[editableNodes.length - 1];
      return lastEditableNode === ownerDocument.activeElement;
    } // When the user scrolls or resizes, the scroll position should be
    // reset.


    defaultView.addEventListener('scroll', onScrollResize, true);
    defaultView.addEventListener('resize', onScrollResize, true);
    node.addEventListener('keydown', onKeyDown);
    node.addEventListener('keyup', maintainCaretPosition);
    node.addEventListener('mousedown', addSelectionChangeListener);
    node.addEventListener('touchstart', addSelectionChangeListener);
    return () => {
      defaultView.removeEventListener('scroll', onScrollResize, true);
      defaultView.removeEventListener('resize', onScrollResize, true);
      node.removeEventListener('keydown', onKeyDown);
      node.removeEventListener('keyup', maintainCaretPosition);
      node.removeEventListener('mousedown', addSelectionChangeListener);
      node.removeEventListener('touchstart', addSelectionChangeListener);
      ownerDocument.removeEventListener('selectionchange', computeCaretRectOnSelectionChange);
      defaultView.cancelAnimationFrame(scrollResizeRafId);
      defaultView.cancelAnimationFrame(onKeyDownRafId);
    };
  }, [hasSelectedBlock]);
}

function Typewriter(_ref2) {
  let {
    children
  } = _ref2;
  return (0,external_wp_element_namespaceObject.createElement)("div", {
    ref: useTypewriter(),
    className: "block-editor__typewriter"
  }, children);
}
/**
 * The exported component. The implementation of Typewriter faced technical
 * challenges in Internet Explorer, and is simply skipped, rendering the given
 * props children instead.
 *
 * @type {WPComponent}
 */


const TypewriterOrIEBypass = isIE ? props => props.children : Typewriter;
/**
 * Ensures that the text selection keeps the same vertical distance from the
 * viewport during keyboard events within this component. The vertical distance
 * can vary. It is the last clicked or scrolled to position.
 */

/* harmony default export */ var typewriter = (TypewriterOrIEBypass);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/use-no-recursive-renders/index.js


/**
 * WordPress dependencies
 */

/**
 * Internal dependencies
 */


const RenderedRefsContext = (0,external_wp_element_namespaceObject.createContext)({});
/**
 * Immutably adds an unique identifier to a set scoped for a given block type.
 *
 * @param {Object} renderedBlocks Rendered blocks grouped by block name
 * @param {string} blockName      Name of the block.
 * @param {*}      uniqueId       Any value that acts as a unique identifier for a block instance.
 *
 * @return {Object} The list of rendered blocks grouped by block name.
 */

function addToBlockType(renderedBlocks, blockName, uniqueId) {
  const result = { ...renderedBlocks,
    [blockName]: renderedBlocks[blockName] ? new Set(renderedBlocks[blockName]) : new Set()
  };
  result[blockName].add(uniqueId);
  return result;
}
/**
 * A React hook for keeping track of blocks previously rendered up in the block
 * tree. Blocks susceptible to recursion can use this hook in their `Edit`
 * function to prevent said recursion.
 *
 * @param {*}      uniqueId  Any value that acts as a unique identifier for a block instance.
 * @param {string} blockName Optional block name.
 *
 * @return {[boolean, Function]} A tuple of:
 *                               - a boolean describing whether the provided id
 *                                 has already been rendered;
 *                               - a React context provider to be used to wrap
 *                                 other elements.
 */


function useNoRecursiveRenders(uniqueId) {
  var _previouslyRenderedBl;

  let blockName = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : '';
  const previouslyRenderedBlocks = (0,external_wp_element_namespaceObject.useContext)(RenderedRefsContext);
  const {
    name
  } = useBlockEditContext();
  blockName = blockName || name;
  const hasAlreadyRendered = Boolean((_previouslyRenderedBl = previouslyRenderedBlocks[blockName]) === null || _previouslyRenderedBl === void 0 ? void 0 : _previouslyRenderedBl.has(uniqueId));
  const newRenderedBlocks = (0,external_wp_element_namespaceObject.useMemo)(() => addToBlockType(previouslyRenderedBlocks, blockName, uniqueId), [previouslyRenderedBlocks, blockName, uniqueId]);
  const Provider = (0,external_wp_element_namespaceObject.useCallback)(_ref => {
    let {
      children
    } = _ref;
    return (0,external_wp_element_namespaceObject.createElement)(RenderedRefsContext.Provider, {
      value: newRenderedBlocks
    }, children);
  }, [newRenderedBlocks]);
  return [hasAlreadyRendered, Provider];
}

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/components/index.js
/*
 * Block Creation Components
 */
































































/*
 * Content Related Components
 */




































/*
 * State Related Components
 */




;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/utils/block-variation-transforms.js
/**
 * External dependencies
 */

/** @typedef {import('@wordpress/blocks').WPBlockVariation} WPBlockVariation */

/**
 * Matches the provided block variations with a block's attributes. If no match
 * or more than one matches are found it returns `undefined`. If a single match is
 * found it returns it.
 *
 * This is a simple implementation for now as it takes into account only the attributes
 * of a block variation and not `InnerBlocks`.
 *
 * @param {Object}             blockAttributes - The block attributes to try to find a match.
 * @param {WPBlockVariation[]} variations      - A list of block variations to test for a match.
 * @return {?WPBlockVariation} - If a match is found returns it. If not or more than one matches are found returns `undefined`.
 */

const __experimentalGetMatchingVariation = (blockAttributes, variations) => {
  if (!variations || !blockAttributes) return;
  const matches = variations.filter(_ref => {
    let {
      attributes
    } = _ref;
    if (!attributes || !Object.keys(attributes).length) return false;
    return (0,external_lodash_namespaceObject.isMatch)(blockAttributes, attributes);
  });
  if (matches.length !== 1) return;
  return matches[0];
};

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/utils/parse-css-unit-to-px.js
/**
 * Converts string to object { value, unit }.
 *
 * @param {string} cssUnit
 * @return {Object} parsedUnit
 */
function parseUnit(cssUnit) {
  const match = cssUnit === null || cssUnit === void 0 ? void 0 : cssUnit.trim().match(/^(0?[-.]?\d*\.?\d+)(r?e[m|x]|v[h|w|min|max]+|p[x|t|c]|[c|m]m|%|in|ch|Q|lh)$/);

  if (!isNaN(cssUnit) && !isNaN(parseFloat(cssUnit))) {
    return {
      value: parseFloat(cssUnit),
      unit: 'px'
    };
  }

  return match ? {
    value: parseFloat(match[1]) || match[1],
    unit: match[2]
  } : {
    value: cssUnit,
    unit: undefined
  };
}
/**
 * Evaluate a math expression.
 *
 * @param {string} expression
 * @return {number} evaluated expression.
 */


function calculate(expression) {
  return Function(`'use strict'; return (${expression})`)();
}
/**
 * Calculates the css function value for the supported css functions such as max, min, clamp and calc.
 *
 * @param {string} functionUnitValue string should be in a particular format (for example min(12px,12px) ) no nested loops.
 * @param {Object} options
 * @return {string} unit containing the unit in PX.
 */


function getFunctionUnitValue(functionUnitValue, options) {
  const functionUnit = functionUnitValue.split(/[(),]/g).filter(Boolean);
  const units = functionUnit.slice(1).map(unit => parseUnit(getPxFromCssUnit(unit, options)).value).filter(Boolean);

  switch (functionUnit[0]) {
    case 'min':
      return Math.min(...units) + 'px';

    case 'max':
      return Math.max(...units) + 'px';

    case 'clamp':
      if (units.length !== 3) {
        return null;
      }

      if (units[1] < units[0]) {
        return units[0] + 'px';
      }

      if (units[1] > units[2]) {
        return units[2] + 'px';
      }

      return units[1] + 'px';

    case 'calc':
      return units[0] + 'px';
  }
}
/**
 * Take a css function such as min, max, calc, clamp and returns parsedUnit
 *
 * How this works for the nested function is that it first replaces the inner function call.
 * Then it tackles the outer onces.
 * So for example: min( max(25px, 35px), 40px )
 * in the first pass we would replace max(25px, 35px) with 35px.
 * then we would try to evaluate min( 35px, 40px )
 * and then finally return 35px.
 *
 * @param {string} cssUnit
 * @return {Object} parsedUnit object.
 */


function parseUnitFunction(cssUnit) {
  while (true) {
    const currentCssUnit = cssUnit;
    const regExp = /(max|min|calc|clamp)\(([^()]*)\)/g;
    const matches = regExp.exec(cssUnit) || [];

    if (matches[0]) {
      const functionUnitValue = getFunctionUnitValue(matches[0]);
      cssUnit = cssUnit.replace(matches[0], functionUnitValue);
    } // If the unit hasn't been modified or we have a single value break free.


    if (cssUnit === currentCssUnit || parseFloat(cssUnit)) {
      break;
    }
  }

  return parseUnit(cssUnit);
}
/**
 * Return true if we think this is a math expression.
 *
 * @param {string} cssUnit the cssUnit value being evaluted.
 * @return {boolean} Whether the cssUnit is a math expression.
 */


function isMathExpression(cssUnit) {
  for (let i = 0; i < cssUnit.length; i++) {
    if (['+', '-', '/', '*'].includes(cssUnit[i])) {
      return true;
    }
  }

  return false;
}
/**
 * Evaluates the math expression and return a px value.
 *
 * @param {string} cssUnit the cssUnit value being evaluted.
 * @return {string} return a converfted value to px.
 */


function evalMathExpression(cssUnit) {
  let errorFound = false; // Convert every part of the expression to px values.

  const cssUnitsBits = cssUnit.split(/[+-/*/]/g).filter(Boolean);

  for (const unit of cssUnitsBits) {
    // Standardize the unit to px and extract the value.
    const parsedUnit = parseUnit(getPxFromCssUnit(unit));

    if (!parseFloat(parsedUnit.value)) {
      errorFound = true; // End early since we are dealing with a null value.

      break;
    }

    cssUnit = cssUnit.replace(unit, parsedUnit.value);
  }

  return errorFound ? null : calculate(cssUnit).toFixed(0) + 'px';
}
/**
 * Convert a parsedUnit object to px value.
 *
 * @param {Object} parsedUnit
 * @param {Object} options
 * @return {string} or {null} returns the converted with in a px value format.
 */


function convertParsedUnitToPx(parsedUnit, options) {
  const PIXELS_PER_INCH = 96;
  const ONE_PERCENT = 0.01;
  const defaultProperties = {
    fontSize: 16,
    lineHeight: 16,
    width: 375,
    height: 812,
    type: 'font'
  };
  const setOptions = Object.assign({}, defaultProperties, options);
  const relativeUnits = {
    em: setOptions.fontSize,
    rem: setOptions.fontSize,
    vh: setOptions.height * ONE_PERCENT,
    vw: setOptions.width * ONE_PERCENT,
    vmin: (setOptions.width < setOptions.height ? setOptions.width : setOptions.height) * ONE_PERCENT,
    vmax: (setOptions.width > setOptions.height ? setOptions.width : setOptions.height) * ONE_PERCENT,
    '%': (setOptions.type === 'font' ? setOptions.fontSize : setOptions.width) * ONE_PERCENT,
    ch: 8,
    // The advance measure (width) of the glyph "0" of the element's font. Approximate
    ex: 7.15625,
    // X-height of the element's font. Approximate.
    lh: setOptions.lineHeight
  };
  const absoluteUnits = {
    in: PIXELS_PER_INCH,
    cm: PIXELS_PER_INCH / 2.54,
    mm: PIXELS_PER_INCH / 25.4,
    pt: PIXELS_PER_INCH / 72,
    pc: PIXELS_PER_INCH / 6,
    px: 1,
    Q: PIXELS_PER_INCH / 2.54 / 40
  };

  if (relativeUnits[parsedUnit.unit]) {
    return (relativeUnits[parsedUnit.unit] * parsedUnit.value).toFixed(0) + 'px';
  }

  if (absoluteUnits[parsedUnit.unit]) {
    return (absoluteUnits[parsedUnit.unit] * parsedUnit.value).toFixed(0) + 'px';
  }

  return null;
}
/**
 * Returns the px value of a cssUnit.
 *
 * @param {string} cssUnit
 * @param {Object} options
 * @return {string} returns the cssUnit value in a simple px format.
 */


function getPxFromCssUnit(cssUnit) {
  let options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};

  if (Number.isFinite(cssUnit)) {
    return cssUnit.toFixed(0) + 'px';
  }

  if (cssUnit === undefined) {
    return null;
  }

  let parsedUnit = parseUnit(cssUnit);

  if (!parsedUnit.unit) {
    parsedUnit = parseUnitFunction(cssUnit, options);
  }

  if (isMathExpression(cssUnit) && !parsedUnit.unit) {
    return evalMathExpression(cssUnit);
  }

  return convertParsedUnitToPx(parsedUnit, options);
} // Use simple cache.

const cache = {};
/**
 * Returns the px value of a cssUnit. The memoized version of getPxFromCssUnit;
 *
 * @param {string} cssUnit
 * @param {Object} options
 * @return {string} returns the cssUnit value in a simple px format.
 */

function memoizedGetPxFromCssUnit(cssUnit) {
  let options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
  const hash = cssUnit + hashOptions(options);

  if (!cache[hash]) {
    cache[hash] = getPxFromCssUnit(cssUnit, options);
  }

  return cache[hash];
}

function hashOptions(options) {
  let hash = '';

  if (options.hasOwnProperty('fontSize')) {
    hash = ':' + options.width;
  }

  if (options.hasOwnProperty('lineHeight')) {
    hash = ':' + options.lineHeight;
  }

  if (options.hasOwnProperty('width')) {
    hash = ':' + options.width;
  }

  if (options.hasOwnProperty('height')) {
    hash = ':' + options.height;
  }

  if (options.hasOwnProperty('type')) {
    hash = ':' + options.type;
  }

  return hash;
}

/* harmony default export */ var parse_css_unit_to_px = (memoizedGetPxFromCssUnit);

;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/utils/index.js




;// CONCATENATED MODULE: ./node_modules/@wordpress/block-editor/build-module/index.js
/**
 * Internal dependencies
 */







}();
(window.wp = window.wp || {}).blockEditor = __webpack_exports__;
/******/ })()
;